Started by timer Running as SYSTEM Building remotely on build4-deb12build-ansible (ttcn3 obs ttcn3_with_linux_6.1_or_higher qemu io_uring osmocom-gerrit coverity osmocom-master) in workspace /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test The recommended git tool is: NONE No credentials specified Wiping out workspace first. Cloning the remote Git repository Cloning repository https://gerrit.osmocom.org/docker-playground > git init /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test # timeout=10 Fetching upstream changes from https://gerrit.osmocom.org/docker-playground > git --version # timeout=10 > git --version # 'git version 2.39.2' > git fetch --tags --force --progress -- https://gerrit.osmocom.org/docker-playground +refs/heads/*:refs/remotes/origin/* # timeout=10 > git config remote.origin.url https://gerrit.osmocom.org/docker-playground # timeout=10 > git config --add remote.origin.fetch +refs/heads/*:refs/remotes/origin/* # timeout=10 Avoid second fetch Seen branch in repository origin/arehbein/devtests Seen branch in repository origin/arehbein/devtests%topic=fixes Seen branch in repository origin/daniel/bscnat_tests Seen branch in repository origin/daniel/training Seen branch in repository origin/daniel/wip Seen branch in repository origin/fixeria/confmerge Seen branch in repository origin/fixeria/sccplite Seen branch in repository origin/fixeria/testing Seen branch in repository origin/jolly/testing Seen branch in repository origin/laforge/ergw Seen branch in repository origin/laforge/fr Seen branch in repository origin/laforge/ns Seen branch in repository origin/laforge/podman Seen branch in repository origin/lynxis/gerrit-comment-ci Seen branch in repository origin/master Seen branch in repository origin/neels/hnbgw-pfcp Seen branch in repository origin/neels/wip Seen branch in repository origin/osmith/fix-registry-pull Seen branch in repository origin/osmith/fix-rpi-gnutls Seen branch in repository origin/osmith/obs-2021q1 Seen branch in repository origin/osmith/rpm-local Seen branch in repository origin/osmith/ttcn3-pass-args Seen branch in repository origin/osmith/wip Seen branch in repository origin/osmith/wip-4g-only Seen branch in repository origin/osmith/wip-asan Seen branch in repository origin/pespin/bts-perf Seen branch in repository origin/pespin/ergw Seen branch in repository origin/pespin/gtp1 Seen branch in repository origin/pespin/master Seen branch in repository origin/pmaier/pcuif Seen branch in repository origin/refsf/for/master/dyn-pdch Seen 31 remote branches > git show-ref --tags -d # timeout=10 Checking out Revision 978adc91b199f824251902d2215bf544eee42d77 (origin/master) > git config core.sparsecheckout # timeout=10 > git checkout -f 978adc91b199f824251902d2215bf544eee42d77 # timeout=10 Commit message: "fpga-build: Update RISC-V toolchain to riscv-none-elf" > git rev-list --no-walk 978adc91b199f824251902d2215bf544eee42d77 # timeout=10 [ttcn3-hnbgw-test] $ /bin/sh -xe /tmp/jenkins11777636014401743891.sh + export REGISTRY_HOST=registry.osmocom.org + DIR=ttcn3-hnbgw-test + export IMAGE_SUFFIX=master + cd ttcn3-hnbgw-test + ./jenkins.sh + [ x = x ] + REPO_USER=osmocom-build + [ x/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test = x ] + VOL_BASE_DIR=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + mkdir -p /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + [ ! -d /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs ] + [ xjenkins-ttcn3-hnbgw-test-1005 = x ] + basename /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test + SUITE_NAME=ttcn3-hnbgw-test + IMAGE_SUFFIX=master + docker_images_require osmo-stp-master osmo-hnbgw-master ttcn3-hnbgw-test + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-stp-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.1s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 5.76kB done #2 DONE 0.1s #3 [auth] sharing credentials for registry.osmocom.org #3 DONE 0.0s #4 [internal] load metadata for registry.osmocom.org/debian:bookworm #4 DONE 0.1s #5 [internal] load build context #5 DONE 0.0s #6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #6 DONE 0.0s #7 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #7 DONE 0.0s #8 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:e225d70fafe80791f18c79b8d76afa1d1b4192b3a40a50f1ffd4de84555ebd04 #8 resolve registry.osmocom.org/debian:bookworm@sha256:e225d70fafe80791f18c79b8d76afa1d1b4192b3a40a50f1ffd4de84555ebd04 0.1s done #8 DONE 0.1s #9 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #9 DONE 0.1s #10 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #10 DONE 0.2s #11 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #11 DONE 0.2s #5 [internal] load build context #5 transferring context: 1.96kB done #5 DONE 0.0s #12 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #12 CACHED #13 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #13 CACHED #14 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #14 CACHED #15 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #15 CACHED #16 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #16 CACHED #17 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #17 CACHED #18 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #18 CACHED #19 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #19 CACHED #20 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #20 CACHED #21 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #21 CACHED #22 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #22 CACHED #23 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #23 CACHED #24 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #24 CACHED #25 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #25 CACHED #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 CACHED #27 exporting to image #27 exporting layers done #27 writing image sha256:2d8e4f4a1d9997e1df38f234882c1d871301504f93bd2930fa46683e03014a8a 0.0s done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest 0.0s done #27 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 2d8e4f4a1d99 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-stp-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-stp-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-stp-master + echo osmo-stp-master + dir=osmo-stp-master + pull_arg=--pull + grep ^FROM ../osmo-stp-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + echo FROM $USER/$DISTRO-build + grep -q $USER + pull_arg= + set +x Building image: osmo-stp-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-stp-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-stp-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-stp-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-stp-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.24kB done #2 DONE 0.0s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [1/7] FROM docker.io/osmocom-build/debian-bookworm-build #4 CACHED #5 [internal] load build context #5 transferring context: 1.13kB done #5 DONE 0.0s #6 [2/7] RUN CASE "debian-bookworm" in debian*) apt-get update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-netif-dev && apt-get clean ;; centos*) dnf install -y "pkgconfig(libosmo-netif)" "pkgconfig(libosmocore)" "pkgconfig(libosmogsm)" "pkgconfig(libosmovty)" ;; esac #6 ... #7 https://gerrit.osmocom.org/plugins/gitiles/libosmo-sigtran/+/master?format=TEXT #7 CACHED #6 [2/7] RUN CASE "debian-bookworm" in debian*) apt-get update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-netif-dev && apt-get clean ;; centos*) dnf install -y "pkgconfig(libosmo-netif)" "pkgconfig(libosmocore)" "pkgconfig(libosmogsm)" "pkgconfig(libosmovty)" ;; esac #6 0.421 Hit:1 http://deb.debian.org/debian bookworm InRelease #6 0.421 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #6 0.421 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #6 0.523 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #6 0.931 Reading package lists... #6 1.198 Reading package lists... #6 1.447 Building dependency tree... #6 1.501 Reading state information... #6 1.564 The following additional packages will be installed: #6 1.564 libosmocodec4 libosmocoding0 libosmocore libosmocore22 libosmoctrl0 #6 1.564 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 libosmousb0 #6 1.564 libosmovty13 osmocom-nightly #6 1.575 The following NEW packages will be installed: #6 1.575 libosmo-netif-dev libosmocodec4 libosmocoding0 libosmocore libosmocore-dev #6 1.575 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #6 1.575 libosmonetif11 libosmosim2 libosmousb0 libosmovty13 osmocom-nightly #6 1.592 0 upgraded, 15 newly installed, 0 to remove and 4 not upgraded. #6 1.592 Need to get 2047 kB of archives. #6 1.592 After this operation, 7278 kB of additional disk space will be used. #6 1.592 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202410072026 [1176 B] #6 1.616 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.15.dbaeb.202410072026 [168 kB] #6 1.619 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.15.dbaeb.202410072026 [50.6 kB] #6 1.620 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.15.dbaeb.202410072026 [69.7 kB] #6 1.621 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.15.dbaeb.202410072026 [227 kB] #6 1.624 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.15.dbaeb.202410072026 [70.3 kB] #6 1.624 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.15.dbaeb.202410072026 [103 kB] #6 1.626 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.15.dbaeb.202410072026 [177 kB] #6 1.627 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.15.dbaeb.202410072026 [58.8 kB] #6 1.627 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.15.dbaeb.202410072026 [62.9 kB] #6 1.628 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.15.dbaeb.202410072026 [49.6 kB] #6 1.628 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.15.dbaeb.202410072026 [43.0 kB] #6 1.637 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.15.dbaeb.202410072026 [846 kB] #6 1.643 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202410072026 [53.9 kB] #6 1.643 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202410072026 [66.0 kB] #6 1.762 debconf: delaying package configuration, since apt-utils is not installed #6 1.804 Fetched 2047 kB in 0s (31.0 MB/s) #6 1.861 Selecting previously unselected package osmocom-nightly. #6 1.861 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117417 files and directories currently installed.) #6 1.898 Preparing to unpack .../00-osmocom-nightly_202410072026_amd64.deb ... #6 1.913 Unpacking osmocom-nightly (202410072026) ... #6 2.036 Selecting previously unselected package libosmocore22:amd64. #6 2.054 Preparing to unpack .../01-libosmocore22_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.087 Unpacking libosmocore22:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.344 Selecting previously unselected package libosmocodec4:amd64. #6 2.352 Preparing to unpack .../02-libosmocodec4_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.383 Unpacking libosmocodec4:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.523 Selecting previously unselected package libosmoisdn0:amd64. #6 2.531 Preparing to unpack .../03-libosmoisdn0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.547 Unpacking libosmoisdn0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.688 Selecting previously unselected package libosmogsm20:amd64. #6 2.706 Preparing to unpack .../04-libosmogsm20_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.723 Unpacking libosmogsm20:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.863 Selecting previously unselected package libosmocoding0:amd64. #6 2.881 Preparing to unpack .../05-libosmocoding0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.898 Unpacking libosmocoding0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.036 Selecting previously unselected package libosmovty13:amd64. #6 3.055 Preparing to unpack .../06-libosmovty13_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.071 Unpacking libosmovty13:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.212 Selecting previously unselected package libosmogb14:amd64. #6 3.230 Preparing to unpack .../07-libosmogb14_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.248 Unpacking libosmogb14:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.395 Selecting previously unselected package libosmoctrl0:amd64. #6 3.404 Preparing to unpack .../08-libosmoctrl0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.421 Unpacking libosmoctrl0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.555 Selecting previously unselected package libosmosim2:amd64. #6 3.562 Preparing to unpack .../09-libosmosim2_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.580 Unpacking libosmosim2:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.720 Selecting previously unselected package libosmousb0:amd64. #6 3.728 Preparing to unpack .../10-libosmousb0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.744 Unpacking libosmousb0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.858 Selecting previously unselected package libosmocore. #6 3.876 Preparing to unpack .../11-libosmocore_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.893 Unpacking libosmocore (1.10.0.15.dbaeb.202410072026) ... #6 4.006 Selecting previously unselected package libosmocore-dev:amd64. #6 4.024 Preparing to unpack .../12-libosmocore-dev_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 4.041 Unpacking libosmocore-dev:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.226 Selecting previously unselected package libosmonetif11:amd64. #6 4.234 Preparing to unpack .../13-libosmonetif11_1.5.1.5.89a1.202410072026_amd64.deb ... #6 4.251 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202410072026) ... #6 4.378 Selecting previously unselected package libosmo-netif-dev:amd64. #6 4.395 Preparing to unpack .../14-libosmo-netif-dev_1.5.1.5.89a1.202410072026_amd64.deb ... #6 4.413 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202410072026) ... #6 4.589 Setting up osmocom-nightly (202410072026) ... #6 4.650 Setting up libosmocore22:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.704 Setting up libosmocodec4:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.759 Setting up libosmovty13:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.814 Setting up libosmoisdn0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.868 Setting up libosmousb0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.922 Setting up libosmogsm20:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.974 Setting up libosmoctrl0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 5.033 Setting up libosmogb14:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 5.085 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202410072026) ... #6 5.138 Setting up libosmocoding0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 5.190 Setting up libosmosim2:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 5.242 Setting up libosmocore (1.10.0.15.dbaeb.202410072026) ... #6 5.294 Setting up libosmocore-dev:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 5.346 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202410072026) ... #6 5.399 Processing triggers for libc-bin (2.36-9+deb12u8) ... #6 DONE 5.7s #8 [3/7] WORKDIR /DATA #8 DONE 0.1s #9 [4/7] RUN GIT clone https://gerrit.osmocom.org/libosmo-sigtran.git #9 0.345 Cloning into 'libosmo-sigtran'... #9 DONE 0.6s #10 [5/7] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/LIBOSMO-SIGTRAN/+/MASTER?FORMAT=TEXT /tmp/commit-libosmo-sigtran #10 DONE 0.1s #11 [6/7] RUN CD libosmo-sigtran && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure && make "-j$(nproc)" install && install examples/.libs/sccp_demo_user /usr/local/bin/ && ldconfig #11 0.386 Already on 'master' #11 0.386 Your branch is up to date with 'origin/master'. #11 0.388 refs/heads/master #11 0.391 HEAD is now at bfd6d20 vty: Fix 'update route' parameter comment descriptions #11 0.393 master #11 0.394 bfd6d20376c5ea0d1f9e87ca32a9ff5c6fe99c98 #11 2.471 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.471 libtoolize: copying file './ltmain.sh' #11 2.787 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 2.787 libtoolize: and rerunning libtoolize and aclocal. #11 2.787 libtoolize: Consider adding '-I m4' to ACLOCAL_AMFLAGS in Makefile.am. #11 3.494 configure.ac:167: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.494 configure.ac:167: You should run autoupdate. #11 3.494 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.494 configure.ac:167: the top level #11 3.494 configure.ac:184: warning: AC_OUTPUT should be used without arguments. #11 3.494 configure.ac:184: You should run autoupdate. #11 3.919 configure.ac:23: installing './compile' #11 3.920 configure.ac:25: installing './config.guess' #11 3.921 configure.ac:25: installing './config.sub' #11 3.922 configure.ac:9: installing './install-sh' #11 3.923 configure.ac:9: installing './missing' #11 3.975 examples/Makefile.am: installing './depcomp' #11 4.140 checking for a BSD-compatible install... /usr/bin/install -c #11 4.155 checking whether build environment is sane... yes #11 4.178 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.183 checking for gawk... gawk #11 4.183 checking whether make sets $(MAKE)... yes #11 4.208 checking whether make supports nested variables... yes #11 4.226 checking whether make supports nested variables... (cached) yes #11 4.226 checking whether make sets $(MAKE)... (cached) yes #11 4.232 checking for gcc... gcc #11 4.301 checking whether the C compiler works... yes #11 4.385 checking for C compiler default output file name... a.out #11 4.385 checking for suffix of executables... #11 4.412 checking whether we are cross compiling... no #11 4.442 checking for suffix of object files... o #11 4.459 checking whether the compiler supports GNU C... yes #11 4.479 checking whether gcc accepts -g... yes #11 4.502 checking for gcc option to enable C11 features... none needed #11 4.530 checking whether gcc understands -c and -o together... yes #11 4.562 checking whether make supports the include directive... yes (GNU style) #11 4.575 checking dependency style of gcc... gcc3 #11 4.662 checking build system type... x86_64-pc-linux-gnu #11 4.743 checking host system type... x86_64-pc-linux-gnu #11 4.743 checking how to print strings... printf #11 4.773 checking for a sed that does not truncate output... /usr/bin/sed #11 4.776 checking for grep that handles long lines and -e... /usr/bin/grep #11 4.777 checking for egrep... /usr/bin/grep -E #11 4.777 checking for fgrep... /usr/bin/grep -F #11 4.778 checking for ld used by gcc... /usr/bin/ld #11 4.780 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 4.782 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 4.783 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 4.793 checking whether ln -s works... yes #11 4.793 checking the maximum length of command line arguments... 1572864 #11 4.796 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 4.796 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 4.796 checking for /usr/bin/ld option to reload object files... -r #11 4.796 checking for file... file #11 4.797 checking for objdump... objdump #11 4.797 checking how to recognize dependent libraries... pass_all #11 4.797 checking for dlltool... no #11 4.797 checking how to associate runtime and link libraries... printf %s\n #11 4.797 checking for ar... ar #11 4.798 checking for archiver @FILE support... @ #11 4.821 checking for strip... strip #11 4.822 checking for ranlib... ranlib #11 4.822 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 4.891 checking for sysroot... no #11 4.891 checking for a working dd... /usr/bin/dd #11 4.893 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 4.906 checking for mt... no #11 4.906 checking if : is a manifest tool... no #11 4.914 checking for stdio.h... yes #11 4.944 checking for stdlib.h... yes #11 4.972 checking for string.h... yes #11 4.996 checking for inttypes.h... yes #11 5.013 checking for stdint.h... yes #11 5.037 checking for strings.h... yes #11 5.059 checking for sys/stat.h... yes #11 5.076 checking for sys/types.h... yes #11 5.096 checking for unistd.h... yes #11 5.114 checking for dlfcn.h... yes #11 5.136 checking for objdir... .libs #11 5.206 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.221 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.221 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.251 checking if gcc static flag -static works... yes #11 5.303 checking if gcc supports -c -o file.o... yes #11 5.318 checking if gcc supports -c -o file.o... (cached) yes #11 5.318 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.325 checking whether -lc should be explicitly linked in... no #11 5.362 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.434 checking how to hardcode library paths into programs... immediate #11 5.434 checking whether stripping libraries is possible... yes #11 5.435 checking if libtool supports shared libraries... yes #11 5.435 checking whether to build shared libraries... yes #11 5.435 checking whether to build static libraries... yes #11 5.435 checking for pkg-config... /usr/bin/pkg-config #11 5.436 checking for pkg-config... /usr/bin/pkg-config #11 5.436 checking pkg-config is at least version 0.20... yes #11 5.436 checking for libosmocore >= 1.10.0... yes #11 5.442 checking for libosmovty >= 1.10.0... yes #11 5.450 checking for libosmogsm >= 1.10.0... yes #11 5.463 checking for libosmo-netif >= 1.5.0... yes #11 5.478 checking for library containing sctp_recvmsg... -lsctp #11 5.568 checking if gcc supports -fvisibility=hidden... yes #11 5.575 checking for doxygen... /usr/bin/doxygen #11 5.577 checking whether to enable VTY/CTRL tests... no #11 5.577 CFLAGS=" -std=gnu11 -Wall" #11 5.577 CPPFLAGS=" -Wall" #11 5.590 checking that generated files are newer than configure... done #11 5.591 configure: creating ./config.status #11 6.637 config.status: creating libosmo-sigtran.pc #11 6.666 config.status: creating include/osmocom/Makefile #11 6.705 config.status: creating include/osmocom/sccp/Makefile #11 6.745 config.status: creating include/osmocom/sigtran/Makefile #11 6.785 config.status: creating include/Makefile #11 6.825 config.status: creating src/Makefile #11 6.867 config.status: creating tests/Makefile #11 6.906 config.status: creating tests/m2ua/Makefile #11 6.935 config.status: creating tests/xua/Makefile #11 6.948 config.status: creating tests/ss7/Makefile #11 6.960 config.status: creating tests/vty/Makefile #11 6.968 config.status: creating examples/Makefile #11 6.979 config.status: creating stp/Makefile #11 6.998 config.status: creating doc/Makefile #11 7.025 config.status: creating doc/examples/Makefile #11 7.063 config.status: creating doc/manuals/Makefile #11 7.103 config.status: creating contrib/Makefile #11 7.143 config.status: creating contrib/systemd/Makefile #11 7.183 config.status: creating Doxyfile #11 7.221 config.status: creating Makefile #11 7.261 config.status: executing tests/atconfig commands #11 7.268 config.status: executing depfiles commands #11 7.899 config.status: executing libtool commands #11 8.012 echo 2.0.0.8-bfd6 > .version-t && mv .version-t .version #11 8.018 make install-recursive #11 8.025 make[1]: Entering directory '/data/libosmo-sigtran' #11 8.034 Making install in include #11 8.039 make[2]: Entering directory '/data/libosmo-sigtran/include' #11 8.047 Making install in osmocom #11 8.052 make[3]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.060 Making install in sccp #11 8.065 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.071 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.071 make[5]: Nothing to be done for 'install-exec-am'. #11 8.073 /usr/bin/mkdir -p '/usr/local/include/osmocom/sccp' #11 8.080 /usr/bin/install -c -m 644 sccp_types.h '/usr/local/include/osmocom/sccp' #11 8.084 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.084 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.084 Making install in sigtran #11 8.089 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.095 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.095 make[5]: Nothing to be done for 'install-exec-am'. #11 8.098 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran' #11 8.099 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran/protocol' #11 8.104 /usr/bin/install -c -m 644 xua_types.h xua_msg.h m2ua_types.h sccp_sap.h sigtran_sap.h sccp_helpers.h mtp_sap.h osmo_ss7.h '/usr/local/include/osmocom/sigtran' #11 8.105 /usr/bin/install -c -m 644 protocol/sua.h protocol/m3ua.h protocol/mtp.h protocol/sccp_scmg.h '/usr/local/include/osmocom/sigtran/protocol' #11 8.109 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.109 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.114 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.120 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.120 make[5]: Nothing to be done for 'install-exec-am'. #11 8.120 make[5]: Nothing to be done for 'install-data-am'. #11 8.120 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.120 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.121 make[3]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.126 make[3]: Entering directory '/data/libosmo-sigtran/include' #11 8.131 make[4]: Entering directory '/data/libosmo-sigtran/include' #11 8.131 make[4]: Nothing to be done for 'install-exec-am'. #11 8.131 make[4]: Nothing to be done for 'install-data-am'. #11 8.131 make[4]: Leaving directory '/data/libosmo-sigtran/include' #11 8.132 make[3]: Leaving directory '/data/libosmo-sigtran/include' #11 8.133 make[2]: Leaving directory '/data/libosmo-sigtran/include' #11 8.133 Making install in src #11 8.140 make[2]: Entering directory '/data/libosmo-sigtran/src' #11 8.143 CC libxua_a-xua_msg.o #11 8.143 CC ipa.lo #11 8.144 CC m3ua.lo #11 8.145 CC osmo_ss7.lo #11 8.145 CC osmo_ss7_as.lo #11 8.146 CC osmo_ss7_asp_peer.lo #11 8.147 CC osmo_ss7_asp.lo #11 8.148 CC osmo_ss7_hmrt.lo #11 8.149 CC osmo_ss7_vty.lo #11 8.150 CC osmo_ss7_xua_srv.lo #11 8.150 CC sccp2sua.lo #11 8.151 CC sccp_helpers.lo #11 8.152 CC sccp_lbcs.lo #11 8.153 CC sccp_sap.lo #11 8.154 CC sccp_sclc.lo #11 8.155 CC sccp_scmg.lo #11 8.156 CC sccp_scrc.lo #11 8.157 CC sccp_scoc.lo #11 8.159 CC sccp_types.lo #11 8.160 CC sccp_user.lo #11 8.264 sccp_scoc.c: In function 'scoc_fsm_active': #11 8.264 sccp_scoc.c:1200:9: note: '#pragma message: TODO: internal disco: send N-DISCONNECT.ind to user' #11 8.264 1200 | #pragma message ("TODO: internal disco: send N-DISCONNECT.ind to user") #11 8.264 | ^~~~~~~ #11 8.355 CC sccp_vty.lo #11 8.357 CC sua.lo #11 8.363 CC xua_asp_fsm.lo #11 8.380 CC xua_as_fsm.lo #11 8.381 CC xua_default_lm_fsm.lo #11 8.383 CC xua_msg.lo #11 8.384 CC xua_rkm.lo #11 8.387 CC xua_shared.lo #11 8.389 CC xua_snm.lo #11 8.392 AR libxua.a #11 8.393 ar: `u' modifier ignored since `D' is the default (see `U') #11 8.614 CCLD libosmo-sigtran.la #11 9.224 make[3]: Entering directory '/data/libosmo-sigtran/src' #11 9.225 make[3]: Nothing to be done for 'install-data-am'. #11 9.225 /usr/bin/mkdir -p '/usr/local/lib' #11 9.226 /bin/bash ../libtool --mode=install /usr/bin/install -c libosmo-sigtran.la '/usr/local/lib' #11 9.249 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.so.10.0.1 /usr/local/lib/libosmo-sigtran.so.10.0.1 #11 9.254 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10 || { rm -f libosmo-sigtran.so.10 && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10; }; }) #11 9.260 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so || { rm -f libosmo-sigtran.so && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so; }; }) #11 9.272 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.lai /usr/local/lib/libosmo-sigtran.la #11 9.286 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.a /usr/local/lib/libosmo-sigtran.a #11 9.296 libtool: install: chmod 644 /usr/local/lib/libosmo-sigtran.a #11 9.304 libtool: install: ranlib /usr/local/lib/libosmo-sigtran.a #11 9.359 libtool: finish: PATH="/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/sbin" ldconfig -n /usr/local/lib #11 9.360 ---------------------------------------------------------------------- #11 9.360 Libraries have been installed in: #11 9.360 /usr/local/lib #11 9.360 #11 9.360 If you ever happen to want to link against installed libraries #11 9.360 in a given directory, LIBDIR, you must either use libtool, and #11 9.360 specify the full pathname of the library, or use the '-LLIBDIR' #11 9.360 flag during linking and do at least one of the following: #11 9.360 - add LIBDIR to the 'LD_LIBRARY_PATH' environment variable #11 9.360 during execution #11 9.360 - add LIBDIR to the 'LD_RUN_PATH' environment variable #11 9.360 during linking #11 9.360 - use the '-Wl,-rpath -Wl,LIBDIR' linker flag #11 9.360 - have your system administrator add LIBDIR to '/etc/ld.so.conf' #11 9.360 #11 9.360 See any operating system documentation about shared libraries for #11 9.360 more information, such as the ld(1) and ld.so(8) manual pages. #11 9.360 ---------------------------------------------------------------------- #11 9.360 make[3]: Leaving directory '/data/libosmo-sigtran/src' #11 9.360 make[2]: Leaving directory '/data/libosmo-sigtran/src' #11 9.361 Making install in tests #11 9.362 make[2]: Entering directory '/data/libosmo-sigtran/tests' #11 9.365 Making install in xua #11 9.367 make[3]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.370 make[4]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.370 make[4]: Nothing to be done for 'install-exec-am'. #11 9.370 make[4]: Nothing to be done for 'install-data-am'. #11 9.370 make[4]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.370 make[3]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.370 Making install in m2ua #11 9.372 make[3]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.379 make[4]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.379 make[4]: Nothing to be done for 'install-exec-am'. #11 9.379 make[4]: Nothing to be done for 'install-data-am'. #11 9.379 make[4]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.379 make[3]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.379 Making install in ss7 #11 9.383 make[3]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.390 make[4]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.390 make[4]: Nothing to be done for 'install-exec-am'. #11 9.390 make[4]: Nothing to be done for 'install-data-am'. #11 9.390 make[4]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.390 make[3]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.391 Making install in vty #11 9.395 make[3]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.401 make[4]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.401 make[4]: Nothing to be done for 'install-exec-am'. #11 9.401 make[4]: Nothing to be done for 'install-data-am'. #11 9.401 make[4]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.401 make[3]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.405 make[3]: Entering directory '/data/libosmo-sigtran/tests' #11 9.411 make[4]: Entering directory '/data/libosmo-sigtran/tests' #11 9.411 make[4]: Nothing to be done for 'install-exec-am'. #11 9.411 make[4]: Nothing to be done for 'install-data-am'. #11 9.411 make[4]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.411 make[3]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.411 make[2]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.412 Making install in examples #11 9.415 make[2]: Entering directory '/data/libosmo-sigtran/examples' #11 9.418 CC sccp_demo_user.o #11 9.418 CC sccp_test_server.o #11 9.419 CC sccp_test_vty.o #11 9.458 CCLD sccp_demo_user #11 9.735 make[3]: Entering directory '/data/libosmo-sigtran/examples' #11 9.735 make[3]: Nothing to be done for 'install-exec-am'. #11 9.735 make[3]: Nothing to be done for 'install-data-am'. #11 9.735 make[3]: Leaving directory '/data/libosmo-sigtran/examples' #11 9.735 make[2]: Leaving directory '/data/libosmo-sigtran/examples' #11 9.735 Making install in stp #11 9.736 make[2]: Entering directory '/data/libosmo-sigtran/stp' #11 9.737 CC stp_main.o #11 9.783 CCLD osmo-stp #11 10.05 make[3]: Entering directory '/data/libosmo-sigtran/stp' #11 10.05 make[3]: Nothing to be done for 'install-data-am'. #11 10.05 /usr/bin/mkdir -p '/usr/local/bin' #11 10.05 /bin/bash ../libtool --mode=install /usr/bin/install -c osmo-stp '/usr/local/bin' #11 10.08 libtool: install: /usr/bin/install -c .libs/osmo-stp /usr/local/bin/osmo-stp #11 10.08 make[3]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.08 make[2]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.08 Making install in doc #11 10.09 make[2]: Entering directory '/data/libosmo-sigtran/doc' #11 10.09 Making install in examples #11 10.10 make[3]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.10 make[4]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.10 make[4]: Nothing to be done for 'install-exec-am'. #11 10.11 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.11 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 10.11 /usr/bin/install -c -m 644 osmo-stp.cfg osmo-stp-multihome.cfg '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.11 /usr/bin/install -c -m 644 osmo-stp.cfg '/usr/local/etc/osmocom' #11 10.12 make[4]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.12 make[3]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.12 Making install in manuals #11 10.12 make[3]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.13 make[4]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.13 make[4]: Nothing to be done for 'install-exec-am'. #11 10.13 make[4]: Nothing to be done for 'install-data-am'. #11 10.13 make[4]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.13 make[3]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.13 make[3]: Entering directory '/data/libosmo-sigtran/doc' #11 10.14 make[4]: Entering directory '/data/libosmo-sigtran/doc' #11 10.14 make[4]: Nothing to be done for 'install-exec-am'. #11 10.14 make[4]: Nothing to be done for 'install-data-am'. #11 10.14 make[4]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.14 make[3]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.14 make[2]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.14 Making install in contrib #11 10.14 make[2]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.15 Making install in systemd #11 10.16 make[3]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.16 make[4]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.16 make[4]: Nothing to be done for 'install-exec-am'. #11 10.16 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.17 /usr/bin/install -c -m 644 osmo-stp.service '/lib/systemd/system' #11 10.18 make[4]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.18 make[3]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.18 make[3]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.19 make[4]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.19 make[4]: Nothing to be done for 'install-exec-am'. #11 10.19 make[4]: Nothing to be done for 'install-data-am'. #11 10.19 make[4]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.19 make[3]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.19 make[2]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.19 make[2]: Entering directory '/data/libosmo-sigtran' #11 10.20 mkdir -p doc/sigtran #11 10.20 /usr/bin/doxygen Doxyfile #11 10.23 warning: Tag 'SYMBOL_CACHE_SIZE' at line 310 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'SHOW_DIRECTORIES' at line 519 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'COLS_IN_ALPHA_INDEX' at line 799 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'HTML_ALIGN_MEMBERS' at line 900 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'USE_INLINE_TREES' at line 1087 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'LATEX_SOURCE_CODE' at line 1247 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'XML_SCHEMA' at line 1339 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'XML_DTD' at line 1345 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'PERL_PATH' at line 1510 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'CLASS_DIAGRAMS' at line 1522 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: Tag 'MSCGEN_PATH' at line 1531 of file 'Doxyfile' has become obsolete. #11 10.23 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.23 warning: argument 'a4wide' for option PAPER_TYPE is not a valid enum value #11 10.23 Using the default: a4! #11 10.26 Doxygen version used: 1.9.4 #11 10.26 Searching for include files... #11 10.26 Searching for example files... #11 10.26 Searching for images... #11 10.26 Searching for dot files... #11 10.26 Searching for msc files... #11 10.26 Searching for dia files... #11 10.26 Searching for files to exclude #11 10.26 Searching INPUT for files to process... #11 10.26 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran #11 10.26 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran/protocol #11 10.26 Searching for files in directory /data/libosmo-sigtran/src #11 10.26 Reading and parsing tag files #11 10.26 Parsing files #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.26 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.26 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.26 Preprocessing /data/libosmo-sigtran/src/ipa.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/ipa.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/m3ua.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/m3ua.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp2sua.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp2sua.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_internal.h... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp_internal.h... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_sap.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp_sap.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.26 Parsing file /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.26 Preprocessing /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.26 Pars/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.32 ing file /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sccp_types.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sccp_types.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sccp_user.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sccp_user.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sccp_vty.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sccp_vty.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/ss7_internal.h... #11 10.32 Parsing file /data/libosmo-sigtran/src/ss7_internal.h... #11 10.32 Preprocessing /data/libosmo-sigtran/src/sua.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/sua.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_internal.h... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_internal.h... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_msg.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_msg.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_rkm.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_rkm.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_shared.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_shared.c... #11 10.32 Preprocessing /data/libosmo-sigtran/src/xua_snm.c... #11 10.32 Parsing file /data/libosmo-sigtran/src/xua_snm.c... #11 10.32 Building macro definition list... #11 10.32 Building group list... #11 10.32 Building directory list... #11 10.32 Building namespace list... #11 10.32 Building file list... #11 10.32 Building class list... #11 10.32 Building concept list... #11 10.32 Computing nesting relations for classes... #11 10.32 Associating documentation with classes... #11 10.32 Associating documentation with concepts... #11 10.32 Building example list... #11 10.32 Searching for enumerations... #11 10.32 Searching for documented typedefs... #11 10.32 Searching for members imported via using declarations... #11 10.32 Searching for included using directives... #11 10.32 Searching for documented variables... #11 10.32 Building interface member list... #11 10.32 Building member list... #11 10.32 Searching for friends... #11 10.32 Searching for documented defines... #11 10.32 Computing class inheritance relations... #11 10.32 Computing class usage relations... #11 10.32 Flushing cached template relations that have become invalid... #11 10.32 Computing class relations... #11 10.32 Add enum values to enums... #11 10.32 Searching for member function documentation... #11 10.32 Creating members for template instances... #11 10.32 Building page list... #11 10.32 Search for main page... #11 10.32 Computing page relations... #11 10.32 Determining the scope of groups... #11 10.32 Sorting lists... #11 10.32 Determining which enums are documented #11 10.32 Computing member relations... #11 10.32 Building full member lists recursively... #11 10.32 Adding members to member groups. #11 10.32 Computing member references... #11 10.32 Inheriting documentation... #11 10.32 Generating disk names... #11 10.32 Adding source references... #11 10.32 Adding xrefitems... #11 10.32 Sorting member lists... #11 10.32 Setting anonymous enum type... #11 10.32 Computing dependencies between directories... #11 10.32 Generating citations page... #11 10.32 Counting members... #11 10.32 Counting data structures... #11 10.32 Resolving user defined references... #11 10.32 Finding anchors and sections in the documentation... #11 10.32 Transferring function references... #11 10.32 Combining using relations... #11 10.32 Adding members to index pages... #11 10.32 Correcting members for VHDL... #11 10.32 Computing tooltip texts... #11 10.32 Generating style sheet... #11 10.32 Generating search indices... #11 10.32 Generating example documentation... #11 10.32 Generating file sources... #11 10.32 Generating code for file include/osmocom/sigtran/m2ua_types.h... #11 10.32 Generating code for file include/osmocom/sigtran/mtp_sap.h... #11 10.32 Generating code for file include/osmocom/sigtran/osmo_ss7.h... #11 10.32 Generating code for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.32 Generating code for file in/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: argument 'ppid_sid' of command @param is not found in the argument list of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) #11 10.40 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: The following parameter of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) is not documented: #11 10.40 parameter 'ppid_mux' #11 10.40 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.40 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.40 parameter 'inst' #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.40 parameter 'asp_name' #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.40 parameter 'asp_name' #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.40 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.40 parameter 'inst' #11 10.41 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2292: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.41 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2292: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.41 parameter 'addr' #11 10.41 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.41 parameter 'prim_cb' #11 10.41 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.41 parameter 'prim_cb' #11 10.41 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.41 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.41 parameter 'num_maps' #11 10.42 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.42 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.42 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.42 parameter 'info_str' #11 10.42 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.42 parameter 'asp_name' #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.42 parameter 'asp_name' #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.42 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.42 parameter 'trans_proto' #11 10.43 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2292: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.43 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2292: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.43 parameter 'addr' #11 10.44 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.44 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.44 parameter 'inst' #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:92: warning: unable to resolve reference to 'in_digits' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:320: warning: unable to resolve reference to 'addr' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:682: warning: The following parameter of sccp_msg_add_sua_opt(enum sccp_message_types type, struct msgb *msg, const struct xua_msg_part *opt) is not documented: #11 10.44 parameter 'type' #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1176: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1140: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1209: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1300: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1638: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1599: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1429: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1559: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:797: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1271: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1238: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1332: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1468: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1382: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1519: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1189: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1156: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:1221: warning: unable to resolve reference to 'xua' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp2sua.c:565: warning: unable to resolve reference to 'opt' for \ref command #11 10.44 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.44 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.44 parameter 'oph' #11 10.44 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.44 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.44 parameter 'oph' #11 10.45 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.45 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.45 parameter 'oph' #11 10.45 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.45 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.45 parameter 'oph' #11 10.46 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.46 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.46 parameter 'inst' #11 10.46 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.46 parameter 'prim_cb' #11 10.46 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.46 parameter 'prim_cb' #11 10.46 /data/libosmo-sigtran/src/sccp_user.c:88: warning: The following parameter of sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.46 parameter 'prim_cb' #11 10.46 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.46 parameter 'trans_proto' #11 10.46 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.46 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.46 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.46 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.46 parameter 'info_str' #11 10.46 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.47 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.47 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.47 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.47 parameter 'info_str' #11 10.47 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.47 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.47 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.47 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.47 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.47 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.47 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.47 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.47 parameter 'info_str' #11 10.47 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.48 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.48 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.48 parameter 'num_maps' #11 10.48 clude/osmocom/sigtran/protocol/mtp.h... #11 10.48 Generating code for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.48 Generating code for file include/osmocom/sigtran/protocol/sua.h... #11 10.48 Generating code for file include/osmocom/sigtran/sccp_helpers.h... #11 10.48 Generating code for file include/osmocom/sigtran/sccp_sap.h... #11 10.48 Generating code for file include/osmocom/sigtran/sigtran_sap.h... #11 10.48 Generating code for file include/osmocom/sigtran/xua_msg.h... #11 10.48 Generating code for file include/osmocom/sigtran/xua_types.h... #11 10.48 Parsing code for file src/ipa.c... #11 10.48 Parsing code for file src/m3ua.c... #11 10.48 Parsing code for file src/osmo_ss7.c... #11 10.48 Parsing code for file src/osmo_ss7_as.c... #11 10.48 Parsing code for file src/osmo_ss7_asp.c... #11 10.48 Parsing code for file src/osmo_ss7_asp_peer.c... #11 10.48 Parsing code for file src/osmo_ss7_hmrt.c... #11 10.48 Parsing code for file src/osmo_ss7_vty.c... #11 10.48 Parsing code for file src/osmo_ss7_xua_srv.c... #11 10.48 Parsing code for file src/sccp2sua.c... #11 10.48 Parsing code for file src/sccp_helpers.c... #11 10.48 Generating code for file src/sccp_internal.h... #11 10.48 Parsing code for file src/sccp_lbcs.c... #11 10.48 Parsing code for file src/sccp_sap.c... #11 10.48 Parsing code for file src/sccp_sclc.c... #11 10.48 Parsing code for file src/sccp_scmg.c... #11 10.48 Parsing code for file src/sccp_scoc.c... #11 10.48 Parsing code for file src/sccp_scrc.c... #11 10.48 Parsing code for file src/sccp_types.c... #11 10.48 Parsing code for file src/sccp_user.c... #11 10.48 Parsing code for file src/sccp_vty.c... #11 10.48 Generating code for file src/ss7_internal.h... #11 10.48 Parsing code for file src/sua.c... #11 10.48 Parsing code for file src/xua_as_fsm.c... #11 10.48 Generating code for file src/xua_as_fsm.h... #11 10.48 Parsing code for file src/xua_asp_fsm.c... #11 10.48 Generating code for file src/xua_asp_fsm.h... #11 10.48 Parsing code for file src/xua_default_lm_fsm.c... #11 10.48 Generating code for file src/xua_internal.h... #11 10.48 Parsing code for file src/xua_msg.c... #11 10.48 Parsing code for file src/xua_rkm.c... #11 10.48 Parsing code for file src/xua_shared.c... #11 10.48 Parsing code for file src/xua_snm.c... #11 10.48 Generating file documentation... #11 10.48 Generating docs for file include/osmocom/sigtran/m2ua_types.h... #11 10.48 Generating docs for file include/osmocom/sigtran/mtp_sap.h... #11 10.48 Generating docs for file include/osmocom/sigtran/osmo_ss7.h... #11 10.48 Generating docs for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.48 Generating docs for file include/osmocom/sigtran/protocol/mtp.h... #11 10.48 Generating docs for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.48 Generating docs for file include/osmocom/sigtran/protocol/sua.h... #11 10.48 Generating docs for file include/osmocom/sigtran/sccp_helpers.h... #11 10.48 Generating docs for file include/osmocom/sigtran/sccp_sap.h... #11 10.48 Generating docs for file include/osmocom/sigtran/sigtran_sap.h... #11 10.48 Generating docs for file include/osmocom/sigtran/xua_msg.h... #11 10.48 Generating docs for file include/osmocom/sigtran/xua_types.h... #11 10.48 Generating docs for file src/ipa.c... #11 10.48 Generating docs for file src/m3ua.c... #11 10.48 Generating docs for file src/osmo_ss7.c... #11 10.48 Generating docs for file src/osmo_ss7_as.c... #11 10.48 Generating docs for file src/osmo_ss7_asp.c... #11 10.48 Generating docs for file src/osmo_ss7_asp_peer.c... #11 10.48 Generating docs for file src/osmo_ss7_hmrt.c... #11 10.48 Generating docs for file src/osmo_ss7_vty.c... #11 10.48 Generating docs for file src/osmo_ss7_xua_srv.c... #11 10.48 Generating docs for file src/sccp2sua.c... #11 10.48 Generating docs for file src/sccp_helpers.c... #11 10.48 Generating docs for file src/sccp_internal.h... #11 10.48 Generating docs for file src/sccp_lbcs.c... #11 10.48 Generating docs for file src/sccp_sap.c... #11 10.48 Generating docs for file src/sccp_sclc.c... #11 10.48 Generating docs for file src/sccp_scmg.c... #11 10.48 Generating docs for file src/sccp_scoc.c... #11 10.48 Generating docs for file src/sccp_scrc.c... #11 10.48 Generating docs for file src/sccp_types.c... #11 10.48 Generating docs for file src/sccp_user.c... #11 10.48 Generating docs for file src/sccp_vty.c... #11 10.48 Generating docs for file src/ss7_internal.h... #11 10.48 Generating docs for file src/sua.c... #11 10.48 Generating docs for file src/xua_as_fsm.c... #11 10.48 Generating docs for file src/xua_as_fsm.h... #11 10.48 Generating docs for file src/xua_asp_fsm.c... #11 10.48 Generating docs for file src/xua_asp_fsm.h... #11 10.48 Generating docs for file src/xua_default_lm_fsm.c... #11 10.48 Generating docs for file src/xua_internal.h... #11 10.48 Generating docs for file src/xua_msg.c... #11 10.48 Generating docs for fil/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.49 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.55 e src/xua_rkm.c... #11 10.55 Generating docs for file src/xua_shared.c... #11 10.55 Generating docs for file src/xua_snm.c... #11 10.55 Generating page documentation... #11 10.55 Generating group documentation... #11 10.55 Generating class documentation... #11 10.55 Generating docs for compound ipa_asp_fsm_priv... #11 10.55 Generating docs for compound lm_fsm_priv... #11 10.55 Generating docs for compound m3ua_data_hdr... #11 10.55 Generating docs for compound osmo_mtp_pause_param... #11 10.55 Generating docs for compound osmo_mtp_prim... #11 10.55 Generating docs for compound osmo_mtp_resume_param... #11 10.55 Generating docs for compound osmo_mtp_status_param... #11 10.55 Generating docs for compound osmo_mtp_transfer_param... #11 10.55 Generating docs for compound osmo_sccp_addr... #11 10.55 Generating docs for compound osmo_sccp_addr_entry... #11 10.55 Generating docs for compound osmo_sccp_gt... #11 10.55 Generating docs for compound osmo_sccp_instance... #11 10.55 Generating docs for compound osmo_sccp_user... #11 10.55 Generating docs for compound osmo_scu_connect_param... #11 10.55 Generating docs for compound osmo_scu_data_param... #11 10.55 Generating docs for compound osmo_scu_disconn_param... #11 10.55 Generating docs for compound osmo_scu_notice_param... #11 10.55 Generating docs for compound osmo_scu_pcstate_param... #11 10.55 Generating docs for compound osmo_scu_prim... #11 10.55 Generating docs for compound osmo_scu_reset_param... #11 10.55 Generating docs for compound osmo_scu_state_param... #11 10.55 Generating docs for compound osmo_scu_unitdata_param... #11 10.55 Generating docs for compound osmo_ss7_as... #11 10.55 Generating docs for compound osmo_ss7_asp... #11 10.55 Generating docs for compound osmo_ss7_asp_peer... #11 10.55 Generating docs for compound osmo_ss7_instance... #11 10.55 Generating docs for compound osmo_ss7_link... #11 10.55 Generating docs for compound osmo_ss7_linkset... #11 10.55 Generating docs for compound osmo_ss7_pc_fmt... #11 10.55 Generating docs for compound osmo_ss7_route... #11 10.55 Generating docs for compound osmo_ss7_route_table... #11 10.55 Generating docs for compound osmo_ss7_routing_key... #11 10.55 Generating docs for compound osmo_ss7_user... #11 10.55 Generating docs for compound osmo_xlm_prim... #11 10.55 Generating docs for compound osmo_xlm_prim_error... #11 10.55 Generating docs for compound osmo_xlm_prim_notify... #11 10.55 Generating docs for compound osmo_xlm_prim_rk_dereg... #11 10.55 Generating docs for compound osmo_xlm_prim_rk_reg... #11 10.55 Generating docs for compound osmo_xua_layer_manager... #11 10.55 Generating docs for compound osmo_xua_server... #11 10.55 Generating docs for compound sccp_connection... #11 10.55 Generating docs for compound sccp_scmg_msg... #11 10.55 Generating docs for compound xua_as_fsm_priv... #11 10.55 Generating docs for compound xua_asp_fsm_priv... #11 10.55 Generating docs for compound xua_common_hdr... #11 10.55 Generating docs for compound xua_dialect... #11 10.55 Generating docs for compound xua_msg... #11 10.55 Generating docs for compound xua_msg_class... #11 10.55 Generating docs for compound xua_msg_event_map... #11 10.55 Generating docs for compound xua_msg_part... #11 10.55 Generating docs for compound xua_parameter_hdr... #11 10.55 Generating concept documentation... #11 10.55 Generating namespace index... #11 10.55 Generating graph info page... #11 10.55 Generating directory documentation... #11 10.55 Generating index page... #11 10.55 Generating page index... #11 10.55 Generating module index... #11 10.55 Generating namespace index... #11 10.55 Generating namespace member index... #11 10.55 Generating concept index... #11 10.55 Generating annotated compound index... #11 10.55 Generating alphabetical compound index... #11 10.55 Generating hierarchical class index... #11 10.55 Generating member index... #11 10.55 Generating file index... #11 10.55 Generating file member index... #11 10.55 Generating example index... #11 10.55 finalizing index lists... #11 10.55 writing tag file... #11 10.55 Running plantuml with JAVA... #11 10.55 lookup cache used 2094/65536 hits=24055 misses=2248 #11 10.55 finished... #11 10.55 cd ./doc && tar cf html.tar */html #11 10.56 make[3]: Entering directory '/data/libosmo-sigtran' #11 10.56 make[3]: Nothing to be done for 'install-exec-am'. #11 10.56 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran' #11 10.56 /usr/bin/mkdir -p '/usr/local/lib/pkgconfig' #11 10.57 /usr/bin/install -c -m 644 ./doc/html.tar '/usr/local/share/doc/libosmo-sigtran' #11 10.57 /usr/bin/install -c -m 644 libosmo-sigtran.pc '/usr/local/lib/pkgconfig' #11 10.57 make install-data-hook #11 10.57 make[4]: Entering directory '/data/libosmo-sigtran' #11 10.57 cd /usr/local/share/doc/libosmo-sigtran && tar xf html.tar && rm -f html.tar #11 10.59 make[4]: Leaving directory '/data/libosmo-sigtran' #11 10.59 make[3]: Leaving directory '/data/libosmo-sigtran' #11 10.59 make[2]: Leaving directory '/data/libosmo-sigtran' #11 10.59 make[1]: Leaving directory '/data/libosmo-sigtran' #11 DONE 11.1s #12 [7/7] COPY OSMO-STP.CFG /data/ #12 DONE 0.2s #13 exporting to image #13 exporting layers #13 exporting layers 0.6s done #13 writing image sha256:34d178cf9b32d5f511a4b224bdf4d59be07460a15e6ec124f8d9ac6151f192d0 0.0s done #13 naming to docker.io/osmocom-build/osmo-stp-master:latest 0.0s done #13 DONE 0.6s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-stp-master' + docker_image_exists osmo-stp-master + docker images -q osmocom-build/osmo-stp-master + test -n 34d178cf9b32 + list_osmo_packages debian-bookworm osmo-stp-master + local distro=debian-bookworm + local image=osmo-stp-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-stp-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-stp-master ### ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202410072026 amd64 Development headers for Osmocom network interface ii libosmocodec4:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo coding library ii libosmocore 1.10.0.15.dbaeb.202410072026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.15.dbaeb.202410072026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202410072026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo SIM library ii libosmousb0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo VTY library ii osmocom-nightly 202410072026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-hnbgw-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 5.76kB done #2 DONE 0.1s #3 [auth] sharing credentials for registry.osmocom.org #3 DONE 0.0s #4 [internal] load metadata for registry.osmocom.org/debian:bookworm #4 DONE 0.0s #5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #5 DONE 0.0s #6 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #6 DONE 0.0s #7 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:e225d70fafe80791f18c79b8d76afa1d1b4192b3a40a50f1ffd4de84555ebd04 #7 resolve registry.osmocom.org/debian:bookworm@sha256:e225d70fafe80791f18c79b8d76afa1d1b4192b3a40a50f1ffd4de84555ebd04 0.1s done #7 DONE 0.1s #8 [internal] load build context #8 transferring context: 1.96kB done #8 DONE 0.1s #9 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #9 DONE 0.2s #10 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #10 DONE 0.2s #11 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #11 DONE 0.2s #12 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #12 CACHED #13 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #13 CACHED #14 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #14 CACHED #15 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #15 CACHED #16 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #16 CACHED #17 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #17 CACHED #18 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #18 CACHED #19 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #19 CACHED #20 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #20 CACHED #21 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #21 CACHED #22 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #22 CACHED #23 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #23 CACHED #24 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #24 CACHED #25 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #25 CACHED #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 CACHED #27 exporting to image #27 exporting layers done #27 writing image sha256:2d8e4f4a1d9997e1df38f234882c1d871301504f93bd2930fa46683e03014a8a 0.0s done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest 0.0s done #27 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 2d8e4f4a1d99 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-hnbgw-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-hnbgw-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-hnbgw-master + echo osmo-hnbgw-master + dir=osmo-hnbgw-master + pull_arg=--pull + grep ^FROM ../osmo-hnbgw-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + echo FROM $USER/$DISTRO-build + grep -q $USER + pull_arg= + set +x Building image: osmo-hnbgw-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-hnbgw-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-hnbgw-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-hnbgw-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-hnbgw-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.16kB done #2 DONE 0.0s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [internal] load build context #4 DONE 0.0s #5 [1/8] FROM docker.io/osmocom-build/debian-bookworm-build #5 CACHED #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 ... #7 https://gerrit.osmocom.org/plugins/gitiles/osmo-hnbgw/+/master?format=TEXT #7 DONE 0.1s #4 [internal] load build context #4 transferring context: 864B done #4 DONE 0.0s #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 0.355 Hit:1 http://deb.debian.org/debian bookworm InRelease #6 0.355 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #6 0.355 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #6 0.355 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #6 0.655 Reading package lists... #6 0.924 Reading package lists... #6 1.174 Building dependency tree... #6 1.228 Reading state information... #6 1.291 The following additional packages will be installed: #6 1.292 libasn1c1 libosmo-gtlv-dev libosmo-gtlv1 libosmo-hnbap0 #6 1.292 libosmo-mgcp-client14 libosmo-pfcp0 libosmo-ranap7 libosmo-rua0 #6 1.292 libosmo-sigtran10 libosmoabis13 libosmocodec4 libosmocoding0 libosmocore #6 1.292 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #6 1.292 libosmonetif11 libosmosim2 libosmotrau10 libosmousb0 libosmovty13 #6 1.292 osmocom-nightly #6 1.304 The following NEW packages will be installed: #6 1.305 libasn1c-dev libasn1c1 libosmo-abis-dev libosmo-gtlv-dev libosmo-gtlv1 #6 1.305 libosmo-hnbap-dev libosmo-hnbap0 libosmo-mgcp-client-dev #6 1.305 libosmo-mgcp-client14 libosmo-netif-dev libosmo-pfcp-dev libosmo-pfcp0 #6 1.305 libosmo-ranap-dev libosmo-ranap7 libosmo-rua-dev libosmo-rua0 #6 1.305 libosmo-sigtran-dev libosmo-sigtran10 libosmoabis13 libosmocodec4 #6 1.305 libosmocoding0 libosmocore libosmocore-dev libosmocore22 libosmoctrl0 #6 1.305 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 #6 1.305 libosmotrau10 libosmousb0 libosmovty13 osmocom-nightly #6 1.326 0 upgraded, 34 newly installed, 0 to remove and 4 not upgraded. #6 1.326 Need to get 4008 kB of archives. #6 1.326 After this operation, 17.9 MB of additional disk space will be used. #6 1.326 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202410072026 [1176 B] #6 1.342 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.15.dbaeb.202410072026 [168 kB] #6 1.346 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.15.dbaeb.202410072026 [50.6 kB] #6 1.347 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmotrau10 1.6.0.21.7306.202410072026 [32.9 kB] #6 1.348 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.15.dbaeb.202410072026 [69.7 kB] #6 1.349 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.15.dbaeb.202410072026 [227 kB] #6 1.352 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.15.dbaeb.202410072026 [103 kB] #6 1.353 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoabis13 1.6.0.21.7306.202410072026 [73.1 kB] #6 1.354 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-abis-dev 1.6.0.21.7306.202410072026 [117 kB] #6 1.357 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv1 0.4.0.1.c4dc.202410072026 [16.5 kB] #6 1.358 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.15.dbaeb.202410072026 [70.3 kB] #6 1.360 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.15.dbaeb.202410072026 [177 kB] #6 1.363 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.15.dbaeb.202410072026 [58.8 kB] #6 1.364 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.15.dbaeb.202410072026 [62.9 kB] #6 1.366 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.15.dbaeb.202410072026 [49.6 kB] #6 1.368 Get:16 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.15.dbaeb.202410072026 [43.0 kB] #6 1.369 Get:17 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.15.dbaeb.202410072026 [846 kB] #6 1.377 Get:18 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv-dev 0.4.0.1.c4dc.202410072026 [57.3 kB] #6 1.378 Get:19 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202410072026 [53.9 kB] #6 1.378 Get:20 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202410072026 [66.0 kB] #6 1.379 Get:21 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp0 0.4.0.1.c4dc.202410072026 [40.7 kB] #6 1.379 Get:22 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp-dev 0.4.0.1.c4dc.202410072026 [170 kB] #6 1.381 Get:23 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran10 2.0.0.8.bfd6.202410072026 [125 kB] #6 1.382 Get:24 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran-dev 2.0.0.8.bfd6.202410072026 [587 kB] #6 1.388 Get:25 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c1 0.9.37.202410072026 [75.3 kB] #6 1.389 Get:26 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c-dev 0.9.37.202410072026 [106 kB] #6 1.391 Get:27 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap0 1.6.0.2.3332.202410072026 [51.8 kB] #6 1.391 Get:28 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap-dev 1.6.0.2.3332.202410072026 [24.9 kB] #6 1.391 Get:29 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client14 1.13.1.202410072026 [57.6 kB] #6 1.392 Get:30 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client-dev 1.13.1.202410072026 [66.5 kB] #6 1.392 Get:31 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap7 1.6.0.2.3332.202410072026 [225 kB] #6 1.393 Get:32 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap-dev 1.6.0.2.3332.202410072026 [92.1 kB] #6 1.394 Get:33 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua0 1.6.0.2.3332.202410072026 [28.1 kB] #6 1.395 Get:34 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua-dev 1.6.0.2.3332.202410072026 [14.7 kB] #6 1.503 debconf: delaying package configuration, since apt-utils is not installed #6 1.544 Fetched 4008 kB in 0s (46.1 MB/s) #6 1.601 Selecting previously unselected package osmocom-nightly. #6 1.601 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117417 files and directories currently installed.) #6 1.637 Preparing to unpack .../00-osmocom-nightly_202410072026_amd64.deb ... #6 1.654 Unpacking osmocom-nightly (202410072026) ... #6 1.787 Selecting previously unselected package libosmocore22:amd64. #6 1.805 Preparing to unpack .../01-libosmocore22_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 1.841 Unpacking libosmocore22:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 1.997 Selecting previously unselected package libosmocodec4:amd64. #6 2.005 Preparing to unpack .../02-libosmocodec4_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.022 Unpacking libosmocodec4:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.168 Selecting previously unselected package libosmotrau10:amd64. #6 2.176 Preparing to unpack .../03-libosmotrau10_1.6.0.21.7306.202410072026_amd64.deb ... #6 2.193 Unpacking libosmotrau10:amd64 (1.6.0.21.7306.202410072026) ... #6 2.341 Selecting previously unselected package libosmoisdn0:amd64. #6 2.349 Preparing to unpack .../04-libosmoisdn0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.367 Unpacking libosmoisdn0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.513 Selecting previously unselected package libosmogsm20:amd64. #6 2.521 Preparing to unpack .../05-libosmogsm20_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.546 Unpacking libosmogsm20:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.722 Selecting previously unselected package libosmovty13:amd64. #6 2.730 Preparing to unpack .../06-libosmovty13_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 2.747 Unpacking libosmovty13:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 2.900 Selecting previously unselected package libosmoabis13:amd64. #6 2.918 Preparing to unpack .../07-libosmoabis13_1.6.0.21.7306.202410072026_amd64.deb ... #6 2.935 Unpacking libosmoabis13:amd64 (1.6.0.21.7306.202410072026) ... #6 3.069 Selecting previously unselected package libosmo-abis-dev:amd64. #6 3.077 Preparing to unpack .../08-libosmo-abis-dev_1.6.0.21.7306.202410072026_amd64.deb ... #6 3.094 Unpacking libosmo-abis-dev:amd64 (1.6.0.21.7306.202410072026) ... #6 3.249 Selecting previously unselected package libosmo-gtlv1:amd64. #6 3.257 Preparing to unpack .../09-libosmo-gtlv1_0.4.0.1.c4dc.202410072026_amd64.deb ... #6 3.275 Unpacking libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202410072026) ... #6 3.415 Selecting previously unselected package libosmocoding0:amd64. #6 3.424 Preparing to unpack .../10-libosmocoding0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.447 Unpacking libosmocoding0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.598 Selecting previously unselected package libosmogb14:amd64. #6 3.606 Preparing to unpack .../11-libosmogb14_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.623 Unpacking libosmogb14:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.778 Selecting previously unselected package libosmoctrl0:amd64. #6 3.796 Preparing to unpack .../12-libosmoctrl0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.817 Unpacking libosmoctrl0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 3.959 Selecting previously unselected package libosmosim2:amd64. #6 3.977 Preparing to unpack .../13-libosmosim2_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 3.995 Unpacking libosmosim2:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.142 Selecting previously unselected package libosmousb0:amd64. #6 4.160 Preparing to unpack .../14-libosmousb0_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 4.178 Unpacking libosmousb0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.321 Selecting previously unselected package libosmocore. #6 4.339 Preparing to unpack .../15-libosmocore_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 4.357 Unpacking libosmocore (1.10.0.15.dbaeb.202410072026) ... #6 4.500 Selecting previously unselected package libosmocore-dev:amd64. #6 4.518 Preparing to unpack .../16-libosmocore-dev_1.10.0.15.dbaeb.202410072026_amd64.deb ... #6 4.536 Unpacking libosmocore-dev:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 4.702 Selecting previously unselected package libosmo-gtlv-dev:amd64. #6 4.720 Preparing to unpack .../17-libosmo-gtlv-dev_0.4.0.1.c4dc.202410072026_amd64.deb ... #6 4.737 Unpacking libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202410072026) ... #6 4.895 Selecting previously unselected package libosmonetif11:amd64. #6 4.903 Preparing to unpack .../18-libosmonetif11_1.5.1.5.89a1.202410072026_amd64.deb ... #6 4.921 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202410072026) ... #6 5.047 Selecting previously unselected package libosmo-netif-dev:amd64. #6 5.065 Preparing to unpack .../19-libosmo-netif-dev_1.5.1.5.89a1.202410072026_amd64.deb ... #6 5.082 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202410072026) ... #6 5.218 Selecting previously unselected package libosmo-pfcp0:amd64. #6 5.226 Preparing to unpack .../20-libosmo-pfcp0_0.4.0.1.c4dc.202410072026_amd64.deb ... #6 5.244 Unpacking libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202410072026) ... #6 5.383 Selecting previously unselected package libosmo-pfcp-dev:amd64. #6 5.401 Preparing to unpack .../21-libosmo-pfcp-dev_0.4.0.1.c4dc.202410072026_amd64.deb ... #6 5.419 Unpacking libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202410072026) ... #6 5.574 Selecting previously unselected package libosmo-sigtran10:amd64. #6 5.592 Preparing to unpack .../22-libosmo-sigtran10_2.0.0.8.bfd6.202410072026_amd64.deb ... #6 5.609 Unpacking libosmo-sigtran10:amd64 (2.0.0.8.bfd6.202410072026) ... #6 5.772 Selecting previously unselected package libosmo-sigtran-dev:amd64. #6 5.790 Preparing to unpack .../23-libosmo-sigtran-dev_2.0.0.8.bfd6.202410072026_amd64.deb ... #6 5.808 Unpacking libosmo-sigtran-dev:amd64 (2.0.0.8.bfd6.202410072026) ... #6 5.978 Selecting previously unselected package libasn1c1:amd64. #6 5.986 Preparing to unpack .../24-libasn1c1_0.9.37.202410072026_amd64.deb ... #6 6.003 Unpacking libasn1c1:amd64 (0.9.37.202410072026) ... #6 6.133 Selecting previously unselected package libasn1c-dev:amd64. #6 6.151 Preparing to unpack .../25-libasn1c-dev_0.9.37.202410072026_amd64.deb ... #6 6.173 Unpacking libasn1c-dev:amd64 (0.9.37.202410072026) ... #6 6.320 Selecting previously unselected package libosmo-hnbap0:amd64. #6 6.337 Preparing to unpack .../26-libosmo-hnbap0_1.6.0.2.3332.202410072026_amd64.deb ... #6 6.355 Unpacking libosmo-hnbap0:amd64 (1.6.0.2.3332.202410072026) ... #6 6.492 Selecting previously unselected package libosmo-hnbap-dev:amd64. #6 6.510 Preparing to unpack .../27-libosmo-hnbap-dev_1.6.0.2.3332.202410072026_amd64.deb ... #6 6.528 Unpacking libosmo-hnbap-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 6.683 Selecting previously unselected package libosmo-mgcp-client14:amd64. #6 6.701 Preparing to unpack .../28-libosmo-mgcp-client14_1.13.1.202410072026_amd64.deb ... #6 6.719 Unpacking libosmo-mgcp-client14:amd64 (1.13.1.202410072026) ... #6 6.849 Selecting previously unselected package libosmo-mgcp-client-dev:amd64. #6 6.867 Preparing to unpack .../29-libosmo-mgcp-client-dev_1.13.1.202410072026_amd64.deb ... #6 6.884 Unpacking libosmo-mgcp-client-dev:amd64 (1.13.1.202410072026) ... #6 7.040 Selecting previously unselected package libosmo-ranap7:amd64. #6 7.058 Preparing to unpack .../30-libosmo-ranap7_1.6.0.2.3332.202410072026_amd64.deb ... #6 7.077 Unpacking libosmo-ranap7:amd64 (1.6.0.2.3332.202410072026) ... #6 7.205 Selecting previously unselected package libosmo-ranap-dev:amd64. #6 7.222 Preparing to unpack .../31-libosmo-ranap-dev_1.6.0.2.3332.202410072026_amd64.deb ... #6 7.239 Unpacking libosmo-ranap-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 7.421 Selecting previously unselected package libosmo-rua0:amd64. #6 7.429 Preparing to unpack .../32-libosmo-rua0_1.6.0.2.3332.202410072026_amd64.deb ... #6 7.446 Unpacking libosmo-rua0:amd64 (1.6.0.2.3332.202410072026) ... #6 7.576 Selecting previously unselected package libosmo-rua-dev:amd64. #6 7.594 Preparing to unpack .../33-libosmo-rua-dev_1.6.0.2.3332.202410072026_amd64.deb ... #6 7.612 Unpacking libosmo-rua-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 7.801 Setting up osmocom-nightly (202410072026) ... #6 7.855 Setting up libosmocore22:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 7.911 Setting up libosmocodec4:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 7.975 Setting up libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202410072026) ... #6 8.029 Setting up libasn1c1:amd64 (0.9.37.202410072026) ... #6 8.090 Setting up libosmo-hnbap0:amd64 (1.6.0.2.3332.202410072026) ... #6 8.143 Setting up libosmovty13:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.197 Setting up libosmo-rua0:amd64 (1.6.0.2.3332.202410072026) ... #6 8.259 Setting up libosmoisdn0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.312 Setting up libosmotrau10:amd64 (1.6.0.21.7306.202410072026) ... #6 8.369 Setting up libasn1c-dev:amd64 (0.9.37.202410072026) ... #6 8.426 Setting up libosmo-rua-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 8.479 Setting up libosmousb0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.545 Setting up libosmo-mgcp-client14:amd64 (1.13.1.202410072026) ... #6 8.598 Setting up libosmogsm20:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.652 Setting up libosmoabis13:amd64 (1.6.0.21.7306.202410072026) ... #6 8.713 Setting up libosmoctrl0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.767 Setting up libosmo-hnbap-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 8.832 Setting up libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202410072026) ... #6 8.893 Setting up libosmogb14:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 8.948 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202410072026) ... #6 9.009 Setting up libosmo-abis-dev:amd64 (1.6.0.21.7306.202410072026) ... #6 9.069 Setting up libosmo-mgcp-client-dev:amd64 (1.13.1.202410072026) ... #6 9.125 Setting up libosmocoding0:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 9.185 Setting up libosmosim2:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 9.239 Setting up libosmocore (1.10.0.15.dbaeb.202410072026) ... #6 9.299 Setting up libosmo-sigtran10:amd64 (2.0.0.8.bfd6.202410072026) ... #6 9.371 Setting up libosmo-ranap7:amd64 (1.6.0.2.3332.202410072026) ... #6 9.536 Setting up libosmocore-dev:amd64 (1.10.0.15.dbaeb.202410072026) ... #6 9.602 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202410072026) ... #6 9.655 Setting up libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202410072026) ... #6 9.709 Setting up libosmo-ranap-dev:amd64 (1.6.0.2.3332.202410072026) ... #6 9.768 Setting up libosmo-sigtran-dev:amd64 (2.0.0.8.bfd6.202410072026) ... #6 9.825 Setting up libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202410072026) ... #6 9.887 Processing triggers for libc-bin (2.36-9+deb12u8) ... #6 DONE 10.4s #8 [3/8] WORKDIR /TMP #8 DONE 0.1s #9 [4/8] RUN GIT clone https://gerrit.osmocom.org/osmo-hnbgw.git #9 0.355 Cloning into 'osmo-hnbgw'... #9 DONE 0.6s #10 [5/8] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-HNBGW/+/MASTER?FORMAT=TEXT /tmp/commit-osmo-hnbgw #10 DONE 0.1s #11 [6/8] RUN CD osmo-hnbgw && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure --enable-pfcp && make "-j$(nproc)" install && ldconfig #11 0.414 Already on 'master' #11 0.414 Your branch is up to date with 'origin/master'. #11 0.415 refs/heads/master #11 0.418 HEAD is now at 3fb99d1 Revert "hnb_persistent: Use incrementing counter for rate_ctr + stat_item index" #11 0.420 master #11 0.422 3fb99d143a9e7ffc788d1d9b95ea243d5c5dfc89 #11 1.480 aclocal: warning: couldn't open directory 'm4': No such file or directory #11 2.587 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.587 libtoolize: copying file './ltmain.sh' #11 2.720 libtoolize: putting macros in 'm4'. #11 2.720 libtoolize: copying file 'm4/libtool.m4' #11 2.771 libtoolize: copying file 'm4/ltoptions.m4' #11 2.825 libtoolize: copying file 'm4/ltsugar.m4' #11 2.880 libtoolize: copying file 'm4/ltversion.m4' #11 2.935 libtoolize: copying file 'm4/lt~obsolete.m4' #11 3.023 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 3.023 libtoolize: and rerunning libtoolize and aclocal. #11 3.854 configure.ac:84: warning: The macro `AC_HEADER_STDC' is obsolete. #11 3.854 configure.ac:84: You should run autoupdate. #11 3.854 ./lib/autoconf/headers.m4:704: AC_HEADER_STDC is expanded from... #11 3.854 configure.ac:84: the top level #11 3.854 configure.ac:132: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.854 configure.ac:132: You should run autoupdate. #11 3.854 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.854 configure.ac:132: the top level #11 3.854 configure.ac:153: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.854 configure.ac:153: You should run autoupdate. #11 3.854 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.854 configure.ac:153: the top level #11 3.854 configure.ac:232: warning: 'AM_CONFIG_HEADER': this macro is obsolete. #11 3.854 configure.ac:232: You should use the 'AC_CONFIG_HEADERS' macro instead. #11 3.854 ./lib/autoconf/general.m4:2434: AC_DIAGNOSE is expanded from... #11 3.854 aclocal.m4:1089: AM_CONFIG_HEADER is expanded from... #11 3.854 configure.ac:232: the top level #11 3.854 configure.ac:234: warning: AC_OUTPUT should be used without arguments. #11 3.854 configure.ac:234: You should run autoupdate. #11 4.376 configure.ac:23: installing './compile' #11 4.376 configure.ac:25: installing './config.guess' #11 4.377 configure.ac:25: installing './config.sub' #11 4.378 configure.ac:9: installing './install-sh' #11 4.379 configure.ac:9: installing './missing' #11 4.415 doc/charts/Makefile.am:10: warning: '%'-style pattern rules are a GNU make extension #11 4.415 doc/charts/Makefile.am:13: warning: '%'-style pattern rules are a GNU make extension #11 4.415 doc/charts/Makefile.am:18: warning: ':='-style assignments are not portable #11 4.468 src/osmo-hnbgw/Makefile.am: installing './depcomp' #11 4.598 checking for a BSD-compatible install... /usr/bin/install -c #11 4.618 checking whether build environment is sane... yes #11 4.643 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.648 checking for gawk... gawk #11 4.648 checking whether make sets $(MAKE)... yes #11 4.674 checking whether make supports nested variables... yes #11 4.692 checking whether make supports nested variables... (cached) yes #11 4.692 checking whether make sets $(MAKE)... (cached) yes #11 4.698 checking for gcc... gcc #11 4.768 checking whether the C compiler works... yes #11 4.854 checking for C compiler default output file name... a.out #11 4.855 checking for suffix of executables... #11 4.872 checking whether we are cross compiling... no #11 4.900 checking for suffix of object files... o #11 4.914 checking whether the compiler supports GNU C... yes #11 4.926 checking whether gcc accepts -g... yes #11 4.944 checking for gcc option to enable C11 features... none needed #11 4.973 checking whether gcc understands -c and -o together... yes #11 5.010 checking whether make supports the include directive... yes (GNU style) #11 5.023 checking dependency style of gcc... gcc3 #11 5.112 checking build system type... x86_64-pc-linux-gnu #11 5.220 checking host system type... x86_64-pc-linux-gnu #11 5.220 checking how to print strings... printf #11 5.250 checking for a sed that does not truncate output... /usr/bin/sed #11 5.252 checking for grep that handles long lines and -e... /usr/bin/grep #11 5.253 checking for egrep... /usr/bin/grep -E #11 5.254 checking for fgrep... /usr/bin/grep -F #11 5.255 checking for ld used by gcc... /usr/bin/ld #11 5.257 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 5.258 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 5.260 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 5.277 checking whether ln -s works... yes #11 5.277 checking the maximum length of command line arguments... 1572864 #11 5.290 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 5.290 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 5.290 checking for /usr/bin/ld option to reload object files... -r #11 5.291 checking for file... file #11 5.292 checking for objdump... objdump #11 5.292 checking how to recognize dependent libraries... pass_all #11 5.293 checking for dlltool... no #11 5.294 checking how to associate runtime and link libraries... printf %s\n #11 5.295 checking for ar... ar #11 5.295 checking for archiver @FILE support... @ #11 5.336 checking for strip... strip #11 5.337 checking for ranlib... ranlib #11 5.337 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 5.424 checking for sysroot... no #11 5.424 checking for a working dd... /usr/bin/dd #11 5.426 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 5.442 checking for mt... no #11 5.443 checking if : is a manifest tool... no #11 5.447 checking for stdio.h... yes #11 5.470 checking for stdlib.h... yes #11 5.490 checking for string.h... yes #11 5.509 checking for inttypes.h... yes #11 5.522 checking for stdint.h... yes #11 5.533 checking for strings.h... yes #11 5.544 checking for sys/stat.h... yes #11 5.555 checking for sys/types.h... yes #11 5.567 checking for unistd.h... yes #11 5.579 checking for dlfcn.h... yes #11 5.600 checking for objdir... .libs #11 5.646 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.655 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.655 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.664 checking if gcc static flag -static works... yes #11 5.695 checking if gcc supports -c -o file.o... yes #11 5.707 checking if gcc supports -c -o file.o... (cached) yes #11 5.707 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.711 checking whether -lc should be explicitly linked in... no #11 5.723 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.749 checking how to hardcode library paths into programs... immediate #11 5.749 checking whether stripping libraries is possible... yes #11 5.750 checking if libtool supports shared libraries... yes #11 5.750 checking whether to build shared libraries... yes #11 5.750 checking whether to build static libraries... yes #11 5.750 checking for pkg-config... /usr/bin/pkg-config #11 5.750 checking for pkg-config... /usr/bin/pkg-config #11 5.750 checking pkg-config is at least version 0.20... yes #11 5.751 checking for library containing sctp_recvmsg... -lsctp #11 5.790 checking for libasn1c >= 0.9.30... yes #11 5.793 checking for libosmocore >= 1.10.0... yes #11 5.797 checking for libosmovty >= 1.10.0... yes #11 5.800 checking for libosmoctrl >= 1.10.0... yes #11 5.804 checking for libosmogsm >= 1.10.0... yes #11 5.809 checking for libosmo-netif >= 1.5.0... yes #11 5.814 checking for libosmo-sigtran >= 1.9.0... yes #11 5.821 checking for libosmo-rua >= 1.6.0... yes #11 5.830 checking for libosmo-ranap >= 1.6.0... yes #11 5.846 checking for libosmo-hnbap >= 1.6.0... yes #11 5.864 checking for libosmo-mgcp-client >= 1.13.0... yes #11 5.883 checking for libosmo-pfcp >= 0.4.0... yes #11 5.901 checking for egrep... (cached) /usr/bin/grep -E #11 5.901 checking if gcc supports -fvisibility=hidden... yes #11 5.935 checking whether to enable code coverage support... no #11 5.936 checking whether to enable VTY/CTRL tests... no #11 5.943 CFLAGS=" -std=gnu11" #11 5.943 CPPFLAGS="" #11 5.996 checking that generated files are newer than configure... done #11 5.998 configure: creating ./config.status #11 7.051 config.status: creating include/Makefile #11 7.088 config.status: creating include/osmocom/Makefile #11 7.126 config.status: creating include/osmocom/hnbgw/Makefile #11 7.163 config.status: creating src/Makefile #11 7.201 config.status: creating src/osmo-hnbgw/Makefile #11 7.239 config.status: creating tests/Makefile #11 7.277 config.status: creating tests/atlocal #11 7.317 config.status: creating tests/ranap_rab_ass/Makefile #11 7.357 config.status: creating tests/umts_cell_id/Makefile #11 7.396 config.status: creating doc/Makefile #11 7.436 config.status: creating doc/examples/Makefile #11 7.475 config.status: creating doc/manuals/Makefile #11 7.514 config.status: creating doc/charts/Makefile #11 7.553 config.status: creating contrib/Makefile #11 7.593 config.status: creating contrib/systemd/Makefile #11 7.632 config.status: creating Makefile #11 7.663 config.status: creating config.h #11 7.697 config.status: executing tests/atconfig commands #11 7.704 config.status: executing depfiles commands #11 8.093 config.status: executing libtool commands #11 8.212 echo 1.6.0.8-3fb9 > .version-t && mv .version-t .version #11 8.217 make install-recursive #11 8.225 make[1]: Entering directory '/tmp/osmo-hnbgw' #11 8.234 Making install in include #11 8.238 make[2]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.247 Making install in osmocom #11 8.252 make[3]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.260 Making install in hnbgw #11 8.265 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.271 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.271 make[5]: Nothing to be done for 'install-exec-am'. #11 8.271 make[5]: Nothing to be done for 'install-data-am'. #11 8.271 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.271 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.276 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.282 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.282 make[5]: Nothing to be done for 'install-exec-am'. #11 8.282 make[5]: Nothing to be done for 'install-data-am'. #11 8.282 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.282 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.283 make[3]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.288 make[3]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.294 make[4]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.294 make[4]: Nothing to be done for 'install-exec-am'. #11 8.294 make[4]: Nothing to be done for 'install-data-am'. #11 8.294 make[4]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.294 make[3]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.295 make[2]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.295 Making install in src #11 8.300 make[2]: Entering directory '/tmp/osmo-hnbgw/src' #11 8.308 Making install in osmo-hnbgw #11 8.315 make[3]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 8.317 CC osmo_hnbgw_main.o #11 8.318 CC hnbgw.lo #11 8.319 CC hnbgw_hnbap.lo #11 8.320 CC hnbgw_l3.lo #11 8.321 CC hnbgw_rua.lo #11 8.322 CC hnbgw_ranap.lo #11 8.323 CC hnbgw_vty.lo #11 8.324 CC context_map.lo #11 8.325 CC context_map_rua.lo #11 8.326 CC context_map_sccp.lo #11 8.326 CC hnbgw_cn.lo #11 8.327 CC cnlink.lo #11 8.327 CC ranap_rab_ass.lo #11 8.327 CC mgw_fsm.lo #11 8.327 CC kpi_dtap.lo #11 8.328 CC kpi_ranap.lo #11 8.328 CC tdefs.lo #11 8.328 CC nft_kpi.lo #11 8.328 CC hnbgw_pfcp.lo #11 8.329 CC ps_rab_ass_fsm.lo #11 8.484 CC ps_rab_fsm.lo #11 8.527 mgw_fsm.c: In function 'mgw_fsm_crcx_hnb_onenter': #11 8.527 mgw_fsm.c:180:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.527 180 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.527 | ^~~~~~~~ #11 8.527 In file included from /usr/include/osmocom/mgcp_client/mgcp_client_endpoint_fsm.h:4, #11 8.527 from mgw_fsm.c:48: #11 8.527 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.527 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.527 | ^~~~~~ #11 8.527 mgw_fsm.c:181:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.527 181 | mgw_info.codecs_len = 1; #11 8.527 | ^~~~~~~~ #11 8.527 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.527 35 | unsigned int codecs_len #11 8.527 | ^~~~~~~~~~ #11 8.531 mgw_fsm.c: In function 'mgw_fsm_mdcx_hnb_onenter': #11 8.531 mgw_fsm.c:368:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.531 368 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.531 | ^~~~~~~~ #11 8.531 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.531 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.531 | ^~~~~~ #11 8.531 mgw_fsm.c:369:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.531 369 | mgw_info.codecs_len = 1; #11 8.531 | ^~~~~~~~ #11 8.531 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.531 35 | unsigned int codecs_len #11 8.531 | ^~~~~~~~~~ #11 8.533 mgw_fsm.c: In function 'mgw_fsm_crcx_msc_onenter': #11 8.533 mgw_fsm.c:452:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.533 452 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.533 | ^~~~~~~~ #11 8.533 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.533 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.533 | ^~~~~~ #11 8.533 mgw_fsm.c:453:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.533 453 | mgw_info.codecs_len = 1; #11 8.533 | ^~~~~~~~ #11 8.533 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.533 35 | unsigned int codecs_len #11 8.533 | ^~~~~~~~~~ #11 8.813 CCLD libhnbgw.la #11 9.479 CCLD osmo-hnbgw #11 9.956 make[4]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.956 make[4]: Nothing to be done for 'install-data-am'. #11 9.957 /usr/bin/mkdir -p '/usr/local/bin' #11 9.958 /bin/bash ../../libtool --mode=install /usr/bin/install -c osmo-hnbgw '/usr/local/bin' #11 9.972 libtool: install: /usr/bin/install -c osmo-hnbgw /usr/local/bin/osmo-hnbgw #11 9.974 make[4]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.974 make[3]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.975 make[3]: Entering directory '/tmp/osmo-hnbgw/src' #11 9.976 make[4]: Entering directory '/tmp/osmo-hnbgw/src' #11 9.976 make[4]: Nothing to be done for 'install-exec-am'. #11 9.976 make[4]: Nothing to be done for 'install-data-am'. #11 9.976 make[4]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.976 make[3]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.976 make[2]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.976 Making install in tests #11 9.977 make[2]: Entering directory '/tmp/osmo-hnbgw/tests' #11 9.979 Making install in ranap_rab_ass #11 9.980 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.981 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.981 make[4]: Nothing to be done for 'install-exec-am'. #11 9.981 make[4]: Nothing to be done for 'install-data-am'. #11 9.981 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.981 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.981 Making install in umts_cell_id #11 9.982 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.983 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.983 make[4]: Nothing to be done for 'install-exec-am'. #11 9.983 make[4]: Nothing to be done for 'install-data-am'. #11 9.983 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.984 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.985 make[3]: Entering directory '/tmp/osmo-hnbgw/tests' #11 9.986 make[4]: Entering directory '/tmp/osmo-hnbgw/tests' #11 9.986 make[4]: Nothing to be done for 'install-exec-am'. #11 9.986 make[4]: Nothing to be done for 'install-data-am'. #11 9.986 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 9.986 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 9.986 make[2]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 9.986 Making install in doc #11 9.988 make[2]: Entering directory '/tmp/osmo-hnbgw/doc' #11 9.990 Making install in examples #11 9.992 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 9.994 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 9.994 make[4]: Nothing to be done for 'install-exec-am'. #11 9.994 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 9.996 /usr/bin/install -c -m 644 osmo-hnbgw/osmo-hnbgw.cfg '/usr/local/etc/osmocom' #11 9.998 make install-data-hook #11 10.000 make[5]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.000 for f in $(find . -name '*.cfg*' | sed -e 's,^.,,'); do \ #11 10.000 j="/usr/local/share/doc/osmo-hnbgw/examples/$f" && \ #11 10.000 mkdir -p "$(dirname $j)" && \ #11 10.000 /usr/bin/install -c -m 644 ./$f $j; \ #11 10.000 done #11 10.02 make[5]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.02 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.02 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.02 Making install in manuals #11 10.03 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.03 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.03 make[4]: Nothing to be done for 'install-exec-am'. #11 10.03 make[4]: Nothing to be done for 'install-data-am'. #11 10.03 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.03 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.03 Making install in charts #11 10.04 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.04 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.04 make[4]: Nothing to be done for 'install-exec-am'. #11 10.04 make[4]: Nothing to be done for 'install-data-am'. #11 10.04 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.04 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.05 make[3]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.05 make[4]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.05 make[4]: Nothing to be done for 'install-exec-am'. #11 10.05 make[4]: Nothing to be done for 'install-data-am'. #11 10.05 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.05 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.06 make[2]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.06 Making install in contrib #11 10.06 make[2]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.07 Making install in systemd #11 10.07 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.08 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.08 make[4]: Nothing to be done for 'install-exec-am'. #11 10.08 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.09 /usr/bin/install -c -m 644 osmo-hnbgw.service '/lib/systemd/system' #11 10.09 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.09 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.10 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.10 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.10 make[4]: Nothing to be done for 'install-exec-am'. #11 10.10 make[4]: Nothing to be done for 'install-data-am'. #11 10.10 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.10 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.11 make[2]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.11 make[2]: Entering directory '/tmp/osmo-hnbgw' #11 10.12 make[3]: Entering directory '/tmp/osmo-hnbgw' #11 10.12 make[3]: Nothing to be done for 'install-exec-am'. #11 10.12 make[3]: Nothing to be done for 'install-data-am'. #11 10.12 make[3]: Leaving directory '/tmp/osmo-hnbgw' #11 10.13 make[2]: Leaving directory '/tmp/osmo-hnbgw' #11 10.13 make[1]: Leaving directory '/tmp/osmo-hnbgw' #11 DONE 10.3s #12 [7/8] COPY OSMO-HNBGW.CFG /data/osmo-hnbgw.cfg #12 DONE 0.1s #13 [8/8] WORKDIR /DATA #13 DONE 0.1s #14 exporting to image #14 exporting layers #14 exporting layers 0.7s done #14 writing image sha256:0c4d3b95177dc88410f2ccaeb56f5f10a26282e63640261c5e425371050724f2 0.0s done #14 naming to docker.io/osmocom-build/osmo-hnbgw-master:latest 0.0s done #14 DONE 0.7s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-hnbgw-master' + docker_image_exists osmo-hnbgw-master + docker images -q osmocom-build/osmo-hnbgw-master + test -n 0c4d3b95177d + list_osmo_packages debian-bookworm osmo-hnbgw-master + local distro=debian-bookworm + local image=osmo-hnbgw-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-hnbgw-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-hnbgw-master ### ii libosmo-abis-dev:amd64 1.6.0.21.7306.202410072026 amd64 Development headers for A-bis interface ii libosmo-gtlv-dev:amd64 0.4.0.1.c4dc.202410072026 amd64 Development files for libosmo-gtlv ii libosmo-gtlv1:amd64 0.4.0.1.c4dc.202410072026 amd64 Generic TLV and TLIV protocol support ii libosmo-hnbap-dev:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-hnbap0:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-mgcp-client-dev:amd64 1.13.1.202410072026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-mgcp-client14:amd64 1.13.1.202410072026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202410072026 amd64 Development headers for Osmocom network interface ii libosmo-pfcp-dev:amd64 0.4.0.1.c4dc.202410072026 amd64 Development files for libosmo-pfcp ii libosmo-pfcp0:amd64 0.4.0.1.c4dc.202410072026 amd64 PFCP protocol support ii libosmo-ranap-dev:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-ranap7:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua-dev:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua0:amd64 1.6.0.2.3332.202410072026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-sigtran-dev:amd64 2.0.0.8.bfd6.202410072026 amd64 Development headers for the Osmocom SIGTRAN library ii libosmo-sigtran10:amd64 2.0.0.8.bfd6.202410072026 amd64 Osmocom SIGTRAN library (SCCP, SUA, M3UA and more) ii libosmoabis13:amd64 1.6.0.21.7306.202410072026 amd64 GSM A-bis handling ii libosmocodec4:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo coding library ii libosmocore 1.10.0.15.dbaeb.202410072026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.15.dbaeb.202410072026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202410072026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo SIM library ii libosmotrau10:amd64 1.6.0.21.7306.202410072026 amd64 GSM trau handling ii libosmousb0:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.15.dbaeb.202410072026 amd64 Osmo VTY library ii osmocom-nightly 202410072026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends ttcn3-hnbgw-test + local feed + echo debian-bookworm-titan + depends=debian-bookworm-titan + [ -n debian-bookworm-titan ] + docker_images_require debian-bookworm-titan + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker pull registry.osmocom.org/osmocom-build/debian-bookworm-titan Using default tag: latest latest: Pulling from osmocom-build/debian-bookworm-titan Digest: sha256:ac3c75b6832e3c198f32b307edc38cd6d9bb4c5ed14a106f86528e0de81d27d9 Status: Image is up to date for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest + continue + docker_distro_from_image_name ttcn3-hnbgw-test + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name ttcn3-hnbgw-test + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name ttcn3-hnbgw-test + echo ttcn3-hnbgw-test + dir=ttcn3-hnbgw-test + pull_arg=--pull + grep ^FROM ../ttcn3-hnbgw-test/Dockerfile + from_line=FROM $REGISTRY/$USER/debian-bookworm-titan + echo FROM $REGISTRY/$USER/debian-bookworm-titan + grep -q $USER + pull_arg= + set +x Building image: ttcn3-hnbgw-test (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../ttcn3-hnbgw-test BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/ttcn3-hnbgw-test OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/ttcn3-hnbgw-test:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 395B done #2 DONE 0.0s #3 [internal] load metadata for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest #3 DONE 0.0s #4 [1/4] FROM registry.osmocom.org/osmocom-build/debian-bookworm-titan #4 DONE 0.0s #5 [internal] load build context #5 transferring context: 3.38kB done #5 DONE 0.0s #6 https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT #6 DONE 0.1s #7 [2/4] ADD https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT /tmp/commit #7 CACHED #8 [3/4] RUN TTCN3-DOCKER-PREPARE "master" hnbgw #8 0.251 + OSMO_TTCN3_BRANCH=master #8 0.251 + shift #8 0.251 + cd /osmo-ttcn3-hacks #8 0.251 + git fetch #8 0.295 + git checkout master #8 0.325 Already on 'master' #8 0.325 Your branch is up to date with 'origin/master'. #8 0.325 + git symbolic-ref -q HEAD #8 0.326 refs/heads/master #8 0.326 + git reset --hard origin/master #8 0.329 HEAD is now at 2d00ff39 ggsn: testenv: replace dummy netdev with bridge #8 0.329 + git rev-parse --abbrev-ref HEAD #8 0.330 master #8 0.330 + git rev-parse HEAD #8 0.331 2d00ff393d38f569a817c50ea1d94f16a38c2e50 #8 0.331 + diff -q /tmp/deps-Makefile deps/Makefile #8 0.332 Files /tmp/deps-Makefile and deps/Makefile differ #8 0.332 + make -j8 deps #8 0.413 make: Nothing to be done for 'deps'. #8 0.414 + ln -sv /osmo-ttcn3-hacks/ttcn3-dumpcap-start.sh /ttcn3-dumpcap-start.sh #8 0.415 '/ttcn3-dumpcap-start.sh' -> '/osmo-ttcn3-hacks/ttcn3-dumpcap-start.sh' #8 0.416 + ln -sv /osmo-ttcn3-hacks/ttcn3-tcpdump-start.sh /ttcn3-tcpdump-start.sh #8 0.417 '/ttcn3-tcpdump-start.sh' -> '/osmo-ttcn3-hacks/ttcn3-tcpdump-start.sh' #8 0.417 + ln -sv /osmo-ttcn3-hacks/ttcn3-dumpcap-stop.sh /ttcn3-dumpcap-stop.sh #8 0.418 '/ttcn3-dumpcap-stop.sh' -> '/osmo-ttcn3-hacks/ttcn3-dumpcap-stop.sh' #8 0.419 + ln -sv /osmo-ttcn3-hacks/ttcn3-tcpdump-stop.sh /ttcn3-tcpdump-stop.sh #8 0.420 '/ttcn3-tcpdump-stop.sh' -> '/osmo-ttcn3-hacks/ttcn3-tcpdump-stop.sh' #8 0.420 + make hnbgw #8 0.545 (cd hnbgw && ./gen_links.sh && ./regen_makefile.sh) #8 0.552 Linking TCCInterface_Functions.ttcn #8 0.554 Linking TCCConversion_Functions.ttcn #8 0.557 Linking TCCConversion.cc #8 0.559 Linking TCCInterface.cc #8 0.562 Linking TCCInterface_ip.h #8 0.564 Linking TCCEncoding_Functions.ttcn #8 0.566 Linking TCCEncoding.cc #8 0.569 Linking Socket_API_Definitions.ttcn #8 0.571 Linking MobileL3_CC_Types.ttcn #8 0.574 Linking MobileL3_CommonIE_Types.ttcn #8 0.576 Linking MobileL3_GMM_SM_Types.ttcn #8 0.578 Linking MobileL3_MM_Types.ttcn #8 0.581 Linking MobileL3_RRM_Types.ttcn #8 0.583 Linking MobileL3_SMS_Types.ttcn #8 0.585 Linking MobileL3_SS_Types.ttcn #8 0.587 Linking MobileL3_Types.ttcn #8 0.589 Linking IPL4asp_Functions.ttcn #8 0.591 Linking IPL4asp_PT.cc #8 0.593 Linking IPL4asp_PT.hh #8 0.595 Linking IPL4asp_PortType.ttcn #8 0.597 Linking IPL4asp_Types.ttcn #8 0.599 Linking IPL4asp_discovery.cc #8 0.601 Linking IPL4asp_protocol_L234.hh #8 0.603 Linking M3UA_Emulation.ttcn #8 0.605 Linking MTP3asp_PortType.ttcn #8 0.606 Linking MTP3asp_Types.ttcn #8 0.608 Linking SCCP_Emulation.ttcn #8 0.611 Linking SCCP_Mapping.ttcnpp #8 0.613 Linking SCCP_Types.ttcn #8 0.614 Linking SCCPasp_Types.ttcn #8 0.616 Linking BSSAP_Types.ttcn #8 0.619 Linking M3UA_Types.ttcn #8 0.621 Linking SCTPasp_PT.cc #8 0.623 Linking SCTPasp_PT.hh #8 0.625 Linking SCTPasp_PortType.ttcn #8 0.627 Linking SCTPasp_Types.ttcn #8 0.628 Linking M3UA_Emulation.ttcn #8 0.631 Linking UD_PT.cc #8 0.633 Linking UD_PT.hh #8 0.636 Linking UD_PortType.ttcn #8 0.638 Linking UD_Types.ttcn #8 0.640 Linking SDP_EncDec.cc #8 0.642 Linking SDP_Types.ttcn #8 0.645 Linking SDP_parse_.tab.c #8 0.647 Linking SDP_parse_.tab.h #8 0.649 Linking SDP_parse_parser.h #8 0.651 Linking SDP_parser.l #8 0.653 Linking SDP_parser.y #8 0.655 Linking lex.SDP_parse_.c #8 0.658 Linking RTP_EncDec.cc #8 0.660 Linking RTP_Types.ttcn #8 0.662 Linking TELNETasp_PT.cc #8 0.664 Linking TELNETasp_PT.hh #8 0.666 Linking TELNETasp_PortType.ttcn #8 0.669 Linking PFCP_Types.ttcn #8 0.671 Linking HNBAP_CommonDataTypes.asn #8 0.673 Linking HNBAP_Constants.asn #8 0.676 Linking HNBAP_Containers.asn #8 0.678 Linking HNBAP_IEs.asn #8 0.680 Linking HNBAP_PDU_Contents.asn #8 0.682 Linking HNBAP_PDU_Descriptions.asn #8 0.684 Linking HNBAP_EncDec.cc #8 0.687 Linking HNBAP_Types.ttcn #8 0.689 Linking HNBAP_Templates.ttcn #8 0.691 Linking RUA_CommonDataTypes.asn #8 0.694 Linking RUA_Constants.asn #8 0.696 Linking RUA_Containers.asn #8 0.698 Linking RUA_IEs.asn #8 0.701 Linking RUA_PDU_Contents.asn #8 0.703 Linking RUA_PDU_Descriptions.asn #8 0.705 Linking RUA_EncDec.cc #8 0.708 Linking RUA_Types.ttcn #8 0.710 Linking RUA_Templates.ttcn #8 0.712 Linking RUA_Emulation.ttcn #8 0.715 Linking RANAP_CommonDataTypes.asn #8 0.717 Linking RANAP_Constants.asn #8 0.719 Linking RANAP_Containers.asn #8 0.722 Linking RANAP_IEs.asn #8 0.724 Linking RANAP_PDU_Contents.asn #8 0.726 Linking RANAP_PDU_Descriptions.asn #8 0.729 Linking RANAP_Types.ttcn #8 0.731 Linking RANAP_Templates.ttcn #8 0.734 Linking RANAP_CodecPort.ttcn #8 0.736 Linking RANAP_EncDec.cc #8 0.739 Linking Iuh_Types.ttcn #8 0.741 Linking Iuh_CodecPort.ttcn #8 0.743 Linking Iuh_CodecPort_CtrlFunctDef.cc #8 0.746 Linking Iuh_CodecPort_CtrlFunct.ttcn #8 0.748 Linking Iuh_Emulation.ttcn #8 0.750 Linking DNS_Helpers.ttcn #8 0.753 Linking SDP_Templates.ttcn #8 0.755 Linking MGCP_Emulation.ttcn #8 0.757 Linking MGCP_Types.ttcn #8 0.760 Linking MGCP_Templates.ttcn #8 0.762 Linking MGCP_CodecPort.ttcn #8 0.764 Linking MGCP_CodecPort_CtrlFunct.ttcn #8 0.767 Linking MGCP_CodecPort_CtrlFunctDef.cc #8 0.769 Linking RAN_Adapter.ttcnpp #8 0.771 Linking RAN_Emulation.ttcnpp #8 0.774 Linking BSSAP_CodecPort.ttcn #8 0.776 Linking SCCP_Templates.ttcn #8 0.778 Linking PFCP_CodecPort.ttcn #8 0.780 Linking PFCP_CodecPort_CtrlFunct.ttcn #8 0.783 Linking PFCP_CodecPort_CtrlFunctDef.cc #8 0.785 Linking PFCP_Emulation.ttcn #8 0.787 Linking PFCP_Templates.ttcn #8 0.790 Linking Misc_Helpers.ttcn #8 0.792 Linking General_Types.ttcn #8 0.794 Linking Osmocom_Types.ttcn #8 0.796 Linking GSM_Types.ttcn #8 0.798 Linking Osmocom_VTY_Functions.ttcn #8 0.801 Linking Native_Functions.ttcn #8 0.803 Linking Native_FunctionDefs.cc #8 0.805 Linking IPA_Types.ttcn #8 0.808 Linking IPA_CodecPort.ttcn #8 0.810 Linking IPA_CodecPort_CtrlFunct.ttcn #8 0.812 Linking IPA_CodecPort_CtrlFunctDef.cc #8 0.814 Linking IPA_Emulation.ttcnpp #8 0.816 Linking Osmocom_CTRL_Types.ttcn #8 0.818 Linking Osmocom_CTRL_Functions.ttcn #8 0.821 Linking Osmocom_CTRL_Adapter.ttcn #8 0.823 Linking RTP_CodecPort.ttcn #8 0.825 Linking RTP_CodecPort_CtrlFunct.ttcn #8 0.827 Linking RTP_CodecPort_CtrlFunctDef.cc #8 0.829 Linking RTP_Emulation.ttcn #8 0.832 Linking IuUP_Types.ttcn #8 0.834 Linking IuUP_EncDec.cc #8 0.836 Linking IuUP_Emulation.ttcn #8 0.838 Linking StatsD_Types.ttcn #8 0.840 Linking StatsD_CodecPort.ttcn #8 0.842 Linking StatsD_CodecPort_CtrlFunct.ttcn #8 0.845 Linking StatsD_CodecPort_CtrlFunctdef.cc #8 0.847 Linking StatsD_Checker.ttcnpp #8 0.849 Linking L3_Templates.ttcn #8 0.851 Linking L3_Common.ttcn #8 0.853 Linking SCTP_Templates.ttcn #8 0.903 Generating Makefile skeleton... #8 0.904 Makefile skeleton was generated. #8 0.969 make -C hnbgw compile #8 0.976 make[1]: Entering directory '/osmo-ttcn3-hacks/hnbgw' #8 0.976 cpp -x c -nostdinc -DIPA_EMULATION_CTRL -DRAN_EMULATION_RANAP -DSTATSD_HAVE_VTY -DUSE_MTP3_DISTRIBUTOR IPA_Emulation.ttcnpp IPA_Emulation.ttcn #8 0.984 cpp -x c -nostdinc -DIPA_EMULATION_CTRL -DRAN_EMULATION_RANAP -DSTATSD_HAVE_VTY -DUSE_MTP3_DISTRIBUTOR RAN_Adapter.ttcnpp RAN_Adapter.ttcn #8 0.998 cpp -x c -nostdinc -DIPA_EMULATION_CTRL -DRAN_EMULATION_RANAP -DSTATSD_HAVE_VTY -DUSE_MTP3_DISTRIBUTOR RAN_Emulation.ttcnpp RAN_Emulation.ttcn #8 1.008 cpp -x c -nostdinc -DIPA_EMULATION_CTRL -DRAN_EMULATION_RANAP -DSTATSD_HAVE_VTY -DUSE_MTP3_DISTRIBUTOR SCCP_Mapping.ttcnpp SCCP_Mapping.ttcn #8 1.017 SCCP_Mapping.ttcnpp:49:4: warning: missing terminating " character #8 1.017 49 | "internal user MTP3asp_PT #8 1.017 | ^ #8 1.017 SCCP_Mapping.ttcnpp:58:4: warning: missing terminating " character #8 1.017 58 | " #8 1.017 | ^ #8 1.017 SCCP_Mapping.ttcnpp:70:4: warning: missing terminating " character #8 1.017 70 | "user MTP3asp_PT #8 1.017 | ^ #8 1.017 SCCP_Mapping.ttcnpp:79:4: warning: missing terminating " character #8 1.017 79 | " #8 1.017 | ^ #8 1.020 cpp -x c -nostdinc -DIPA_EMULATION_CTRL -DRAN_EMULATION_RANAP -DSTATSD_HAVE_VTY -DUSE_MTP3_DISTRIBUTOR StatsD_Checker.ttcnpp StatsD_Checker.ttcn #8 1.045 /usr/bin/ttcn3_compiler -L -U 8 BSSAP_CodecPort.ttcn BSSAP_Types.ttcn DNS_Helpers.ttcn GSM_Types.ttcn General_Types.ttcn HNBAP_Templates.ttcn HNBAP_Types.ttcn HNBGW_Tests.ttcn IPA_CodecPort.ttcn IPA_CodecPort_CtrlFunct.ttcn IPA_Types.ttcn IPL4asp_Functions.ttcn IPL4asp_PortType.ttcn IPL4asp_Types.ttcn IuUP_Emulation.ttcn IuUP_Types.ttcn Iuh_CodecPort.ttcn Iuh_CodecPort_CtrlFunct.ttcn Iuh_Emulation.ttcn Iuh_Types.ttcn L3_Common.ttcn L3_Templates.ttcn M3UA_Emulation.ttcn M3UA_Types.ttcn MGCP_CodecPort.ttcn MGCP_CodecPort_CtrlFunct.ttcn MGCP_Emulation.ttcn MGCP_Templates.ttcn MGCP_Types.ttcn MTP3asp_PortType.ttcn MTP3asp_Types.ttcn Misc_Helpers.ttcn MobileL3_CC_Types.ttcn MobileL3_CommonIE_Types.ttcn MobileL3_GMM_SM_Types.ttcn MobileL3_MM_Types.ttcn MobileL3_RRM_Types.ttcn MobileL3_SMS_Types.ttcn MobileL3_SS_Types.ttcn MobileL3_Types.ttcn Native_Functions.ttcn Osmocom_CTRL_Adapter.ttcn Osmocom_CTRL_Functions.ttcn Osmocom_CTRL_Types.ttcn Osmocom_Types.ttcn Osmocom_VTY_Functions.ttcn PFCP_CodecPort.ttcn PFCP_CodecPort_CtrlFunct.ttcn PFCP_Emulation.ttcn PFCP_Templates.ttcn PFCP_Types.ttcn RANAP_CodecPort.ttcn RANAP_Templates.ttcn RANAP_Types.ttcn RTP_CodecPort.ttcn RTP_CodecPort_CtrlFunct.ttcn RTP_Emulation.ttcn RTP_Types.ttcn RUA_Emulation.ttcn RUA_Templates.ttcn RUA_Types.ttcn SCCP_Emulation.ttcn SCCP_Templates.ttcn SCCP_Types.ttcn SCCPasp_Types.ttcn SCTP_Templates.ttcn SCTPasp_PortType.ttcn SCTPasp_Types.ttcn SDP_Templates.ttcn SDP_Types.ttcn Socket_API_Definitions.ttcn StatsD_CodecPort.ttcn StatsD_CodecPort_CtrlFunct.ttcn StatsD_Types.ttcn TCCConversion_Functions.ttcn TCCEncoding_Functions.ttcn TCCInterface_Functions.ttcn TELNETasp_PortType.ttcn UD_PortType.ttcn UD_Types.ttcn IPA_Emulation.ttcn RAN_Adapter.ttcn RAN_Emulation.ttcn SCCP_Mapping.ttcn StatsD_Checker.ttcn HNBAP_CommonDataTypes.asn HNBAP_Constants.asn HNBAP_Containers.asn HNBAP_IEs.asn HNBAP_PDU_Contents.asn HNBAP_PDU_Descriptions.asn RANAP_CommonDataTypes.asn RANAP_Constants.asn RANAP_Containers.asn RANAP_IEs.asn RANAP_PDU_Contents.asn RANAP_PDU_Descriptions.asn RUA_CommonDataTypes.asn RUA_Constants.asn RUA_Containers.asn RUA_IEs.asn RUA_PDU_Contents.asn RUA_PDU_Descriptions.asn - BSSAP_CodecPort.ttcn BSSAP_Types.ttcn DNS_Helpers.ttcn GSM_Types.ttcn General_Types.ttcn HNBAP_Templates.ttcn HNBAP_Types.ttcn HNBGW_Tests.ttcn IPA_CodecPort.ttcn IPA_CodecPort_CtrlFunct.ttcn IPA_Types.ttcn IPL4asp_Functions.ttcn IPL4asp_PortType.ttcn IPL4asp_Types.ttcn IuUP_Emulation.ttcn IuUP_Types.ttcn Iuh_CodecPort.ttcn Iuh_CodecPort_CtrlFunct.ttcn Iuh_Emulation.ttcn Iuh_Types.ttcn L3_Common.ttcn L3_Templates.ttcn M3UA_Emulation.ttcn M3UA_Types.ttcn MGCP_CodecPort.ttcn MGCP_CodecPort_CtrlFunct.ttcn MGCP_Emulation.ttcn MGCP_Templates.ttcn MGCP_Types.ttcn MTP3asp_PortType.ttcn MTP3asp_Types.ttcn Misc_Helpers.ttcn MobileL3_CC_Types.ttcn MobileL3_CommonIE_Types.ttcn MobileL3_GMM_SM_Types.ttcn MobileL3_MM_Types.ttcn MobileL3_RRM_Types.ttcn MobileL3_SMS_Types.ttcn MobileL3_SS_Types.ttcn MobileL3_Types.ttcn Native_Functions.ttcn Osmocom_CTRL_Adapter.ttcn Osmocom_CTRL_Functions.ttcn Osmocom_CTRL_Types.ttcn Osmocom_Types.ttcn Osmocom_VTY_Functions.ttcn PFCP_CodecPort.ttcn PFCP_CodecPort_CtrlFunct.ttcn PFCP_Emulation.ttcn PFCP_Templates.ttcn PFCP_Types.ttcn RANAP_CodecPort.ttcn RANAP_Templates.ttcn RANAP_Types.ttcn RTP_CodecPort.ttcn RTP_CodecPort_CtrlFunct.ttcn RTP_Emulation.ttcn RTP_Types.ttcn RUA_Emulation.ttcn RUA_Templates.ttcn RUA_Types.ttcn SCCP_Emulation.ttcn SCCP_Templates.ttcn SCCP_Types.ttcn SCCPasp_Types.ttcn SCTP_Templates.ttcn SCTPasp_PortType.ttcn SCTPasp_Types.ttcn SDP_Templates.ttcn SDP_Types.ttcn Socket_API_Definitions.ttcn StatsD_CodecPort.ttcn StatsD_CodecPort_CtrlFunct.ttcn StatsD_Types.ttcn TCCConversion_Functions.ttcn TCCEncoding_Functions.ttcn TCCInterface_Functions.ttcn TELNETasp_PortType.ttcn UD_PortType.ttcn UD_Types.ttcn IPA_Emulation.ttcn RAN_Adapter.ttcn RAN_Emulation.ttcn SCCP_Mapping.ttcn StatsD_Checker.ttcn HNBAP_CommonDataTypes.asn HNBAP_Constants.asn HNBAP_Containers.asn HNBAP_IEs.asn HNBAP_PDU_Contents.asn HNBAP_PDU_Descriptions.asn RANAP_CommonDataTypes.asn RANAP_Constants.asn RANAP_Containers.asn RANAP_IEs.asn RANAP_PDU_Contents.asn RANAP_PDU_Descriptions.asn RUA_CommonDataTypes.asn RUA_Constants.asn RUA_Containers.asn RUA_IEs.asn RUA_PDU_Contents.asn RUA_PDU_Descriptions.asn #8 1.052 warning: Charstring pattern: Environment variable TTCN3_DIR not present. Case-insensitive universal charstring patterns are disabled. #8 1.052 #8 1.064 Notify: Parsing TTCN-3 module `BSSAP_CodecPort.ttcn'... #8 1.065 Notify: Parsing TTCN-3 module `BSSAP_Types.ttcn'... #8 1.068 Notify: Parsing TTCN-3 module `DNS_Helpers.ttcn'... #8 1.069 Notify: Parsing TTCN-3 module `GSM_Types.ttcn'... #8 1.070 Notify: Parsing TTCN-3 module `General_Types.ttcn'... #8 1.070 Notify: Parsing TTCN-3 module `HNBAP_Templates.ttcn'... #8 1.070 Notify: Parsing TTCN-3 module `HNBAP_Types.ttcn'... #8 1.070 Notify: Parsing TTCN-3 module `HNBGW_Tests.ttcn'... #8 1.076 Notify: Parsing TTCN-3 module `IPA_CodecPort.ttcn'... #8 1.076 Notify: Parsing TTCN-3 module `IPA_CodecPort_CtrlFunct.ttcn'... #8 1.076 Notify: Parsing TTCN-3 module `IPA_Types.ttcn'... #8 1.076 Notify: Parsing TTCN-3 module `IPL4asp_Functions.ttcn'... #8 1.076 Notify: Parsing TTCN-3 module `IPL4asp_PortType.ttcn'... #8 1.077 Notify: Parsing TTCN-3 module `IPL4asp_Types.ttcn'... #8 1.077 Notify: Parsing TTCN-3 module `IuUP_Emulation.ttcn'... #8 1.077 Notify: Parsing TTCN-3 module `IuUP_Types.ttcn'... #8 1.078 Notify: Parsing TTCN-3 module `Iuh_CodecPort.ttcn'... #8 1.078 Notify: Parsing TTCN-3 module `Iuh_CodecPort_CtrlFunct.ttcn'... #8 1.078 Notify: Parsing TTCN-3 module `Iuh_Emulation.ttcn'... #8 1.078 Notify: Parsing TTCN-3 module `Iuh_Types.ttcn'... #8 1.078 Notify: Parsing TTCN-3 module `L3_Common.ttcn'... #8 1.079 Notify: Parsing TTCN-3 module `L3_Templates.ttcn'... #8 1.083 Notify: Parsing TTCN-3 module `M3UA_Emulation.ttcn'... #8 1.084 Notify: Parsing TTCN-3 module `M3UA_Types.ttcn'... #8 1.085 Notify: Parsing TTCN-3 module `MGCP_CodecPort.ttcn'... #8 1.086 Notify: Parsing TTCN-3 module `MGCP_CodecPort_CtrlFunct.ttcn'... #8 1.086 Notify: Parsing TTCN-3 module `MGCP_Emulation.ttcn'... #8 1.087 Notify: Parsing TTCN-3 module `MGCP_Templates.ttcn'... #8 1.087 Notify: Parsing TTCN-3 module `MGCP_Types.ttcn'... #8 1.087 Notify: Parsing TTCN-3 module `MTP3asp_PortType.ttcn'... #8 1.087 Notify: Parsing TTCN-3 module `MTP3asp_Types.ttcn'... #8 1.088 Notify: Parsing TTCN-3 module `Misc_Helpers.ttcn'... #8 1.088 Notify: Parsing TTCN-3 module `MobileL3_CC_Types.ttcn'... #8 1.089 Notify: Parsing TTCN-3 module `MobileL3_CommonIE_Types.ttcn'... #8 1.090 Notify: Parsing TTCN-3 module `MobileL3_GMM_SM_Types.ttcn'... #8 1.093 Notify: Parsing TTCN-3 module `MobileL3_MM_Types.ttcn'... #8 1.093 Notify: Parsing TTCN-3 module `MobileL3_RRM_Types.ttcn'... #8 1.095 Notify: Parsing TTCN-3 module `MobileL3_SMS_Types.ttcn'... #8 1.096 Notify: Parsing TTCN-3 module `MobileL3_SS_Types.ttcn'... #8 1.096 Notify: Parsing TTCN-3 module `MobileL3_Types.ttcn'... #8 1.096 Notify: Parsing TTCN-3 module `Native_Functions.ttcn'... #8 1.096 Notify: Parsing TTCN-3 module `Osmocom_CTRL_Adapter.ttcn'... #8 1.097 Notify: Parsing TTCN-3 module `Osmocom_CTRL_Functions.ttcn'... #8 1.098 Notify: Parsing TTCN-3 module `Osmocom_CTRL_Types.ttcn'... #8 1.098 Osmocom_CTRL_Types.ttcn:26.39-88: In character string pattern: #8 1.098 Osmocom_CTRL_Types.ttcn:26.44-45: warning: Use of unrecognized escape sequence `\{' is deprecated #8 1.098 Osmocom_CTRL_Types.ttcn:26.46-47: warning: Use of unrecognized escape sequence `\}' is deprecated #8 1.098 Notify: Parsing TTCN-3 module `Osmocom_Types.ttcn'... #8 1.099 Notify: Parsing TTCN-3 module `Osmocom_VTY_Functions.ttcn'... #8 1.099 Notify: Parsing TTCN-3 module `PFCP_CodecPort.ttcn'... #8 1.099 Notify: Parsing TTCN-3 module `PFCP_CodecPort_CtrlFunct.ttcn'... #8 1.099 Notify: Parsing TTCN-3 module `PFCP_Emulation.ttcn'... #8 1.100 Notify: Parsing TTCN-3 module `PFCP_Templates.ttcn'... #8 1.102 Notify: Parsing TTCN-3 module `PFCP_Types.ttcn'... #8 1.104 Notify: Parsing TTCN-3 module `RANAP_CodecPort.ttcn'... #8 1.105 Notify: Parsing TTCN-3 module `RANAP_Templates.ttcn'... #8 1.107 Notify: Parsing TTCN-3 module `RANAP_Types.ttcn'... #8 1.107 Notify: Parsing TTCN-3 module `RTP_CodecPort.ttcn'... #8 1.107 Notify: Parsing TTCN-3 module `RTP_CodecPort_CtrlFunct.ttcn'... #8 1.107 Notify: Parsing TTCN-3 module `RTP_Emulation.ttcn'... #8 1.108 Notify: Parsing TTCN-3 module `RTP_Types.ttcn'... #8 1.109 Notify: Parsing TTCN-3 module `RUA_Emulation.ttcn'... #8 1.110 Notify: Parsing TTCN-3 module `RUA_Templates.ttcn'... #8 1.110 Notify: Parsing TTCN-3 module `RUA_Types.ttcn'... #8 1.110 Notify: Parsing TTCN-3 module `SCCP_Emulation.ttcn'... #8 1.112 SCCP_Emulation.ttcn:1828.40: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.112 SCCP_Emulation.ttcn:2237.44-52: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.112 SCCP_Emulation.ttcn:2270.44-52: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.113 SCCP_Emulation.ttcn:3521.41-49: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:4915.44: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5020.33-41: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5347.9-20: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5348.41-52: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5350.41-52: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5405.7-18: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.115 SCCP_Emulation.ttcn:5407.7-18: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.118 Notify: Parsing TTCN-3 module `SCCP_Templates.ttcn'... #8 1.118 SCCP_Templates.ttcn:85.44: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.119 Notify: Parsing TTCN-3 module `SCCP_Types.ttcn'... #8 1.119 SCCP_Types.ttcn:522.5-8: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.119 SCCP_Types.ttcn:702.5-8: warning: Keyword 'class' is treated as an identifier. Activate compiler option '-k' to use object-oriented features. #8 1.120 Notify: Parsing TTCN-3 module `SCCPasp_Types.ttcn'... #8 1.121 Notify: Parsing TTCN-3 module `SCTP_Templates.ttcn'... #8 1.121 Notify: Parsing TTCN-3 module `SCTPasp_PortType.ttcn'... #8 1.121 Notify: Parsing TTCN-3 module `SCTPasp_Types.ttcn'... #8 1.121 Notify: Parsing TTCN-3 module `SDP_Templates.ttcn'... #8 1.122 Notify: Parsing TTCN-3 module `SDP_Types.ttcn'... #8 1.122 Notify: Parsing TTCN-3 module `Socket_API_Definitions.ttcn'... #8 1.123 Notify: Parsing TTCN-3 module `StatsD_CodecPort.ttcn'... #8 1.123 Notify: Parsing TTCN-3 module `StatsD_CodecPort_CtrlFunct.ttcn'... #8 1.123 Notify: Parsing TTCN-3 module `StatsD_Types.ttcn'... #8 1.123 Notify: Parsing TTCN-3 module `TCCConversion_Functions.ttcn'... #8 1.124 Notify: Parsing TTCN-3 module `TCCEncoding_Functions.ttcn'... #8 1.125 Notify: Parsing TTCN-3 module `TCCInterface_Functions.ttcn'... #8 1.125 Notify: Parsing TTCN-3 module `TELNETasp_PortType.ttcn'... #8 1.125 Notify: Parsing TTCN-3 module `UD_PortType.ttcn'... #8 1.125 Notify: Parsing TTCN-3 module `UD_Types.ttcn'... #8 1.125 Notify: Parsing TTCN-3 module `IPA_Emulation.ttcn'... #8 1.126 Notify: Parsing TTCN-3 module `RAN_Adapter.ttcn'... #8 1.127 Notify: Parsing TTCN-3 module `RAN_Emulation.ttcn'... #8 1.129 Notify: Parsing TTCN-3 module `SCCP_Mapping.ttcn'... #8 1.129 Notify: Parsing TTCN-3 module `StatsD_Checker.ttcn'... #8 1.130 Notify: Parsing ASN.1 module `HNBAP_CommonDataTypes.asn'... #8 1.130 HNBAP_CommonDataTypes.asn:29: warning: Missing IMPORTS clause is interpreted as `IMPORTS ;' (import nothing) instead of importing all symbols from all modules. #8 1.130 Notify: Parsing ASN.1 module `HNBAP_Constants.asn'... #8 1.130 Notify: Parsing ASN.1 module `HNBAP_Containers.asn'... #8 1.130 Notify: Parsing ASN.1 module `HNBAP_IEs.asn'... #8 1.130 Notify: Parsing ASN.1 module `HNBAP_PDU_Contents.asn'... #8 1.131 Notify: Parsing ASN.1 module `HNBAP_PDU_Descriptions.asn'... #8 1.131 Notify: Parsing ASN.1 module `RANAP_CommonDataTypes.asn'... #8 1.131 RANAP_CommonDataTypes.asn:23: warning: Missing IMPORTS clause is interpreted as `IMPORTS ;' (import nothing) instead of importing all symbols from all modules. #8 1.131 Notify: Parsing ASN.1 module `RANAP_Constants.asn'... #8 1.131 RANAP_Constants.asn:28: warning: Missing IMPORTS clause is interpreted as `IMPORTS ;' (import nothing) instead of importing all symbols from all modules. #8 1.132 Notify: Parsing ASN.1 module `RANAP_Containers.asn'... #8 1.132 Notify: Parsing ASN.1 module `RANAP_IEs.asn'... #8 1.135 Notify: Parsing ASN.1 module `RANAP_PDU_Contents.asn'... #8 1.138 Notify: Parsing ASN.1 module `RANAP_PDU_Descriptions.asn'... #8 1.138 Notify: Parsing ASN.1 module `RUA_CommonDataTypes.asn'... #8 1.138 RUA_CommonDataTypes.asn:28: warning: Missing IMPORTS clause is interpreted as `IMPORTS ;' (import nothing) instead of importing all symbols from all modules. #8 1.138 Notify: Parsing ASN.1 module `RUA_Constants.asn'... #8 1.138 Notify: Parsing ASN.1 module `RUA_Containers.asn'... #8 1.139 Notify: Parsing ASN.1 module `RUA_IEs.asn'... #8 1.139 Notify: Parsing ASN.1 module `RUA_PDU_Contents.asn'... #8 1.139 Notify: Parsing ASN.1 module `RUA_PDU_Descriptions.asn'... #8 1.139 Notify: Checking modules... #8 1.141 RAN_Adapter.ttcn: In TTCN-3 module `RAN_Adapter': #8 1.141 RAN_Adapter.ttcnpp:40.1-54.1: warning: Definition with name `RAN_Adapter' hides a module identifier #8 1.162 HNBAP_Templates.ttcn: In TTCN-3 module `HNBAP_Templates': #8 1.162 HNBAP_Templates.ttcn:236.1-267.1: In template definition `tr_HNBAP_UERegisterRequest': #8 1.162 HNBAP_Templates.ttcn:238.23-266.2: In template for union field `initiatingMessage': #8 1.162 HNBAP_Templates.ttcn:241.13-265.3: In template for record field `value_': #8 1.162 HNBAP_Templates.ttcn:242.25-264.4: In template for union field `uERegisterRequest': #8 1.162 HNBAP_Templates.ttcn:243.20-262.5: In template for record field `protocolIEs': #8 1.162 HNBAP_Templates.ttcn:252.9-261.6: In component 3: #8 1.162 HNBAP_Templates.ttcn:255.17-260.7: In template for record field `value_': #8 1.162 HNBAP_Templates.ttcn:256.27-259.8: In template for union field `uE__Capabilities': #8 1.162 HNBAP_Templates.ttcn:256.27-259.8: warning: Field `iE-Extensions' is missing from template for record type `@HNBAP-IEs.UE-Capabilities' #8 1.165 Iuh_Emulation.ttcn: In TTCN-3 module `Iuh_Emulation': #8 1.165 Iuh_Emulation.ttcn:127.1-208.1: In function definition `main': #8 1.165 Iuh_Emulation.ttcn:151.2-207.2: In while statement: #8 1.165 Iuh_Emulation.ttcn:157.3-206.3: In alt construct: #8 1.165 Iuh_Emulation.ttcn:170.6-51: In guard operation: #8 1.165 Iuh_Emulation.ttcn:170.6-51: In receive statement: #8 1.165 Iuh_Emulation.ttcn:170.18-37: warning: Function invocation 'tr_Iuh_RecvFrom_R(?)' may change the actual snapshot. #8 1.181 MGCP_Types.ttcn: In TTCN-3 module `MGCP_Types': #8 1.181 MGCP_Types.ttcn:50.2-55.2: In type definition `MgcpCommandLine': #8 1.181 warning: Charstring pattern: Duplicate character `\r' in the character set. Please note the \n includes the \r implicitly. Use \q{0,0,0,10} if you would like to match the LF only. #8 1.181 MGCP_Types.ttcn:60.2-63.2: In type definition `MgcpParameter': #8 1.181 warning: Charstring pattern: Duplicate character `\r' in the character set. Please note the \n includes the \r implicitly. Use \q{0,0,0,10} if you would like to match the LF only. #8 1.181 MGCP_Types.ttcn:73.2-77.2: In type definition `MgcpCommand': #8 1.181 warning: Charstring pattern: Duplicate character `\r' in the character set. Please note the \n includes the \r implicitly. Use \q{0,0,0,10} if you would like to match the LF only. #8 1.181 MGCP_Types.ttcn:87.2-91.2: In type definition `MgcpResponseLine': #8 1.181 warning: Charstring pattern: Duplicate character `\r' in the character set. Please note the \n includes the \r implicitly. Use \q{0,0,0,10} if you would like to match the LF only. #8 1.181 MGCP_Types.ttcn:96.2-100.2: In type definition `MgcpResponse': #8 1.181 warning: Charstring pattern: Duplicate character `\r' in the character set. Please note the \n includes the \r implicitly. Use \q{0,0,0,10} if you would like to match the LF only. #8 1.184 MGCP_Emulation.ttcn: In TTCN-3 module `MGCP_Emulation': #8 1.184 MGCP_Emulation.ttcn:261.1-372.1: In function definition `main': #8 1.184 MGCP_Emulation.ttcn:280.2-371.2: In while statement: #8 1.184 MGCP_Emulation.ttcn:290.3-369.3: In alt construct: #8 1.184 MGCP_Emulation.ttcn:315.6-53: In guard operation: #8 1.184 MGCP_Emulation.ttcn:315.6-53: In receive statement: #8 1.184 MGCP_Emulation.ttcn:315.19-39: warning: Function invocation 'tr_MGCP_RecvFrom_R(?)' may change the actual snapshot. #8 1.192 PFCP_Emulation.ttcn: In TTCN-3 module `PFCP_Emulation': #8 1.192 PFCP_Emulation.ttcn:104.9-120.1: In function definition `f_PFCPEM_conn_for_pdu': #8 1.192 PFCP_Emulation.ttcn:109.2-112.2: In if statement: #8 1.192 PFCP_Emulation.ttcn:110.3-47: In function instance: #8 1.192 PFCP_Emulation.ttcn:110.3-47: warning: The value returned by function `@PFCP_Emulation.f_PFCPEM_conns_seqnr_del' is not used #8 1.192 PFCP_Emulation.ttcn:232.1-309.1: In function definition `main': #8 1.192 PFCP_Emulation.ttcn:240.2-308.2: In while statement: #8 1.192 PFCP_Emulation.ttcn:241.3-307.3: In alt construct: #8 1.192 PFCP_Emulation.ttcn:279.5-58: In function instance: #8 1.192 PFCP_Emulation.ttcn:279.5-58: warning: The value returned by function `@PFCP_Emulation.f_PFCPEM_conns_seqnr_add' is not used #8 1.236 RAN_Emulation.ttcn: In TTCN-3 module `RAN_Emulation': #8 1.236 RAN_Emulation.ttcnpp:1409.1-1445.1: In function definition `RanapExpectedCreateCallback': #8 1.236 RAN_Emulation.ttcnpp:1416.2-1424.2: In if statement: #8 1.236 RAN_Emulation.ttcnpp:1419.3-1423.3: In if statement: #8 1.236 RAN_Emulation.ttcnpp:1422.4-13: warning: Control never reaches this statement #8 1.236 RAN_Emulation.ttcnpp:1444.2-11: warning: Control never reaches this statement #8 1.239 HNBGW_Tests.ttcn: In TTCN-3 module `HNBGW_Tests': #8 1.239 HNBGW_Tests.ttcn:702.1-714.1: In function definition `f_iuh2iu': #8 1.239 HNBGW_Tests.ttcn:713.2-30: In return statement: #8 1.239 HNBGW_Tests.ttcn:713.23-30: In actual parameter list of function `@HNBGW_Tests.f_bssap_expect': #8 1.239 HNBGW_Tests.ttcn:713.24-29: In parameter #1 for `exp_rx': #8 1.239 HNBGW_Tests.ttcn:713.24-29: warning: Inadequate restriction on the referenced template parameter `exp_rx', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:702.52-84: note: Referenced template parameter is here #8 1.239 HNBGW_Tests.ttcn:717.1-726.1: In function definition `f_iu2iuh': #8 1.239 HNBGW_Tests.ttcn:725.2-28: In return statement: #8 1.239 HNBGW_Tests.ttcn:725.21-28: In actual parameter list of function `@HNBGW_Tests.f_rua_expect': #8 1.239 HNBGW_Tests.ttcn:725.22-27: In parameter #1 for `exp_rx': #8 1.239 HNBGW_Tests.ttcn:725.22-27: warning: Inadequate restriction on the referenced template parameter `exp_rx', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:717.52-84: note: Referenced template parameter is here #8 1.239 HNBGW_Tests.ttcn:752.1-779.1: In function definition `f_iuh2iu_connect': #8 1.239 HNBGW_Tests.ttcn:778.2-30: In return statement: #8 1.239 HNBGW_Tests.ttcn:778.23-30: In actual parameter list of function `@HNBGW_Tests.f_bssap_expect': #8 1.239 HNBGW_Tests.ttcn:778.24-29: In parameter #1 for `exp_rx': #8 1.239 HNBGW_Tests.ttcn:778.24-29: warning: Inadequate restriction on the referenced template parameter `exp_rx', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:752.60-92: note: Referenced template parameter is here #8 1.239 HNBGW_Tests.ttcn:795.1-824.1: In function definition `f_iuh2iu_disconnect': #8 1.239 HNBGW_Tests.ttcn:809.2-29: In variable assignment: #8 1.239 HNBGW_Tests.ttcn:809.22-29: In actual parameter list of function `@HNBGW_Tests.f_bssap_expect': #8 1.239 HNBGW_Tests.ttcn:809.23-28: In parameter #1 for `exp_rx': #8 1.239 HNBGW_Tests.ttcn:809.23-28: warning: Inadequate restriction on the referenced template parameter `exp_rx', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:796.9-41: note: Referenced template parameter is here #8 1.239 HNBGW_Tests.ttcn:901.8-907.1: In function definition `f_build_rab_ass_resp': #8 1.239 HNBGW_Tests.ttcn:906.2-45: In return statement: #8 1.239 HNBGW_Tests.ttcn:906.9-45: In the operand of operation `valueof()': #8 1.239 HNBGW_Tests.ttcn:906.36-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.239 HNBGW_Tests.ttcn:906.37-43: In parameter #1 for `rab_sml': #8 1.239 HNBGW_Tests.ttcn:906.37-43: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:902.39-45: note: Referenced template variable is here #8 1.239 HNBGW_Tests.ttcn:951.1-980.1: In function definition `f_hnbap_ue_register': #8 1.239 HNBGW_Tests.ttcn:955.2-55: In send statement: #8 1.239 HNBGW_Tests.ttcn:955.48-54: In actual parameter list of template `@HNBAP_Templates.ts_HNBAP_UERegisterRequest': #8 1.239 HNBGW_Tests.ttcn:955.49-53: In parameter #1 for `ue_id': #8 1.239 HNBGW_Tests.ttcn:955.49-53: warning: Inadequate restriction on the referenced template parameter `ue_id', this may cause a dynamic test case error at runtime #8 1.239 HNBGW_Tests.ttcn:951.52-87: note: Referenced template parameter is here #8 1.239 HNBGW_Tests.ttcn:1210.8-1214.1: In function definition `f_tc_initial_ue': #8 1.239 HNBGW_Tests.ttcn:1213.2-21: In function instance: #8 1.239 HNBGW_Tests.ttcn:1213.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.240 HNBGW_Tests.ttcn:1432.8-1435.1: In function definition `f_create_rab': #8 1.240 HNBGW_Tests.ttcn:1433.2-20: In function instance: #8 1.240 HNBGW_Tests.ttcn:1437.8-1467.1: In function definition `f_rab_ass_req': #8 1.240 HNBGW_Tests.ttcn:1445.2-43: In variable assignment: #8 1.240 HNBGW_Tests.ttcn:1445.8-43: In the operand of operation `valueof()': #8 1.240 HNBGW_Tests.ttcn:1445.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.240 HNBGW_Tests.ttcn:1445.35-41: In parameter #1 for `rab_sml': #8 1.240 HNBGW_Tests.ttcn:1445.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.240 HNBGW_Tests.ttcn:1440.37-43: note: Referenced template variable is here #8 1.240 HNBGW_Tests.ttcn:1464.2-43: In variable assignment: #8 1.240 HNBGW_Tests.ttcn:1464.8-43: In the operand of operation `valueof()': #8 1.240 HNBGW_Tests.ttcn:1464.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.240 HNBGW_Tests.ttcn:1464.35-41: In parameter #1 for `rab_sml': #8 1.240 HNBGW_Tests.ttcn:1464.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.240 HNBGW_Tests.ttcn:1440.37-43: note: Referenced template variable is here #8 1.240 HNBGW_Tests.ttcn:1466.2-17: In function instance: #8 1.240 HNBGW_Tests.ttcn:1466.2-17: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.240 HNBGW_Tests.ttcn:1434.2-21: In function instance: #8 1.240 HNBGW_Tests.ttcn:1469.8-1529.1: In function definition `f_rab_ass_resp': #8 1.240 HNBGW_Tests.ttcn:1476.2-45: In variable assignment: #8 1.240 HNBGW_Tests.ttcn:1476.8-45: In the operand of operation `valueof()': #8 1.240 HNBGW_Tests.ttcn:1476.35-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.240 HNBGW_Tests.ttcn:1476.36-43: In parameter #1 for `rab_sml': #8 1.240 HNBGW_Tests.ttcn:1476.36-43: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.240 HNBGW_Tests.ttcn:1472.39-46: note: Referenced template variable is here #8 1.241 HNBGW_Tests.ttcn:1479.2-1522.2: In interleave statement: #8 1.241 HNBGW_Tests.ttcn:1501.3-1513.3: In if statement: #8 1.241 HNBGW_Tests.ttcn:1505.4-45: In variable assignment: #8 1.241 HNBGW_Tests.ttcn:1505.10-45: In the operand of operation `valueof()': #8 1.241 HNBGW_Tests.ttcn:1505.36-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.241 HNBGW_Tests.ttcn:1505.37-43: In parameter #1 for `rab_sml': #8 1.241 HNBGW_Tests.ttcn:1505.37-43: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.241 HNBGW_Tests.ttcn:1502.39-45: note: Referenced template variable is here #8 1.241 HNBGW_Tests.ttcn:1507.4-19: In function instance: #8 1.241 HNBGW_Tests.ttcn:1507.4-19: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1510.4-47: In variable assignment: #8 1.241 HNBGW_Tests.ttcn:1510.10-47: In the operand of operation `valueof()': #8 1.241 HNBGW_Tests.ttcn:1510.37-46: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.241 HNBGW_Tests.ttcn:1510.38-45: In parameter #1 for `rab_sml': #8 1.241 HNBGW_Tests.ttcn:1510.38-45: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.241 HNBGW_Tests.ttcn:1472.39-46: note: Referenced template variable is here #8 1.241 HNBGW_Tests.ttcn:1526.2-45: In variable assignment: #8 1.241 HNBGW_Tests.ttcn:1526.8-45: In the operand of operation `valueof()': #8 1.241 HNBGW_Tests.ttcn:1526.35-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.241 HNBGW_Tests.ttcn:1526.36-43: In parameter #1 for `rab_sml': #8 1.241 HNBGW_Tests.ttcn:1526.36-43: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.241 HNBGW_Tests.ttcn:1472.39-46: note: Referenced template variable is here #8 1.241 HNBGW_Tests.ttcn:1528.2-19: In function instance: #8 1.241 HNBGW_Tests.ttcn:1528.2-19: warning: The value returned by function `@HNBGW_Tests.f_bssap_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1545.8-1590.1: In function definition `f_tc_rab_assignment': #8 1.241 HNBGW_Tests.ttcn:1557.2-21: In function instance: #8 1.241 HNBGW_Tests.ttcn:1557.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.241 HNBGW_Tests.ttcn:1565.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1565.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1574.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1574.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1578.2-13: In function instance: #8 1.241 HNBGW_Tests.ttcn:1578.2-13: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.241 HNBGW_Tests.ttcn:1589.2-13: In function instance: #8 1.241 HNBGW_Tests.ttcn:1589.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.241 HNBGW_Tests.ttcn:1603.8-1646.1: In function definition `f_tc_rab_assign_fail': #8 1.241 HNBGW_Tests.ttcn:1615.2-21: In function instance: #8 1.241 HNBGW_Tests.ttcn:1615.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.241 HNBGW_Tests.ttcn:1623.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1623.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1629.2-13: In function instance: #8 1.241 HNBGW_Tests.ttcn:1629.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.241 HNBGW_Tests.ttcn:1636.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1636.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1659.8-1708.1: In function definition `f_tc_rab_release': #8 1.241 HNBGW_Tests.ttcn:1671.2-21: In function instance: #8 1.241 HNBGW_Tests.ttcn:1671.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.241 HNBGW_Tests.ttcn:1686.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1686.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.241 HNBGW_Tests.ttcn:1695.2-24: In function instance: #8 1.241 HNBGW_Tests.ttcn:1695.2-24: warning: The value returned by function `@StatsD_Checker.f_statsd_expect' is not used #8 1.242 HNBGW_Tests.ttcn:1707.2-17: In function instance: #8 1.242 HNBGW_Tests.ttcn:1707.2-17: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.242 HNBGW_Tests.ttcn:1735.8-1772.1: In function definition `f_tc_rab_assign_mgcp_to': #8 1.242 HNBGW_Tests.ttcn:1746.2-21: In function instance: #8 1.242 HNBGW_Tests.ttcn:1746.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.242 HNBGW_Tests.ttcn:1751.2-43: In variable assignment: #8 1.242 HNBGW_Tests.ttcn:1751.8-43: In the operand of operation `valueof()': #8 1.242 HNBGW_Tests.ttcn:1751.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.242 HNBGW_Tests.ttcn:1751.35-41: In parameter #1 for `rab_sml': #8 1.242 HNBGW_Tests.ttcn:1751.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.242 HNBGW_Tests.ttcn:1738.37-43: note: Referenced template variable is here #8 1.242 HNBGW_Tests.ttcn:1768.2-13: In function instance: #8 1.242 HNBGW_Tests.ttcn:1768.2-13: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.242 HNBGW_Tests.ttcn:1771.2-13: In function instance: #8 1.242 HNBGW_Tests.ttcn:1771.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.242 HNBGW_Tests.ttcn:1803.8-1816.1: In function definition `f_tc_ranap_bidir': #8 1.242 HNBGW_Tests.ttcn:1807.2-45: In function instance: #8 1.242 HNBGW_Tests.ttcn:1807.2-45: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.242 HNBGW_Tests.ttcn:1810.2-55: In function instance: #8 1.242 HNBGW_Tests.ttcn:1810.2-55: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.242 HNBGW_Tests.ttcn:1812.2-55: In function instance: #8 1.242 HNBGW_Tests.ttcn:1812.2-55: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.242 HNBGW_Tests.ttcn:1815.2-48: In function instance: #8 1.242 HNBGW_Tests.ttcn:1815.2-48: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.242 HNBGW_Tests.ttcn:1839.9-1852.1: In function definition `f_tc_ranap_mo_disconnect': #8 1.242 HNBGW_Tests.ttcn:1843.2-45: In function instance: #8 1.242 HNBGW_Tests.ttcn:1843.2-45: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.242 HNBGW_Tests.ttcn:1846.2-55: In function instance: #8 1.242 HNBGW_Tests.ttcn:1846.2-55: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.242 HNBGW_Tests.ttcn:1848.2-55: In function instance: #8 1.242 HNBGW_Tests.ttcn:1848.2-55: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.242 HNBGW_Tests.ttcn:1851.2-91: In function instance: #8 1.242 HNBGW_Tests.ttcn:1851.2-91: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_disconnect' is not used #8 1.243 HNBGW_Tests.ttcn:1944.8-2042.1: In function definition `f_tc_ps_rab_assignment_with_pfcp': #8 1.243 HNBGW_Tests.ttcn:1970.2-21: In function instance: #8 1.243 HNBGW_Tests.ttcn:1970.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.243 HNBGW_Tests.ttcn:1977.2-43: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:1977.8-43: In the operand of operation `valueof()': #8 1.243 HNBGW_Tests.ttcn:1977.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.243 HNBGW_Tests.ttcn:1977.35-41: In parameter #1 for `rab_sml': #8 1.243 HNBGW_Tests.ttcn:1977.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1973.37-43: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:1997.27-1998.36: In template variable definition `pdr1': #8 1.243 HNBGW_Tests.ttcn:1997.54-1998.36: In actual parameter list of template `@PFCP_Templates.ts_PFCP_Created_PDR': #8 1.243 In parameter #2 for `local_F_TEID': #8 1.243 HNBGW_Tests.ttcn:1998.29-35: warning: Inadequate restriction on the referenced template variable `f_teid1', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1993.22-1994.48: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:1999.27-2000.36: In template variable definition `pdr2': #8 1.243 HNBGW_Tests.ttcn:1999.54-2000.36: In actual parameter list of template `@PFCP_Templates.ts_PFCP_Created_PDR': #8 1.243 In parameter #2 for `local_F_TEID': #8 1.243 HNBGW_Tests.ttcn:2000.29-35: warning: Inadequate restriction on the referenced template variable `f_teid2', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1995.22-1996.50: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2001.24-2005.39: In template variable definition `r': #8 1.243 HNBGW_Tests.ttcn:2001.53-2005.39: In actual parameter list of template `@PFCP_Templates.ts_PFCP_Session_Est_Resp': #8 1.243 In parameter #4 for `f_seid': #8 1.243 HNBGW_Tests.ttcn:2004.22-30: warning: Inadequate restriction on the referenced template variable `up_f_seid', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1992.22-88: note: Referenced template variable is here #8 1.243 In parameter #5 for `created_pdr': #8 1.243 HNBGW_Tests.ttcn:2005.28-31: warning: Inadequate restriction on the referenced template variable `pdr1', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1997.27-1998.36: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2005.34-37: warning: Inadequate restriction on the referenced template variable `pdr2', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1999.27-2000.36: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2011.2-43: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2011.8-43: In the operand of operation `valueof()': #8 1.243 HNBGW_Tests.ttcn:2011.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.243 HNBGW_Tests.ttcn:2011.35-41: In parameter #1 for `rab_sml': #8 1.243 HNBGW_Tests.ttcn:2011.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1973.37-43: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2012.2-17: In function instance: #8 1.243 HNBGW_Tests.ttcn:2012.2-17: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.243 HNBGW_Tests.ttcn:2018.2-45: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2018.8-45: In the operand of operation `valueof()': #8 1.243 HNBGW_Tests.ttcn:2018.35-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.243 HNBGW_Tests.ttcn:2018.36-43: In parameter #1 for `rab_sml': #8 1.243 HNBGW_Tests.ttcn:2018.36-43: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:2015.39-46: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2021.2-60: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2021.20-60: In actual parameter list of function `@HNBGW_Tests.f_pfcp_expect': #8 1.243 HNBGW_Tests.ttcn:2021.21-59: In parameter #1 for `exp_rx': #8 1.243 HNBGW_Tests.ttcn:2021.44-59: In actual parameter list of template `@PFCP_Templates.tr_PFCP_Session_Mod_Req': #8 1.243 HNBGW_Tests.ttcn:2021.45-58: In parameter #1 for `seid': #8 1.243 HNBGW_Tests.ttcn:2021.45-58: warning: Inadequate restriction on the referenced template variable `up_f_seid.seid', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1992.22-88: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2026.2-46: In function instance: #8 1.243 HNBGW_Tests.ttcn:2026.16-46: In actual parameter list of function `@HNBGW_Tests.f_bssap_expect': #8 1.243 HNBGW_Tests.ttcn:2026.17-45: In parameter #1 for `exp_rx': #8 1.243 HNBGW_Tests.ttcn:2026.17-45: warning: Inadequate restriction on the referenced function `tr_RANAP_RabAssResp(rab_smdl, -, -)', this may cause a dynamic test case error at runtime #8 1.243 RANAP_Templates.ttcn:1764.1-1826.1: note: Referenced function is here #8 1.243 HNBGW_Tests.ttcn:2026.2-46: warning: The value returned by function `@HNBGW_Tests.f_bssap_expect' is not used #8 1.243 HNBGW_Tests.ttcn:2030.2-13: In function instance: #8 1.243 HNBGW_Tests.ttcn:2030.2-13: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.243 HNBGW_Tests.ttcn:2033.2-13: In function instance: #8 1.243 HNBGW_Tests.ttcn:2033.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.243 HNBGW_Tests.ttcn:2035.2-60: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2035.20-60: In actual parameter list of function `@HNBGW_Tests.f_pfcp_expect': #8 1.243 HNBGW_Tests.ttcn:2035.21-59: In parameter #1 for `exp_rx': #8 1.243 HNBGW_Tests.ttcn:2035.44-59: In actual parameter list of template `@PFCP_Templates.tr_PFCP_Session_Del_Req': #8 1.243 HNBGW_Tests.ttcn:2035.45-58: In parameter #1 for `seid': #8 1.243 HNBGW_Tests.ttcn:2035.45-58: warning: Inadequate restriction on the referenced template variable `up_f_seid.seid', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:1992.22-88: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2064.8-2108.1: In function definition `f_tc_ps_rab_assignment_without_pfcp': #8 1.243 HNBGW_Tests.ttcn:2076.2-21: In function instance: #8 1.243 HNBGW_Tests.ttcn:2076.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.243 HNBGW_Tests.ttcn:2083.2-43: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2083.8-43: In the operand of operation `valueof()': #8 1.243 HNBGW_Tests.ttcn:2083.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.243 HNBGW_Tests.ttcn:2083.35-41: In parameter #1 for `rab_sml': #8 1.243 HNBGW_Tests.ttcn:2083.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:2079.37-43: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2087.2-43: In variable assignment: #8 1.243 HNBGW_Tests.ttcn:2087.8-43: In the operand of operation `valueof()': #8 1.243 HNBGW_Tests.ttcn:2087.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.243 HNBGW_Tests.ttcn:2087.35-41: In parameter #1 for `rab_sml': #8 1.243 HNBGW_Tests.ttcn:2087.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.243 HNBGW_Tests.ttcn:2079.37-43: note: Referenced template variable is here #8 1.243 HNBGW_Tests.ttcn:2088.2-17: In function instance: #8 1.243 HNBGW_Tests.ttcn:2088.2-17: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.244 HNBGW_Tests.ttcn:2094.2-45: In variable assignment: #8 1.244 HNBGW_Tests.ttcn:2094.8-45: In the operand of operation `valueof()': #8 1.244 HNBGW_Tests.ttcn:2094.35-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.244 HNBGW_Tests.ttcn:2094.36-43: In parameter #1 for `rab_sml': #8 1.244 HNBGW_Tests.ttcn:2094.36-43: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.244 HNBGW_Tests.ttcn:2091.39-46: note: Referenced template variable is here #8 1.244 HNBGW_Tests.ttcn:2098.2-46: In function instance: #8 1.244 HNBGW_Tests.ttcn:2098.16-46: In actual parameter list of function `@HNBGW_Tests.f_bssap_expect': #8 1.244 HNBGW_Tests.ttcn:2098.17-45: In parameter #1 for `exp_rx': #8 1.244 HNBGW_Tests.ttcn:2098.17-45: warning: Inadequate restriction on the referenced function `tr_RANAP_RabAssResp(rab_smdl, -, -)', this may cause a dynamic test case error at runtime #8 1.244 RANAP_Templates.ttcn:1764.1-1826.1: note: Referenced function is here #8 1.244 HNBGW_Tests.ttcn:2098.2-46: warning: The value returned by function `@HNBGW_Tests.f_bssap_expect' is not used #8 1.244 HNBGW_Tests.ttcn:2102.2-13: In function instance: #8 1.244 HNBGW_Tests.ttcn:2102.2-13: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.244 HNBGW_Tests.ttcn:2105.2-13: In function instance: #8 1.244 HNBGW_Tests.ttcn:2105.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.244 HNBGW_Tests.ttcn:2176.9-2195.1: In function definition `f_perform_compl_l3': #8 1.244 HNBGW_Tests.ttcn:2191.2-2194.2: In if statement: #8 1.244 HNBGW_Tests.ttcn:2193.3-20: In function instance: #8 1.244 HNBGW_Tests.ttcn:2193.3-20: warning: The value returned by function `@HNBGW_Tests.f_bssap_expect' is not used #8 1.247 HNBGW_Tests.ttcn:2897.9-2924.1: In function definition `f_tc_apply_sccp': #8 1.247 HNBGW_Tests.ttcn:2910.2-55: In function instance: #8 1.247 HNBGW_Tests.ttcn:2910.2-55: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.247 HNBGW_Tests.ttcn:2911.2-55: In function instance: #8 1.247 HNBGW_Tests.ttcn:2911.2-55: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.247 HNBGW_Tests.ttcn:2941.8-2992.1: In function definition `f_tc_second_rab_assignment': #8 1.247 HNBGW_Tests.ttcn:2950.2-21: In function instance: #8 1.247 HNBGW_Tests.ttcn:2950.2-21: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu_connect' is not used #8 1.247 HNBGW_Tests.ttcn:2961.2-43: In variable assignment: #8 1.247 HNBGW_Tests.ttcn:2961.8-43: In the operand of operation `valueof()': #8 1.247 HNBGW_Tests.ttcn:2961.34-42: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssReq': #8 1.247 HNBGW_Tests.ttcn:2961.35-41: In parameter #1 for `rab_sml': #8 1.247 HNBGW_Tests.ttcn:2961.35-41: warning: Inadequate restriction on the referenced template variable `rab_sml', this may cause a dynamic test case error at runtime #8 1.247 HNBGW_Tests.ttcn:2956.37-43: note: Referenced template variable is here #8 1.247 HNBGW_Tests.ttcn:2966.2-17: In function instance: #8 1.247 HNBGW_Tests.ttcn:2966.2-17: warning: The value returned by function `@HNBGW_Tests.f_rua_expect' is not used #8 1.247 HNBGW_Tests.ttcn:2974.2-45: In variable assignment: #8 1.247 HNBGW_Tests.ttcn:2974.8-45: In the operand of operation `valueof()': #8 1.247 HNBGW_Tests.ttcn:2974.35-44: In actual parameter list of function `@RANAP_Templates.ts_RANAP_RabAssResp': #8 1.247 HNBGW_Tests.ttcn:2974.36-43: In parameter #1 for `rab_sml': #8 1.247 HNBGW_Tests.ttcn:2974.36-43: warning: Inadequate restriction on the referenced template variable `rab_smdl', this may cause a dynamic test case error at runtime #8 1.247 HNBGW_Tests.ttcn:2972.39-46: note: Referenced template variable is here #8 1.247 HNBGW_Tests.ttcn:2976.2-19: In function instance: #8 1.247 HNBGW_Tests.ttcn:2976.2-19: warning: The value returned by function `@HNBGW_Tests.f_bssap_expect' is not used #8 1.247 HNBGW_Tests.ttcn:2980.2-13: In function instance: #8 1.247 HNBGW_Tests.ttcn:2980.2-13: warning: The value returned by function `@HNBGW_Tests.f_iu2iuh' is not used #8 1.247 HNBGW_Tests.ttcn:2991.2-13: In function instance: #8 1.247 HNBGW_Tests.ttcn:2991.2-13: warning: The value returned by function `@HNBGW_Tests.f_iuh2iu' is not used #8 1.248 IuUP_Emulation.ttcn: In TTCN-3 module `IuUP_Emulation': #8 1.248 IuUP_Emulation.ttcn:150.9-190.1: In function definition `f_ts_IuUP_INIT': #8 1.248 IuUP_Emulation.ttcn:179.2-187.3: In template definition `tpl': #8 1.248 IuUP_Emulation.ttcn:179.84-187.3: In actual parameter list of template `@IuUP_Types.ts_IuUP_PDU14_ProcSending_INIT': #8 1.248 In parameter #4 for `rfci': #8 1.248 IuUP_Emulation.ttcn:183.11-14: warning: Inadequate restriction on the referenced template variable `rfci', this may cause a dynamic test case error at runtime #8 1.248 IuUP_Emulation.ttcn:154.36-47: note: Referenced template variable is here #8 1.251 Notify: Generating code... #8 1.754 Notify: File `BSSAP_CodecPort.hh' was generated. #8 1.754 Notify: File `BSSAP_CodecPort.cc' was generated. #8 1.754 Notify: File `BSSAP_CodecPort_part_1.cc' was generated. #8 1.754 Notify: File `BSSAP_CodecPort_part_2.cc' was generated. #8 1.754 Notify: File `BSSAP_CodecPort_part_3.cc' was generated. #8 1.754 Notify: File `BSSAP_CodecPort_part_4.cc' was generated. #8 1.755 Notify: File `BSSAP_CodecPort_part_5.cc' was generated. #8 1.755 Notify: File `BSSAP_CodecPort_part_6.cc' was generated. #8 1.755 Notify: File `BSSAP_CodecPort_part_7.cc' was generated. #8 1.755 Notify: File `BSSAP_Types.hh' was generated. #8 1.758 Notify: File `BSSAP_Types.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_1.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_2.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_3.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_4.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_5.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_6.cc' was generated. #8 1.762 Notify: File `BSSAP_Types_part_7.cc' was generated. #8 1.762 Notify: File `DNS_Helpers.hh' was generated. #8 1.762 Notify: File `DNS_Helpers.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_1.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_2.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_3.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_4.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_5.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_6.cc' was generated. #8 1.762 Notify: File `DNS_Helpers_part_7.cc' was generated. #8 1.762 Notify: File `GSM_Types.hh' was generated. #8 1.762 Notify: File `GSM_Types.cc' was generated. #8 1.762 Notify: File `GSM_Types_part_1.cc' was generated. #8 1.762 Notify: File `GSM_Types_part_2.cc' was generated. #8 1.762 Notify: File `GSM_Types_part_3.cc' was generated. #8 1.762 Notify: File `GSM_Types_part_4.cc' was generated. #8 1.763 Notify: File `GSM_Types_part_5.cc' was generated. #8 1.763 Notify: File `GSM_Types_part_6.cc' was generated. #8 1.763 Notify: File `GSM_Types_part_7.cc' was generated. #8 1.763 Notify: File `General_Types.hh' was generated. #8 1.763 Notify: File `General_Types.cc' was generated. #8 1.763 Notify: File `General_Types_part_1.cc' was generated. #8 1.763 Notify: File `General_Types_part_2.cc' was generated. #8 1.763 Notify: File `General_Types_part_3.cc' was generated. #8 1.763 Notify: File `General_Types_part_4.cc' was generated. #8 1.763 Notify: File `General_Types_part_5.cc' was generated. #8 1.763 Notify: File `General_Types_part_6.cc' was generated. #8 1.763 Notify: File `General_Types_part_7.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes.hh' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_1.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_2.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_3.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_4.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_5.cc' was generated. #8 1.763 Notify: File `HNBAP_CommonDataTypes_part_6.cc' was generated. #8 1.764 Notify: File `HNBAP_CommonDataTypes_part_7.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants.hh' was generated. #8 1.764 Notify: File `HNBAP_Constants.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_1.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_2.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_3.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_4.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_5.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_6.cc' was generated. #8 1.764 Notify: File `HNBAP_Constants_part_7.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers.hh' was generated. #8 1.764 Notify: File `HNBAP_Containers.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_1.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_2.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_3.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_4.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_5.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_6.cc' was generated. #8 1.764 Notify: File `HNBAP_Containers_part_7.cc' was generated. #8 1.765 Notify: File `HNBAP_IEs.hh' was generated. #8 1.767 Notify: File `HNBAP_IEs.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_1.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_2.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_3.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_4.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_5.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_6.cc' was generated. #8 1.767 Notify: File `HNBAP_IEs_part_7.cc' was generated. #8 1.768 Notify: File `HNBAP_PDU_Contents.hh' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_1.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_2.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_3.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_4.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_5.cc' was generated. #8 1.771 Notify: File `HNBAP_PDU_Contents_part_6.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Contents_part_7.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions.hh' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_1.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_2.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_3.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_4.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_5.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_6.cc' was generated. #8 1.772 Notify: File `HNBAP_PDU_Descriptions_part_7.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates.hh' was generated. #8 1.772 Notify: File `HNBAP_Templates.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_1.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_2.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_3.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_4.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_5.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_6.cc' was generated. #8 1.772 Notify: File `HNBAP_Templates_part_7.cc' was generated. #8 1.772 Notify: File `HNBAP_Types.hh' was generated. #8 1.772 Notify: File `HNBAP_Types.cc' was generated. #8 1.772 Notify: File `HNBAP_Types_part_1.cc' was generated. #8 1.772 Notify: File `HNBAP_Types_part_2.cc' was generated. #8 1.773 Notify: File `HNBAP_Types_part_3.cc' was generated. #8 1.773 Notify: File `HNBAP_Types_part_4.cc' was generated. #8 1.773 Notify: File `HNBAP_Types_part_5.cc' was generated. #8 1.773 Notify: File `HNBAP_Types_part_6.cc' was generated. #8 1.773 Notify: File `HNBAP_Types_part_7.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests.hh' was generated. #8 1.773 Notify: File `HNBGW_Tests.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_1.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_2.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_3.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_4.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_5.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_6.cc' was generated. #8 1.773 Notify: File `HNBGW_Tests_part_7.cc' was generated. #8 1.773 Notify: File `IPA_CodecPort.hh' was generated. #8 1.774 Notify: File `IPA_CodecPort.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct.hh' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_1.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_2.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_3.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_4.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_5.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_6.cc' was generated. #8 1.774 Notify: File `IPA_CodecPort_part_7.cc' was generated. #8 1.774 Notify: File `IPA_Emulation.hh' was generated. #8 1.774 Notify: File `IPA_Emulation.cc' was generated. #8 1.774 Notify: File `IPA_Emulation_part_1.cc' was generated. #8 1.774 Notify: File `IPA_Emulation_part_2.cc' was generated. #8 1.774 Notify: File `IPA_Emulation_part_3.cc' was generated. #8 1.774 Notify: File `IPA_Emulation_part_4.cc' was generated. #8 1.775 Notify: File `IPA_Emulation_part_5.cc' was generated. #8 1.775 Notify: File `IPA_Emulation_part_6.cc' was generated. #8 1.775 Notify: File `IPA_Emulation_part_7.cc' was generated. #8 1.775 Notify: File `IPA_Types.hh' was generated. #8 1.775 Notify: File `IPA_Types.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_1.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_2.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_3.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_4.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_5.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_6.cc' was generated. #8 1.775 Notify: File `IPA_Types_part_7.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions.hh' was generated. #8 1.775 Notify: File `IPL4asp_Functions.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_1.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_2.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_3.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_4.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_5.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_6.cc' was generated. #8 1.775 Notify: File `IPL4asp_Functions_part_7.cc' was generated. #8 1.775 Notify: File `IPL4asp_PortType.hh' was generated. #8 1.776 Notify: File `IPL4asp_PortType.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_1.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_2.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_3.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_4.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_5.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_6.cc' was generated. #8 1.776 Notify: File `IPL4asp_PortType_part_7.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types.hh' was generated. #8 1.776 Notify: File `IPL4asp_Types.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_1.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_2.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_3.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_4.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_5.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_6.cc' was generated. #8 1.776 Notify: File `IPL4asp_Types_part_7.cc' was generated. #8 1.776 Notify: File `IuUP_Emulation.hh' was generated. #8 1.777 Notify: File `IuUP_Emulation.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_1.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_2.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_3.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_4.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_5.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_6.cc' was generated. #8 1.777 Notify: File `IuUP_Emulation_part_7.cc' was generated. #8 1.777 Notify: File `IuUP_Types.hh' was generated. #8 1.777 Notify: File `IuUP_Types.cc' was generated. #8 1.777 Notify: File `IuUP_Types_part_1.cc' was generated. #8 1.777 Notify: File `IuUP_Types_part_2.cc' was generated. #8 1.777 Notify: File `IuUP_Types_part_3.cc' was generated. #8 1.778 Notify: File `IuUP_Types_part_4.cc' was generated. #8 1.778 Notify: File `IuUP_Types_part_5.cc' was generated. #8 1.778 Notify: File `IuUP_Types_part_6.cc' was generated. #8 1.778 Notify: File `IuUP_Types_part_7.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort.hh' was generated. #8 1.778 Notify: File `Iuh_CodecPort.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct.hh' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_1.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_2.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_3.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_4.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_5.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_6.cc' was generated. #8 1.778 Notify: File `Iuh_CodecPort_part_7.cc' was generated. #8 1.778 Notify: File `Iuh_Emulation.hh' was generated. #8 1.778 Notify: File `Iuh_Emulation.cc' was generated. #8 1.778 Notify: File `Iuh_Emulation_part_1.cc' was generated. #8 1.778 Notify: File `Iuh_Emulation_part_2.cc' was generated. #8 1.778 Notify: File `Iuh_Emulation_part_3.cc' was generated. #8 1.779 Notify: File `Iuh_Emulation_part_4.cc' was generated. #8 1.779 Notify: File `Iuh_Emulation_part_5.cc' was generated. #8 1.779 Notify: File `Iuh_Emulation_part_6.cc' was generated. #8 1.779 Notify: File `Iuh_Emulation_part_7.cc' was generated. #8 1.779 Notify: File `Iuh_Types.hh' was generated. #8 1.779 Notify: File `Iuh_Types.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_1.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_2.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_3.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_4.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_5.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_6.cc' was generated. #8 1.779 Notify: File `Iuh_Types_part_7.cc' was generated. #8 1.779 Notify: File `L3_Common.hh' was generated. #8 1.779 Notify: File `L3_Common.cc' was generated. #8 1.779 Notify: File `L3_Common_part_1.cc' was generated. #8 1.779 Notify: File `L3_Common_part_2.cc' was generated. #8 1.779 Notify: File `L3_Common_part_3.cc' was generated. #8 1.779 Notify: File `L3_Common_part_4.cc' was generated. #8 1.779 Notify: File `L3_Common_part_5.cc' was generated. #8 1.779 Notify: File `L3_Common_part_6.cc' was generated. #8 1.779 Notify: File `L3_Common_part_7.cc' was generated. #8 1.779 Notify: File `L3_Templates.hh' was generated. #8 1.779 Notify: File `L3_Templates.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_1.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_2.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_3.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_4.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_5.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_6.cc' was generated. #8 1.780 Notify: File `L3_Templates_part_7.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation.hh' was generated. #8 1.780 Notify: File `M3UA_Emulation.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_1.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_2.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_3.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_4.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_5.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_6.cc' was generated. #8 1.780 Notify: File `M3UA_Emulation_part_7.cc' was generated. #8 1.780 Notify: File `M3UA_Types.hh' was generated. #8 1.782 Notify: File `M3UA_Types.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_1.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_2.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_3.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_4.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_5.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_6.cc' was generated. #8 1.782 Notify: File `M3UA_Types_part_7.cc' was generated. #8 1.782 Notify: File `MGCP_CodecPort.hh' was generated. #8 1.782 Notify: File `MGCP_CodecPort.cc' was generated. #8 1.782 Notify: File `MGCP_CodecPort_CtrlFunct.hh' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_1.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_2.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_3.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_4.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_5.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_6.cc' was generated. #8 1.783 Notify: File `MGCP_CodecPort_part_7.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation.hh' was generated. #8 1.783 Notify: File `MGCP_Emulation.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_1.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_2.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_3.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_4.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_5.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_6.cc' was generated. #8 1.783 Notify: File `MGCP_Emulation_part_7.cc' was generated. #8 1.784 Notify: File `MGCP_Templates.hh' was generated. #8 1.784 Notify: File `MGCP_Templates.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_1.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_2.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_3.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_4.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_5.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_6.cc' was generated. #8 1.784 Notify: File `MGCP_Templates_part_7.cc' was generated. #8 1.784 Notify: File `MGCP_Types.hh' was generated. #8 1.784 Notify: File `MGCP_Types.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_1.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_2.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_3.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_4.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_5.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_6.cc' was generated. #8 1.784 Notify: File `MGCP_Types_part_7.cc' was generated. #8 1.784 Notify: File `MTP3asp_PortType.hh' was generated. #8 1.784 Notify: File `MTP3asp_PortType.cc' was generated. #8 1.784 Notify: File `MTP3asp_PortType_part_1.cc' was generated. #8 1.784 Notify: File `MTP3asp_PortType_part_2.cc' was generated. #8 1.784 Notify: File `MTP3asp_PortType_part_3.cc' was generated. #8 1.784 Notify: File `MTP3asp_PortType_part_4.cc' was generated. #8 1.785 Notify: File `MTP3asp_PortType_part_5.cc' was generated. #8 1.785 Notify: File `MTP3asp_PortType_part_6.cc' was generated. #8 1.785 Notify: File `MTP3asp_PortType_part_7.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types.hh' was generated. #8 1.785 Notify: File `MTP3asp_Types.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_1.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_2.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_3.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_4.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_5.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_6.cc' was generated. #8 1.785 Notify: File `MTP3asp_Types_part_7.cc' was generated. #8 1.785 Notify: File `Misc_Helpers.hh' was generated. #8 1.785 Notify: File `Misc_Helpers.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_1.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_2.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_3.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_4.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_5.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_6.cc' was generated. #8 1.785 Notify: File `Misc_Helpers_part_7.cc' was generated. #8 1.786 Notify: File `MobileL3_CC_Types.hh' was generated. #8 1.788 Notify: File `MobileL3_CC_Types.cc' was generated. #8 1.788 Notify: File `MobileL3_CC_Types_part_1.cc' was generated. #8 1.788 Notify: File `MobileL3_CC_Types_part_2.cc' was generated. #8 1.789 Notify: File `MobileL3_CC_Types_part_3.cc' was generated. #8 1.789 Notify: File `MobileL3_CC_Types_part_4.cc' was generated. #8 1.789 Notify: File `MobileL3_CC_Types_part_5.cc' was generated. #8 1.789 Notify: File `MobileL3_CC_Types_part_6.cc' was generated. #8 1.789 Notify: File `MobileL3_CC_Types_part_7.cc' was generated. #8 1.789 Notify: File `MobileL3_CommonIE_Types.hh' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_1.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_2.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_3.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_4.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_5.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_6.cc' was generated. #8 1.790 Notify: File `MobileL3_CommonIE_Types_part_7.cc' was generated. #8 1.791 Notify: File `MobileL3_GMM_SM_Types.hh' was generated. #8 1.794 Notify: File `MobileL3_GMM_SM_Types.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_1.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_2.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_3.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_4.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_5.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_6.cc' was generated. #8 1.797 Notify: File `MobileL3_GMM_SM_Types_part_7.cc' was generated. #8 1.797 Notify: File `MobileL3_MM_Types.hh' was generated. #8 1.798 Notify: File `MobileL3_MM_Types.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_1.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_2.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_3.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_4.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_5.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_6.cc' was generated. #8 1.798 Notify: File `MobileL3_MM_Types_part_7.cc' was generated. #8 1.799 Notify: File `MobileL3_RRM_Types.hh' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types.cc' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types_part_1.cc' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types_part_2.cc' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types_part_3.cc' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types_part_4.cc' was generated. #8 1.802 Notify: File `MobileL3_RRM_Types_part_5.cc' was generated. #8 1.803 Notify: File `MobileL3_RRM_Types_part_6.cc' was generated. #8 1.803 Notify: File `MobileL3_RRM_Types_part_7.cc' was generated. #8 1.803 Notify: File `MobileL3_SMS_Types.hh' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_1.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_2.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_3.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_4.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_5.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_6.cc' was generated. #8 1.804 Notify: File `MobileL3_SMS_Types_part_7.cc' was generated. #8 1.804 Notify: File `MobileL3_SS_Types.hh' was generated. #8 1.804 Notify: File `MobileL3_SS_Types.cc' was generated. #8 1.804 Notify: File `MobileL3_SS_Types_part_1.cc' was generated. #8 1.804 Notify: File `MobileL3_SS_Types_part_2.cc' was generated. #8 1.805 Notify: File `MobileL3_SS_Types_part_3.cc' was generated. #8 1.805 Notify: File `MobileL3_SS_Types_part_4.cc' was generated. #8 1.805 Notify: File `MobileL3_SS_Types_part_5.cc' was generated. #8 1.805 Notify: File `MobileL3_SS_Types_part_6.cc' was generated. #8 1.805 Notify: File `MobileL3_SS_Types_part_7.cc' was generated. #8 1.805 Notify: File `MobileL3_Types.hh' was generated. #8 1.805 Notify: File `MobileL3_Types.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_1.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_2.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_3.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_4.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_5.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_6.cc' was generated. #8 1.805 Notify: File `MobileL3_Types_part_7.cc' was generated. #8 1.805 Notify: File `Native_Functions.hh' was generated. #8 1.805 Notify: File `Native_Functions.cc' was generated. #8 1.805 Notify: File `Native_Functions_part_1.cc' was generated. #8 1.805 Notify: File `Native_Functions_part_2.cc' was generated. #8 1.805 Notify: File `Native_Functions_part_3.cc' was generated. #8 1.805 Notify: File `Native_Functions_part_4.cc' was generated. #8 1.806 Notify: File `Native_Functions_part_5.cc' was generated. #8 1.806 Notify: File `Native_Functions_part_6.cc' was generated. #8 1.806 Notify: File `Native_Functions_part_7.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter.hh' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_1.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_2.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_3.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_4.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_5.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_6.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Adapter_part_7.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions.hh' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_1.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_2.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_3.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_4.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_5.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_6.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Functions_part_7.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types.hh' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types_part_1.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types_part_2.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types_part_3.cc' was generated. #8 1.806 Notify: File `Osmocom_CTRL_Types_part_4.cc' was generated. #8 1.807 Notify: File `Osmocom_CTRL_Types_part_5.cc' was generated. #8 1.807 Notify: File `Osmocom_CTRL_Types_part_6.cc' was generated. #8 1.807 Notify: File `Osmocom_CTRL_Types_part_7.cc' was generated. #8 1.807 Notify: File `Osmocom_Types.hh' was generated. #8 1.807 Notify: File `Osmocom_Types.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_1.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_2.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_3.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_4.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_5.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_6.cc' was generated. #8 1.807 Notify: File `Osmocom_Types_part_7.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions.hh' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_1.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_2.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_3.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_4.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_5.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_6.cc' was generated. #8 1.807 Notify: File `Osmocom_VTY_Functions_part_7.cc' was generated. #8 1.807 Notify: File `PFCP_CodecPort.hh' was generated. #8 1.808 Notify: File `PFCP_CodecPort.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct.hh' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_1.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_2.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_3.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_4.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_5.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_6.cc' was generated. #8 1.808 Notify: File `PFCP_CodecPort_part_7.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation.hh' was generated. #8 1.808 Notify: File `PFCP_Emulation.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_1.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_2.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_3.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_4.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_5.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_6.cc' was generated. #8 1.808 Notify: File `PFCP_Emulation_part_7.cc' was generated. #8 1.808 Notify: File `PFCP_Templates.hh' was generated. #8 1.809 Notify: File `PFCP_Templates.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_1.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_2.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_3.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_4.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_5.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_6.cc' was generated. #8 1.809 Notify: File `PFCP_Templates_part_7.cc' was generated. #8 1.810 Notify: File `PFCP_Types.hh' was generated. #8 1.813 Notify: File `PFCP_Types.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_1.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_2.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_3.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_4.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_5.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_6.cc' was generated. #8 1.816 Notify: File `PFCP_Types_part_7.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort.hh' was generated. #8 1.816 Notify: File `RANAP_CodecPort.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_1.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_2.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_3.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_4.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_5.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_6.cc' was generated. #8 1.816 Notify: File `RANAP_CodecPort_part_7.cc' was generated. #8 1.816 Notify: File `RANAP_CommonDataTypes.hh' was generated. #8 1.816 Notify: File `RANAP_CommonDataTypes.cc' was generated. #8 1.816 Notify: File `RANAP_CommonDataTypes_part_1.cc' was generated. #8 1.816 Notify: File `RANAP_CommonDataTypes_part_2.cc' was generated. #8 1.817 Notify: File `RANAP_CommonDataTypes_part_3.cc' was generated. #8 1.817 Notify: File `RANAP_CommonDataTypes_part_4.cc' was generated. #8 1.817 Notify: File `RANAP_CommonDataTypes_part_5.cc' was generated. #8 1.817 Notify: File `RANAP_CommonDataTypes_part_6.cc' was generated. #8 1.817 Notify: File `RANAP_CommonDataTypes_part_7.cc' was generated. #8 1.817 Notify: File `RANAP_Constants.hh' was generated. #8 1.817 Notify: File `RANAP_Constants.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_1.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_2.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_3.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_4.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_5.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_6.cc' was generated. #8 1.817 Notify: File `RANAP_Constants_part_7.cc' was generated. #8 1.817 Notify: File `RANAP_Containers.hh' was generated. #8 1.817 Notify: File `RANAP_Containers.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_1.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_2.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_3.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_4.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_5.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_6.cc' was generated. #8 1.817 Notify: File `RANAP_Containers_part_7.cc' was generated. #8 1.819 Notify: File `RANAP_IEs.hh' was generated. #8 1.822 Notify: File `RANAP_IEs.cc' was generated. #8 1.826 Notify: File `RANAP_IEs_part_1.cc' was generated. #8 1.829 Notify: File `RANAP_IEs_part_2.cc' was generated. #8 1.832 Notify: File `RANAP_IEs_part_3.cc' was generated. #8 1.833 Notify: File `RANAP_IEs_part_4.cc' was generated. #8 1.833 Notify: File `RANAP_IEs_part_5.cc' was generated. #8 1.833 Notify: File `RANAP_IEs_part_6.cc' was generated. #8 1.833 Notify: File `RANAP_IEs_part_7.cc' was generated. #8 1.837 Notify: File `RANAP_PDU_Contents.hh' was generated. #8 1.840 Notify: File `RANAP_PDU_Contents.cc' was generated. #8 1.843 Notify: File `RANAP_PDU_Contents_part_1.cc' was generated. #8 1.846 Notify: File `RANAP_PDU_Contents_part_2.cc' was generated. #8 1.849 Notify: File `RANAP_PDU_Contents_part_3.cc' was generated. #8 1.852 Notify: File `RANAP_PDU_Contents_part_4.cc' was generated. #8 1.855 Notify: File `RANAP_PDU_Contents_part_5.cc' was generated. #8 1.858 Notify: File `RANAP_PDU_Contents_part_6.cc' was generated. #8 1.861 Notify: File `RANAP_PDU_Contents_part_7.cc' was generated. #8 1.861 Notify: File `RANAP_PDU_Descriptions.hh' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_1.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_2.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_3.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_4.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_5.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_6.cc' was generated. #8 1.862 Notify: File `RANAP_PDU_Descriptions_part_7.cc' was generated. #8 1.862 Notify: File `RANAP_Templates.hh' was generated. #8 1.862 Notify: File `RANAP_Templates.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_1.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_2.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_3.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_4.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_5.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_6.cc' was generated. #8 1.862 Notify: File `RANAP_Templates_part_7.cc' was generated. #8 1.862 Notify: File `RANAP_Types.hh' was generated. #8 1.863 Notify: File `RANAP_Types.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_1.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_2.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_3.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_4.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_5.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_6.cc' was generated. #8 1.863 Notify: File `RANAP_Types_part_7.cc' was generated. #8 1.863 Notify: File `RAN_Adapter.hh' was generated. #8 1.863 Notify: File `RAN_Adapter.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_1.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_2.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_3.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_4.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_5.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_6.cc' was generated. #8 1.863 Notify: File `RAN_Adapter_part_7.cc' was generated. #8 1.863 Notify: File `RAN_Emulation.hh' was generated. #8 1.864 Notify: File `RAN_Emulation.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_1.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_2.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_3.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_4.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_5.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_6.cc' was generated. #8 1.864 Notify: File `RAN_Emulation_part_7.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort.hh' was generated. #8 1.864 Notify: File `RTP_CodecPort.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct.hh' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_1.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_2.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_3.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_4.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_5.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_6.cc' was generated. #8 1.864 Notify: File `RTP_CodecPort_part_7.cc' was generated. #8 1.864 Notify: File `RTP_Emulation.hh' was generated. #8 1.865 Notify: File `RTP_Emulation.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_1.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_2.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_3.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_4.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_5.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_6.cc' was generated. #8 1.865 Notify: File `RTP_Emulation_part_7.cc' was generated. #8 1.865 Notify: File `RTP_Types.hh' was generated. #8 1.866 Notify: File `RTP_Types.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_1.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_2.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_3.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_4.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_5.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_6.cc' was generated. #8 1.866 Notify: File `RTP_Types_part_7.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes.hh' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_1.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_2.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_3.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_4.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_5.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_6.cc' was generated. #8 1.867 Notify: File `RUA_CommonDataTypes_part_7.cc' was generated. #8 1.867 Notify: File `RUA_Constants.hh' was generated. #8 1.867 Notify: File `RUA_Constants.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_1.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_2.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_3.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_4.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_5.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_6.cc' was generated. #8 1.867 Notify: File `RUA_Constants_part_7.cc' was generated. #8 1.867 Notify: File `RUA_Containers.hh' was generated. #8 1.867 Notify: File `RUA_Containers.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_1.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_2.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_3.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_4.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_5.cc' was generated. #8 1.867 Notify: File `RUA_Containers_part_6.cc' was generated. #8 1.868 Notify: File `RUA_Containers_part_7.cc' was generated. #8 1.868 Notify: File `RUA_Emulation.hh' was generated. #8 1.868 Notify: File `RUA_Emulation.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_1.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_2.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_3.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_4.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_5.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_6.cc' was generated. #8 1.868 Notify: File `RUA_Emulation_part_7.cc' was generated. #8 1.868 Notify: File `RUA_IEs.hh' was generated. #8 1.869 Notify: File `RUA_IEs.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_1.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_2.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_3.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_4.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_5.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_6.cc' was generated. #8 1.869 Notify: File `RUA_IEs_part_7.cc' was generated. #8 1.869 Notify: File `RUA_PDU_Contents.hh' was generated. #8 1.870 Notify: File `RUA_PDU_Contents.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_1.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_2.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_3.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_4.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_5.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_6.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Contents_part_7.cc' was generated. #8 1.870 Notify: File `RUA_PDU_Descriptions.hh' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_1.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_2.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_3.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_4.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_5.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_6.cc' was generated. #8 1.871 Notify: File `RUA_PDU_Descriptions_part_7.cc' was generated. #8 1.871 Notify: File `RUA_Templates.hh' was generated. #8 1.871 Notify: File `RUA_Templates.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_1.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_2.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_3.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_4.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_5.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_6.cc' was generated. #8 1.871 Notify: File `RUA_Templates_part_7.cc' was generated. #8 1.871 Notify: File `RUA_Types.hh' was generated. #8 1.871 Notify: File `RUA_Types.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_1.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_2.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_3.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_4.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_5.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_6.cc' was generated. #8 1.871 Notify: File `RUA_Types_part_7.cc' was generated. #8 1.871 Notify: File `SCCP_Emulation.hh' was generated. #8 1.872 Notify: File `SCCP_Emulation.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_1.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_2.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_3.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_4.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_5.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_6.cc' was generated. #8 1.872 Notify: File `SCCP_Emulation_part_7.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping.hh' was generated. #8 1.872 Notify: File `SCCP_Mapping.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_1.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_2.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_3.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_4.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_5.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_6.cc' was generated. #8 1.872 Notify: File `SCCP_Mapping_part_7.cc' was generated. #8 1.872 Notify: File `SCCP_Templates.hh' was generated. #8 1.872 Notify: File `SCCP_Templates.cc' was generated. #8 1.872 Notify: File `SCCP_Templates_part_1.cc' was generated. #8 1.872 Notify: File `SCCP_Templates_part_2.cc' was generated. #8 1.872 Notify: File `SCCP_Templates_part_3.cc' was generated. #8 1.872 Notify: File `SCCP_Templates_part_4.cc' was generated. #8 1.873 Notify: File `SCCP_Templates_part_5.cc' was generated. #8 1.873 Notify: File `SCCP_Templates_part_6.cc' was generated. #8 1.873 Notify: File `SCCP_Templates_part_7.cc' was generated. #8 1.873 Notify: File `SCCP_Types.hh' was generated. #8 1.874 Notify: File `SCCP_Types.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_1.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_2.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_3.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_4.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_5.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_6.cc' was generated. #8 1.874 Notify: File `SCCP_Types_part_7.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types.hh' was generated. #8 1.875 Notify: File `SCCPasp_Types.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_1.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_2.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_3.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_4.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_5.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_6.cc' was generated. #8 1.875 Notify: File `SCCPasp_Types_part_7.cc' was generated. #8 1.875 Notify: File `SCTP_Templates.hh' was generated. #8 1.875 Notify: File `SCTP_Templates.cc' was generated. #8 1.875 Notify: File `SCTP_Templates_part_1.cc' was generated. #8 1.875 Notify: File `SCTP_Templates_part_2.cc' was generated. #8 1.876 Notify: File `SCTP_Templates_part_3.cc' was generated. #8 1.876 Notify: File `SCTP_Templates_part_4.cc' was generated. #8 1.876 Notify: File `SCTP_Templates_part_5.cc' was generated. #8 1.876 Notify: File `SCTP_Templates_part_6.cc' was generated. #8 1.876 Notify: File `SCTP_Templates_part_7.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType.hh' was generated. #8 1.876 Notify: File `SCTPasp_PortType.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_1.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_2.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_3.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_4.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_5.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_6.cc' was generated. #8 1.876 Notify: File `SCTPasp_PortType_part_7.cc' was generated. #8 1.876 Notify: File `SCTPasp_Types.hh' was generated. #8 1.876 Notify: File `SCTPasp_Types.cc' was generated. #8 1.876 Notify: File `SCTPasp_Types_part_1.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_2.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_3.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_4.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_5.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_6.cc' was generated. #8 1.877 Notify: File `SCTPasp_Types_part_7.cc' was generated. #8 1.877 Notify: File `SDP_Templates.hh' was generated. #8 1.877 Notify: File `SDP_Templates.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_1.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_2.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_3.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_4.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_5.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_6.cc' was generated. #8 1.877 Notify: File `SDP_Templates_part_7.cc' was generated. #8 1.877 Notify: File `SDP_Types.hh' was generated. #8 1.879 Notify: File `SDP_Types.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_1.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_2.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_3.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_4.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_5.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_6.cc' was generated. #8 1.879 Notify: File `SDP_Types_part_7.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions.hh' was generated. #8 1.880 Notify: File `Socket_API_Definitions.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_1.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_2.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_3.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_4.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_5.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_6.cc' was generated. #8 1.880 Notify: File `Socket_API_Definitions_part_7.cc' was generated. #8 1.880 Notify: File `StatsD_Checker.hh' was generated. #8 1.880 Notify: File `StatsD_Checker.cc' was generated. #8 1.880 Notify: File `StatsD_Checker_part_1.cc' was generated. #8 1.880 Notify: File `StatsD_Checker_part_2.cc' was generated. #8 1.880 Notify: File `StatsD_Checker_part_3.cc' was generated. #8 1.880 Notify: File `StatsD_Checker_part_4.cc' was generated. #8 1.880 Notify: File `StatsD_Checker_part_5.cc' was generated. #8 1.881 Notify: File `StatsD_Checker_part_6.cc' was generated. #8 1.881 Notify: File `StatsD_Checker_part_7.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort.hh' was generated. #8 1.881 Notify: File `StatsD_CodecPort.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct.hh' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_1.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_2.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_3.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_4.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_5.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_6.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_CtrlFunct_part_7.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_1.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_2.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_3.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_4.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_5.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_6.cc' was generated. #8 1.881 Notify: File `StatsD_CodecPort_part_7.cc' was generated. #8 1.881 Notify: File `StatsD_Types.hh' was generated. #8 1.881 Notify: File `StatsD_Types.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_1.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_2.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_3.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_4.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_5.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_6.cc' was generated. #8 1.881 Notify: File `StatsD_Types_part_7.cc' was generated. #8 1.881 Notify: File `TCCConversion_Functions.hh' was generated. #8 1.881 Notify: File `TCCConversion_Functions.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_1.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_2.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_3.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_4.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_5.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_6.cc' was generated. #8 1.882 Notify: File `TCCConversion_Functions_part_7.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions.hh' was generated. #8 1.882 Notify: File `TCCEncoding_Functions.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_1.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_2.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_3.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_4.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_5.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_6.cc' was generated. #8 1.882 Notify: File `TCCEncoding_Functions_part_7.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions.hh' was generated. #8 1.882 Notify: File `TCCInterface_Functions.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_1.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_2.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_3.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_4.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_5.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_6.cc' was generated. #8 1.882 Notify: File `TCCInterface_Functions_part_7.cc' was generated. #8 1.882 Notify: File `TELNETasp_PortType.hh' was generated. #8 1.883 Notify: File `TELNETasp_PortType.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_1.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_2.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_3.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_4.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_5.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_6.cc' was generated. #8 1.883 Notify: File `TELNETasp_PortType_part_7.cc' was generated. #8 1.883 Notify: File `UD_PortType.hh' was generated. #8 1.883 Notify: File `UD_PortType.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_1.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_2.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_3.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_4.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_5.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_6.cc' was generated. #8 1.883 Notify: File `UD_PortType_part_7.cc' was generated. #8 1.883 Notify: File `UD_Types.hh' was generated. #8 1.883 Notify: File `UD_Types.cc' was generated. #8 1.883 Notify: File `UD_Types_part_1.cc' was generated. #8 1.883 Notify: File `UD_Types_part_2.cc' was generated. #8 1.883 Notify: File `UD_Types_part_3.cc' was generated. #8 1.883 Notify: File `UD_Types_part_4.cc' was generated. #8 1.883 Notify: File `UD_Types_part_5.cc' was generated. #8 1.884 Notify: File `UD_Types_part_6.cc' was generated. #8 1.884 Notify: File `UD_Types_part_7.cc' was generated. #8 1.884 Notify: 927 files were updated. #8 1.925 touch compile #8 1.925 make[1]: Leaving directory '/osmo-ttcn3-hacks/hnbgw' #8 1.925 make -j20 -C hnbgw #8 1.942 make[1]: Entering directory '/osmo-ttcn3-hacks/hnbgw' #8 1.995 Creating dependency file for PFCP_CodecPort_CtrlFunctDef.cc #8 1.995 Creating dependency file for UD_PT.cc #8 1.995 Creating dependency file for MGCP_CodecPort_CtrlFunctDef.cc #8 1.995 Creating dependency file for RANAP_EncDec.cc #8 1.995 Creating dependency file for RUA_EncDec.cc #8 1.995 Creating dependency file for HNBAP_EncDec.cc #8 1.995 Creating dependency file for TELNETasp_PT.cc #8 1.996 Creating dependency file for TCCInterface.cc #8 1.996 Creating dependency file for TCCEncoding.cc #8 1.996 Creating dependency file for TCCConversion.cc #8 1.996 Creating dependency file for StatsD_CodecPort_CtrlFunctdef.cc #8 1.996 Creating dependency file for SDP_EncDec.cc #8 1.996 Creating dependency file for SCTPasp_PT.cc #8 1.997 Creating dependency file for RTP_EncDec.cc #8 1.997 Creating dependency file for RTP_CodecPort_CtrlFunctDef.cc #8 1.997 Creating dependency file for Native_FunctionDefs.cc #8 1.997 Creating dependency file for Iuh_CodecPort_CtrlFunctDef.cc #8 1.998 Creating dependency file for IuUP_EncDec.cc #8 1.998 Creating dependency file for IPL4asp_discovery.cc #8 2.007 Creating dependency file for IPL4asp_PT.cc #8 2.014 Creating dependency file for IPA_CodecPort_CtrlFunctDef.cc #8 2.049 Creating dependency file for lex.SDP_parse_.c #8 2.052 Creating dependency file for SDP_parse_.tab.c #8 2.053 Creating dependency file for RUA_PDU_Descriptions_part_7.cc #8 2.053 Creating dependency file for RUA_PDU_Descriptions_part_6.cc #8 2.054 Creating dependency file for RUA_PDU_Descriptions_part_5.cc #8 2.055 Creating dependency file for RUA_PDU_Descriptions_part_4.cc #8 2.058 Creating dependency file for RUA_PDU_Descriptions_part_3.cc #8 2.060 Creating dependency file for RUA_PDU_Descriptions_part_2.cc #8 2.060 Creating dependency file for RUA_PDU_Contents_part_7.cc #8 2.060 Creating dependency file for RUA_PDU_Descriptions_part_1.cc #8 2.061 Creating dependency file for RUA_PDU_Contents_part_6.cc #8 2.063 Creating dependency file for RUA_PDU_Contents_part_5.cc #8 2.064 Creating dependency file for RUA_PDU_Contents_part_4.cc #8 2.066 Creating dependency file for RUA_PDU_Contents_part_3.cc #8 2.066 Creating dependency file for RUA_PDU_Contents_part_2.cc #8 2.066 Creating dependency file for RUA_PDU_Contents_part_1.cc #8 2.066 Creating dependency file for RUA_IEs_part_7.cc #8 2.067 Creating dependency file for RUA_IEs_part_6.cc #8 2.067 Creating dependency file for RUA_IEs_part_5.cc #8 2.067 Creating dependency file for RUA_IEs_part_4.cc #8 2.068 Creating dependency file for RUA_IEs_part_3.cc #8 2.069 Creating dependency file for RUA_IEs_part_2.cc #8 2.070 Creating dependency file for RUA_IEs_part_1.cc #8 2.071 Creating dependency file for RUA_Containers_part_7.cc #8 2.072 Creating dependency file for RUA_Containers_part_6.cc #8 2.072 Creating dependency file for RUA_Containers_part_5.cc #8 2.073 Creating dependency file for RUA_Containers_part_4.cc #8 2.073 Creating dependency file for RUA_Containers_part_3.cc #8 2.073 Creating dependency file for RUA_Containers_part_2.cc #8 2.075 Creating dependency file for RUA_Constants_part_7.cc #8 2.075 Creating dependency file for RUA_Containers_part_1.cc #8 2.075 Creating dependency file for RUA_Constants_part_6.cc #8 2.076 Creating dependency file for RUA_Constants_part_5.cc #8 2.077 Creating dependency file for RUA_Constants_part_4.cc #8 2.078 Creating dependency file for RUA_Constants_part_3.cc #8 2.079 Creating dependency file for RUA_Constants_part_2.cc #8 2.079 Creating dependency file for RUA_Constants_part_1.cc #8 2.080 Creating dependency file for RUA_CommonDataTypes_part_6.cc #8 2.080 Creating dependency file for RUA_CommonDataTypes_part_7.cc #8 2.081 Creating dependency file for RUA_CommonDataTypes_part_4.cc #8 2.081 Creating dependency file for RUA_CommonDataTypes_part_5.cc #8 2.082 Creating dependency file for RUA_CommonDataTypes_part_3.cc #8 2.082 Creating dependency file for RUA_CommonDataTypes_part_1.cc #8 2.083 Creating dependency file for RUA_CommonDataTypes_part_2.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_7.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_6.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_5.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_3.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_4.cc #8 2.087 Creating dependency file for RANAP_PDU_Descriptions_part_2.cc #8 2.088 Creating dependency file for RANAP_PDU_Descriptions_part_1.cc #8 2.088 Creating dependency file for RANAP_PDU_Contents_part_7.cc #8 2.088 Creating dependency file for RANAP_PDU_Contents_part_6.cc #8 2.089 Creating dependency file for RANAP_PDU_Contents_part_5.cc #8 2.089 Creating dependency file for RANAP_PDU_Contents_part_4.cc #8 2.089 Creating dependency file for RANAP_PDU_Contents_part_3.cc #8 2.089 Creating dependency file for RANAP_PDU_Contents_part_2.cc #8 2.096 Creating dependency file for RANAP_PDU_Contents_part_1.cc #8 2.096 Creating dependency file for RANAP_IEs_part_7.cc #8 2.096 Creating dependency file for RANAP_IEs_part_6.cc #8 2.096 Creating dependency file for RANAP_IEs_part_5.cc #8 2.097 Creating dependency file for RANAP_IEs_part_4.cc #8 2.097 Creating dependency file for RANAP_IEs_part_3.cc #8 2.097 Creating dependency file for RANAP_IEs_part_2.cc #8 2.098 Creating dependency file for RANAP_IEs_part_1.cc #8 2.098 Creating dependency file for RANAP_Containers_part_7.cc #8 2.099 Creating dependency file for RANAP_Containers_part_6.cc #8 2.105 Creating dependency file for RANAP_Containers_part_5.cc #8 2.106 Creating dependency file for RANAP_Containers_part_4.cc #8 2.108 Creating dependency file for RANAP_Containers_part_3.cc #8 2.109 Creating dependency file for RANAP_Containers_part_2.cc #8 2.110 Creating dependency file for RANAP_Containers_part_1.cc #8 2.113 Creating dependency file for RANAP_Constants_part_7.cc #8 2.113 Creating dependency file for RANAP_Constants_part_6.cc #8 2.114 Creating dependency file for RANAP_Constants_part_5.cc #8 2.117 Creating dependency file for RANAP_Constants_part_4.cc #8 2.118 Creating dependency file for RANAP_Constants_part_3.cc #8 2.120 Creating dependency file for RANAP_Constants_part_2.cc #8 2.121 Creating dependency file for RANAP_Constants_part_1.cc #8 2.122 Creating dependency file for RANAP_CommonDataTypes_part_7.cc #8 2.125 Creating dependency file for RANAP_CommonDataTypes_part_6.cc #8 2.126 Creating dependency file for RANAP_CommonDataTypes_part_5.cc #8 2.128 Creating dependency file for RANAP_CommonDataTypes_part_4.cc #8 2.128 Creating dependency file for RANAP_CommonDataTypes_part_3.cc #8 2.128 Creating dependency file for RANAP_CommonDataTypes_part_2.cc #8 2.129 Creating dependency file for RANAP_CommonDataTypes_part_1.cc #8 2.133 Creating dependency file for HNBAP_PDU_Descriptions_part_6.cc #8 2.134 Creating dependency file for HNBAP_PDU_Descriptions_part_7.cc #8 2.134 Creating dependency file for HNBAP_PDU_Descriptions_part_5.cc #8 2.135 Creating dependency file for HNBAP_PDU_Descriptions_part_4.cc #8 2.137 Creating dependency file for HNBAP_PDU_Descriptions_part_3.cc #8 2.142 Creating dependency file for HNBAP_PDU_Descriptions_part_2.cc #8 2.142 Creating dependency file for HNBAP_PDU_Descriptions_part_1.cc #8 2.142 Creating dependency file for HNBAP_PDU_Contents_part_7.cc #8 2.143 Creating dependency file for HNBAP_PDU_Contents_part_6.cc #8 2.143 Creating dependency file for HNBAP_PDU_Contents_part_5.cc #8 2.144 Creating dependency file for HNBAP_PDU_Contents_part_4.cc #8 2.144 Creating dependency file for HNBAP_PDU_Contents_part_3.cc #8 2.166 Creating dependency file for HNBAP_PDU_Contents_part_2.cc #8 2.166 Creating dependency file for HNBAP_IEs_part_7.cc #8 2.166 Creating dependency file for HNBAP_PDU_Contents_part_1.cc #8 2.166 Creating dependency file for HNBAP_IEs_part_6.cc #8 2.166 Creating dependency file for HNBAP_IEs_part_5.cc #8 2.166 Creating dependency file for HNBAP_IEs_part_4.cc #8 2.167 Creating dependency file for HNBAP_IEs_part_3.cc #8 2.173 Creating dependency file for HNBAP_IEs_part_2.cc #8 2.174 Creating dependency file for HNBAP_IEs_part_1.cc #8 2.174 Creating dependency file for HNBAP_Containers_part_7.cc #8 2.174 Creating dependency file for HNBAP_Containers_part_6.cc #8 2.175 Creating dependency file for HNBAP_Containers_part_5.cc #8 2.175 Creating dependency file for HNBAP_Containers_part_4.cc #8 2.177 Creating dependency file for HNBAP_Containers_part_3.cc #8 2.181 Creating dependency file for HNBAP_Containers_part_2.cc #8 2.182 Creating dependency file for HNBAP_Containers_part_1.cc #8 2.182 Creating dependency file for HNBAP_Constants_part_7.cc #8 2.182 Creating dependency file for HNBAP_Constants_part_6.cc #8 2.182 Creating dependency file for HNBAP_Constants_part_5.cc #8 2.182 Creating dependency file for HNBAP_Constants_part_4.cc #8 2.183 Creating dependency file for HNBAP_Constants_part_3.cc #8 2.191 Creating dependency file for HNBAP_Constants_part_2.cc #8 2.191 Creating dependency file for HNBAP_CommonDataTypes_part_7.cc #8 2.191 Creating dependency file for HNBAP_Constants_part_1.cc #8 2.192 Creating dependency file for HNBAP_CommonDataTypes_part_6.cc #8 2.192 Creating dependency file for HNBAP_CommonDataTypes_part_5.cc #8 2.193 Creating dependency file for HNBAP_CommonDataTypes_part_4.cc #8 2.199 Creating dependency file for HNBAP_CommonDataTypes_part_3.cc #8 2.200 Creating dependency file for HNBAP_CommonDataTypes_part_2.cc #8 2.201 Creating dependency file for HNBAP_CommonDataTypes_part_1.cc #8 2.201 Creating dependency file for RUA_PDU_Descriptions.cc #8 2.203 Creating dependency file for RUA_PDU_Contents.cc #8 2.207 Creating dependency file for RUA_IEs.cc #8 2.207 Creating dependency file for RUA_Containers.cc #8 2.208 Creating dependency file for RUA_Constants.cc #8 2.208 Creating dependency file for RUA_CommonDataTypes.cc #8 2.209 Creating dependency file for RANAP_PDU_Descriptions.cc #8 2.224 Creating dependency file for RANAP_PDU_Contents.cc #8 2.267 Creating dependency file for RANAP_Containers.cc #8 2.267 Creating dependency file for RANAP_IEs.cc #8 2.270 Creating dependency file for RANAP_Constants.cc #8 2.287 Creating dependency file for RANAP_CommonDataTypes.cc #8 2.305 Creating dependency file for HNBAP_PDU_Descriptions.cc #8 2.328 Creating dependency file for HNBAP_PDU_Contents.cc #8 2.329 Creating dependency file for HNBAP_IEs.cc #8 2.343 Creating dependency file for HNBAP_Containers.cc #8 2.345 Creating dependency file for HNBAP_Constants.cc #8 2.370 Creating dependency file for HNBAP_CommonDataTypes.cc #8 2.389 Creating dependency file for StatsD_Checker_part_7.cc #8 2.390 Creating dependency file for StatsD_Checker_part_6.cc #8 2.400 Creating dependency file for StatsD_Checker_part_5.cc #8 2.400 Creating dependency file for StatsD_Checker_part_4.cc #8 2.406 Creating dependency file for StatsD_Checker_part_3.cc #8 2.410 Creating dependency file for StatsD_Checker_part_2.cc #8 2.411 Creating dependency file for StatsD_Checker_part_1.cc #8 2.411 Creating dependency file for SCCP_Mapping_part_7.cc #8 2.419 Creating dependency file for SCCP_Mapping_part_5.cc #8 2.419 Creating dependency file for SCCP_Mapping_part_6.cc #8 2.421 Creating dependency file for SCCP_Mapping_part_4.cc #8 2.428 Creating dependency file for SCCP_Mapping_part_3.cc #8 2.428 Creating dependency file for SCCP_Mapping_part_2.cc #8 2.429 Creating dependency file for SCCP_Mapping_part_1.cc #8 2.438 Creating dependency file for RAN_Emulation_part_7.cc #8 2.439 Creating dependency file for RAN_Emulation_part_6.cc #8 2.439 Creating dependency file for RAN_Emulation_part_5.cc #8 2.441 Creating dependency file for RAN_Emulation_part_4.cc #8 2.443 Creating dependency file for RAN_Emulation_part_3.cc #8 2.448 Creating dependency file for RAN_Emulation_part_2.cc #8 2.449 Creating dependency file for RAN_Emulation_part_1.cc #8 2.449 Creating dependency file for RAN_Adapter_part_7.cc #8 2.454 Creating dependency file for RAN_Adapter_part_6.cc #8 2.458 Creating dependency file for RAN_Adapter_part_5.cc #8 2.459 Creating dependency file for RAN_Adapter_part_3.cc #8 2.459 Creating dependency file for RAN_Adapter_part_2.cc #8 2.459 Creating dependency file for RAN_Adapter_part_4.cc #8 2.466 Creating dependency file for RAN_Adapter_part_1.cc #8 2.468 Creating dependency file for IPA_Emulation_part_7.cc #8 2.468 Creating dependency file for IPA_Emulation_part_6.cc #8 2.469 Creating dependency file for IPA_Emulation_part_5.cc #8 2.477 Creating dependency file for IPA_Emulation_part_4.cc #8 2.477 Creating dependency file for IPA_Emulation_part_3.cc #8 2.478 Creating dependency file for IPA_Emulation_part_2.cc #8 2.487 Creating dependency file for IPA_Emulation_part_1.cc #8 2.487 Creating dependency file for RAN_Emulation.cc #8 2.487 Creating dependency file for SCCP_Mapping.cc #8 2.487 Creating dependency file for StatsD_Checker.cc #8 2.504 Creating dependency file for RAN_Adapter.cc #8 2.505 Creating dependency file for IPA_Emulation.cc #8 2.548 Creating dependency file for UD_Types_part_7.cc #8 2.562 Creating dependency file for UD_Types_part_6.cc #8 2.572 Creating dependency file for UD_Types_part_5.cc #8 2.574 Creating dependency file for UD_Types_part_4.cc #8 2.577 Creating dependency file for UD_Types_part_3.cc #8 2.585 Creating dependency file for UD_Types_part_2.cc #8 2.591 Creating dependency file for UD_Types_part_1.cc #8 2.596 Creating dependency file for UD_PortType_part_7.cc #8 2.598 Creating dependency file for UD_PortType_part_6.cc #8 2.605 Creating dependency file for UD_PortType_part_4.cc #8 2.605 Creating dependency file for UD_PortType_part_5.cc #8 2.606 Creating dependency file for UD_PortType_part_3.cc #8 2.609 Creating dependency file for UD_PortType_part_2.cc #8 2.616 Creating dependency file for UD_PortType_part_1.cc #8 2.616 Creating dependency file for TELNETasp_PortType_part_7.cc #8 2.616 Creating dependency file for TELNETasp_PortType_part_6.cc #8 2.616 Creating dependency file for TELNETasp_PortType_part_5.cc #8 2.618 Creating dependency file for TELNETasp_PortType_part_4.cc #8 2.626 Creating dependency file for TELNETasp_PortType_part_3.cc #8 2.627 Creating dependency file for TELNETasp_PortType_part_1.cc #8 2.627 Creating dependency file for TELNETasp_PortType_part_2.cc #8 2.627 Creating dependency file for TCCInterface_Functions_part_6.cc #8 2.627 Creating dependency file for TCCInterface_Functions_part_7.cc #8 2.642 Creating dependency file for TCCInterface_Functions_part_5.cc #8 2.643 Creating dependency file for TCCInterface_Functions_part_4.cc #8 2.643 Creating dependency file for TCCInterface_Functions_part_2.cc #8 2.643 Creating dependency file for TCCInterface_Functions_part_3.cc #8 2.644 Creating dependency file for TCCInterface_Functions_part_1.cc #8 2.644 Creating dependency file for TCCEncoding_Functions_part_7.cc #8 2.644 Creating dependency file for TCCEncoding_Functions_part_6.cc #8 2.652 Creating dependency file for TCCEncoding_Functions_part_5.cc #8 2.652 Creating dependency file for TCCEncoding_Functions_part_4.cc #8 2.652 Creating dependency file for TCCEncoding_Functions_part_3.cc #8 2.653 Creating dependency file for TCCEncoding_Functions_part_2.cc #8 2.654 Creating dependency file for TCCEncoding_Functions_part_1.cc #8 2.664 Creating dependency file for TCCConversion_Functions_part_7.cc #8 2.665 Creating dependency file for TCCConversion_Functions_part_6.cc #8 2.665 Creating dependency file for TCCConversion_Functions_part_5.cc #8 2.665 Creating dependency file for TCCConversion_Functions_part_4.cc #8 2.666 Creating dependency file for TCCConversion_Functions_part_3.cc #8 2.667 Creating dependency file for TCCConversion_Functions_part_2.cc #8 2.672 Creating dependency file for TCCConversion_Functions_part_1.cc #8 2.675 Creating dependency file for StatsD_Types_part_7.cc #8 2.675 Creating dependency file for StatsD_Types_part_6.cc #8 2.676 Creating dependency file for StatsD_Types_part_4.cc #8 2.676 Creating dependency file for StatsD_Types_part_5.cc #8 2.676 Creating dependency file for StatsD_Types_part_3.cc #8 2.680 Creating dependency file for StatsD_Types_part_2.cc #8 2.684 Creating dependency file for StatsD_Types_part_1.cc #8 2.685 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_7.cc #8 2.686 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_6.cc #8 2.688 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_5.cc #8 2.691 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_4.cc #8 2.692 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_3.cc #8 2.693 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_2.cc #8 2.694 Creating dependency file for StatsD_CodecPort_CtrlFunct_part_1.cc #8 2.695 Creating dependency file for StatsD_CodecPort_part_7.cc #8 2.696 Creating dependency file for StatsD_CodecPort_part_6.cc #8 2.699 Creating dependency file for StatsD_CodecPort_part_5.cc #8 2.703 Creating dependency file for StatsD_CodecPort_part_4.cc #8 2.703 Creating dependency file for StatsD_CodecPort_part_3.cc #8 2.703 Creating dependency file for StatsD_CodecPort_part_1.cc #8 2.703 Creating dependency file for StatsD_CodecPort_part_2.cc #8 2.707 Creating dependency file for Socket_API_Definitions_part_7.cc #8 2.711 Creating dependency file for Socket_API_Definitions_part_6.cc #8 2.712 Creating dependency file for Socket_API_Definitions_part_5.cc #8 2.712 Creating dependency file for Socket_API_Definitions_part_4.cc #8 2.715 Creating dependency file for Socket_API_Definitions_part_3.cc #8 2.716 Creating dependency file for Socket_API_Definitions_part_2.cc #8 2.719 Creating dependency file for Socket_API_Definitions_part_1.cc #8 2.726 Creating dependency file for SDP_Types_part_7.cc #8 2.726 Creating dependency file for SDP_Types_part_6.cc #8 2.726 Creating dependency file for SDP_Types_part_5.cc #8 2.727 Creating dependency file for SDP_Types_part_4.cc #8 2.727 Creating dependency file for SDP_Types_part_3.cc #8 2.727 Creating dependency file for SDP_Types_part_2.cc #8 2.734 Creating dependency file for SDP_Types_part_1.cc #8 2.734 Creating dependency file for SDP_Templates_part_7.cc #8 2.734 Creating dependency file for SDP_Templates_part_6.cc #8 2.735 Creating dependency file for SDP_Templates_part_5.cc #8 2.736 Creating dependency file for SDP_Templates_part_4.cc #8 2.740 Creating dependency file for SDP_Templates_part_3.cc #8 2.740 Creating dependency file for SDP_Templates_part_2.cc #8 2.740 Creating dependency file for SDP_Templates_part_1.cc #8 2.743 Creating dependency file for SCTPasp_Types_part_7.cc #8 2.744 Creating dependency file for SCTPasp_Types_part_6.cc #8 2.746 Creating dependency file for SCTPasp_Types_part_5.cc #8 2.746 Creating dependency file for SCTPasp_Types_part_4.cc #8 2.746 Creating dependency file for SCTPasp_Types_part_3.cc #8 2.749 Creating dependency file for SCTPasp_Types_part_2.cc #8 2.758 Creating dependency file for SCTPasp_Types_part_1.cc #8 2.758 Creating dependency file for SCTPasp_PortType_part_7.cc #8 2.758 Creating dependency file for SCTPasp_PortType_part_6.cc #8 2.758 Creating dependency file for SCTPasp_PortType_part_5.cc #8 2.759 Creating dependency file for SCTPasp_PortType_part_4.cc #8 2.759 Creating dependency file for SCTPasp_PortType_part_3.cc #8 2.759 Creating dependency file for SCTPasp_PortType_part_2.cc #8 2.760 Creating dependency file for SCTP_Templates_part_7.cc #8 2.760 Creating dependency file for SCTPasp_PortType_part_1.cc #8 2.768 Creating dependency file for SCTP_Templates_part_6.cc #8 2.768 Creating dependency file for SCTP_Templates_part_4.cc #8 2.768 Creating dependency file for SCTP_Templates_part_3.cc #8 2.768 Creating dependency file for SCTP_Templates_part_5.cc #8 2.769 Creating dependency file for SCTP_Templates_part_2.cc #8 2.769 Creating dependency file for SCTP_Templates_part_1.cc #8 2.770 Creating dependency file for SCCPasp_Types_part_7.cc #8 2.773 Creating dependency file for SCCPasp_Types_part_6.cc #8 2.775 Creating dependency file for SCCPasp_Types_part_5.cc #8 2.776 Creating dependency file for SCCPasp_Types_part_4.cc #8 2.776 Creating dependency file for SCCPasp_Types_part_2.cc #8 2.776 Creating dependency file for SCCPasp_Types_part_3.cc #8 2.777 Creating dependency file for SCCPasp_Types_part_1.cc #8 2.777 Creating dependency file for SCCP_Types_part_7.cc #8 2.779 Creating dependency file for SCCP_Types_part_6.cc #8 2.783 Creating dependency file for SCCP_Types_part_5.cc #8 2.784 Creating dependency file for SCCP_Types_part_4.cc #8 2.784 Creating dependency file for SCCP_Types_part_3.cc #8 2.784 Creating dependency file for SCCP_Types_part_1.cc #8 2.784 Creating dependency file for SCCP_Types_part_2.cc #8 2.785 Creating dependency file for SCCP_Templates_part_7.cc #8 2.785 Creating dependency file for SCCP_Templates_part_6.cc #8 2.785 Creating dependency file for SCCP_Templates_part_5.cc #8 2.787 Creating dependency file for SCCP_Templates_part_4.cc #8 2.793 Creating dependency file for SCCP_Templates_part_3.cc #8 2.793 Creating dependency file for SCCP_Templates_part_2.cc #8 2.794 Creating dependency file for SCCP_Templates_part_1.cc #8 2.794 Creating dependency file for SCCP_Emulation_part_6.cc #8 2.794 Creating dependency file for SCCP_Emulation_part_5.cc #8 2.794 Creating dependency file for SCCP_Emulation_part_7.cc #8 2.796 Creating dependency file for SCCP_Emulation_part_4.cc #8 2.796 Creating dependency file for SCCP_Emulation_part_3.cc #8 2.799 Creating dependency file for SCCP_Emulation_part_2.cc #8 2.799 Creating dependency file for SCCP_Emulation_part_1.cc #8 2.803 Creating dependency file for RUA_Types_part_7.cc #8 2.804 Creating dependency file for RUA_Types_part_6.cc #8 2.804 Creating dependency file for RUA_Types_part_4.cc #8 2.804 Creating dependency file for RUA_Types_part_3.cc #8 2.804 Creating dependency file for RUA_Types_part_5.cc #8 2.805 Creating dependency file for RUA_Types_part_2.cc #8 2.805 Creating dependency file for RUA_Types_part_1.cc #8 2.807 Creating dependency file for RUA_Templates_part_7.cc #8 2.807 Creating dependency file for RUA_Templates_part_6.cc #8 2.818 Creating dependency file for RUA_Templates_part_5.cc #8 2.818 Creating dependency file for RUA_Templates_part_4.cc #8 2.818 Creating dependency file for RUA_Templates_part_3.cc #8 2.818 Creating dependency file for RUA_Templates_part_2.cc #8 2.819 Creating dependency file for RUA_Templates_part_1.cc #8 2.819 Creating dependency file for RUA_Emulation_part_6.cc #8 2.819 Creating dependency file for RUA_Emulation_part_7.cc #8 2.819 Creating dependency file for RUA_Emulation_part_5.cc #8 2.820 Creating dependency file for RUA_Emulation_part_4.cc #8 2.820 Creating dependency file for RUA_Emulation_part_3.cc #8 2.828 Creating dependency file for RUA_Emulation_part_2.cc #8 2.828 Creating dependency file for RUA_Emulation_part_1.cc #8 2.828 Creating dependency file for RTP_Types_part_7.cc #8 2.828 Creating dependency file for RTP_Types_part_6.cc #8 2.829 Creating dependency file for RTP_Types_part_5.cc #8 2.829 Creating dependency file for RTP_Types_part_4.cc #8 2.829 Creating dependency file for RTP_Types_part_3.cc #8 2.836 Creating dependency file for RTP_Types_part_2.cc #8 2.837 Creating dependency file for RTP_Emulation_part_7.cc #8 2.837 Creating dependency file for RTP_Types_part_1.cc #8 2.837 Creating dependency file for RTP_Emulation_part_6.cc #8 2.837 Creating dependency file for RTP_Emulation_part_5.cc #8 2.838 Creating dependency file for RTP_Emulation_part_4.cc #8 2.838 Creating dependency file for RTP_Emulation_part_2.cc #8 2.838 Creating dependency file for RTP_Emulation_part_3.cc #8 2.838 Creating dependency file for RTP_Emulation_part_1.cc #8 2.845 Creating dependency file for RTP_CodecPort_CtrlFunct_part_7.cc #8 2.846 Creating dependency file for RTP_CodecPort_CtrlFunct_part_6.cc #8 2.846 Creating dependency file for RTP_CodecPort_CtrlFunct_part_4.cc #8 2.846 Creating dependency file for RTP_CodecPort_CtrlFunct_part_5.cc #8 2.846 Creating dependency file for RTP_CodecPort_CtrlFunct_part_2.cc #8 2.846 Creating dependency file for RTP_CodecPort_CtrlFunct_part_3.cc #8 2.847 Creating dependency file for RTP_CodecPort_CtrlFunct_part_1.cc #8 2.848 Creating dependency file for RTP_CodecPort_part_7.cc #8 2.853 Creating dependency file for RTP_CodecPort_part_6.cc #8 2.853 Creating dependency file for RTP_CodecPort_part_5.cc #8 2.853 Creating dependency file for RTP_CodecPort_part_4.cc #8 2.853 Creating dependency file for RTP_CodecPort_part_3.cc #8 2.855 Creating dependency file for RTP_CodecPort_part_2.cc #8 2.856 Creating dependency file for RANAP_Types_part_7.cc #8 2.856 Creating dependency file for RTP_CodecPort_part_1.cc #8 2.856 Creating dependency file for RANAP_Types_part_6.cc #8 2.860 Creating dependency file for RANAP_Types_part_5.cc #8 2.860 Creating dependency file for RANAP_Types_part_4.cc #8 2.860 Creating dependency file for RANAP_Types_part_3.cc #8 2.862 Creating dependency file for RANAP_Types_part_2.cc #8 2.862 Creating dependency file for RANAP_Types_part_1.cc #8 2.863 Creating dependency file for RANAP_Templates_part_7.cc #8 2.863 Creating dependency file for RANAP_Templates_part_6.cc #8 2.866 Creating dependency file for RANAP_Templates_part_5.cc #8 2.868 Creating dependency file for RANAP_Templates_part_4.cc #8 2.868 Creating dependency file for RANAP_Templates_part_3.cc #8 2.869 Creating dependency file for RANAP_Templates_part_2.cc #8 2.870 Creating dependency file for RANAP_Templates_part_1.cc #8 2.870 Creating dependency file for RANAP_CodecPort_part_7.cc #8 2.870 Creating dependency file for RANAP_CodecPort_part_6.cc #8 2.871 Creating dependency file for RANAP_CodecPort_part_5.cc #8 2.872 Creating dependency file for RANAP_CodecPort_part_4.cc #8 2.872 Creating dependency file for RANAP_CodecPort_part_3.cc #8 2.875 Creating dependency file for RANAP_CodecPort_part_2.cc #8 2.876 Creating dependency file for PFCP_Types_part_7.cc #8 2.876 Creating dependency file for RANAP_CodecPort_part_1.cc #8 2.878 Creating dependency file for PFCP_Types_part_6.cc #8 2.878 Creating dependency file for PFCP_Types_part_4.cc #8 2.878 Creating dependency file for PFCP_Types_part_5.cc #8 2.881 Creating dependency file for PFCP_Types_part_3.cc #8 2.881 Creating dependency file for PFCP_Types_part_1.cc #8 2.881 Creating dependency file for PFCP_Types_part_2.cc #8 2.882 Creating dependency file for PFCP_Templates_part_7.cc #8 2.884 Creating dependency file for PFCP_Templates_part_6.cc #8 2.884 Creating dependency file for PFCP_Templates_part_5.cc #8 2.884 Creating dependency file for PFCP_Templates_part_4.cc #8 2.884 Creating dependency file for PFCP_Templates_part_3.cc #8 2.886 Creating dependency file for PFCP_Templates_part_2.cc #8 2.887 Creating dependency file for PFCP_Templates_part_1.cc #8 2.887 Creating dependency file for PFCP_Emulation_part_7.cc #8 2.889 Creating dependency file for PFCP_Emulation_part_6.cc #8 2.894 Creating dependency file for PFCP_Emulation_part_5.cc #8 2.895 Creating dependency file for PFCP_Emulation_part_3.cc #8 2.895 Creating dependency file for PFCP_Emulation_part_4.cc #8 2.895 Creating dependency file for PFCP_Emulation_part_1.cc #8 2.895 Creating dependency file for PFCP_Emulation_part_2.cc #8 2.895 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_7.cc #8 2.895 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_6.cc #8 2.896 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_4.cc #8 2.896 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_5.cc #8 2.896 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_3.cc #8 2.897 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_2.cc #8 2.897 Creating dependency file for PFCP_CodecPort_CtrlFunct_part_1.cc #8 2.898 Creating dependency file for PFCP_CodecPort_part_7.cc #8 2.903 Creating dependency file for PFCP_CodecPort_part_6.cc #8 2.903 Creating dependency file for PFCP_CodecPort_part_4.cc #8 2.903 Creating dependency file for PFCP_CodecPort_part_5.cc #8 2.903 Creating dependency file for PFCP_CodecPort_part_3.cc #8 2.908 Creating dependency file for PFCP_CodecPort_part_2.cc #8 2.908 Creating dependency file for PFCP_CodecPort_part_1.cc #8 2.908 Creating dependency file for Osmocom_VTY_Functions_part_7.cc #8 2.908 Creating dependency file for Osmocom_VTY_Functions_part_6.cc #8 2.908 Creating dependency file for Osmocom_VTY_Functions_part_5.cc #8 2.909 Creating dependency file for Osmocom_VTY_Functions_part_4.cc #8 2.910 Creating dependency file for Osmocom_VTY_Functions_part_3.cc #8 2.910 Creating dependency file for Osmocom_VTY_Functions_part_2.cc #8 2.910 Creating dependency file for Osmocom_VTY_Functions_part_1.cc #8 2.911 Creating dependency file for Osmocom_Types_part_6.cc #8 2.911 Creating dependency file for Osmocom_Types_part_7.cc #8 2.912 Creating dependency file for Osmocom_Types_part_5.cc #8 2.912 Creating dependency file for Osmocom_Types_part_4.cc #8 2.913 Creating dependency file for Osmocom_Types_part_3.cc #8 2.916 Creating dependency file for Osmocom_Types_part_2.cc #8 2.916 Creating dependency file for Osmocom_Types_part_1.cc #8 2.916 Creating dependency file for Osmocom_CTRL_Types_part_7.cc #8 2.918 Creating dependency file for Osmocom_CTRL_Types_part_6.cc #8 2.919 Creating dependency file for Osmocom_CTRL_Types_part_5.cc #8 2.919 Creating dependency file for Osmocom_CTRL_Types_part_3.cc #8 2.920 Creating dependency file for Osmocom_CTRL_Types_part_2.cc #8 2.920 Creating dependency file for Osmocom_CTRL_Types_part_1.cc #8 2.920 Creating dependency file for Osmocom_CTRL_Types_part_4.cc #8 2.924 Creating dependency file for Osmocom_CTRL_Functions_part_7.cc #8 2.924 Creating dependency file for Osmocom_CTRL_Functions_part_6.cc #8 2.925 Creating dependency file for Osmocom_CTRL_Functions_part_4.cc #8 2.925 Creating dependency file for Osmocom_CTRL_Functions_part_5.cc #8 2.925 Creating dependency file for Osmocom_CTRL_Functions_part_3.cc #8 2.925 Creating dependency file for Osmocom_CTRL_Functions_part_2.cc #8 2.927 Creating dependency file for Osmocom_CTRL_Functions_part_1.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_7.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_6.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_5.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_4.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_3.cc #8 2.928 Creating dependency file for Osmocom_CTRL_Adapter_part_2.cc #8 2.929 Creating dependency file for Osmocom_CTRL_Adapter_part_1.cc #8 2.929 Creating dependency file for Native_Functions_part_7.cc #8 2.930 Creating dependency file for Native_Functions_part_6.cc #8 2.931 Creating dependency file for Native_Functions_part_5.cc #8 2.931 Creating dependency file for Native_Functions_part_4.cc #8 2.932 Creating dependency file for Native_Functions_part_3.cc #8 2.932 Creating dependency file for Native_Functions_part_2.cc #8 2.937 Creating dependency file for Native_Functions_part_1.cc #8 2.937 Creating dependency file for MobileL3_Types_part_7.cc #8 2.937 Creating dependency file for MobileL3_Types_part_6.cc #8 2.937 Creating dependency file for MobileL3_Types_part_5.cc #8 2.937 Creating dependency file for MobileL3_Types_part_4.cc #8 2.938 Creating dependency file for MobileL3_Types_part_3.cc #8 2.939 Creating dependency file for MobileL3_Types_part_2.cc #8 2.939 Creating dependency file for MobileL3_Types_part_1.cc #8 2.939 Creating dependency file for MobileL3_SS_Types_part_7.cc #8 2.939 Creating dependency file for MobileL3_SS_Types_part_6.cc #8 2.939 Creating dependency file for MobileL3_SS_Types_part_5.cc #8 2.939 Creating dependency file for MobileL3_SS_Types_part_4.cc #8 2.940 Creating dependency file for MobileL3_SS_Types_part_3.cc #8 2.940 Creating dependency file for MobileL3_SS_Types_part_2.cc #8 2.940 Creating dependency file for MobileL3_SS_Types_part_1.cc #8 2.941 Creating dependency file for MobileL3_SMS_Types_part_7.cc #8 2.945 Creating dependency file for MobileL3_SMS_Types_part_6.cc #8 2.945 Creating dependency file for MobileL3_SMS_Types_part_5.cc #8 2.945 Creating dependency file for MobileL3_SMS_Types_part_4.cc #8 2.946 Creating dependency file for MobileL3_SMS_Types_part_3.cc #8 2.947 Creating dependency file for MobileL3_SMS_Types_part_2.cc #8 2.947 Creating dependency file for MobileL3_SMS_Types_part_1.cc #8 2.947 Creating dependency file for MobileL3_RRM_Types_part_7.cc #8 2.948 Creating dependency file for MobileL3_RRM_Types_part_6.cc #8 2.948 Creating dependency file for MobileL3_RRM_Types_part_5.cc #8 2.948 Creating dependency file for MobileL3_RRM_Types_part_4.cc #8 2.948 Creating dependency file for MobileL3_RRM_Types_part_3.cc #8 2.949 Creating dependency file for MobileL3_RRM_Types_part_2.cc #8 2.949 Creating dependency file for MobileL3_RRM_Types_part_1.cc #8 2.949 Creating dependency file for MobileL3_MM_Types_part_6.cc #8 2.949 Creating dependency file for MobileL3_MM_Types_part_7.cc #8 2.951 Creating dependency file for MobileL3_MM_Types_part_5.cc #8 2.953 Creating dependency file for MobileL3_MM_Types_part_4.cc #8 2.953 Creating dependency file for MobileL3_MM_Types_part_3.cc #8 2.953 Creating dependency file for MobileL3_MM_Types_part_2.cc #8 2.954 Creating dependency file for MobileL3_MM_Types_part_1.cc #8 2.955 Creating dependency file for MobileL3_GMM_SM_Types_part_7.cc #8 2.955 Creating dependency file for MobileL3_GMM_SM_Types_part_6.cc #8 2.956 Creating dependency file for MobileL3_GMM_SM_Types_part_5.cc #8 2.956 Creating dependency file for MobileL3_GMM_SM_Types_part_3.cc #8 2.956 Creating dependency file for MobileL3_GMM_SM_Types_part_2.cc #8 2.956 Creating dependency file for MobileL3_GMM_SM_Types_part_4.cc #8 2.957 Creating dependency file for MobileL3_GMM_SM_Types_part_1.cc #8 2.957 Creating dependency file for MobileL3_CommonIE_Types_part_7.cc #8 2.957 Creating dependency file for MobileL3_CommonIE_Types_part_6.cc #8 2.960 Creating dependency file for MobileL3_CommonIE_Types_part_5.cc #8 2.961 Creating dependency file for MobileL3_CommonIE_Types_part_4.cc #8 2.961 Creating dependency file for MobileL3_CommonIE_Types_part_3.cc #8 2.963 Creating dependency file for MobileL3_CommonIE_Types_part_2.cc #8 2.964 Creating dependency file for MobileL3_CommonIE_Types_part_1.cc #8 2.964 Creating dependency file for MobileL3_CC_Types_part_7.cc #8 2.964 Creating dependency file for MobileL3_CC_Types_part_6.cc #8 2.965 Creating dependency file for MobileL3_CC_Types_part_5.cc #8 2.965 Creating dependency file for MobileL3_CC_Types_part_4.cc #8 2.971 Creating dependency file for MobileL3_CC_Types_part_3.cc #8 2.971 Creating dependency file for MobileL3_CC_Types_part_2.cc #8 2.971 Creating dependency file for MobileL3_CC_Types_part_1.cc #8 2.972 Creating dependency file for Misc_Helpers_part_7.cc #8 2.972 Creating dependency file for Misc_Helpers_part_6.cc #8 2.972 Creating dependency file for Misc_Helpers_part_5.cc #8 2.972 Creating dependency file for Misc_Helpers_part_4.cc #8 2.972 Creating dependency file for Misc_Helpers_part_3.cc #8 2.973 Creating dependency file for Misc_Helpers_part_2.cc #8 2.973 Creating dependency file for Misc_Helpers_part_1.cc #8 2.973 Creating dependency file for MTP3asp_Types_part_6.cc #8 2.973 Creating dependency file for MTP3asp_Types_part_7.cc #8 2.974 Creating dependency file for MTP3asp_Types_part_5.cc #8 2.980 Creating dependency file for MTP3asp_Types_part_4.cc #8 2.980 Creating dependency file for MTP3asp_Types_part_3.cc #8 2.980 Creating dependency file for MTP3asp_Types_part_2.cc #8 2.980 Creating dependency file for MTP3asp_Types_part_1.cc #8 2.980 Creating dependency file for MTP3asp_PortType_part_6.cc #8 2.981 Creating dependency file for MTP3asp_PortType_part_7.cc #8 2.981 Creating dependency file for MTP3asp_PortType_part_5.cc #8 2.981 Creating dependency file for MTP3asp_PortType_part_4.cc #8 2.981 Creating dependency file for MTP3asp_PortType_part_3.cc #8 2.982 Creating dependency file for MTP3asp_PortType_part_2.cc #8 2.982 Creating dependency file for MTP3asp_PortType_part_1.cc #8 2.982 Creating dependency file for MGCP_Types_part_7.cc #8 2.982 Creating dependency file for MGCP_Types_part_6.cc #8 2.983 Creating dependency file for MGCP_Types_part_5.cc #8 2.987 Creating dependency file for MGCP_Types_part_4.cc #8 2.987 Creating dependency file for MGCP_Types_part_2.cc #8 2.988 Creating dependency file for MGCP_Types_part_3.cc #8 2.988 Creating dependency file for MGCP_Types_part_1.cc #8 2.988 Creating dependency file for MGCP_Templates_part_6.cc #8 2.988 Creating dependency file for MGCP_Templates_part_7.cc #8 2.988 Creating dependency file for MGCP_Templates_part_5.cc #8 2.989 Creating dependency file for MGCP_Templates_part_4.cc #8 2.989 Creating dependency file for MGCP_Templates_part_3.cc #8 2.989 Creating dependency file for MGCP_Templates_part_2.cc #8 2.989 Creating dependency file for MGCP_Templates_part_1.cc #8 2.990 Creating dependency file for MGCP_Emulation_part_7.cc #8 2.994 Creating dependency file for MGCP_Emulation_part_6.cc #8 2.994 Creating dependency file for MGCP_Emulation_part_5.cc #8 2.994 Creating dependency file for MGCP_Emulation_part_4.cc #8 2.995 Creating dependency file for MGCP_Emulation_part_3.cc #8 2.996 Creating dependency file for MGCP_Emulation_part_2.cc #8 2.996 Creating dependency file for MGCP_Emulation_part_1.cc #8 2.997 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_7.cc #8 2.997 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_6.cc #8 2.998 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_5.cc #8 2.998 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_4.cc #8 2.998 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_3.cc #8 3.003 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_2.cc #8 3.003 Creating dependency file for MGCP_CodecPort_CtrlFunct_part_1.cc #8 3.004 Creating dependency file for MGCP_CodecPort_part_7.cc #8 3.004 Creating dependency file for MGCP_CodecPort_part_6.cc #8 3.004 Creating dependency file for MGCP_CodecPort_part_5.cc #8 3.005 Creating dependency file for MGCP_CodecPort_part_4.cc #8 3.005 Creating dependency file for MGCP_CodecPort_part_3.cc #8 3.005 Creating dependency file for MGCP_CodecPort_part_2.cc #8 3.005 Creating dependency file for MGCP_CodecPort_part_1.cc #8 3.006 Creating dependency file for M3UA_Types_part_6.cc #8 3.006 Creating dependency file for M3UA_Types_part_7.cc #8 3.011 Creating dependency file for M3UA_Types_part_5.cc #8 3.012 Creating dependency file for M3UA_Types_part_4.cc #8 3.012 Creating dependency file for M3UA_Types_part_3.cc #8 3.012 Creating dependency file for M3UA_Types_part_2.cc #8 3.012 Creating dependency file for M3UA_Types_part_1.cc #8 3.013 Creating dependency file for M3UA_Emulation_part_7.cc #8 3.013 Creating dependency file for M3UA_Emulation_part_6.cc #8 3.013 Creating dependency file for M3UA_Emulation_part_5.cc #8 3.013 Creating dependency file for M3UA_Emulation_part_4.cc #8 3.013 Creating dependency file for M3UA_Emulation_part_2.cc #8 3.014 Creating dependency file for M3UA_Emulation_part_1.cc #8 3.014 Creating dependency file for M3UA_Emulation_part_3.cc #8 3.014 Creating dependency file for L3_Templates_part_7.cc #8 3.014 Creating dependency file for L3_Templates_part_6.cc #8 3.019 Creating dependency file for L3_Templates_part_5.cc #8 3.019 Creating dependency file for L3_Templates_part_4.cc #8 3.019 Creating dependency file for L3_Templates_part_3.cc #8 3.020 Creating dependency file for L3_Templates_part_2.cc #8 3.020 Creating dependency file for L3_Templates_part_1.cc #8 3.021 Creating dependency file for L3_Common_part_7.cc #8 3.022 Creating dependency file for L3_Common_part_6.cc #8 3.022 Creating dependency file for L3_Common_part_5.cc #8 3.022 Creating dependency file for L3_Common_part_4.cc #8 3.022 Creating dependency file for L3_Common_part_3.cc #8 3.023 Creating dependency file for L3_Common_part_2.cc #8 3.024 Creating dependency file for L3_Common_part_1.cc #8 3.024 Creating dependency file for Iuh_Types_part_7.cc #8 3.024 Creating dependency file for Iuh_Types_part_6.cc #8 3.025 Creating dependency file for Iuh_Types_part_5.cc #8 3.027 Creating dependency file for Iuh_Types_part_4.cc #8 3.027 Creating dependency file for Iuh_Types_part_3.cc #8 3.028 Creating dependency file for Iuh_Types_part_1.cc #8 3.028 Creating dependency file for Iuh_Types_part_2.cc #8 3.029 Creating dependency file for Iuh_Emulation_part_7.cc #8 3.032 Creating dependency file for Iuh_Emulation_part_6.cc #8 3.033 Creating dependency file for Iuh_Emulation_part_5.cc #8 3.033 Creating dependency file for Iuh_Emulation_part_4.cc #8 3.033 Creating dependency file for Iuh_Emulation_part_3.cc #8 3.034 Creating dependency file for Iuh_Emulation_part_1.cc #8 3.034 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_7.cc #8 3.034 Creating dependency file for Iuh_Emulation_part_2.cc #8 3.034 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_6.cc #8 3.035 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_5.cc #8 3.035 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_4.cc #8 3.035 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_3.cc #8 3.036 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_2.cc #8 3.037 Creating dependency file for Iuh_CodecPort_CtrlFunct_part_1.cc #8 3.037 Creating dependency file for Iuh_CodecPort_part_7.cc #8 3.037 Creating dependency file for Iuh_CodecPort_part_6.cc #8 3.040 Creating dependency file for Iuh_CodecPort_part_5.cc #8 3.040 Creating dependency file for Iuh_CodecPort_part_4.cc #8 3.040 Creating dependency file for Iuh_CodecPort_part_3.cc #8 3.041 Creating dependency file for Iuh_CodecPort_part_2.cc #8 3.043 Creating dependency file for Iuh_CodecPort_part_1.cc #8 3.044 Creating dependency file for IuUP_Types_part_7.cc #8 3.044 Creating dependency file for IuUP_Types_part_5.cc #8 3.044 Creating dependency file for IuUP_Types_part_4.cc #8 3.044 Creating dependency file for IuUP_Types_part_6.cc #8 3.045 Creating dependency file for IuUP_Types_part_3.cc #8 3.046 Creating dependency file for IuUP_Types_part_1.cc #8 3.046 Creating dependency file for IuUP_Types_part_2.cc #8 3.048 Creating dependency file for IuUP_Emulation_part_7.cc #8 3.048 Creating dependency file for IuUP_Emulation_part_6.cc #8 3.049 Creating dependency file for IuUP_Emulation_part_5.cc #8 3.049 Creating dependency file for IuUP_Emulation_part_4.cc #8 3.050 Creating dependency file for IuUP_Emulation_part_3.cc #8 3.050 Creating dependency file for IuUP_Emulation_part_2.cc #8 3.050 Creating dependency file for IuUP_Emulation_part_1.cc #8 3.055 Creating dependency file for IPL4asp_Types_part_7.cc #8 3.055 Creating dependency file for IPL4asp_Types_part_6.cc #8 3.055 Creating dependency file for IPL4asp_Types_part_5.cc #8 3.055 Creating dependency file for IPL4asp_Types_part_4.cc #8 3.056 Creating dependency file for IPL4asp_Types_part_3.cc #8 3.056 Creating dependency file for IPL4asp_Types_part_2.cc #8 3.056 Creating dependency file for IPL4asp_PortType_part_7.cc #8 3.056 Creating dependency file for IPL4asp_Types_part_1.cc #8 3.056 Creating dependency file for IPL4asp_PortType_part_6.cc #8 3.056 Creating dependency file for IPL4asp_PortType_part_5.cc #8 3.056 Creating dependency file for IPL4asp_PortType_part_4.cc #8 3.057 Creating dependency file for IPL4asp_PortType_part_3.cc #8 3.057 Creating dependency file for IPL4asp_PortType_part_2.cc #8 3.058 Creating dependency file for IPL4asp_PortType_part_1.cc #8 3.064 Creating dependency file for IPL4asp_Functions_part_7.cc #8 3.064 Creating dependency file for IPL4asp_Functions_part_6.cc #8 3.064 Creating dependency file for IPL4asp_Functions_part_5.cc #8 3.064 Creating dependency file for IPL4asp_Functions_part_4.cc #8 3.065 Creating dependency file for IPL4asp_Functions_part_3.cc #8 3.065 Creating dependency file for IPL4asp_Functions_part_2.cc #8 3.065 Creating dependency file for IPL4asp_Functions_part_1.cc #8 3.065 Creating dependency file for IPA_Types_part_7.cc #8 3.065 Creating dependency file for IPA_Types_part_6.cc #8 3.066 Creating dependency file for IPA_Types_part_5.cc #8 3.066 Creating dependency file for IPA_Types_part_4.cc #8 3.067 Creating dependency file for IPA_Types_part_3.cc #8 3.067 Creating dependency file for IPA_Types_part_2.cc #8 3.067 Creating dependency file for IPA_Types_part_1.cc #8 3.067 Creating dependency file for IPA_CodecPort_CtrlFunct_part_7.cc #8 3.068 Creating dependency file for IPA_CodecPort_CtrlFunct_part_6.cc #8 3.072 Creating dependency file for IPA_CodecPort_CtrlFunct_part_3.cc #8 3.072 Creating dependency file for IPA_CodecPort_CtrlFunct_part_5.cc #8 3.072 Creating dependency file for IPA_CodecPort_CtrlFunct_part_4.cc #8 3.072 Creating dependency file for IPA_CodecPort_CtrlFunct_part_2.cc #8 3.072 Creating dependency file for IPA_CodecPort_part_7.cc #8 3.072 Creating dependency file for IPA_CodecPort_CtrlFunct_part_1.cc #8 3.073 Creating dependency file for IPA_CodecPort_part_6.cc #8 3.073 Creating dependency file for IPA_CodecPort_part_5.cc #8 3.074 Creating dependency file for IPA_CodecPort_part_4.cc #8 3.074 Creating dependency file for IPA_CodecPort_part_3.cc #8 3.075 Creating dependency file for IPA_CodecPort_part_2.cc #8 3.076 Creating dependency file for IPA_CodecPort_part_1.cc #8 3.077 Creating dependency file for HNBGW_Tests_part_7.cc #8 3.079 Creating dependency file for HNBGW_Tests_part_6.cc #8 3.079 Creating dependency file for HNBGW_Tests_part_5.cc #8 3.080 Creating dependency file for HNBGW_Tests_part_4.cc #8 3.080 Creating dependency file for HNBGW_Tests_part_3.cc #8 3.081 Creating dependency file for HNBGW_Tests_part_1.cc #8 3.081 Creating dependency file for HNBAP_Types_part_7.cc #8 3.081 Creating dependency file for HNBAP_Types_part_6.cc #8 3.081 Creating dependency file for HNBGW_Tests_part_2.cc #8 3.082 Creating dependency file for HNBAP_Types_part_5.cc #8 3.083 Creating dependency file for HNBAP_Types_part_4.cc #8 3.083 Creating dependency file for HNBAP_Types_part_3.cc #8 3.084 Creating dependency file for HNBAP_Types_part_2.cc #8 3.084 Creating dependency file for HNBAP_Types_part_1.cc #8 3.086 Creating dependency file for HNBAP_Templates_part_7.cc #8 3.086 Creating dependency file for HNBAP_Templates_part_5.cc #8 3.086 Creating dependency file for HNBAP_Templates_part_6.cc #8 3.086 Creating dependency file for HNBAP_Templates_part_4.cc #8 3.087 Creating dependency file for HNBAP_Templates_part_3.cc #8 3.088 Creating dependency file for HNBAP_Templates_part_2.cc #8 3.089 Creating dependency file for HNBAP_Templates_part_1.cc #8 3.089 Creating dependency file for General_Types_part_7.cc #8 3.091 Creating dependency file for General_Types_part_5.cc #8 3.091 Creating dependency file for General_Types_part_4.cc #8 3.091 Creating dependency file for General_Types_part_6.cc #8 3.091 Creating dependency file for General_Types_part_3.cc #8 3.093 Creating dependency file for General_Types_part_2.cc #8 3.094 Creating dependency file for General_Types_part_1.cc #8 3.094 Creating dependency file for GSM_Types_part_6.cc #8 3.094 Creating dependency file for GSM_Types_part_7.cc #8 3.094 Creating dependency file for GSM_Types_part_5.cc #8 3.094 Creating dependency file for GSM_Types_part_4.cc #8 3.095 Creating dependency file for GSM_Types_part_3.cc #8 3.095 Creating dependency file for GSM_Types_part_2.cc #8 3.096 Creating dependency file for GSM_Types_part_1.cc #8 3.096 Creating dependency file for DNS_Helpers_part_7.cc #8 3.098 Creating dependency file for DNS_Helpers_part_6.cc #8 3.099 Creating dependency file for DNS_Helpers_part_5.cc #8 3.099 Creating dependency file for DNS_Helpers_part_4.cc #8 3.100 Creating dependency file for DNS_Helpers_part_3.cc #8 3.100 Creating dependency file for DNS_Helpers_part_2.cc #8 3.101 Creating dependency file for BSSAP_Types_part_7.cc #8 3.101 Creating dependency file for DNS_Helpers_part_1.cc #8 3.102 Creating dependency file for BSSAP_Types_part_6.cc #8 3.105 Creating dependency file for BSSAP_Types_part_5.cc #8 3.105 Creating dependency file for BSSAP_Types_part_4.cc #8 3.106 Creating dependency file for BSSAP_Types_part_2.cc #8 3.106 Creating dependency file for BSSAP_Types_part_3.cc #8 3.106 Creating dependency file for BSSAP_Types_part_1.cc #8 3.106 Creating dependency file for BSSAP_CodecPort_part_7.cc #8 3.107 Creating dependency file for BSSAP_CodecPort_part_6.cc #8 3.107 Creating dependency file for BSSAP_CodecPort_part_5.cc #8 3.107 Creating dependency file for BSSAP_CodecPort_part_4.cc #8 3.107 Creating dependency file for BSSAP_CodecPort_part_3.cc #8 3.108 Creating dependency file for BSSAP_CodecPort_part_2.cc #8 3.108 Creating dependency file for BSSAP_CodecPort_part_1.cc #8 3.108 Creating dependency file for UD_Types.cc #8 3.109 Creating dependency file for UD_PortType.cc #8 3.109 Creating dependency file for TELNETasp_PortType.cc #8 3.109 Creating dependency file for TCCInterface_Functions.cc #8 3.113 Creating dependency file for TCCEncoding_Functions.cc #8 3.113 Creating dependency file for StatsD_Types.cc #8 3.113 Creating dependency file for TCCConversion_Functions.cc #8 3.114 Creating dependency file for StatsD_CodecPort_CtrlFunct.cc #8 3.114 Creating dependency file for StatsD_CodecPort.cc #8 3.115 Creating dependency file for Socket_API_Definitions.cc #8 3.115 Creating dependency file for SDP_Types.cc #8 3.117 Creating dependency file for SDP_Templates.cc #8 3.117 Creating dependency file for SCTPasp_Types.cc #8 3.119 Creating dependency file for SCTPasp_PortType.cc #8 3.124 Creating dependency file for SCTP_Templates.cc #8 3.159 Creating dependency file for SCCPasp_Types.cc #8 3.168 Creating dependency file for SCCP_Types.cc #8 3.170 Creating dependency file for SCCP_Templates.cc #8 3.170 Creating dependency file for SCCP_Emulation.cc #8 3.171 Creating dependency file for RUA_Types.cc #8 3.172 Creating dependency file for RUA_Templates.cc #8 3.176 Creating dependency file for RUA_Emulation.cc #8 3.176 Creating dependency file for RTP_Types.cc #8 3.176 Creating dependency file for RTP_Emulation.cc #8 3.177 Creating dependency file for RTP_CodecPort_CtrlFunct.cc #8 3.177 Creating dependency file for RTP_CodecPort.cc #8 3.179 Creating dependency file for RANAP_Types.cc #8 3.180 Creating dependency file for RANAP_Templates.cc #8 3.181 Creating dependency file for RANAP_CodecPort.cc #8 3.181 Creating dependency file for PFCP_Types.cc #8 3.185 Creating dependency file for PFCP_Templates.cc #8 3.226 Creating dependency file for PFCP_Emulation.cc #8 3.230 Creating dependency file for PFCP_CodecPort_CtrlFunct.cc #8 3.233 Creating dependency file for PFCP_CodecPort.cc #8 3.240 Creating dependency file for Osmocom_VTY_Functions.cc #8 3.243 Creating dependency file for Osmocom_Types.cc #8 3.245 Creating dependency file for Osmocom_CTRL_Types.cc #8 3.246 Creating dependency file for Osmocom_CTRL_Functions.cc #8 3.261 Creating dependency file for Osmocom_CTRL_Adapter.cc #8 3.262 Creating dependency file for Native_Functions.cc #8 3.270 Creating dependency file for MobileL3_Types.cc #8 3.276 Creating dependency file for MobileL3_SS_Types.cc #8 3.285 Creating dependency file for MobileL3_SMS_Types.cc #8 3.287 Creating dependency file for MobileL3_RRM_Types.cc #8 3.298 Creating dependency file for MobileL3_MM_Types.cc #8 3.301 Creating dependency file for MobileL3_GMM_SM_Types.cc #8 3.306 Creating dependency file for MobileL3_CommonIE_Types.cc #8 3.320 Creating dependency file for MobileL3_CC_Types.cc #8 3.321 Creating dependency file for Misc_Helpers.cc #8 3.334 Creating dependency file for MTP3asp_Types.cc #8 3.360 Creating dependency file for MTP3asp_PortType.cc #8 3.360 Creating dependency file for MGCP_Types.cc #8 3.360 Creating dependency file for MGCP_Templates.cc #8 3.360 Creating dependency file for MGCP_Emulation.cc #8 3.362 Creating dependency file for MGCP_CodecPort_CtrlFunct.cc #8 3.382 Creating dependency file for MGCP_CodecPort.cc #8 3.394 Creating dependency file for M3UA_Types.cc #8 3.400 Creating dependency file for M3UA_Emulation.cc #8 3.403 Creating dependency file for L3_Templates.cc #8 3.408 Creating dependency file for L3_Common.cc #8 3.416 Creating dependency file for Iuh_Types.cc #8 3.440 Creating dependency file for Iuh_Emulation.cc #8 3.443 Creating dependency file for Iuh_CodecPort.cc #8 3.443 Creating dependency file for Iuh_CodecPort_CtrlFunct.cc #8 3.445 Creating dependency file for IuUP_Types.cc #8 3.446 Creating dependency file for IuUP_Emulation.cc #8 3.451 Creating dependency file for IPL4asp_Types.cc #8 3.461 Creating dependency file for IPL4asp_PortType.cc #8 3.484 Creating dependency file for IPL4asp_Functions.cc #8 3.495 Creating dependency file for IPA_Types.cc #8 3.502 Creating dependency file for IPA_CodecPort_CtrlFunct.cc #8 3.504 Creating dependency file for IPA_CodecPort.cc #8 3.507 Creating dependency file for HNBGW_Tests.cc #8 3.508 Creating dependency file for HNBAP_Types.cc #8 3.518 Creating dependency file for HNBAP_Templates.cc #8 3.534 Creating dependency file for General_Types.cc #8 3.543 Creating dependency file for GSM_Types.cc #8 3.549 Creating dependency file for DNS_Helpers.cc #8 3.566 Creating dependency file for BSSAP_Types.cc #8 3.566 Creating dependency file for BSSAP_CodecPort.cc #8 4.140 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort.o BSSAP_CodecPort.cc #8 4.140 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types.o BSSAP_Types.cc #8 4.140 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers.o DNS_Helpers.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types.o GSM_Types.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types.o General_Types.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates.o HNBAP_Templates.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types.o HNBAP_Types.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests.o HNBGW_Tests.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort.o IPA_CodecPort.cc #8 4.141 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct.o IPA_CodecPort_CtrlFunct.cc #8 4.142 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types.o IPA_Types.cc #8 4.142 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions.o IPL4asp_Functions.cc #8 4.142 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType.o IPL4asp_PortType.cc #8 4.142 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types.o IPL4asp_Types.cc #8 4.142 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation.o IuUP_Emulation.cc #8 4.143 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types.o IuUP_Types.cc #8 4.143 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort.o Iuh_CodecPort.cc #8 4.143 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct.o Iuh_CodecPort_CtrlFunct.cc #8 4.143 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation.o Iuh_Emulation.cc #8 4.144 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types.o Iuh_Types.cc #8 4.685 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common.o L3_Common.cc #8 4.782 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates.o L3_Templates.cc #8 4.855 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation.o M3UA_Emulation.cc #8 4.945 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types.o M3UA_Types.cc #8 5.123 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort.o MGCP_CodecPort.cc #8 5.260 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct.o MGCP_CodecPort_CtrlFunct.cc #8 5.312 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation.o MGCP_Emulation.cc #8 5.341 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates.o MGCP_Templates.cc #8 5.373 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types.o MGCP_Types.cc #8 5.406 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType.o MTP3asp_PortType.cc #8 5.905 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types.o MTP3asp_Types.cc #8 5.909 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers.o Misc_Helpers.cc #8 5.976 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types.o MobileL3_CC_Types.cc #8 6.069 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types.o MobileL3_CommonIE_Types.cc #8 6.208 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types.o MobileL3_GMM_SM_Types.cc #8 6.281 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types.o MobileL3_MM_Types.cc #8 6.303 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types.o MobileL3_RRM_Types.cc #8 6.319 MGCP_Emulation.cc: In function 'COMPONENT MGCP__Emulation::f__comp__by__ep(const CHARSTRING&)': #8 6.319 MGCP_Emulation.cc:7791:1: warning: control reaches end of non-void function [-Wreturn-type] #8 6.319 7791 | } #8 6.319 | ^ #8 6.320 MGCP_Emulation.cc: In function 'CHARSTRING MGCP__Emulation::f__ep__by__comp(const COMPONENT&)': #8 6.320 MGCP_Emulation.cc:7843:1: warning: control reaches end of non-void function [-Wreturn-type] #8 6.320 7843 | } #8 6.320 | ^ #8 6.327 MGCP_Emulation.cc: In function 'COMPONENT MGCP__Emulation::ExpectedCreateCallback(const MGCP__Types::MgcpCommand&, const CHARSTRING&)': #8 6.327 MGCP_Emulation.cc:8940:1: warning: control reaches end of non-void function [-Wreturn-type] #8 6.327 8940 | } #8 6.327 | ^ #8 6.330 MGCP_Emulation.cc: In function 'CHARSTRING MGCP__Emulation::f__encoding__name__from__pt(const MGCP__Types::SDP__FIELD__PayloadType&)': #8 6.330 MGCP_Emulation.cc:9388:1: warning: control reaches end of non-void function [-Wreturn-type] #8 6.330 9388 | } #8 6.330 | ^ #8 6.366 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types.o MobileL3_SMS_Types.cc #8 6.425 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types.o MobileL3_SS_Types.cc #8 6.467 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types.o MobileL3_Types.cc #8 6.610 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions.o Native_Functions.cc #8 7.039 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter.o Osmocom_CTRL_Adapter.cc #8 7.094 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions.o Osmocom_CTRL_Functions.cc #8 7.197 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types.o Osmocom_CTRL_Types.cc #8 7.217 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types.o Osmocom_Types.cc #8 7.340 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions.o Osmocom_VTY_Functions.cc #8 7.394 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort.o PFCP_CodecPort.cc #8 7.652 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct.o PFCP_CodecPort_CtrlFunct.cc #8 7.664 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation.o PFCP_Emulation.cc #8 7.820 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates.o PFCP_Templates.cc #8 7.912 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types.o PFCP_Types.cc #8 7.929 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort.o RANAP_CodecPort.cc #8 8.190 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates.o RANAP_Templates.cc #8 8.230 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types.o RANAP_Types.cc #8 8.231 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort.o RTP_CodecPort.cc #8 8.522 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct.o RTP_CodecPort_CtrlFunct.cc #8 8.794 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation.o RTP_Emulation.cc #8 9.180 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types.o RTP_Types.cc #8 9.411 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation.o RUA_Emulation.cc #8 9.486 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates.o RUA_Templates.cc #8 9.489 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types.o RUA_Types.cc #8 10.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation.o SCCP_Emulation.cc #8 10.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates.o SCCP_Templates.cc #8 10.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types.o SCCP_Types.cc #8 11.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types.o SCCPasp_Types.cc #8 11.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates.o SCTP_Templates.cc #8 11.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType.o SCTPasp_PortType.cc #8 12.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types.o SCTPasp_Types.cc #8 12.75 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates.o SDP_Templates.cc #8 12.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types.o SDP_Types.cc #8 13.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions.o Socket_API_Definitions.cc #8 13.73 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort.o StatsD_CodecPort.cc #8 14.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct.o StatsD_CodecPort_CtrlFunct.cc #8 14.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types.o StatsD_Types.cc #8 14.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions.o TCCConversion_Functions.cc #8 15.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions.o TCCEncoding_Functions.cc #8 15.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions.o TCCInterface_Functions.cc #8 15.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType.o TELNETasp_PortType.cc #8 15.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType.o UD_PortType.cc #8 16.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types.o UD_Types.cc #8 16.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_1.o BSSAP_CodecPort_part_1.cc #8 16.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_2.o BSSAP_CodecPort_part_2.cc #8 16.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_3.o BSSAP_CodecPort_part_3.cc #8 16.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_4.o BSSAP_CodecPort_part_4.cc #8 16.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_5.o BSSAP_CodecPort_part_5.cc #8 16.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_6.o BSSAP_CodecPort_part_6.cc #8 16.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_CodecPort_part_7.o BSSAP_CodecPort_part_7.cc #8 16.75 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_1.o BSSAP_Types_part_1.cc #8 16.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_2.o BSSAP_Types_part_2.cc #8 16.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_3.o BSSAP_Types_part_3.cc #8 16.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_4.o BSSAP_Types_part_4.cc #8 16.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_5.o BSSAP_Types_part_5.cc #8 16.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_6.o BSSAP_Types_part_6.cc #8 16.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o BSSAP_Types_part_7.o BSSAP_Types_part_7.cc #8 16.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_1.o DNS_Helpers_part_1.cc #8 16.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_2.o DNS_Helpers_part_2.cc #8 16.98 RUA_Emulation.cc: In function 'BITSTRING RUA__Emulation::f__context__id__by__comp(const COMPONENT&)': #8 16.98 RUA_Emulation.cc:5826:1: warning: control reaches end of non-void function [-Wreturn-type] #8 16.98 5826 | } #8 16.98 | ^ #8 16.98 RUA_Emulation.cc: In function 'INTEGER RUA__Emulation::f__idx__by__comp(const COMPONENT&)': #8 16.98 RUA_Emulation.cc:5877:1: warning: control reaches end of non-void function [-Wreturn-type] #8 16.98 5877 | } #8 16.98 | ^ #8 16.98 RUA_Emulation.cc: In function 'COMPONENT RUA__Emulation::f__comp__by__context__id(const BITSTRING&)': #8 16.98 RUA_Emulation.cc:6155:1: warning: control reaches end of non-void function [-Wreturn-type] #8 16.98 6155 | } #8 16.98 | ^ #8 17.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_3.o DNS_Helpers_part_3.cc #8 17.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_4.o DNS_Helpers_part_4.cc #8 17.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_5.o DNS_Helpers_part_5.cc #8 17.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_6.o DNS_Helpers_part_6.cc #8 17.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o DNS_Helpers_part_7.o DNS_Helpers_part_7.cc #8 17.11 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_1.o GSM_Types_part_1.cc #8 17.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_2.o GSM_Types_part_2.cc #8 17.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_3.o GSM_Types_part_3.cc #8 17.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_4.o GSM_Types_part_4.cc #8 17.16 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_5.o GSM_Types_part_5.cc #8 17.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_6.o GSM_Types_part_6.cc #8 17.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o GSM_Types_part_7.o GSM_Types_part_7.cc #8 17.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_1.o General_Types_part_1.cc #8 17.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_2.o General_Types_part_2.cc #8 17.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_3.o General_Types_part_3.cc #8 17.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_4.o General_Types_part_4.cc #8 17.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_5.o General_Types_part_5.cc #8 17.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_6.o General_Types_part_6.cc #8 17.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o General_Types_part_7.o General_Types_part_7.cc #8 17.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_1.o HNBAP_Templates_part_1.cc #8 17.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_2.o HNBAP_Templates_part_2.cc #8 17.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_3.o HNBAP_Templates_part_3.cc #8 17.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_4.o HNBAP_Templates_part_4.cc #8 17.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_5.o HNBAP_Templates_part_5.cc #8 17.35 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_6.o HNBAP_Templates_part_6.cc #8 17.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Templates_part_7.o HNBAP_Templates_part_7.cc #8 17.39 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_1.o HNBAP_Types_part_1.cc #8 17.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_2.o HNBAP_Types_part_2.cc #8 17.41 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_3.o HNBAP_Types_part_3.cc #8 17.41 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_4.o HNBAP_Types_part_4.cc #8 17.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_5.o HNBAP_Types_part_5.cc #8 17.43 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_6.o HNBAP_Types_part_6.cc #8 17.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Types_part_7.o HNBAP_Types_part_7.cc #8 17.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_1.o HNBGW_Tests_part_1.cc #8 17.45 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_2.o HNBGW_Tests_part_2.cc #8 17.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_3.o HNBGW_Tests_part_3.cc #8 17.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_4.o HNBGW_Tests_part_4.cc #8 17.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_5.o HNBGW_Tests_part_5.cc #8 17.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_6.o HNBGW_Tests_part_6.cc #8 17.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBGW_Tests_part_7.o HNBGW_Tests_part_7.cc #8 17.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_1.o IPA_CodecPort_part_1.cc #8 17.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_2.o IPA_CodecPort_part_2.cc #8 17.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_3.o IPA_CodecPort_part_3.cc #8 17.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_4.o IPA_CodecPort_part_4.cc #8 17.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_5.o IPA_CodecPort_part_5.cc #8 17.54 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_6.o IPA_CodecPort_part_6.cc #8 17.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_part_7.o IPA_CodecPort_part_7.cc #8 17.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_1.o IPA_CodecPort_CtrlFunct_part_1.cc #8 17.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_2.o IPA_CodecPort_CtrlFunct_part_2.cc #8 17.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_3.o IPA_CodecPort_CtrlFunct_part_3.cc #8 17.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_4.o IPA_CodecPort_CtrlFunct_part_4.cc #8 17.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_5.o IPA_CodecPort_CtrlFunct_part_5.cc #8 17.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_6.o IPA_CodecPort_CtrlFunct_part_6.cc #8 17.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunct_part_7.o IPA_CodecPort_CtrlFunct_part_7.cc #8 17.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_1.o IPA_Types_part_1.cc #8 17.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_2.o IPA_Types_part_2.cc #8 17.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_3.o IPA_Types_part_3.cc #8 17.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_4.o IPA_Types_part_4.cc #8 17.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_5.o IPA_Types_part_5.cc #8 17.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_6.o IPA_Types_part_6.cc #8 17.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Types_part_7.o IPA_Types_part_7.cc #8 17.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_1.o IPL4asp_Functions_part_1.cc #8 17.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_2.o IPL4asp_Functions_part_2.cc #8 17.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_3.o IPL4asp_Functions_part_3.cc #8 17.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_4.o IPL4asp_Functions_part_4.cc #8 17.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_5.o IPL4asp_Functions_part_5.cc #8 17.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_6.o IPL4asp_Functions_part_6.cc #8 17.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Functions_part_7.o IPL4asp_Functions_part_7.cc #8 17.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_1.o IPL4asp_PortType_part_1.cc #8 17.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_2.o IPL4asp_PortType_part_2.cc #8 17.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_3.o IPL4asp_PortType_part_3.cc #8 17.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_4.o IPL4asp_PortType_part_4.cc #8 17.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_5.o IPL4asp_PortType_part_5.cc #8 17.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_6.o IPL4asp_PortType_part_6.cc #8 17.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PortType_part_7.o IPL4asp_PortType_part_7.cc #8 17.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_1.o IPL4asp_Types_part_1.cc #8 17.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_2.o IPL4asp_Types_part_2.cc #8 17.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_3.o IPL4asp_Types_part_3.cc #8 17.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_4.o IPL4asp_Types_part_4.cc #8 17.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_5.o IPL4asp_Types_part_5.cc #8 17.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_6.o IPL4asp_Types_part_6.cc #8 17.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_Types_part_7.o IPL4asp_Types_part_7.cc #8 17.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_1.o IuUP_Emulation_part_1.cc #8 17.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_2.o IuUP_Emulation_part_2.cc #8 17.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_3.o IuUP_Emulation_part_3.cc #8 17.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_4.o IuUP_Emulation_part_4.cc #8 17.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_5.o IuUP_Emulation_part_5.cc #8 17.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_6.o IuUP_Emulation_part_6.cc #8 17.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Emulation_part_7.o IuUP_Emulation_part_7.cc #8 17.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_1.o IuUP_Types_part_1.cc #8 17.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_2.o IuUP_Types_part_2.cc #8 17.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_3.o IuUP_Types_part_3.cc #8 17.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_4.o IuUP_Types_part_4.cc #8 17.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_5.o IuUP_Types_part_5.cc #8 17.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_6.o IuUP_Types_part_6.cc #8 17.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_Types_part_7.o IuUP_Types_part_7.cc #8 17.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_1.o Iuh_CodecPort_part_1.cc #8 17.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_2.o Iuh_CodecPort_part_2.cc #8 17.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_3.o Iuh_CodecPort_part_3.cc #8 17.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_4.o Iuh_CodecPort_part_4.cc #8 17.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_5.o Iuh_CodecPort_part_5.cc #8 17.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_6.o Iuh_CodecPort_part_6.cc #8 17.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_part_7.o Iuh_CodecPort_part_7.cc #8 17.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_1.o Iuh_CodecPort_CtrlFunct_part_1.cc #8 17.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_2.o Iuh_CodecPort_CtrlFunct_part_2.cc #8 17.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_3.o Iuh_CodecPort_CtrlFunct_part_3.cc #8 17.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_4.o Iuh_CodecPort_CtrlFunct_part_4.cc #8 17.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_5.o Iuh_CodecPort_CtrlFunct_part_5.cc #8 17.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_6.o Iuh_CodecPort_CtrlFunct_part_6.cc #8 17.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunct_part_7.o Iuh_CodecPort_CtrlFunct_part_7.cc #8 17.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_1.o Iuh_Emulation_part_1.cc #8 17.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_2.o Iuh_Emulation_part_2.cc #8 17.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_3.o Iuh_Emulation_part_3.cc #8 17.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_4.o Iuh_Emulation_part_4.cc #8 17.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_5.o Iuh_Emulation_part_5.cc #8 17.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_6.o Iuh_Emulation_part_6.cc #8 17.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Emulation_part_7.o Iuh_Emulation_part_7.cc #8 17.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_1.o Iuh_Types_part_1.cc #8 17.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_2.o Iuh_Types_part_2.cc #8 17.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_3.o Iuh_Types_part_3.cc #8 17.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_4.o Iuh_Types_part_4.cc #8 17.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_5.o Iuh_Types_part_5.cc #8 17.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_6.o Iuh_Types_part_6.cc #8 17.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_Types_part_7.o Iuh_Types_part_7.cc #8 17.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_1.o L3_Common_part_1.cc #8 17.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_2.o L3_Common_part_2.cc #8 17.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_3.o L3_Common_part_3.cc #8 17.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_4.o L3_Common_part_4.cc #8 17.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_5.o L3_Common_part_5.cc #8 17.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_6.o L3_Common_part_6.cc #8 17.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Common_part_7.o L3_Common_part_7.cc #8 17.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_1.o L3_Templates_part_1.cc #8 17.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_2.o L3_Templates_part_2.cc #8 17.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_3.o L3_Templates_part_3.cc #8 17.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_4.o L3_Templates_part_4.cc #8 17.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_5.o L3_Templates_part_5.cc #8 17.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_6.o L3_Templates_part_6.cc #8 17.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o L3_Templates_part_7.o L3_Templates_part_7.cc #8 17.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_1.o M3UA_Emulation_part_1.cc #8 17.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_2.o M3UA_Emulation_part_2.cc #8 18.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_3.o M3UA_Emulation_part_3.cc #8 18.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_4.o M3UA_Emulation_part_4.cc #8 18.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_5.o M3UA_Emulation_part_5.cc #8 18.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_6.o M3UA_Emulation_part_6.cc #8 18.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Emulation_part_7.o M3UA_Emulation_part_7.cc #8 18.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_1.o M3UA_Types_part_1.cc #8 18.02 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_2.o M3UA_Types_part_2.cc #8 18.02 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_3.o M3UA_Types_part_3.cc #8 18.02 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_4.o M3UA_Types_part_4.cc #8 18.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_5.o M3UA_Types_part_5.cc #8 18.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_6.o M3UA_Types_part_6.cc #8 18.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o M3UA_Types_part_7.o M3UA_Types_part_7.cc #8 18.04 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_1.o MGCP_CodecPort_part_1.cc #8 18.04 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_2.o MGCP_CodecPort_part_2.cc #8 18.04 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_3.o MGCP_CodecPort_part_3.cc #8 18.04 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_4.o MGCP_CodecPort_part_4.cc #8 18.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_5.o MGCP_CodecPort_part_5.cc #8 18.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_6.o MGCP_CodecPort_part_6.cc #8 18.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_part_7.o MGCP_CodecPort_part_7.cc #8 18.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_1.o MGCP_CodecPort_CtrlFunct_part_1.cc #8 18.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_2.o MGCP_CodecPort_CtrlFunct_part_2.cc #8 18.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_3.o MGCP_CodecPort_CtrlFunct_part_3.cc #8 18.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_4.o MGCP_CodecPort_CtrlFunct_part_4.cc #8 18.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_5.o MGCP_CodecPort_CtrlFunct_part_5.cc #8 18.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_6.o MGCP_CodecPort_CtrlFunct_part_6.cc #8 18.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunct_part_7.o MGCP_CodecPort_CtrlFunct_part_7.cc #8 18.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_1.o MGCP_Emulation_part_1.cc #8 18.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_2.o MGCP_Emulation_part_2.cc #8 18.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_3.o MGCP_Emulation_part_3.cc #8 18.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_4.o MGCP_Emulation_part_4.cc #8 18.09 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_5.o MGCP_Emulation_part_5.cc #8 18.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_6.o MGCP_Emulation_part_6.cc #8 18.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Emulation_part_7.o MGCP_Emulation_part_7.cc #8 18.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_1.o MGCP_Templates_part_1.cc #8 18.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_2.o MGCP_Templates_part_2.cc #8 18.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_3.o MGCP_Templates_part_3.cc #8 18.11 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_4.o MGCP_Templates_part_4.cc #8 18.11 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_5.o MGCP_Templates_part_5.cc #8 18.11 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_6.o MGCP_Templates_part_6.cc #8 18.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Templates_part_7.o MGCP_Templates_part_7.cc #8 18.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_1.o MGCP_Types_part_1.cc #8 18.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_2.o MGCP_Types_part_2.cc #8 18.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_3.o MGCP_Types_part_3.cc #8 18.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_4.o MGCP_Types_part_4.cc #8 18.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_5.o MGCP_Types_part_5.cc #8 18.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_6.o MGCP_Types_part_6.cc #8 18.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_Types_part_7.o MGCP_Types_part_7.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_1.o MTP3asp_PortType_part_1.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_2.o MTP3asp_PortType_part_2.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_3.o MTP3asp_PortType_part_3.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_4.o MTP3asp_PortType_part_4.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_5.o MTP3asp_PortType_part_5.cc #8 18.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_6.o MTP3asp_PortType_part_6.cc #8 18.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_PortType_part_7.o MTP3asp_PortType_part_7.cc #8 18.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_1.o MTP3asp_Types_part_1.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_2.o MTP3asp_Types_part_2.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_3.o MTP3asp_Types_part_3.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_4.o MTP3asp_Types_part_4.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_5.o MTP3asp_Types_part_5.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_6.o MTP3asp_Types_part_6.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MTP3asp_Types_part_7.o MTP3asp_Types_part_7.cc #8 18.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_1.o Misc_Helpers_part_1.cc #8 18.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_2.o Misc_Helpers_part_2.cc #8 18.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_3.o Misc_Helpers_part_3.cc #8 18.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_4.o Misc_Helpers_part_4.cc #8 18.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_5.o Misc_Helpers_part_5.cc #8 18.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_6.o Misc_Helpers_part_6.cc #8 18.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Misc_Helpers_part_7.o Misc_Helpers_part_7.cc #8 18.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_1.o MobileL3_CC_Types_part_1.cc #8 18.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_2.o MobileL3_CC_Types_part_2.cc #8 18.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_3.o MobileL3_CC_Types_part_3.cc #8 18.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_4.o MobileL3_CC_Types_part_4.cc #8 18.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_5.o MobileL3_CC_Types_part_5.cc #8 18.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_6.o MobileL3_CC_Types_part_6.cc #8 18.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CC_Types_part_7.o MobileL3_CC_Types_part_7.cc #8 18.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_1.o MobileL3_CommonIE_Types_part_1.cc #8 18.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_2.o MobileL3_CommonIE_Types_part_2.cc #8 18.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_3.o MobileL3_CommonIE_Types_part_3.cc #8 18.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_4.o MobileL3_CommonIE_Types_part_4.cc #8 18.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_5.o MobileL3_CommonIE_Types_part_5.cc #8 18.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_6.o MobileL3_CommonIE_Types_part_6.cc #8 18.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_CommonIE_Types_part_7.o MobileL3_CommonIE_Types_part_7.cc #8 18.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_1.o MobileL3_GMM_SM_Types_part_1.cc #8 18.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_2.o MobileL3_GMM_SM_Types_part_2.cc #8 18.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_3.o MobileL3_GMM_SM_Types_part_3.cc #8 18.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_4.o MobileL3_GMM_SM_Types_part_4.cc #8 18.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_5.o MobileL3_GMM_SM_Types_part_5.cc #8 18.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_6.o MobileL3_GMM_SM_Types_part_6.cc #8 18.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_GMM_SM_Types_part_7.o MobileL3_GMM_SM_Types_part_7.cc #8 18.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_1.o MobileL3_MM_Types_part_1.cc #8 18.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_2.o MobileL3_MM_Types_part_2.cc #8 18.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_3.o MobileL3_MM_Types_part_3.cc #8 18.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_4.o MobileL3_MM_Types_part_4.cc #8 18.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_5.o MobileL3_MM_Types_part_5.cc #8 18.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_6.o MobileL3_MM_Types_part_6.cc #8 18.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_MM_Types_part_7.o MobileL3_MM_Types_part_7.cc #8 18.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_1.o MobileL3_RRM_Types_part_1.cc #8 18.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_2.o MobileL3_RRM_Types_part_2.cc #8 18.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_3.o MobileL3_RRM_Types_part_3.cc #8 18.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_4.o MobileL3_RRM_Types_part_4.cc #8 18.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_5.o MobileL3_RRM_Types_part_5.cc #8 18.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_6.o MobileL3_RRM_Types_part_6.cc #8 18.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_RRM_Types_part_7.o MobileL3_RRM_Types_part_7.cc #8 18.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_1.o MobileL3_SMS_Types_part_1.cc #8 18.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_2.o MobileL3_SMS_Types_part_2.cc #8 18.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_3.o MobileL3_SMS_Types_part_3.cc #8 18.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_4.o MobileL3_SMS_Types_part_4.cc #8 18.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_5.o MobileL3_SMS_Types_part_5.cc #8 18.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_6.o MobileL3_SMS_Types_part_6.cc #8 18.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SMS_Types_part_7.o MobileL3_SMS_Types_part_7.cc #8 18.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_1.o MobileL3_SS_Types_part_1.cc #8 18.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_2.o MobileL3_SS_Types_part_2.cc #8 18.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_3.o MobileL3_SS_Types_part_3.cc #8 18.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_4.o MobileL3_SS_Types_part_4.cc #8 18.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_5.o MobileL3_SS_Types_part_5.cc #8 18.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_6.o MobileL3_SS_Types_part_6.cc #8 18.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_SS_Types_part_7.o MobileL3_SS_Types_part_7.cc #8 18.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_1.o MobileL3_Types_part_1.cc #8 18.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_2.o MobileL3_Types_part_2.cc #8 18.35 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_3.o MobileL3_Types_part_3.cc #8 18.35 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_4.o MobileL3_Types_part_4.cc #8 18.35 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_5.o MobileL3_Types_part_5.cc #8 18.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_6.o MobileL3_Types_part_6.cc #8 18.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MobileL3_Types_part_7.o MobileL3_Types_part_7.cc #8 18.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_1.o Native_Functions_part_1.cc #8 18.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_2.o Native_Functions_part_2.cc #8 18.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_3.o Native_Functions_part_3.cc #8 18.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_4.o Native_Functions_part_4.cc #8 18.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_5.o Native_Functions_part_5.cc #8 18.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_6.o Native_Functions_part_6.cc #8 18.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_Functions_part_7.o Native_Functions_part_7.cc #8 18.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_1.o Osmocom_CTRL_Adapter_part_1.cc #8 18.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_2.o Osmocom_CTRL_Adapter_part_2.cc #8 18.39 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_3.o Osmocom_CTRL_Adapter_part_3.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_4.o Osmocom_CTRL_Adapter_part_4.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_5.o Osmocom_CTRL_Adapter_part_5.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_6.o Osmocom_CTRL_Adapter_part_6.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Adapter_part_7.o Osmocom_CTRL_Adapter_part_7.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_1.o Osmocom_CTRL_Functions_part_1.cc #8 18.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_2.o Osmocom_CTRL_Functions_part_2.cc #8 18.41 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_3.o Osmocom_CTRL_Functions_part_3.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_4.o Osmocom_CTRL_Functions_part_4.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_5.o Osmocom_CTRL_Functions_part_5.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_6.o Osmocom_CTRL_Functions_part_6.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Functions_part_7.o Osmocom_CTRL_Functions_part_7.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_1.o Osmocom_CTRL_Types_part_1.cc #8 18.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_2.o Osmocom_CTRL_Types_part_2.cc #8 18.43 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_3.o Osmocom_CTRL_Types_part_3.cc #8 18.43 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_4.o Osmocom_CTRL_Types_part_4.cc #8 18.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_5.o Osmocom_CTRL_Types_part_5.cc #8 18.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_6.o Osmocom_CTRL_Types_part_6.cc #8 18.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_CTRL_Types_part_7.o Osmocom_CTRL_Types_part_7.cc #8 18.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_1.o Osmocom_Types_part_1.cc #8 18.45 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_2.o Osmocom_Types_part_2.cc #8 18.45 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_3.o Osmocom_Types_part_3.cc #8 18.45 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_4.o Osmocom_Types_part_4.cc #8 18.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_5.o Osmocom_Types_part_5.cc #8 18.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_6.o Osmocom_Types_part_6.cc #8 18.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_Types_part_7.o Osmocom_Types_part_7.cc #8 18.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_1.o Osmocom_VTY_Functions_part_1.cc #8 18.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_2.o Osmocom_VTY_Functions_part_2.cc #8 18.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_3.o Osmocom_VTY_Functions_part_3.cc #8 18.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_4.o Osmocom_VTY_Functions_part_4.cc #8 18.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_5.o Osmocom_VTY_Functions_part_5.cc #8 18.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_6.o Osmocom_VTY_Functions_part_6.cc #8 18.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Osmocom_VTY_Functions_part_7.o Osmocom_VTY_Functions_part_7.cc #8 18.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_1.o PFCP_CodecPort_part_1.cc #8 18.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_2.o PFCP_CodecPort_part_2.cc #8 18.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_3.o PFCP_CodecPort_part_3.cc #8 18.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_4.o PFCP_CodecPort_part_4.cc #8 18.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_5.o PFCP_CodecPort_part_5.cc #8 18.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_6.o PFCP_CodecPort_part_6.cc #8 18.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_part_7.o PFCP_CodecPort_part_7.cc #8 18.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_1.o PFCP_CodecPort_CtrlFunct_part_1.cc #8 18.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_2.o PFCP_CodecPort_CtrlFunct_part_2.cc #8 18.52 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_3.o PFCP_CodecPort_CtrlFunct_part_3.cc #8 18.52 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_4.o PFCP_CodecPort_CtrlFunct_part_4.cc #8 18.52 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_5.o PFCP_CodecPort_CtrlFunct_part_5.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_6.o PFCP_CodecPort_CtrlFunct_part_6.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunct_part_7.o PFCP_CodecPort_CtrlFunct_part_7.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_1.o PFCP_Emulation_part_1.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_2.o PFCP_Emulation_part_2.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_3.o PFCP_Emulation_part_3.cc #8 18.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_4.o PFCP_Emulation_part_4.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_5.o PFCP_Emulation_part_5.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_6.o PFCP_Emulation_part_6.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Emulation_part_7.o PFCP_Emulation_part_7.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_1.o PFCP_Templates_part_1.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_2.o PFCP_Templates_part_2.cc #8 18.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_3.o PFCP_Templates_part_3.cc #8 18.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_4.o PFCP_Templates_part_4.cc #8 18.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_5.o PFCP_Templates_part_5.cc #8 18.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_6.o PFCP_Templates_part_6.cc #8 18.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Templates_part_7.o PFCP_Templates_part_7.cc #8 18.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_1.o PFCP_Types_part_1.cc #8 18.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_2.o PFCP_Types_part_2.cc #8 18.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_3.o PFCP_Types_part_3.cc #8 18.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_4.o PFCP_Types_part_4.cc #8 18.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_5.o PFCP_Types_part_5.cc #8 18.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_6.o PFCP_Types_part_6.cc #8 18.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_Types_part_7.o PFCP_Types_part_7.cc #8 18.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_1.o RANAP_CodecPort_part_1.cc #8 18.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_2.o RANAP_CodecPort_part_2.cc #8 18.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_3.o RANAP_CodecPort_part_3.cc #8 18.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_4.o RANAP_CodecPort_part_4.cc #8 18.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_5.o RANAP_CodecPort_part_5.cc #8 18.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_6.o RANAP_CodecPort_part_6.cc #8 18.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CodecPort_part_7.o RANAP_CodecPort_part_7.cc #8 18.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_1.o RANAP_Templates_part_1.cc #8 18.63 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_2.o RANAP_Templates_part_2.cc #8 18.63 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_3.o RANAP_Templates_part_3.cc #8 18.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_4.o RANAP_Templates_part_4.cc #8 18.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_5.o RANAP_Templates_part_5.cc #8 18.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_6.o RANAP_Templates_part_6.cc #8 18.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Templates_part_7.o RANAP_Templates_part_7.cc #8 18.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_1.o RANAP_Types_part_1.cc #8 18.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_2.o RANAP_Types_part_2.cc #8 18.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_3.o RANAP_Types_part_3.cc #8 18.66 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_4.o RANAP_Types_part_4.cc #8 18.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_5.o RANAP_Types_part_5.cc #8 18.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_6.o RANAP_Types_part_6.cc #8 18.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Types_part_7.o RANAP_Types_part_7.cc #8 18.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_1.o RTP_CodecPort_part_1.cc #8 18.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_2.o RTP_CodecPort_part_2.cc #8 18.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_3.o RTP_CodecPort_part_3.cc #8 18.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_4.o RTP_CodecPort_part_4.cc #8 18.69 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_5.o RTP_CodecPort_part_5.cc #8 18.69 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_6.o RTP_CodecPort_part_6.cc #8 18.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_part_7.o RTP_CodecPort_part_7.cc #8 18.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_1.o RTP_CodecPort_CtrlFunct_part_1.cc #8 18.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_2.o RTP_CodecPort_CtrlFunct_part_2.cc #8 18.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_3.o RTP_CodecPort_CtrlFunct_part_3.cc #8 18.71 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_4.o RTP_CodecPort_CtrlFunct_part_4.cc #8 18.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_5.o RTP_CodecPort_CtrlFunct_part_5.cc #8 18.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_6.o RTP_CodecPort_CtrlFunct_part_6.cc #8 18.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunct_part_7.o RTP_CodecPort_CtrlFunct_part_7.cc #8 18.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_1.o RTP_Emulation_part_1.cc #8 18.73 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_2.o RTP_Emulation_part_2.cc #8 18.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_3.o RTP_Emulation_part_3.cc #8 18.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_4.o RTP_Emulation_part_4.cc #8 18.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_5.o RTP_Emulation_part_5.cc #8 18.74 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_6.o RTP_Emulation_part_6.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Emulation_part_7.o RTP_Emulation_part_7.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_1.o RTP_Types_part_1.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_2.o RTP_Types_part_2.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_3.o RTP_Types_part_3.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_4.o RTP_Types_part_4.cc #8 18.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_5.o RTP_Types_part_5.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_6.o RTP_Types_part_6.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_Types_part_7.o RTP_Types_part_7.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_1.o RUA_Emulation_part_1.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_2.o RUA_Emulation_part_2.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_3.o RUA_Emulation_part_3.cc #8 18.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_4.o RUA_Emulation_part_4.cc #8 18.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_5.o RUA_Emulation_part_5.cc #8 18.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_6.o RUA_Emulation_part_6.cc #8 18.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Emulation_part_7.o RUA_Emulation_part_7.cc #8 18.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_1.o RUA_Templates_part_1.cc #8 18.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_2.o RUA_Templates_part_2.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_3.o RUA_Templates_part_3.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_4.o RUA_Templates_part_4.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_5.o RUA_Templates_part_5.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_6.o RUA_Templates_part_6.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Templates_part_7.o RUA_Templates_part_7.cc #8 18.82 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_1.o RUA_Types_part_1.cc #8 18.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_2.o RUA_Types_part_2.cc #8 18.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_3.o RUA_Types_part_3.cc #8 18.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_4.o RUA_Types_part_4.cc #8 18.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_5.o RUA_Types_part_5.cc #8 18.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_6.o RUA_Types_part_6.cc #8 18.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Types_part_7.o RUA_Types_part_7.cc #8 18.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_1.o SCCP_Emulation_part_1.cc #8 18.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_2.o SCCP_Emulation_part_2.cc #8 18.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_3.o SCCP_Emulation_part_3.cc #8 18.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_4.o SCCP_Emulation_part_4.cc #8 18.86 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_5.o SCCP_Emulation_part_5.cc #8 18.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_6.o SCCP_Emulation_part_6.cc #8 18.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Emulation_part_7.o SCCP_Emulation_part_7.cc #8 18.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_1.o SCCP_Templates_part_1.cc #8 18.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_2.o SCCP_Templates_part_2.cc #8 18.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_3.o SCCP_Templates_part_3.cc #8 18.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_4.o SCCP_Templates_part_4.cc #8 18.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_5.o SCCP_Templates_part_5.cc #8 18.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_6.o SCCP_Templates_part_6.cc #8 18.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Templates_part_7.o SCCP_Templates_part_7.cc #8 18.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_1.o SCCP_Types_part_1.cc #8 18.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_2.o SCCP_Types_part_2.cc #8 18.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_3.o SCCP_Types_part_3.cc #8 18.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_4.o SCCP_Types_part_4.cc #8 18.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_5.o SCCP_Types_part_5.cc #8 18.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_6.o SCCP_Types_part_6.cc #8 18.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Types_part_7.o SCCP_Types_part_7.cc #8 18.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_1.o SCCPasp_Types_part_1.cc #8 18.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_2.o SCCPasp_Types_part_2.cc #8 18.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_3.o SCCPasp_Types_part_3.cc #8 18.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_4.o SCCPasp_Types_part_4.cc #8 18.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_5.o SCCPasp_Types_part_5.cc #8 18.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_6.o SCCPasp_Types_part_6.cc #8 18.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCPasp_Types_part_7.o SCCPasp_Types_part_7.cc #8 18.94 HNBGW_Tests.cc: In function 'OCTETSTRING HNBGW__Tests::f__gen__one__compl__l3(const Compl3Type&, const MobileL3__CommonIE__Types::MobileIdentityLV_template&, const INTEGER&)': #8 18.94 HNBGW_Tests.cc:18985:1: warning: control reaches end of non-void function [-Wreturn-type] #8 18.94 18985 | } #8 18.94 | ^ #8 18.94 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_1.o SCTP_Templates_part_1.cc #8 18.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_2.o SCTP_Templates_part_2.cc #8 18.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_3.o SCTP_Templates_part_3.cc #8 18.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_4.o SCTP_Templates_part_4.cc #8 18.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_5.o SCTP_Templates_part_5.cc #8 18.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_6.o SCTP_Templates_part_6.cc #8 18.96 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTP_Templates_part_7.o SCTP_Templates_part_7.cc #8 18.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_1.o SCTPasp_PortType_part_1.cc #8 18.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_2.o SCTPasp_PortType_part_2.cc #8 18.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_3.o SCTPasp_PortType_part_3.cc #8 18.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_4.o SCTPasp_PortType_part_4.cc #8 18.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_5.o SCTPasp_PortType_part_5.cc #8 18.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_6.o SCTPasp_PortType_part_6.cc #8 18.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PortType_part_7.o SCTPasp_PortType_part_7.cc #8 18.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_1.o SCTPasp_Types_part_1.cc #8 18.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_2.o SCTPasp_Types_part_2.cc #8 19.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_3.o SCTPasp_Types_part_3.cc #8 19.00 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_4.o SCTPasp_Types_part_4.cc #8 19.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_5.o SCTPasp_Types_part_5.cc #8 19.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_6.o SCTPasp_Types_part_6.cc #8 19.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_Types_part_7.o SCTPasp_Types_part_7.cc #8 19.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_1.o SDP_Templates_part_1.cc #8 19.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_2.o SDP_Templates_part_2.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_3.o SDP_Templates_part_3.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_4.o SDP_Templates_part_4.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_5.o SDP_Templates_part_5.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_6.o SDP_Templates_part_6.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Templates_part_7.o SDP_Templates_part_7.cc #8 19.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_1.o SDP_Types_part_1.cc #8 19.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_2.o SDP_Types_part_2.cc #8 19.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_3.o SDP_Types_part_3.cc #8 19.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_4.o SDP_Types_part_4.cc #8 19.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_5.o SDP_Types_part_5.cc #8 19.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_6.o SDP_Types_part_6.cc #8 19.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_Types_part_7.o SDP_Types_part_7.cc #8 19.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_1.o Socket_API_Definitions_part_1.cc #8 19.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_2.o Socket_API_Definitions_part_2.cc #8 19.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_3.o Socket_API_Definitions_part_3.cc #8 19.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_4.o Socket_API_Definitions_part_4.cc #8 19.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_5.o Socket_API_Definitions_part_5.cc #8 19.08 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_6.o Socket_API_Definitions_part_6.cc #8 19.09 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Socket_API_Definitions_part_7.o Socket_API_Definitions_part_7.cc #8 19.09 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_1.o StatsD_CodecPort_part_1.cc #8 19.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_2.o StatsD_CodecPort_part_2.cc #8 19.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_3.o StatsD_CodecPort_part_3.cc #8 19.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_4.o StatsD_CodecPort_part_4.cc #8 19.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_5.o StatsD_CodecPort_part_5.cc #8 19.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_6.o StatsD_CodecPort_part_6.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_part_7.o StatsD_CodecPort_part_7.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_1.o StatsD_CodecPort_CtrlFunct_part_1.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_2.o StatsD_CodecPort_CtrlFunct_part_2.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_3.o StatsD_CodecPort_CtrlFunct_part_3.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_4.o StatsD_CodecPort_CtrlFunct_part_4.cc #8 19.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_5.o StatsD_CodecPort_CtrlFunct_part_5.cc #8 19.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_6.o StatsD_CodecPort_CtrlFunct_part_6.cc #8 19.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunct_part_7.o StatsD_CodecPort_CtrlFunct_part_7.cc #8 19.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_1.o StatsD_Types_part_1.cc #8 19.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_2.o StatsD_Types_part_2.cc #8 19.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_3.o StatsD_Types_part_3.cc #8 19.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_4.o StatsD_Types_part_4.cc #8 19.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_5.o StatsD_Types_part_5.cc #8 19.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_6.o StatsD_Types_part_6.cc #8 19.16 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Types_part_7.o StatsD_Types_part_7.cc #8 19.16 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_1.o TCCConversion_Functions_part_1.cc #8 19.16 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_2.o TCCConversion_Functions_part_2.cc #8 19.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_3.o TCCConversion_Functions_part_3.cc #8 19.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_4.o TCCConversion_Functions_part_4.cc #8 19.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_5.o TCCConversion_Functions_part_5.cc #8 19.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_6.o TCCConversion_Functions_part_6.cc #8 19.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion_Functions_part_7.o TCCConversion_Functions_part_7.cc #8 19.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_1.o TCCEncoding_Functions_part_1.cc #8 19.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_2.o TCCEncoding_Functions_part_2.cc #8 19.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_3.o TCCEncoding_Functions_part_3.cc #8 19.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_4.o TCCEncoding_Functions_part_4.cc #8 19.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_5.o TCCEncoding_Functions_part_5.cc #8 19.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_6.o TCCEncoding_Functions_part_6.cc #8 19.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding_Functions_part_7.o TCCEncoding_Functions_part_7.cc #8 19.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_1.o TCCInterface_Functions_part_1.cc #8 19.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_2.o TCCInterface_Functions_part_2.cc #8 19.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_3.o TCCInterface_Functions_part_3.cc #8 19.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_4.o TCCInterface_Functions_part_4.cc #8 19.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_5.o TCCInterface_Functions_part_5.cc #8 19.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_6.o TCCInterface_Functions_part_6.cc #8 19.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface_Functions_part_7.o TCCInterface_Functions_part_7.cc #8 19.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_1.o TELNETasp_PortType_part_1.cc #8 19.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_2.o TELNETasp_PortType_part_2.cc #8 19.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_3.o TELNETasp_PortType_part_3.cc #8 19.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_4.o TELNETasp_PortType_part_4.cc #8 19.24 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_5.o TELNETasp_PortType_part_5.cc #8 19.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_6.o TELNETasp_PortType_part_6.cc #8 19.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PortType_part_7.o TELNETasp_PortType_part_7.cc #8 19.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_1.o UD_PortType_part_1.cc #8 19.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_2.o UD_PortType_part_2.cc #8 19.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_3.o UD_PortType_part_3.cc #8 19.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_4.o UD_PortType_part_4.cc #8 19.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_5.o UD_PortType_part_5.cc #8 19.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_6.o UD_PortType_part_6.cc #8 19.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PortType_part_7.o UD_PortType_part_7.cc #8 19.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_1.o UD_Types_part_1.cc #8 19.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_2.o UD_Types_part_2.cc #8 19.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_3.o UD_Types_part_3.cc #8 19.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_4.o UD_Types_part_4.cc #8 19.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_5.o UD_Types_part_5.cc #8 19.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_6.o UD_Types_part_6.cc #8 19.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_Types_part_7.o UD_Types_part_7.cc #8 19.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation.o IPA_Emulation.cc #8 19.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter.o RAN_Adapter.cc #8 19.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation.o RAN_Emulation.cc #8 19.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping.o SCCP_Mapping.cc #8 19.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker.o StatsD_Checker.cc #8 19.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_1.o IPA_Emulation_part_1.cc #8 19.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_2.o IPA_Emulation_part_2.cc #8 19.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_3.o IPA_Emulation_part_3.cc #8 19.43 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_4.o IPA_Emulation_part_4.cc #8 19.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_5.o IPA_Emulation_part_5.cc #8 19.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_6.o IPA_Emulation_part_6.cc #8 19.54 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_Emulation_part_7.o IPA_Emulation_part_7.cc #8 19.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_1.o RAN_Adapter_part_1.cc #8 19.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_2.o RAN_Adapter_part_2.cc #8 19.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_3.o RAN_Adapter_part_3.cc #8 19.69 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_4.o RAN_Adapter_part_4.cc #8 19.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_5.o RAN_Adapter_part_5.cc #8 19.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_6.o RAN_Adapter_part_6.cc #8 19.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Adapter_part_7.o RAN_Adapter_part_7.cc #8 19.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_1.o RAN_Emulation_part_1.cc #8 19.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_2.o RAN_Emulation_part_2.cc #8 19.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_3.o RAN_Emulation_part_3.cc #8 19.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_4.o RAN_Emulation_part_4.cc #8 19.99 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_5.o RAN_Emulation_part_5.cc #8 20.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_6.o RAN_Emulation_part_6.cc #8 20.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RAN_Emulation_part_7.o RAN_Emulation_part_7.cc #8 20.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_1.o SCCP_Mapping_part_1.cc #8 20.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_2.o SCCP_Mapping_part_2.cc #8 20.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_3.o SCCP_Mapping_part_3.cc #8 20.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_4.o SCCP_Mapping_part_4.cc #8 20.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_5.o SCCP_Mapping_part_5.cc #8 20.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_6.o SCCP_Mapping_part_6.cc #8 20.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCCP_Mapping_part_7.o SCCP_Mapping_part_7.cc #8 20.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_1.o StatsD_Checker_part_1.cc #8 20.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_2.o StatsD_Checker_part_2.cc #8 20.27 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_3.o StatsD_Checker_part_3.cc #8 20.28 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_4.o StatsD_Checker_part_4.cc #8 20.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_5.o StatsD_Checker_part_5.cc #8 20.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_6.o StatsD_Checker_part_6.cc #8 20.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_Checker_part_7.o StatsD_Checker_part_7.cc #8 20.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes.o HNBAP_CommonDataTypes.cc #8 20.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants.o HNBAP_Constants.cc #8 20.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers.o HNBAP_Containers.cc #8 21.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs.o HNBAP_IEs.cc #8 21.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents.o HNBAP_PDU_Contents.cc #8 21.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions.o HNBAP_PDU_Descriptions.cc #8 21.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes.o RANAP_CommonDataTypes.cc #8 21.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants.o RANAP_Constants.cc #8 21.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers.o RANAP_Containers.cc #8 21.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs.o RANAP_IEs.cc #8 22.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents.o RANAP_PDU_Contents.cc #8 22.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions.o RANAP_PDU_Descriptions.cc #8 22.45 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes.o RUA_CommonDataTypes.cc #8 22.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants.o RUA_Constants.cc #8 23.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers.o RUA_Containers.cc #8 23.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs.o RUA_IEs.cc #8 24.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents.o RUA_PDU_Contents.cc #8 24.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions.o RUA_PDU_Descriptions.cc #8 24.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_1.o HNBAP_CommonDataTypes_part_1.cc #8 24.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_2.o HNBAP_CommonDataTypes_part_2.cc #8 24.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_3.o HNBAP_CommonDataTypes_part_3.cc #8 24.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_4.o HNBAP_CommonDataTypes_part_4.cc #8 24.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_5.o HNBAP_CommonDataTypes_part_5.cc #8 24.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_6.o HNBAP_CommonDataTypes_part_6.cc #8 24.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_CommonDataTypes_part_7.o HNBAP_CommonDataTypes_part_7.cc #8 24.52 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_1.o HNBAP_Constants_part_1.cc #8 24.56 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_2.o HNBAP_Constants_part_2.cc #8 24.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_3.o HNBAP_Constants_part_3.cc #8 24.63 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_4.o HNBAP_Constants_part_4.cc #8 24.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_5.o HNBAP_Constants_part_5.cc #8 24.71 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_6.o HNBAP_Constants_part_6.cc #8 24.77 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Constants_part_7.o HNBAP_Constants_part_7.cc #8 24.80 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_1.o HNBAP_Containers_part_1.cc #8 24.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_2.o HNBAP_Containers_part_2.cc #8 24.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_3.o HNBAP_Containers_part_3.cc #8 24.90 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_4.o HNBAP_Containers_part_4.cc #8 24.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_5.o HNBAP_Containers_part_5.cc #8 24.97 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_6.o HNBAP_Containers_part_6.cc #8 25.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_Containers_part_7.o HNBAP_Containers_part_7.cc #8 25.04 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_1.o HNBAP_IEs_part_1.cc #8 25.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_2.o HNBAP_IEs_part_2.cc #8 25.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_3.o HNBAP_IEs_part_3.cc #8 25.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_4.o HNBAP_IEs_part_4.cc #8 25.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_5.o HNBAP_IEs_part_5.cc #8 25.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_6.o HNBAP_IEs_part_6.cc #8 25.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_IEs_part_7.o HNBAP_IEs_part_7.cc #8 25.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_1.o HNBAP_PDU_Contents_part_1.cc #8 25.31 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_2.o HNBAP_PDU_Contents_part_2.cc #8 25.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_3.o HNBAP_PDU_Contents_part_3.cc #8 25.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_4.o HNBAP_PDU_Contents_part_4.cc #8 25.41 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_5.o HNBAP_PDU_Contents_part_5.cc #8 25.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_6.o HNBAP_PDU_Contents_part_6.cc #8 25.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Contents_part_7.o HNBAP_PDU_Contents_part_7.cc #8 25.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_1.o HNBAP_PDU_Descriptions_part_1.cc #8 25.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_2.o HNBAP_PDU_Descriptions_part_2.cc #8 25.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_3.o HNBAP_PDU_Descriptions_part_3.cc #8 25.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_4.o HNBAP_PDU_Descriptions_part_4.cc #8 25.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_5.o HNBAP_PDU_Descriptions_part_5.cc #8 25.68 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_6.o HNBAP_PDU_Descriptions_part_6.cc #8 25.72 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_PDU_Descriptions_part_7.o HNBAP_PDU_Descriptions_part_7.cc #8 25.76 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_1.o RANAP_CommonDataTypes_part_1.cc #8 25.79 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_2.o RANAP_CommonDataTypes_part_2.cc #8 25.83 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_3.o RANAP_CommonDataTypes_part_3.cc #8 25.89 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_4.o RANAP_CommonDataTypes_part_4.cc #8 25.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_5.o RANAP_CommonDataTypes_part_5.cc #8 25.93 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_6.o RANAP_CommonDataTypes_part_6.cc #8 25.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_CommonDataTypes_part_7.o RANAP_CommonDataTypes_part_7.cc #8 26.01 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_1.o RANAP_Constants_part_1.cc #8 26.03 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_2.o RANAP_Constants_part_2.cc #8 26.05 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_3.o RANAP_Constants_part_3.cc #8 26.09 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_4.o RANAP_Constants_part_4.cc #8 26.11 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_5.o RANAP_Constants_part_5.cc #8 26.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_6.o RANAP_Constants_part_6.cc #8 26.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Constants_part_7.o RANAP_Constants_part_7.cc #8 26.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_1.o RANAP_Containers_part_1.cc #8 26.17 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_2.o RANAP_Containers_part_2.cc #8 26.19 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_3.o RANAP_Containers_part_3.cc #8 26.20 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_4.o RANAP_Containers_part_4.cc #8 26.21 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_5.o RANAP_Containers_part_5.cc #8 26.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_6.o RANAP_Containers_part_6.cc #8 26.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_Containers_part_7.o RANAP_Containers_part_7.cc #8 26.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_1.o RANAP_IEs_part_1.cc #8 26.25 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_2.o RANAP_IEs_part_2.cc #8 28.48 RAN_Emulation.cc: In function 'COMPONENT RAN__Emulation::f__comp__by__conn__id(const INTEGER&)': #8 28.48 RAN_Emulation.cc:16604:1: warning: control reaches end of non-void function [-Wreturn-type] #8 28.48 16604 | } #8 28.48 | ^ #8 28.48 RAN_Emulation.cc: In function 'COMPONENT RAN__Emulation::f__comp__by__cic(const INTEGER&)': #8 28.48 RAN_Emulation.cc:16656:1: warning: control reaches end of non-void function [-Wreturn-type] #8 28.48 16656 | } #8 28.48 | ^ #8 28.48 RAN_Emulation.cc: In function 'INTEGER RAN__Emulation::f__conn__id__by__comp(const COMPONENT&)': #8 28.48 RAN_Emulation.cc:16765:1: warning: control reaches end of non-void function [-Wreturn-type] #8 28.48 16765 | } #8 28.48 | ^ #8 28.49 RAN_Emulation.cc: In function 'INTEGER RAN__Emulation::f__idx__by__comp(const COMPONENT&)': #8 28.49 RAN_Emulation.cc:16816:1: warning: control reaches end of non-void function [-Wreturn-type] #8 28.49 16816 | } #8 28.49 | ^ #8 28.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_3.o RANAP_IEs_part_3.cc #8 30.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_4.o RANAP_IEs_part_4.cc #8 30.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_5.o RANAP_IEs_part_5.cc #8 30.63 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_6.o RANAP_IEs_part_6.cc #8 30.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_IEs_part_7.o RANAP_IEs_part_7.cc #8 30.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_1.o RANAP_PDU_Contents_part_1.cc #8 30.92 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_2.o RANAP_PDU_Contents_part_2.cc #8 31.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_3.o RANAP_PDU_Contents_part_3.cc #8 32.12 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_4.o RANAP_PDU_Contents_part_4.cc #8 32.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_5.o RANAP_PDU_Contents_part_5.cc #8 32.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_6.o RANAP_PDU_Contents_part_6.cc #8 34.35 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Contents_part_7.o RANAP_PDU_Contents_part_7.cc #8 36.15 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_1.o RANAP_PDU_Descriptions_part_1.cc #8 36.23 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_2.o RANAP_PDU_Descriptions_part_2.cc #8 36.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_3.o RANAP_PDU_Descriptions_part_3.cc #8 36.30 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_4.o RANAP_PDU_Descriptions_part_4.cc #8 36.32 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_5.o RANAP_PDU_Descriptions_part_5.cc #8 36.34 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_6.o RANAP_PDU_Descriptions_part_6.cc #8 36.36 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_PDU_Descriptions_part_7.o RANAP_PDU_Descriptions_part_7.cc #8 36.38 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_1.o RUA_CommonDataTypes_part_1.cc #8 36.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_2.o RUA_CommonDataTypes_part_2.cc #8 36.43 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_3.o RUA_CommonDataTypes_part_3.cc #8 36.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_4.o RUA_CommonDataTypes_part_4.cc #8 36.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_5.o RUA_CommonDataTypes_part_5.cc #8 36.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_6.o RUA_CommonDataTypes_part_6.cc #8 36.57 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_CommonDataTypes_part_7.o RUA_CommonDataTypes_part_7.cc #8 36.60 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_1.o RUA_Constants_part_1.cc #8 36.64 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_2.o RUA_Constants_part_2.cc #8 36.67 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_3.o RUA_Constants_part_3.cc #8 36.71 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_4.o RUA_Constants_part_4.cc #8 36.75 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_5.o RUA_Constants_part_5.cc #8 36.79 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_6.o RUA_Constants_part_6.cc #8 36.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Constants_part_7.o RUA_Constants_part_7.cc #8 36.87 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_1.o RUA_Containers_part_1.cc #8 36.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_2.o RUA_Containers_part_2.cc #8 36.95 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_3.o RUA_Containers_part_3.cc #8 36.98 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_4.o RUA_Containers_part_4.cc #8 37.02 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_5.o RUA_Containers_part_5.cc #8 37.06 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_6.o RUA_Containers_part_6.cc #8 37.10 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_Containers_part_7.o RUA_Containers_part_7.cc #8 37.14 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_1.o RUA_IEs_part_1.cc #8 37.16 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_2.o RUA_IEs_part_2.cc #8 37.18 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_3.o RUA_IEs_part_3.cc #8 37.22 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_4.o RUA_IEs_part_4.cc #8 37.26 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_5.o RUA_IEs_part_5.cc #8 37.29 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_6.o RUA_IEs_part_6.cc #8 37.33 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_IEs_part_7.o RUA_IEs_part_7.cc #8 37.37 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_1.o RUA_PDU_Contents_part_1.cc #8 37.40 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_2.o RUA_PDU_Contents_part_2.cc #8 37.44 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_3.o RUA_PDU_Contents_part_3.cc #8 37.47 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_4.o RUA_PDU_Contents_part_4.cc #8 37.51 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_5.o RUA_PDU_Contents_part_5.cc #8 37.55 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_6.o RUA_PDU_Contents_part_6.cc #8 37.58 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Contents_part_7.o RUA_PDU_Contents_part_7.cc #8 37.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_1.o RUA_PDU_Descriptions_part_1.cc #8 37.65 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_2.o RUA_PDU_Descriptions_part_2.cc #8 37.69 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_3.o RUA_PDU_Descriptions_part_3.cc #8 37.73 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_4.o RUA_PDU_Descriptions_part_4.cc #8 37.77 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_5.o RUA_PDU_Descriptions_part_5.cc #8 37.81 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_6.o RUA_PDU_Descriptions_part_6.cc #8 37.85 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_PDU_Descriptions_part_7.o RUA_PDU_Descriptions_part_7.cc #8 37.88 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_parse_.tab.o SDP_parse_.tab.c #8 38.50 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o lex.SDP_parse_.o lex.SDP_parse_.c #8 39.07 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPA_CodecPort_CtrlFunctDef.o IPA_CodecPort_CtrlFunctDef.cc #8 39.52 lex.SDP_parse_.c: In function 'int SDP_parse_lex()': #8 39.52 lex.SDP_parse_.c:21592:32: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 21592 | register yy_state_type yy_current_state; #8 39.52 | ^~~~~~~~~~~~~~~~ #8 39.52 lex.SDP_parse_.c:21593:24: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 21593 | register char *yy_cp, *yy_bp; #8 39.52 | ^~~~~ #8 39.52 lex.SDP_parse_.c:21593:32: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 21593 | register char *yy_cp, *yy_bp; #8 39.52 | ^~~~~ #8 39.52 lex.SDP_parse_.c:21594:22: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 21594 | register int yy_act; #8 39.52 | ^~~~~~ #8 39.52 lex.SDP_parse_.c: In function 'int yy_get_next_buffer()': #8 39.52 lex.SDP_parse_.c:22512:24: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 22512 | register char *dest = YY_CURRENT_BUFFER_LVALUE->yy_ch_buf; #8 39.52 | ^~~~ #8 39.52 lex.SDP_parse_.c:22513:24: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 22513 | register char *source = (yytext_ptr); #8 39.52 | ^~~~~~ #8 39.52 lex.SDP_parse_.c:22514:22: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 22514 | register int number_to_move, i; #8 39.52 | ^~~~~~~~~~~~~~ #8 39.52 lex.SDP_parse_.c:22514:38: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.52 22514 | register int number_to_move, i; #8 39.52 | ^ #8 39.53 lex.SDP_parse_.c: In function 'yy_state_type yy_get_previous_state()': #8 39.53 lex.SDP_parse_.c:22646:32: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.53 22646 | register yy_state_type yy_current_state; #8 39.53 | ^~~~~~~~~~~~~~~~ #8 39.53 lex.SDP_parse_.c:22647:24: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.53 22647 | register char *yy_cp; #8 39.53 | ^~~~~ #8 39.53 lex.SDP_parse_.c: In function 'yy_state_type yy_try_NUL_trans(yy_state_type)': #8 39.53 lex.SDP_parse_.c:22676:22: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.53 22676 | register int yy_is_jam; #8 39.53 | ^~~~~~~~~ #8 39.53 lex.SDP_parse_.c:22677:24: warning: ISO C++17 does not allow 'register' storage class specifier [-Wregister] #8 39.53 22677 | register char *yy_cp = (yy_c_buf_p); #8 39.53 | ^~~~~ #8 39.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_PT.o IPL4asp_PT.cc #8 39.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IPL4asp_discovery.o IPL4asp_discovery.cc #8 39.91 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o IuUP_EncDec.o IuUP_EncDec.cc #8 40.13 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Iuh_CodecPort_CtrlFunctDef.o Iuh_CodecPort_CtrlFunctDef.cc #8 40.59 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o Native_FunctionDefs.o Native_FunctionDefs.cc #8 40.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_CodecPort_CtrlFunctDef.o RTP_CodecPort_CtrlFunctDef.cc #8 40.84 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RTP_EncDec.o RTP_EncDec.cc #8 41.46 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SCTPasp_PT.o SCTPasp_PT.cc #8 41.62 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o SDP_EncDec.o SDP_EncDec.cc #8 41.70 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o StatsD_CodecPort_CtrlFunctdef.o StatsD_CodecPort_CtrlFunctdef.cc #8 41.77 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCConversion.o TCCConversion.cc #8 41.78 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCEncoding.o TCCEncoding.cc #8 42.48 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TCCInterface.o TCCInterface.cc #8 42.49 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o TELNETasp_PT.o TELNETasp_PT.cc #8 42.52 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o HNBAP_EncDec.o HNBAP_EncDec.cc #8 42.56 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RUA_EncDec.o RUA_EncDec.cc #8 42.61 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o RANAP_EncDec.o RANAP_EncDec.cc #8 43.41 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o MGCP_CodecPort_CtrlFunctDef.o MGCP_CodecPort_CtrlFunctDef.cc #8 43.42 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o UD_PT.o UD_PT.cc #8 43.53 g++ -c -DLINUX -DMAKEDEPEND_RUN -DUSE_SCTP -DLKSCTP_MULTIHOMING_ENABLED -DAS_USE_SSL -I/usr/include/titan -fPIC -o PFCP_CodecPort_CtrlFunctDef.o PFCP_CodecPort_CtrlFunctDef.cc #8 43.72 g++ -shared -o BSSAP_CodecPort.so BSSAP_CodecPort.o #8 43.84 g++ -shared -o BSSAP_Types.so BSSAP_Types.o #8 44.01 g++ -shared -o DNS_Helpers.so DNS_Helpers.o #8 44.10 g++ -shared -o GSM_Types.so GSM_Types.o #8 44.11 g++ -shared -o General_Types.so General_Types.o #8 44.21 g++ -shared -o HNBAP_Templates.so HNBAP_Templates.o #8 44.22 g++ -shared -o HNBAP_Types.so HNBAP_Types.o #8 44.30 g++ -shared -o HNBGW_Tests.so HNBGW_Tests.o #8 44.32 g++ -shared -o IPA_CodecPort.so IPA_CodecPort.o #8 44.42 g++ -shared -o IPA_CodecPort_CtrlFunct.so IPA_CodecPort_CtrlFunct.o #8 44.42 g++ -shared -o IPA_Types.so IPA_Types.o #8 44.43 g++ -shared -o IPL4asp_Functions.so IPL4asp_Functions.o #8 44.51 g++ -shared -o IPL4asp_PortType.so IPL4asp_PortType.o #8 44.52 g++ -shared -o IPL4asp_Types.so IPL4asp_Types.o #8 44.53 g++ -shared -o IuUP_Emulation.so IuUP_Emulation.o #8 44.60 g++ -shared -o IuUP_Types.so IuUP_Types.o #8 44.61 g++ -shared -o Iuh_CodecPort.so Iuh_CodecPort.o #8 44.62 g++ -shared -o Iuh_CodecPort_CtrlFunct.so Iuh_CodecPort_CtrlFunct.o #8 44.65 g++ -shared -o Iuh_Emulation.so Iuh_Emulation.o #8 44.71 g++ -shared -o Iuh_Types.so Iuh_Types.o #8 44.75 g++ -shared -o L3_Common.so L3_Common.o #8 44.80 g++ -shared -o L3_Templates.so L3_Templates.o #8 44.83 g++ -shared -o M3UA_Emulation.so M3UA_Emulation.o #8 44.85 g++ -shared -o M3UA_Types.so M3UA_Types.o #8 44.86 g++ -shared -o MGCP_CodecPort.so MGCP_CodecPort.o #8 44.94 g++ -shared -o MGCP_CodecPort_CtrlFunct.so MGCP_CodecPort_CtrlFunct.o #8 44.97 g++ -shared -o MGCP_Emulation.so MGCP_Emulation.o #8 44.97 g++ -shared -o MGCP_Templates.so MGCP_Templates.o #8 45.00 g++ -shared -o MGCP_Types.so MGCP_Types.o #8 45.04 g++ -shared -o MTP3asp_PortType.so MTP3asp_PortType.o #8 45.07 g++ -shared -o MTP3asp_Types.so MTP3asp_Types.o #8 45.08 g++ -shared -o Misc_Helpers.so Misc_Helpers.o #8 45.09 g++ -shared -o MobileL3_CC_Types.so MobileL3_CC_Types.o #8 45.17 g++ -shared -o MobileL3_CommonIE_Types.so MobileL3_CommonIE_Types.o #8 45.17 g++ -shared -o MobileL3_GMM_SM_Types.so MobileL3_GMM_SM_Types.o #8 45.18 g++ -shared -o MobileL3_MM_Types.so MobileL3_MM_Types.o #8 45.20 g++ -shared -o MobileL3_RRM_Types.so MobileL3_RRM_Types.o #8 45.26 g++ -shared -o MobileL3_SMS_Types.so MobileL3_SMS_Types.o #8 45.34 g++ -shared -o MobileL3_SS_Types.so MobileL3_SS_Types.o #8 45.35 g++ -shared -o MobileL3_Types.so MobileL3_Types.o #8 45.36 g++ -shared -o Native_Functions.so Native_Functions.o #8 45.44 g++ -shared -o Osmocom_CTRL_Adapter.so Osmocom_CTRL_Adapter.o #8 45.45 g++ -shared -o Osmocom_CTRL_Functions.so Osmocom_CTRL_Functions.o #8 45.46 g++ -shared -o Osmocom_CTRL_Types.so Osmocom_CTRL_Types.o #8 45.49 g++ -shared -o Osmocom_Types.so Osmocom_Types.o #8 45.50 g++ -shared -o Osmocom_VTY_Functions.so Osmocom_VTY_Functions.o #8 45.54 g++ -shared -o PFCP_CodecPort.so PFCP_CodecPort.o #8 45.54 g++ -shared -o PFCP_CodecPort_CtrlFunct.so PFCP_CodecPort_CtrlFunct.o #8 45.55 g++ -shared -o PFCP_Emulation.so PFCP_Emulation.o #8 45.55 g++ -shared -o PFCP_Templates.so PFCP_Templates.o #8 45.62 g++ -shared -o PFCP_Types.so PFCP_Types.o #8 45.65 g++ -shared -o RANAP_CodecPort.so RANAP_CodecPort.o #8 45.65 g++ -shared -o RANAP_Templates.so RANAP_Templates.o #8 45.66 g++ -shared -o RANAP_Types.so RANAP_Types.o #8 45.66 g++ -shared -o RTP_CodecPort.so RTP_CodecPort.o #8 45.70 g++ -shared -o RTP_CodecPort_CtrlFunct.so RTP_CodecPort_CtrlFunct.o #8 45.76 g++ -shared -o RTP_Emulation.so RTP_Emulation.o #8 45.76 g++ -shared -o RTP_Types.so RTP_Types.o #8 45.79 g++ -shared -o RUA_Emulation.so RUA_Emulation.o #8 45.84 g++ -shared -o RUA_Templates.so RUA_Templates.o #8 45.85 g++ -shared -o RUA_Types.so RUA_Types.o #8 45.87 g++ -shared -o SCCP_Emulation.so SCCP_Emulation.o #8 45.92 g++ -shared -o SCCP_Templates.so SCCP_Templates.o #8 45.93 g++ -shared -o SCCP_Types.so SCCP_Types.o #8 45.94 g++ -shared -o SCCPasp_Types.so SCCPasp_Types.o #8 45.99 g++ -shared -o SCTP_Templates.so SCTP_Templates.o #8 46.00 g++ -shared -o SCTPasp_PortType.so SCTPasp_PortType.o #8 46.02 g++ -shared -o SCTPasp_Types.so SCTPasp_Types.o #8 46.04 g++ -shared -o SDP_Templates.so SDP_Templates.o #8 46.07 g++ -shared -o SDP_Types.so SDP_Types.o #8 46.12 g++ -shared -o Socket_API_Definitions.so Socket_API_Definitions.o #8 46.14 g++ -shared -o StatsD_CodecPort.so StatsD_CodecPort.o #8 46.16 g++ -shared -o StatsD_CodecPort_CtrlFunct.so StatsD_CodecPort_CtrlFunct.o #8 46.16 g++ -shared -o StatsD_Types.so StatsD_Types.o #8 46.20 g++ -shared -o TCCConversion_Functions.so TCCConversion_Functions.o #8 46.28 g++ -shared -o TCCEncoding_Functions.so TCCEncoding_Functions.o #8 46.29 g++ -shared -o TCCInterface_Functions.so TCCInterface_Functions.o #8 46.29 g++ -shared -o TELNETasp_PortType.so TELNETasp_PortType.o #8 46.30 g++ -shared -o UD_PortType.so UD_PortType.o #8 46.32 g++ -shared -o UD_Types.so UD_Types.o #8 46.34 g++ -shared -o BSSAP_CodecPort_part_1.so BSSAP_CodecPort_part_1.o #8 46.37 g++ -shared -o BSSAP_CodecPort_part_2.so BSSAP_CodecPort_part_2.o #8 46.39 g++ -shared -o BSSAP_CodecPort_part_3.so BSSAP_CodecPort_part_3.o #8 46.39 g++ -shared -o BSSAP_CodecPort_part_4.so BSSAP_CodecPort_part_4.o #8 46.40 g++ -shared -o BSSAP_CodecPort_part_5.so BSSAP_CodecPort_part_5.o #8 46.41 g++ -shared -o BSSAP_CodecPort_part_6.so BSSAP_CodecPort_part_6.o #8 46.42 g++ -shared -o BSSAP_CodecPort_part_7.so BSSAP_CodecPort_part_7.o #8 46.43 g++ -shared -o BSSAP_Types_part_2.so BSSAP_Types_part_2.o #8 46.44 g++ -shared -o BSSAP_Types_part_3.so BSSAP_Types_part_3.o #8 46.45 g++ -shared -o BSSAP_Types_part_4.so BSSAP_Types_part_4.o #8 46.45 g++ -shared -o BSSAP_Types_part_5.so BSSAP_Types_part_5.o #8 46.45 g++ -shared -o BSSAP_Types_part_6.so BSSAP_Types_part_6.o #8 46.46 g++ -shared -o BSSAP_Types_part_7.so BSSAP_Types_part_7.o #8 46.46 g++ -shared -o DNS_Helpers_part_1.so DNS_Helpers_part_1.o #8 46.47 g++ -shared -o DNS_Helpers_part_2.so DNS_Helpers_part_2.o #8 46.48 g++ -shared -o DNS_Helpers_part_3.so DNS_Helpers_part_3.o #8 46.48 g++ -shared -o DNS_Helpers_part_4.so DNS_Helpers_part_4.o #8 46.48 g++ -shared -o DNS_Helpers_part_5.so DNS_Helpers_part_5.o #8 46.49 g++ -shared -o DNS_Helpers_part_6.so DNS_Helpers_part_6.o #8 46.49 g++ -shared -o DNS_Helpers_part_7.so DNS_Helpers_part_7.o #8 46.50 g++ -shared -o GSM_Types_part_1.so GSM_Types_part_1.o #8 46.50 g++ -shared -o GSM_Types_part_2.so GSM_Types_part_2.o #8 46.51 g++ -shared -o GSM_Types_part_3.so GSM_Types_part_3.o #8 46.51 g++ -shared -o GSM_Types_part_4.so GSM_Types_part_4.o #8 46.51 g++ -shared -o GSM_Types_part_5.so GSM_Types_part_5.o #8 46.52 g++ -shared -o GSM_Types_part_6.so GSM_Types_part_6.o #8 46.52 g++ -shared -o GSM_Types_part_7.so GSM_Types_part_7.o #8 46.53 g++ -shared -o General_Types_part_1.so General_Types_part_1.o #8 46.53 g++ -shared -o General_Types_part_2.so General_Types_part_2.o #8 46.54 g++ -shared -o General_Types_part_3.so General_Types_part_3.o #8 46.55 g++ -shared -o General_Types_part_4.so General_Types_part_4.o #8 46.55 g++ -shared -o General_Types_part_5.so General_Types_part_5.o #8 46.55 g++ -shared -o General_Types_part_6.so General_Types_part_6.o #8 46.56 g++ -shared -o General_Types_part_7.so General_Types_part_7.o #8 46.56 g++ -shared -o HNBAP_Templates_part_1.so HNBAP_Templates_part_1.o #8 46.56 g++ -shared -o HNBAP_Templates_part_2.so HNBAP_Templates_part_2.o #8 46.57 g++ -shared -o HNBAP_Templates_part_3.so HNBAP_Templates_part_3.o #8 46.58 g++ -shared -o HNBAP_Templates_part_4.so HNBAP_Templates_part_4.o #8 46.59 g++ -shared -o HNBAP_Templates_part_5.so HNBAP_Templates_part_5.o #8 46.59 g++ -shared -o HNBAP_Templates_part_6.so HNBAP_Templates_part_6.o #8 46.59 g++ -shared -o HNBAP_Templates_part_7.so HNBAP_Templates_part_7.o #8 46.60 g++ -shared -o HNBAP_Types_part_1.so HNBAP_Types_part_1.o #8 46.60 g++ -shared -o HNBAP_Types_part_2.so HNBAP_Types_part_2.o #8 46.60 g++ -shared -o HNBAP_Types_part_3.so HNBAP_Types_part_3.o #8 46.61 g++ -shared -o HNBAP_Types_part_4.so HNBAP_Types_part_4.o #8 46.63 g++ -shared -o HNBAP_Types_part_5.so HNBAP_Types_part_5.o #8 46.63 g++ -shared -o HNBAP_Types_part_6.so HNBAP_Types_part_6.o #8 46.63 g++ -shared -o HNBAP_Types_part_7.so HNBAP_Types_part_7.o #8 46.63 g++ -shared -o HNBGW_Tests_part_1.so HNBGW_Tests_part_1.o #8 46.64 g++ -shared -o HNBGW_Tests_part_2.so HNBGW_Tests_part_2.o #8 46.65 g++ -shared -o HNBGW_Tests_part_3.so HNBGW_Tests_part_3.o #8 46.65 g++ -shared -o HNBGW_Tests_part_4.so HNBGW_Tests_part_4.o #8 46.65 g++ -shared -o HNBGW_Tests_part_5.so HNBGW_Tests_part_5.o #8 46.66 g++ -shared -o HNBGW_Tests_part_6.so HNBGW_Tests_part_6.o #8 46.67 g++ -shared -o HNBGW_Tests_part_7.so HNBGW_Tests_part_7.o #8 46.68 g++ -shared -o IPA_CodecPort_part_1.so IPA_CodecPort_part_1.o #8 46.68 g++ -shared -o IPA_CodecPort_part_2.so IPA_CodecPort_part_2.o #8 46.68 g++ -shared -o IPA_CodecPort_part_3.so IPA_CodecPort_part_3.o #8 46.68 g++ -shared -o IPA_CodecPort_part_4.so IPA_CodecPort_part_4.o #8 46.70 g++ -shared -o IPA_CodecPort_part_5.so IPA_CodecPort_part_5.o #8 46.71 g++ -shared -o IPA_CodecPort_part_6.so IPA_CodecPort_part_6.o #8 46.71 g++ -shared -o IPA_CodecPort_part_7.so IPA_CodecPort_part_7.o #8 46.71 g++ -shared -o IPA_CodecPort_CtrlFunct_part_1.so IPA_CodecPort_CtrlFunct_part_1.o #8 46.71 g++ -shared -o IPA_CodecPort_CtrlFunct_part_2.so IPA_CodecPort_CtrlFunct_part_2.o #8 46.72 g++ -shared -o IPA_CodecPort_CtrlFunct_part_3.so IPA_CodecPort_CtrlFunct_part_3.o #8 46.73 g++ -shared -o IPA_CodecPort_CtrlFunct_part_4.so IPA_CodecPort_CtrlFunct_part_4.o #8 46.73 g++ -shared -o IPA_CodecPort_CtrlFunct_part_5.so IPA_CodecPort_CtrlFunct_part_5.o #8 46.73 g++ -shared -o IPA_CodecPort_CtrlFunct_part_6.so IPA_CodecPort_CtrlFunct_part_6.o #8 46.73 g++ -shared -o IPA_CodecPort_CtrlFunct_part_7.so IPA_CodecPort_CtrlFunct_part_7.o #8 46.74 g++ -shared -o IPA_Types_part_1.so IPA_Types_part_1.o #8 46.75 g++ -shared -o IPA_Types_part_2.so IPA_Types_part_2.o #8 46.76 g++ -shared -o IPA_Types_part_3.so IPA_Types_part_3.o #8 46.76 g++ -shared -o IPA_Types_part_4.so IPA_Types_part_4.o #8 46.76 g++ -shared -o IPA_Types_part_5.so IPA_Types_part_5.o #8 46.77 g++ -shared -o IPA_Types_part_6.so IPA_Types_part_6.o #8 46.77 g++ -shared -o IPA_Types_part_7.so IPA_Types_part_7.o #8 46.78 g++ -shared -o IPL4asp_Functions_part_1.so IPL4asp_Functions_part_1.o #8 46.79 g++ -shared -o IPL4asp_Functions_part_2.so IPL4asp_Functions_part_2.o #8 46.79 g++ -shared -o IPL4asp_Functions_part_3.so IPL4asp_Functions_part_3.o #8 46.79 g++ -shared -o IPL4asp_Functions_part_4.so IPL4asp_Functions_part_4.o #8 46.80 g++ -shared -o IPL4asp_Functions_part_5.so IPL4asp_Functions_part_5.o #8 46.80 g++ -shared -o IPL4asp_Functions_part_6.so IPL4asp_Functions_part_6.o #8 46.81 g++ -shared -o IPL4asp_Functions_part_7.so IPL4asp_Functions_part_7.o #8 46.81 g++ -shared -o IPL4asp_PortType_part_1.so IPL4asp_PortType_part_1.o #8 46.81 g++ -shared -o IPL4asp_PortType_part_2.so IPL4asp_PortType_part_2.o #8 46.82 g++ -shared -o IPL4asp_PortType_part_3.so IPL4asp_PortType_part_3.o #8 46.82 g++ -shared -o IPL4asp_PortType_part_4.so IPL4asp_PortType_part_4.o #8 46.83 g++ -shared -o IPL4asp_PortType_part_5.so IPL4asp_PortType_part_5.o #8 46.84 g++ -shared -o IPL4asp_PortType_part_6.so IPL4asp_PortType_part_6.o #8 46.85 g++ -shared -o IPL4asp_PortType_part_7.so IPL4asp_PortType_part_7.o #8 46.85 g++ -shared -o IPL4asp_Types_part_1.so IPL4asp_Types_part_1.o #8 46.85 g++ -shared -o IPL4asp_Types_part_2.so IPL4asp_Types_part_2.o #8 46.86 g++ -shared -o IPL4asp_Types_part_3.so IPL4asp_Types_part_3.o #8 46.86 g++ -shared -o IPL4asp_Types_part_4.so IPL4asp_Types_part_4.o #8 46.88 g++ -shared -o IPL4asp_Types_part_5.so IPL4asp_Types_part_5.o #8 46.88 g++ -shared -o IPL4asp_Types_part_6.so IPL4asp_Types_part_6.o #8 46.88 g++ -shared -o IPL4asp_Types_part_7.so IPL4asp_Types_part_7.o #8 46.88 g++ -shared -o IuUP_Emulation_part_1.so IuUP_Emulation_part_1.o #8 46.89 g++ -shared -o IuUP_Emulation_part_2.so IuUP_Emulation_part_2.o #8 46.90 g++ -shared -o IuUP_Emulation_part_3.so IuUP_Emulation_part_3.o #8 46.90 g++ -shared -o IuUP_Emulation_part_4.so IuUP_Emulation_part_4.o #8 46.90 g++ -shared -o IuUP_Emulation_part_5.so IuUP_Emulation_part_5.o #8 46.91 g++ -shared -o IuUP_Emulation_part_6.so IuUP_Emulation_part_6.o #8 46.91 g++ -shared -o IuUP_Emulation_part_7.so IuUP_Emulation_part_7.o #8 46.93 g++ -shared -o IuUP_Types_part_1.so IuUP_Types_part_1.o #8 46.93 g++ -shared -o IuUP_Types_part_2.so IuUP_Types_part_2.o #8 46.93 g++ -shared -o IuUP_Types_part_3.so IuUP_Types_part_3.o #8 46.94 g++ -shared -o IuUP_Types_part_4.so IuUP_Types_part_4.o #8 46.94 g++ -shared -o IuUP_Types_part_5.so IuUP_Types_part_5.o #8 46.95 g++ -shared -o IuUP_Types_part_6.so IuUP_Types_part_6.o #8 46.95 g++ -shared -o IuUP_Types_part_7.so IuUP_Types_part_7.o #8 46.95 g++ -shared -o Iuh_CodecPort_part_1.so Iuh_CodecPort_part_1.o #8 46.96 g++ -shared -o Iuh_CodecPort_part_2.so Iuh_CodecPort_part_2.o #8 46.96 g++ -shared -o Iuh_CodecPort_part_3.so Iuh_CodecPort_part_3.o #8 46.97 g++ -shared -o Iuh_CodecPort_part_4.so Iuh_CodecPort_part_4.o #8 46.98 g++ -shared -o Iuh_CodecPort_part_5.so Iuh_CodecPort_part_5.o #8 46.98 g++ -shared -o Iuh_CodecPort_part_6.so Iuh_CodecPort_part_6.o #8 46.99 g++ -shared -o Iuh_CodecPort_part_7.so Iuh_CodecPort_part_7.o #8 46.99 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_1.so Iuh_CodecPort_CtrlFunct_part_1.o #8 47.00 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_2.so Iuh_CodecPort_CtrlFunct_part_2.o #8 47.00 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_3.so Iuh_CodecPort_CtrlFunct_part_3.o #8 47.01 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_4.so Iuh_CodecPort_CtrlFunct_part_4.o #8 47.01 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_5.so Iuh_CodecPort_CtrlFunct_part_5.o #8 47.03 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_6.so Iuh_CodecPort_CtrlFunct_part_6.o #8 47.03 g++ -shared -o Iuh_CodecPort_CtrlFunct_part_7.so Iuh_CodecPort_CtrlFunct_part_7.o #8 47.03 g++ -shared -o Iuh_Emulation_part_1.so Iuh_Emulation_part_1.o #8 47.03 g++ -shared -o Iuh_Emulation_part_2.so Iuh_Emulation_part_2.o #8 47.04 g++ -shared -o Iuh_Emulation_part_3.so Iuh_Emulation_part_3.o #8 47.05 g++ -shared -o Iuh_Emulation_part_4.so Iuh_Emulation_part_4.o #8 47.05 g++ -shared -o Iuh_Emulation_part_5.so Iuh_Emulation_part_5.o #8 47.06 g++ -shared -o Iuh_Emulation_part_6.so Iuh_Emulation_part_6.o #8 47.06 g++ -shared -o Iuh_Emulation_part_7.so Iuh_Emulation_part_7.o #8 47.08 g++ -shared -o Iuh_Types_part_1.so Iuh_Types_part_1.o #8 47.08 g++ -shared -o Iuh_Types_part_2.so Iuh_Types_part_2.o #8 47.08 g++ -shared -o Iuh_Types_part_3.so Iuh_Types_part_3.o #8 47.08 g++ -shared -o Iuh_Types_part_4.so Iuh_Types_part_4.o #8 47.08 g++ -shared -o Iuh_Types_part_5.so Iuh_Types_part_5.o #8 47.10 g++ -shared -o Iuh_Types_part_6.so Iuh_Types_part_6.o #8 47.10 g++ -shared -o Iuh_Types_part_7.so Iuh_Types_part_7.o #8 47.10 g++ -shared -o L3_Common_part_1.so L3_Common_part_1.o #8 47.11 g++ -shared -o L3_Common_part_2.so L3_Common_part_2.o #8 47.12 g++ -shared -o L3_Common_part_3.so L3_Common_part_3.o #8 47.12 g++ -shared -o L3_Common_part_4.so L3_Common_part_4.o #8 47.13 g++ -shared -o L3_Common_part_5.so L3_Common_part_5.o #8 47.13 g++ -shared -o L3_Common_part_6.so L3_Common_part_6.o #8 47.13 g++ -shared -o L3_Common_part_7.so L3_Common_part_7.o #8 47.14 g++ -shared -o L3_Templates_part_1.so L3_Templates_part_1.o #8 47.15 g++ -shared -o L3_Templates_part_2.so L3_Templates_part_2.o #8 47.15 g++ -shared -o L3_Templates_part_3.so L3_Templates_part_3.o #8 47.15 g++ -shared -o L3_Templates_part_4.so L3_Templates_part_4.o #8 47.15 g++ -shared -o L3_Templates_part_5.so L3_Templates_part_5.o #8 47.17 g++ -shared -o L3_Templates_part_6.so L3_Templates_part_6.o #8 47.17 g++ -shared -o L3_Templates_part_7.so L3_Templates_part_7.o #8 47.18 g++ -shared -o M3UA_Emulation_part_1.so M3UA_Emulation_part_1.o #8 47.18 g++ -shared -o M3UA_Emulation_part_2.so M3UA_Emulation_part_2.o #8 47.20 g++ -shared -o M3UA_Emulation_part_3.so M3UA_Emulation_part_3.o #8 47.20 g++ -shared -o M3UA_Emulation_part_4.so M3UA_Emulation_part_4.o #8 47.20 g++ -shared -o M3UA_Emulation_part_5.so M3UA_Emulation_part_5.o #8 47.20 g++ -shared -o M3UA_Emulation_part_6.so M3UA_Emulation_part_6.o #8 47.22 g++ -shared -o M3UA_Emulation_part_7.so M3UA_Emulation_part_7.o #8 47.22 g++ -shared -o M3UA_Types_part_1.so M3UA_Types_part_1.o #8 47.22 g++ -shared -o M3UA_Types_part_2.so M3UA_Types_part_2.o #8 47.22 g++ -shared -o M3UA_Types_part_3.so M3UA_Types_part_3.o #8 47.23 g++ -shared -o M3UA_Types_part_4.so M3UA_Types_part_4.o #8 47.24 g++ -shared -o M3UA_Types_part_5.so M3UA_Types_part_5.o #8 47.25 g++ -shared -o M3UA_Types_part_6.so M3UA_Types_part_6.o #8 47.27 g++ -shared -o M3UA_Types_part_7.so M3UA_Types_part_7.o #8 47.27 g++ -shared -o MGCP_CodecPort_part_1.so MGCP_CodecPort_part_1.o #8 47.27 g++ -shared -o MGCP_CodecPort_part_2.so MGCP_CodecPort_part_2.o #8 47.27 g++ -shared -o MGCP_CodecPort_part_3.so MGCP_CodecPort_part_3.o #8 47.27 g++ -shared -o MGCP_CodecPort_part_4.so MGCP_CodecPort_part_4.o #8 47.29 g++ -shared -o MGCP_CodecPort_part_5.so MGCP_CodecPort_part_5.o #8 47.29 g++ -shared -o MGCP_CodecPort_part_6.so MGCP_CodecPort_part_6.o #8 47.29 g++ -shared -o MGCP_CodecPort_part_7.so MGCP_CodecPort_part_7.o #8 47.29 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_1.so MGCP_CodecPort_CtrlFunct_part_1.o #8 47.29 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_2.so MGCP_CodecPort_CtrlFunct_part_2.o #8 47.31 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_3.so MGCP_CodecPort_CtrlFunct_part_3.o #8 47.32 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_4.so MGCP_CodecPort_CtrlFunct_part_4.o #8 47.32 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_5.so MGCP_CodecPort_CtrlFunct_part_5.o #8 47.32 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_6.so MGCP_CodecPort_CtrlFunct_part_6.o #8 47.32 g++ -shared -o MGCP_CodecPort_CtrlFunct_part_7.so MGCP_CodecPort_CtrlFunct_part_7.o #8 47.32 g++ -shared -o MGCP_Emulation_part_1.so MGCP_Emulation_part_1.o #8 47.34 g++ -shared -o MGCP_Emulation_part_2.so MGCP_Emulation_part_2.o #8 47.34 g++ -shared -o MGCP_Emulation_part_3.so MGCP_Emulation_part_3.o #8 47.34 g++ -shared -o MGCP_Emulation_part_4.so MGCP_Emulation_part_4.o #8 47.34 g++ -shared -o MGCP_Emulation_part_5.so MGCP_Emulation_part_5.o #8 47.36 g++ -shared -o MGCP_Emulation_part_6.so MGCP_Emulation_part_6.o #8 47.36 g++ -shared -o MGCP_Emulation_part_7.so MGCP_Emulation_part_7.o #8 47.37 g++ -shared -o MGCP_Templates_part_1.so MGCP_Templates_part_1.o #8 47.37 g++ -shared -o MGCP_Templates_part_2.so MGCP_Templates_part_2.o #8 47.37 g++ -shared -o MGCP_Templates_part_3.so MGCP_Templates_part_3.o #8 47.38 g++ -shared -o MGCP_Templates_part_4.so MGCP_Templates_part_4.o #8 47.39 g++ -shared -o MGCP_Templates_part_5.so MGCP_Templates_part_5.o #8 47.39 g++ -shared -o MGCP_Templates_part_6.so MGCP_Templates_part_6.o #8 47.40 g++ -shared -o MGCP_Templates_part_7.so MGCP_Templates_part_7.o #8 47.40 g++ -shared -o MGCP_Types_part_1.so MGCP_Types_part_1.o #8 47.41 g++ -shared -o MGCP_Types_part_2.so MGCP_Types_part_2.o #8 47.41 g++ -shared -o MGCP_Types_part_3.so MGCP_Types_part_3.o #8 47.41 g++ -shared -o MGCP_Types_part_4.so MGCP_Types_part_4.o #8 47.42 g++ -shared -o MGCP_Types_part_5.so MGCP_Types_part_5.o #8 47.42 g++ -shared -o MGCP_Types_part_6.so MGCP_Types_part_6.o #8 47.42 g++ -shared -o MGCP_Types_part_7.so MGCP_Types_part_7.o #8 47.44 g++ -shared -o MTP3asp_PortType_part_1.so MTP3asp_PortType_part_1.o #8 47.44 g++ -shared -o MTP3asp_PortType_part_2.so MTP3asp_PortType_part_2.o #8 47.44 g++ -shared -o MTP3asp_PortType_part_3.so MTP3asp_PortType_part_3.o #8 47.45 g++ -shared -o MTP3asp_PortType_part_4.so MTP3asp_PortType_part_4.o #8 47.45 g++ -shared -o MTP3asp_PortType_part_5.so MTP3asp_PortType_part_5.o #8 47.46 g++ -shared -o MTP3asp_PortType_part_6.so MTP3asp_PortType_part_6.o #8 47.46 g++ -shared -o MTP3asp_PortType_part_7.so MTP3asp_PortType_part_7.o #8 47.46 g++ -shared -o MTP3asp_Types_part_1.so MTP3asp_Types_part_1.o #8 47.47 g++ -shared -o MTP3asp_Types_part_2.so MTP3asp_Types_part_2.o #8 47.47 g++ -shared -o MTP3asp_Types_part_3.so MTP3asp_Types_part_3.o #8 47.49 g++ -shared -o MTP3asp_Types_part_4.so MTP3asp_Types_part_4.o #8 47.49 g++ -shared -o MTP3asp_Types_part_5.so MTP3asp_Types_part_5.o #8 47.49 g++ -shared -o MTP3asp_Types_part_6.so MTP3asp_Types_part_6.o #8 47.50 g++ -shared -o MTP3asp_Types_part_7.so MTP3asp_Types_part_7.o #8 47.50 g++ -shared -o Misc_Helpers_part_1.so Misc_Helpers_part_1.o #8 47.51 g++ -shared -o Misc_Helpers_part_2.so Misc_Helpers_part_2.o #8 47.51 g++ -shared -o Misc_Helpers_part_3.so Misc_Helpers_part_3.o #8 47.52 g++ -shared -o Misc_Helpers_part_4.so Misc_Helpers_part_4.o #8 47.52 g++ -shared -o Misc_Helpers_part_5.so Misc_Helpers_part_5.o #8 47.53 g++ -shared -o Misc_Helpers_part_6.so Misc_Helpers_part_6.o #8 47.54 g++ -shared -o Misc_Helpers_part_7.so Misc_Helpers_part_7.o #8 47.54 g++ -shared -o MobileL3_CC_Types_part_1.so MobileL3_CC_Types_part_1.o #8 47.54 g++ -shared -o MobileL3_CC_Types_part_2.so MobileL3_CC_Types_part_2.o #8 47.55 g++ -shared -o MobileL3_CC_Types_part_3.so MobileL3_CC_Types_part_3.o #8 47.55 g++ -shared -o MobileL3_CC_Types_part_4.so MobileL3_CC_Types_part_4.o #8 47.56 g++ -shared -o MobileL3_CC_Types_part_5.so MobileL3_CC_Types_part_5.o #8 47.57 g++ -shared -o MobileL3_CC_Types_part_6.so MobileL3_CC_Types_part_6.o #8 47.57 g++ -shared -o MobileL3_CC_Types_part_7.so MobileL3_CC_Types_part_7.o #8 47.58 g++ -shared -o MobileL3_CommonIE_Types_part_1.so MobileL3_CommonIE_Types_part_1.o #8 47.58 g++ -shared -o MobileL3_CommonIE_Types_part_2.so MobileL3_CommonIE_Types_part_2.o #8 47.58 g++ -shared -o MobileL3_CommonIE_Types_part_3.so MobileL3_CommonIE_Types_part_3.o #8 47.59 g++ -shared -o MobileL3_CommonIE_Types_part_4.so MobileL3_CommonIE_Types_part_4.o #8 47.60 g++ -shared -o MobileL3_CommonIE_Types_part_5.so MobileL3_CommonIE_Types_part_5.o #8 47.60 g++ -shared -o MobileL3_CommonIE_Types_part_6.so MobileL3_CommonIE_Types_part_6.o #8 47.60 g++ -shared -o MobileL3_CommonIE_Types_part_7.so MobileL3_CommonIE_Types_part_7.o #8 47.61 g++ -shared -o MobileL3_GMM_SM_Types_part_1.so MobileL3_GMM_SM_Types_part_1.o #8 47.61 g++ -shared -o MobileL3_GMM_SM_Types_part_2.so MobileL3_GMM_SM_Types_part_2.o #8 47.62 g++ -shared -o MobileL3_GMM_SM_Types_part_3.so MobileL3_GMM_SM_Types_part_3.o #8 47.62 g++ -shared -o MobileL3_GMM_SM_Types_part_4.so MobileL3_GMM_SM_Types_part_4.o #8 47.63 g++ -shared -o MobileL3_GMM_SM_Types_part_5.so MobileL3_GMM_SM_Types_part_5.o #8 47.63 g++ -shared -o MobileL3_GMM_SM_Types_part_6.so MobileL3_GMM_SM_Types_part_6.o #8 47.63 g++ -shared -o MobileL3_GMM_SM_Types_part_7.so MobileL3_GMM_SM_Types_part_7.o #8 47.64 g++ -shared -o MobileL3_MM_Types_part_1.so MobileL3_MM_Types_part_1.o #8 47.65 g++ -shared -o MobileL3_MM_Types_part_2.so MobileL3_MM_Types_part_2.o #8 47.65 g++ -shared -o MobileL3_MM_Types_part_3.so MobileL3_MM_Types_part_3.o #8 47.65 g++ -shared -o MobileL3_MM_Types_part_4.so MobileL3_MM_Types_part_4.o #8 47.66 g++ -shared -o MobileL3_MM_Types_part_5.so MobileL3_MM_Types_part_5.o #8 47.67 g++ -shared -o MobileL3_MM_Types_part_6.so MobileL3_MM_Types_part_6.o #8 47.68 g++ -shared -o MobileL3_MM_Types_part_7.so MobileL3_MM_Types_part_7.o #8 47.68 g++ -shared -o MobileL3_RRM_Types_part_1.so MobileL3_RRM_Types_part_1.o #8 47.68 g++ -shared -o MobileL3_RRM_Types_part_2.so MobileL3_RRM_Types_part_2.o #8 47.68 g++ -shared -o MobileL3_RRM_Types_part_3.so MobileL3_RRM_Types_part_3.o #8 47.70 g++ -shared -o MobileL3_RRM_Types_part_4.so MobileL3_RRM_Types_part_4.o #8 47.70 g++ -shared -o MobileL3_RRM_Types_part_5.so MobileL3_RRM_Types_part_5.o #8 47.71 g++ -shared -o MobileL3_RRM_Types_part_6.so MobileL3_RRM_Types_part_6.o #8 47.71 g++ -shared -o MobileL3_RRM_Types_part_7.so MobileL3_RRM_Types_part_7.o #8 47.72 g++ -shared -o MobileL3_SMS_Types_part_1.so MobileL3_SMS_Types_part_1.o #8 47.73 g++ -shared -o MobileL3_SMS_Types_part_2.so MobileL3_SMS_Types_part_2.o #8 47.73 g++ -shared -o MobileL3_SMS_Types_part_3.so MobileL3_SMS_Types_part_3.o #8 47.73 g++ -shared -o MobileL3_SMS_Types_part_4.so MobileL3_SMS_Types_part_4.o #8 47.75 g++ -shared -o MobileL3_SMS_Types_part_5.so MobileL3_SMS_Types_part_5.o #8 47.75 g++ -shared -o MobileL3_SMS_Types_part_6.so MobileL3_SMS_Types_part_6.o #8 47.76 g++ -shared -o MobileL3_SMS_Types_part_7.so MobileL3_SMS_Types_part_7.o #8 47.76 g++ -shared -o MobileL3_SS_Types_part_1.so MobileL3_SS_Types_part_1.o #8 47.76 g++ -shared -o MobileL3_SS_Types_part_2.so MobileL3_SS_Types_part_2.o #8 47.78 g++ -shared -o MobileL3_SS_Types_part_3.so MobileL3_SS_Types_part_3.o #8 47.78 g++ -shared -o MobileL3_SS_Types_part_4.so MobileL3_SS_Types_part_4.o #8 47.79 g++ -shared -o MobileL3_SS_Types_part_5.so MobileL3_SS_Types_part_5.o #8 47.79 g++ -shared -o MobileL3_SS_Types_part_6.so MobileL3_SS_Types_part_6.o #8 47.80 g++ -shared -o MobileL3_SS_Types_part_7.so MobileL3_SS_Types_part_7.o #8 47.81 g++ -shared -o MobileL3_Types_part_1.so MobileL3_Types_part_1.o #8 47.82 g++ -shared -o MobileL3_Types_part_2.so MobileL3_Types_part_2.o #8 47.82 g++ -shared -o MobileL3_Types_part_3.so MobileL3_Types_part_3.o #8 47.82 g++ -shared -o MobileL3_Types_part_4.so MobileL3_Types_part_4.o #8 47.83 g++ -shared -o MobileL3_Types_part_5.so MobileL3_Types_part_5.o #8 47.84 g++ -shared -o MobileL3_Types_part_6.so MobileL3_Types_part_6.o #8 47.84 g++ -shared -o MobileL3_Types_part_7.so MobileL3_Types_part_7.o #8 47.84 g++ -shared -o Native_Functions_part_1.so Native_Functions_part_1.o #8 47.85 g++ -shared -o Native_Functions_part_2.so Native_Functions_part_2.o #8 47.85 g++ -shared -o Native_Functions_part_3.so Native_Functions_part_3.o #8 47.85 g++ -shared -o Native_Functions_part_4.so Native_Functions_part_4.o #8 47.86 g++ -shared -o Native_Functions_part_5.so Native_Functions_part_5.o #8 47.87 g++ -shared -o Native_Functions_part_6.so Native_Functions_part_6.o #8 47.87 g++ -shared -o Native_Functions_part_7.so Native_Functions_part_7.o #8 47.87 g++ -shared -o Osmocom_CTRL_Adapter_part_1.so Osmocom_CTRL_Adapter_part_1.o #8 47.88 g++ -shared -o Osmocom_CTRL_Adapter_part_2.so Osmocom_CTRL_Adapter_part_2.o #8 47.88 g++ -shared -o Osmocom_CTRL_Adapter_part_3.so Osmocom_CTRL_Adapter_part_3.o #8 47.88 g++ -shared -o Osmocom_CTRL_Adapter_part_4.so Osmocom_CTRL_Adapter_part_4.o #8 47.90 g++ -shared -o Osmocom_CTRL_Adapter_part_5.so Osmocom_CTRL_Adapter_part_5.o #8 47.90 g++ -shared -o Osmocom_CTRL_Adapter_part_6.so Osmocom_CTRL_Adapter_part_6.o #8 47.90 g++ -shared -o Osmocom_CTRL_Adapter_part_7.so Osmocom_CTRL_Adapter_part_7.o #8 47.90 g++ -shared -o Osmocom_CTRL_Functions_part_1.so Osmocom_CTRL_Functions_part_1.o #8 47.91 g++ -shared -o Osmocom_CTRL_Functions_part_2.so Osmocom_CTRL_Functions_part_2.o #8 47.91 g++ -shared -o Osmocom_CTRL_Functions_part_3.so Osmocom_CTRL_Functions_part_3.o #8 47.91 g++ -shared -o Osmocom_CTRL_Functions_part_4.so Osmocom_CTRL_Functions_part_4.o #8 47.92 g++ -shared -o Osmocom_CTRL_Functions_part_5.so Osmocom_CTRL_Functions_part_5.o #8 47.92 g++ -shared -o Osmocom_CTRL_Functions_part_6.so Osmocom_CTRL_Functions_part_6.o #8 47.93 g++ -shared -o Osmocom_CTRL_Functions_part_7.so Osmocom_CTRL_Functions_part_7.o #8 47.93 g++ -shared -o Osmocom_CTRL_Types_part_1.so Osmocom_CTRL_Types_part_1.o #8 47.94 g++ -shared -o Osmocom_CTRL_Types_part_2.so Osmocom_CTRL_Types_part_2.o #8 47.94 g++ -shared -o Osmocom_CTRL_Types_part_3.so Osmocom_CTRL_Types_part_3.o #8 47.95 g++ -shared -o Osmocom_CTRL_Types_part_4.so Osmocom_CTRL_Types_part_4.o #8 47.95 g++ -shared -o Osmocom_CTRL_Types_part_5.so Osmocom_CTRL_Types_part_5.o #8 47.95 g++ -shared -o Osmocom_CTRL_Types_part_6.so Osmocom_CTRL_Types_part_6.o #8 47.95 g++ -shared -o Osmocom_CTRL_Types_part_7.so Osmocom_CTRL_Types_part_7.o #8 47.96 g++ -shared -o Osmocom_Types_part_1.so Osmocom_Types_part_1.o #8 47.96 g++ -shared -o Osmocom_Types_part_2.so Osmocom_Types_part_2.o #8 47.97 g++ -shared -o Osmocom_Types_part_3.so Osmocom_Types_part_3.o #8 47.98 g++ -shared -o Osmocom_Types_part_4.so Osmocom_Types_part_4.o #8 47.98 g++ -shared -o Osmocom_Types_part_5.so Osmocom_Types_part_5.o #8 47.98 g++ -shared -o Osmocom_Types_part_6.so Osmocom_Types_part_6.o #8 47.98 g++ -shared -o Osmocom_Types_part_7.so Osmocom_Types_part_7.o #8 47.99 g++ -shared -o Osmocom_VTY_Functions_part_1.so Osmocom_VTY_Functions_part_1.o #8 48.00 g++ -shared -o Osmocom_VTY_Functions_part_2.so Osmocom_VTY_Functions_part_2.o #8 48.00 g++ -shared -o Osmocom_VTY_Functions_part_3.so Osmocom_VTY_Functions_part_3.o #8 48.01 g++ -shared -o Osmocom_VTY_Functions_part_4.so Osmocom_VTY_Functions_part_4.o #8 48.01 g++ -shared -o Osmocom_VTY_Functions_part_5.so Osmocom_VTY_Functions_part_5.o #8 48.01 g++ -shared -o Osmocom_VTY_Functions_part_6.so Osmocom_VTY_Functions_part_6.o #8 48.02 g++ -shared -o Osmocom_VTY_Functions_part_7.so Osmocom_VTY_Functions_part_7.o #8 48.02 g++ -shared -o PFCP_CodecPort_part_1.so PFCP_CodecPort_part_1.o #8 48.02 g++ -shared -o PFCP_CodecPort_part_2.so PFCP_CodecPort_part_2.o #8 48.04 g++ -shared -o PFCP_CodecPort_part_3.so PFCP_CodecPort_part_3.o #8 48.04 g++ -shared -o PFCP_CodecPort_part_4.so PFCP_CodecPort_part_4.o #8 48.04 g++ -shared -o PFCP_CodecPort_part_5.so PFCP_CodecPort_part_5.o #8 48.04 g++ -shared -o PFCP_CodecPort_part_6.so PFCP_CodecPort_part_6.o #8 48.04 g++ -shared -o PFCP_CodecPort_part_7.so PFCP_CodecPort_part_7.o #8 48.05 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_1.so PFCP_CodecPort_CtrlFunct_part_1.o #8 48.05 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_2.so PFCP_CodecPort_CtrlFunct_part_2.o #8 48.06 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_3.so PFCP_CodecPort_CtrlFunct_part_3.o #8 48.07 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_4.so PFCP_CodecPort_CtrlFunct_part_4.o #8 48.07 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_5.so PFCP_CodecPort_CtrlFunct_part_5.o #8 48.07 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_6.so PFCP_CodecPort_CtrlFunct_part_6.o #8 48.07 g++ -shared -o PFCP_CodecPort_CtrlFunct_part_7.so PFCP_CodecPort_CtrlFunct_part_7.o #8 48.07 g++ -shared -o PFCP_Emulation_part_1.so PFCP_Emulation_part_1.o #8 48.09 g++ -shared -o PFCP_Emulation_part_2.so PFCP_Emulation_part_2.o #8 48.09 g++ -shared -o PFCP_Emulation_part_3.so PFCP_Emulation_part_3.o #8 48.09 g++ -shared -o PFCP_Emulation_part_4.so PFCP_Emulation_part_4.o #8 48.09 g++ -shared -o PFCP_Emulation_part_5.so PFCP_Emulation_part_5.o #8 48.09 g++ -shared -o PFCP_Emulation_part_6.so PFCP_Emulation_part_6.o #8 48.10 g++ -shared -o PFCP_Emulation_part_7.so PFCP_Emulation_part_7.o #8 48.10 g++ -shared -o PFCP_Templates_part_1.so PFCP_Templates_part_1.o #8 48.11 g++ -shared -o PFCP_Templates_part_2.so PFCP_Templates_part_2.o #8 48.12 g++ -shared -o PFCP_Templates_part_3.so PFCP_Templates_part_3.o #8 48.12 g++ -shared -o PFCP_Templates_part_4.so PFCP_Templates_part_4.o #8 48.12 g++ -shared -o PFCP_Templates_part_5.so PFCP_Templates_part_5.o #8 48.12 g++ -shared -o PFCP_Templates_part_6.so PFCP_Templates_part_6.o #8 48.12 g++ -shared -o PFCP_Templates_part_7.so PFCP_Templates_part_7.o #8 48.12 g++ -shared -o PFCP_Types_part_1.so PFCP_Types_part_1.o #8 48.14 g++ -shared -o PFCP_Types_part_2.so PFCP_Types_part_2.o #8 48.14 g++ -shared -o PFCP_Types_part_3.so PFCP_Types_part_3.o #8 48.14 g++ -shared -o PFCP_Types_part_4.so PFCP_Types_part_4.o #8 48.14 g++ -shared -o PFCP_Types_part_5.so PFCP_Types_part_5.o #8 48.15 g++ -shared -o PFCP_Types_part_6.so PFCP_Types_part_6.o #8 48.15 g++ -shared -o PFCP_Types_part_7.so PFCP_Types_part_7.o #8 48.15 g++ -shared -o RANAP_CodecPort_part_1.so RANAP_CodecPort_part_1.o #8 48.17 g++ -shared -o RANAP_CodecPort_part_2.so RANAP_CodecPort_part_2.o #8 48.17 g++ -shared -o RANAP_CodecPort_part_3.so RANAP_CodecPort_part_3.o #8 48.17 g++ -shared -o RANAP_CodecPort_part_4.so RANAP_CodecPort_part_4.o #8 48.17 g++ -shared -o RANAP_CodecPort_part_5.so RANAP_CodecPort_part_5.o #8 48.17 g++ -shared -o RANAP_CodecPort_part_6.so RANAP_CodecPort_part_6.o #8 48.18 g++ -shared -o RANAP_CodecPort_part_7.so RANAP_CodecPort_part_7.o #8 48.20 g++ -shared -o RANAP_Templates_part_1.so RANAP_Templates_part_1.o #8 48.20 g++ -shared -o RANAP_Templates_part_2.so RANAP_Templates_part_2.o #8 48.20 g++ -shared -o RANAP_Templates_part_3.so RANAP_Templates_part_3.o #8 48.20 g++ -shared -o RANAP_Templates_part_4.so RANAP_Templates_part_4.o #8 48.20 g++ -shared -o RANAP_Templates_part_5.so RANAP_Templates_part_5.o #8 48.21 g++ -shared -o RANAP_Templates_part_6.so RANAP_Templates_part_6.o #8 48.23 g++ -shared -o RANAP_Templates_part_7.so RANAP_Templates_part_7.o #8 48.23 g++ -shared -o RANAP_Types_part_1.so RANAP_Types_part_1.o #8 48.23 g++ -shared -o RANAP_Types_part_2.so RANAP_Types_part_2.o #8 48.23 g++ -shared -o RANAP_Types_part_3.so RANAP_Types_part_3.o #8 48.23 g++ -shared -o RANAP_Types_part_4.so RANAP_Types_part_4.o #8 48.23 g++ -shared -o RANAP_Types_part_5.so RANAP_Types_part_5.o #8 48.25 g++ -shared -o RANAP_Types_part_6.so RANAP_Types_part_6.o #8 48.25 g++ -shared -o RANAP_Types_part_7.so RANAP_Types_part_7.o #8 48.25 g++ -shared -o RTP_CodecPort_part_1.so RTP_CodecPort_part_1.o #8 48.25 g++ -shared -o RTP_CodecPort_part_2.so RTP_CodecPort_part_2.o #8 48.26 g++ -shared -o RTP_CodecPort_part_3.so RTP_CodecPort_part_3.o #8 48.26 g++ -shared -o RTP_CodecPort_part_4.so RTP_CodecPort_part_4.o #8 48.26 g++ -shared -o RTP_CodecPort_part_5.so RTP_CodecPort_part_5.o #8 48.27 g++ -shared -o RTP_CodecPort_part_6.so RTP_CodecPort_part_6.o #8 48.28 g++ -shared -o RTP_CodecPort_part_7.so RTP_CodecPort_part_7.o #8 48.28 g++ -shared -o RTP_CodecPort_CtrlFunct_part_1.so RTP_CodecPort_CtrlFunct_part_1.o #8 48.28 g++ -shared -o RTP_CodecPort_CtrlFunct_part_2.so RTP_CodecPort_CtrlFunct_part_2.o #8 48.28 g++ -shared -o RTP_CodecPort_CtrlFunct_part_3.so RTP_CodecPort_CtrlFunct_part_3.o #8 48.28 g++ -shared -o RTP_CodecPort_CtrlFunct_part_4.so RTP_CodecPort_CtrlFunct_part_4.o #8 48.28 g++ -shared -o RTP_CodecPort_CtrlFunct_part_5.so RTP_CodecPort_CtrlFunct_part_5.o #8 48.29 g++ -shared -o RTP_CodecPort_CtrlFunct_part_6.so RTP_CodecPort_CtrlFunct_part_6.o #8 48.30 g++ -shared -o RTP_CodecPort_CtrlFunct_part_7.so RTP_CodecPort_CtrlFunct_part_7.o #8 48.30 g++ -shared -o RTP_Emulation_part_1.so RTP_Emulation_part_1.o #8 48.30 g++ -shared -o RTP_Emulation_part_2.so RTP_Emulation_part_2.o #8 48.31 g++ -shared -o RTP_Emulation_part_3.so RTP_Emulation_part_3.o #8 48.31 g++ -shared -o RTP_Emulation_part_4.so RTP_Emulation_part_4.o #8 48.31 g++ -shared -o RTP_Emulation_part_5.so RTP_Emulation_part_5.o #8 48.32 g++ -shared -o RTP_Emulation_part_6.so RTP_Emulation_part_6.o #8 48.34 g++ -shared -o RTP_Emulation_part_7.so RTP_Emulation_part_7.o #8 48.34 g++ -shared -o RTP_Types_part_1.so RTP_Types_part_1.o #8 48.34 g++ -shared -o RTP_Types_part_2.so RTP_Types_part_2.o #8 48.34 g++ -shared -o RTP_Types_part_3.so RTP_Types_part_3.o #8 48.34 g++ -shared -o RTP_Types_part_4.so RTP_Types_part_4.o #8 48.34 g++ -shared -o RTP_Types_part_5.so RTP_Types_part_5.o #8 48.34 g++ -shared -o RTP_Types_part_6.so RTP_Types_part_6.o #8 48.36 g++ -shared -o RTP_Types_part_7.so RTP_Types_part_7.o #8 48.37 g++ -shared -o RUA_Emulation_part_1.so RUA_Emulation_part_1.o #8 48.37 g++ -shared -o RUA_Emulation_part_2.so RUA_Emulation_part_2.o #8 48.37 g++ -shared -o RUA_Emulation_part_3.so RUA_Emulation_part_3.o #8 48.37 g++ -shared -o RUA_Emulation_part_4.so RUA_Emulation_part_4.o #8 48.37 g++ -shared -o RUA_Emulation_part_5.so RUA_Emulation_part_5.o #8 48.37 g++ -shared -o RUA_Emulation_part_6.so RUA_Emulation_part_6.o #8 48.38 g++ -shared -o RUA_Emulation_part_7.so RUA_Emulation_part_7.o #8 48.39 g++ -shared -o RUA_Templates_part_1.so RUA_Templates_part_1.o #8 48.39 g++ -shared -o RUA_Templates_part_2.so RUA_Templates_part_2.o #8 48.41 g++ -shared -o RUA_Templates_part_3.so RUA_Templates_part_3.o #8 48.41 g++ -shared -o RUA_Templates_part_4.so RUA_Templates_part_4.o #8 48.41 g++ -shared -o RUA_Templates_part_5.so RUA_Templates_part_5.o #8 48.41 g++ -shared -o RUA_Templates_part_6.so RUA_Templates_part_6.o #8 48.41 g++ -shared -o RUA_Templates_part_7.so RUA_Templates_part_7.o #8 48.41 g++ -shared -o RUA_Types_part_1.so RUA_Types_part_1.o #8 48.42 g++ -shared -o RUA_Types_part_2.so RUA_Types_part_2.o #8 48.42 g++ -shared -o RUA_Types_part_3.so RUA_Types_part_3.o #8 48.43 g++ -shared -o RUA_Types_part_4.so RUA_Types_part_4.o #8 48.43 g++ -shared -o RUA_Types_part_5.so RUA_Types_part_5.o #8 48.44 g++ -shared -o RUA_Types_part_6.so RUA_Types_part_6.o #8 48.44 g++ -shared -o RUA_Types_part_7.so RUA_Types_part_7.o #8 48.44 g++ -shared -o SCCP_Emulation_part_1.so SCCP_Emulation_part_1.o #8 48.44 g++ -shared -o SCCP_Emulation_part_2.so SCCP_Emulation_part_2.o #8 48.44 g++ -shared -o SCCP_Emulation_part_3.so SCCP_Emulation_part_3.o #8 48.44 g++ -shared -o SCCP_Emulation_part_4.so SCCP_Emulation_part_4.o #8 48.45 g++ -shared -o SCCP_Emulation_part_5.so SCCP_Emulation_part_5.o #8 48.46 g++ -shared -o SCCP_Emulation_part_6.so SCCP_Emulation_part_6.o #8 48.46 g++ -shared -o SCCP_Emulation_part_7.so SCCP_Emulation_part_7.o #8 48.47 g++ -shared -o SCCP_Templates_part_1.so SCCP_Templates_part_1.o #8 48.47 g++ -shared -o SCCP_Templates_part_2.so SCCP_Templates_part_2.o #8 48.47 g++ -shared -o SCCP_Templates_part_3.so SCCP_Templates_part_3.o #8 48.47 g++ -shared -o SCCP_Templates_part_4.so SCCP_Templates_part_4.o #8 48.47 g++ -shared -o SCCP_Templates_part_5.so SCCP_Templates_part_5.o #8 48.48 g++ -shared -o SCCP_Templates_part_6.so SCCP_Templates_part_6.o #8 48.49 g++ -shared -o SCCP_Templates_part_7.so SCCP_Templates_part_7.o #8 48.49 g++ -shared -o SCCP_Types_part_1.so SCCP_Types_part_1.o #8 48.49 g++ -shared -o SCCP_Types_part_2.so SCCP_Types_part_2.o #8 48.49 g++ -shared -o SCCP_Types_part_3.so SCCP_Types_part_3.o #8 48.49 g++ -shared -o SCCP_Types_part_4.so SCCP_Types_part_4.o #8 48.49 g++ -shared -o SCCP_Types_part_5.so SCCP_Types_part_5.o #8 48.51 g++ -shared -o SCCP_Types_part_6.so SCCP_Types_part_6.o #8 48.51 g++ -shared -o SCCP_Types_part_7.so SCCP_Types_part_7.o #8 48.51 g++ -shared -o SCCPasp_Types_part_1.so SCCPasp_Types_part_1.o #8 48.52 g++ -shared -o SCCPasp_Types_part_2.so SCCPasp_Types_part_2.o #8 48.52 g++ -shared -o SCCPasp_Types_part_3.so SCCPasp_Types_part_3.o #8 48.52 g++ -shared -o SCCPasp_Types_part_4.so SCCPasp_Types_part_4.o #8 48.52 g++ -shared -o SCCPasp_Types_part_5.so SCCPasp_Types_part_5.o #8 48.52 g++ -shared -o SCCPasp_Types_part_6.so SCCPasp_Types_part_6.o #8 48.53 g++ -shared -o SCCPasp_Types_part_7.so SCCPasp_Types_part_7.o #8 48.53 g++ -shared -o SCTP_Templates_part_1.so SCTP_Templates_part_1.o #8 48.53 g++ -shared -o SCTP_Templates_part_2.so SCTP_Templates_part_2.o #8 48.54 g++ -shared -o SCTP_Templates_part_3.so SCTP_Templates_part_3.o #8 48.54 g++ -shared -o SCTP_Templates_part_4.so SCTP_Templates_part_4.o #8 48.55 g++ -shared -o SCTP_Templates_part_5.so SCTP_Templates_part_5.o #8 48.55 g++ -shared -o SCTP_Templates_part_6.so SCTP_Templates_part_6.o #8 48.55 g++ -shared -o SCTP_Templates_part_7.so SCTP_Templates_part_7.o #8 48.56 g++ -shared -o SCTPasp_PortType_part_1.so SCTPasp_PortType_part_1.o #8 48.56 g++ -shared -o SCTPasp_PortType_part_2.so SCTPasp_PortType_part_2.o #8 48.56 g++ -shared -o SCTPasp_PortType_part_3.so SCTPasp_PortType_part_3.o #8 48.57 g++ -shared -o SCTPasp_PortType_part_4.so SCTPasp_PortType_part_4.o #8 48.57 g++ -shared -o SCTPasp_PortType_part_5.so SCTPasp_PortType_part_5.o #8 48.57 g++ -shared -o SCTPasp_PortType_part_6.so SCTPasp_PortType_part_6.o #8 48.57 g++ -shared -o SCTPasp_PortType_part_7.so SCTPasp_PortType_part_7.o #8 48.57 g++ -shared -o SCTPasp_Types_part_1.so SCTPasp_Types_part_1.o #8 48.58 g++ -shared -o SCTPasp_Types_part_2.so SCTPasp_Types_part_2.o #8 48.58 g++ -shared -o SCTPasp_Types_part_3.so SCTPasp_Types_part_3.o #8 48.58 g++ -shared -o SCTPasp_Types_part_4.so SCTPasp_Types_part_4.o #8 48.58 g++ -shared -o SCTPasp_Types_part_5.so SCTPasp_Types_part_5.o #8 48.59 g++ -shared -o SCTPasp_Types_part_6.so SCTPasp_Types_part_6.o #8 48.60 g++ -shared -o SCTPasp_Types_part_7.so SCTPasp_Types_part_7.o #8 48.60 g++ -shared -o SDP_Templates_part_1.so SDP_Templates_part_1.o #8 48.60 g++ -shared -o SDP_Templates_part_2.so SDP_Templates_part_2.o #8 48.61 g++ -shared -o SDP_Templates_part_3.so SDP_Templates_part_3.o #8 48.61 g++ -shared -o SDP_Templates_part_4.so SDP_Templates_part_4.o #8 48.62 g++ -shared -o SDP_Templates_part_5.so SDP_Templates_part_5.o #8 48.62 g++ -shared -o SDP_Templates_part_6.so SDP_Templates_part_6.o #8 48.62 g++ -shared -o SDP_Templates_part_7.so SDP_Templates_part_7.o #8 48.62 g++ -shared -o SDP_Types_part_1.so SDP_Types_part_1.o #8 48.62 g++ -shared -o SDP_Types_part_2.so SDP_Types_part_2.o #8 48.63 g++ -shared -o SDP_Types_part_3.so SDP_Types_part_3.o #8 48.63 g++ -shared -o SDP_Types_part_4.so SDP_Types_part_4.o #8 48.65 g++ -shared -o SDP_Types_part_5.so SDP_Types_part_5.o #8 48.65 g++ -shared -o SDP_Types_part_6.so SDP_Types_part_6.o #8 48.65 g++ -shared -o SDP_Types_part_7.so SDP_Types_part_7.o #8 48.65 g++ -shared -o Socket_API_Definitions_part_1.so Socket_API_Definitions_part_1.o #8 48.65 g++ -shared -o Socket_API_Definitions_part_2.so Socket_API_Definitions_part_2.o #8 48.65 g++ -shared -o Socket_API_Definitions_part_3.so Socket_API_Definitions_part_3.o #8 48.66 g++ -shared -o Socket_API_Definitions_part_4.so Socket_API_Definitions_part_4.o #8 48.66 g++ -shared -o Socket_API_Definitions_part_5.so Socket_API_Definitions_part_5.o #8 48.67 g++ -shared -o Socket_API_Definitions_part_6.so Socket_API_Definitions_part_6.o #8 48.67 g++ -shared -o Socket_API_Definitions_part_7.so Socket_API_Definitions_part_7.o #8 48.67 g++ -shared -o StatsD_CodecPort_part_1.so StatsD_CodecPort_part_1.o #8 48.67 g++ -shared -o StatsD_CodecPort_part_2.so StatsD_CodecPort_part_2.o #8 48.67 g++ -shared -o StatsD_CodecPort_part_3.so StatsD_CodecPort_part_3.o #8 48.68 g++ -shared -o StatsD_CodecPort_part_4.so StatsD_CodecPort_part_4.o #8 48.68 g++ -shared -o StatsD_CodecPort_part_5.so StatsD_CodecPort_part_5.o #8 48.68 g++ -shared -o StatsD_CodecPort_part_6.so StatsD_CodecPort_part_6.o #8 48.69 g++ -shared -o StatsD_CodecPort_part_7.so StatsD_CodecPort_part_7.o #8 48.70 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_1.so StatsD_CodecPort_CtrlFunct_part_1.o #8 48.70 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_2.so StatsD_CodecPort_CtrlFunct_part_2.o #8 48.70 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_3.so StatsD_CodecPort_CtrlFunct_part_3.o #8 48.70 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_4.so StatsD_CodecPort_CtrlFunct_part_4.o #8 48.71 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_5.so StatsD_CodecPort_CtrlFunct_part_5.o #8 48.71 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_6.so StatsD_CodecPort_CtrlFunct_part_6.o #8 48.71 g++ -shared -o StatsD_CodecPort_CtrlFunct_part_7.so StatsD_CodecPort_CtrlFunct_part_7.o #8 48.71 g++ -shared -o StatsD_Types_part_1.so StatsD_Types_part_1.o #8 48.71 g++ -shared -o StatsD_Types_part_2.so StatsD_Types_part_2.o #8 48.72 g++ -shared -o StatsD_Types_part_3.so StatsD_Types_part_3.o #8 48.73 g++ -shared -o StatsD_Types_part_4.so StatsD_Types_part_4.o #8 48.73 g++ -shared -o StatsD_Types_part_5.so StatsD_Types_part_5.o #8 48.73 g++ -shared -o StatsD_Types_part_6.so StatsD_Types_part_6.o #8 48.73 g++ -shared -o StatsD_Types_part_7.so StatsD_Types_part_7.o #8 48.74 g++ -shared -o TCCConversion_Functions_part_1.so TCCConversion_Functions_part_1.o #8 48.74 g++ -shared -o TCCConversion_Functions_part_2.so TCCConversion_Functions_part_2.o #8 48.74 g++ -shared -o TCCConversion_Functions_part_3.so TCCConversion_Functions_part_3.o #8 48.75 g++ -shared -o TCCConversion_Functions_part_4.so TCCConversion_Functions_part_4.o #8 48.75 g++ -shared -o TCCConversion_Functions_part_5.so TCCConversion_Functions_part_5.o #8 48.76 g++ -shared -o TCCConversion_Functions_part_6.so TCCConversion_Functions_part_6.o #8 48.76 g++ -shared -o TCCConversion_Functions_part_7.so TCCConversion_Functions_part_7.o #8 48.76 g++ -shared -o TCCEncoding_Functions_part_1.so TCCEncoding_Functions_part_1.o #8 48.76 g++ -shared -o TCCEncoding_Functions_part_2.so TCCEncoding_Functions_part_2.o #8 48.76 g++ -shared -o TCCEncoding_Functions_part_3.so TCCEncoding_Functions_part_3.o #8 48.77 g++ -shared -o TCCEncoding_Functions_part_4.so TCCEncoding_Functions_part_4.o #8 48.77 g++ -shared -o TCCEncoding_Functions_part_5.so TCCEncoding_Functions_part_5.o #8 48.78 g++ -shared -o TCCEncoding_Functions_part_6.so TCCEncoding_Functions_part_6.o #8 48.78 g++ -shared -o TCCEncoding_Functions_part_7.so TCCEncoding_Functions_part_7.o #8 48.79 g++ -shared -o TCCInterface_Functions_part_1.so TCCInterface_Functions_part_1.o #8 48.79 g++ -shared -o TCCInterface_Functions_part_2.so TCCInterface_Functions_part_2.o #8 48.79 g++ -shared -o TCCInterface_Functions_part_3.so TCCInterface_Functions_part_3.o #8 48.79 g++ -shared -o TCCInterface_Functions_part_4.so TCCInterface_Functions_part_4.o #8 48.79 g++ -shared -o TCCInterface_Functions_part_5.so TCCInterface_Functions_part_5.o #8 48.80 g++ -shared -o TCCInterface_Functions_part_6.so TCCInterface_Functions_part_6.o #8 48.80 g++ -shared -o TCCInterface_Functions_part_7.so TCCInterface_Functions_part_7.o #8 48.80 g++ -shared -o TELNETasp_PortType_part_1.so TELNETasp_PortType_part_1.o #8 48.81 g++ -shared -o TELNETasp_PortType_part_2.so TELNETasp_PortType_part_2.o #8 48.82 g++ -shared -o TELNETasp_PortType_part_3.so TELNETasp_PortType_part_3.o #8 48.82 g++ -shared -o TELNETasp_PortType_part_4.so TELNETasp_PortType_part_4.o #8 48.82 g++ -shared -o TELNETasp_PortType_part_5.so TELNETasp_PortType_part_5.o #8 48.82 g++ -shared -o TELNETasp_PortType_part_6.so TELNETasp_PortType_part_6.o #8 48.82 g++ -shared -o TELNETasp_PortType_part_7.so TELNETasp_PortType_part_7.o #8 48.83 g++ -shared -o UD_PortType_part_1.so UD_PortType_part_1.o #8 48.83 g++ -shared -o UD_PortType_part_2.so UD_PortType_part_2.o #8 48.84 g++ -shared -o UD_PortType_part_3.so UD_PortType_part_3.o #8 48.84 g++ -shared -o UD_PortType_part_4.so UD_PortType_part_4.o #8 48.84 g++ -shared -o UD_PortType_part_5.so UD_PortType_part_5.o #8 48.84 g++ -shared -o UD_PortType_part_6.so UD_PortType_part_6.o #8 48.85 g++ -shared -o UD_PortType_part_7.so UD_PortType_part_7.o #8 48.85 g++ -shared -o UD_Types_part_1.so UD_Types_part_1.o #8 48.85 g++ -shared -o UD_Types_part_2.so UD_Types_part_2.o #8 48.86 g++ -shared -o UD_Types_part_3.so UD_Types_part_3.o #8 48.86 g++ -shared -o UD_Types_part_4.so UD_Types_part_4.o #8 48.86 g++ -shared -o UD_Types_part_5.so UD_Types_part_5.o #8 48.87 g++ -shared -o UD_Types_part_6.so UD_Types_part_6.o #8 48.87 g++ -shared -o UD_Types_part_7.so UD_Types_part_7.o #8 48.88 g++ -shared -o IPA_Emulation.so IPA_Emulation.o #8 48.88 g++ -shared -o RAN_Adapter.so RAN_Adapter.o #8 48.88 g++ -shared -o RAN_Emulation.so RAN_Emulation.o #8 48.88 g++ -shared -o SCCP_Mapping.so SCCP_Mapping.o #8 48.88 g++ -shared -o StatsD_Checker.so StatsD_Checker.o #8 48.89 g++ -shared -o IPA_Emulation_part_1.so IPA_Emulation_part_1.o #8 48.89 g++ -shared -o IPA_Emulation_part_2.so IPA_Emulation_part_2.o #8 48.90 g++ -shared -o IPA_Emulation_part_3.so IPA_Emulation_part_3.o #8 48.90 g++ -shared -o IPA_Emulation_part_4.so IPA_Emulation_part_4.o #8 48.92 g++ -shared -o IPA_Emulation_part_5.so IPA_Emulation_part_5.o #8 48.92 g++ -shared -o IPA_Emulation_part_6.so IPA_Emulation_part_6.o #8 48.92 g++ -shared -o IPA_Emulation_part_7.so IPA_Emulation_part_7.o #8 48.93 g++ -shared -o RAN_Adapter_part_1.so RAN_Adapter_part_1.o #8 48.94 g++ -shared -o RAN_Adapter_part_2.so RAN_Adapter_part_2.o #8 48.95 g++ -shared -o RAN_Adapter_part_3.so RAN_Adapter_part_3.o #8 48.95 g++ -shared -o RAN_Adapter_part_4.so RAN_Adapter_part_4.o #8 48.97 g++ -shared -o RAN_Adapter_part_5.so RAN_Adapter_part_5.o #8 48.97 g++ -shared -o RAN_Adapter_part_6.so RAN_Adapter_part_6.o #8 48.98 g++ -shared -o RAN_Adapter_part_7.so RAN_Adapter_part_7.o #8 48.98 g++ -shared -o RAN_Emulation_part_1.so RAN_Emulation_part_1.o #8 48.99 g++ -shared -o RAN_Emulation_part_2.so RAN_Emulation_part_2.o #8 48.99 g++ -shared -o RAN_Emulation_part_3.so RAN_Emulation_part_3.o #8 49.00 g++ -shared -o RAN_Emulation_part_4.so RAN_Emulation_part_4.o #8 49.01 g++ -shared -o RAN_Emulation_part_5.so RAN_Emulation_part_5.o #8 49.01 g++ -shared -o RAN_Emulation_part_6.so RAN_Emulation_part_6.o #8 49.01 g++ -shared -o RAN_Emulation_part_7.so RAN_Emulation_part_7.o #8 49.02 g++ -shared -o SCCP_Mapping_part_1.so SCCP_Mapping_part_1.o #8 49.02 g++ -shared -o SCCP_Mapping_part_2.so SCCP_Mapping_part_2.o #8 49.02 g++ -shared -o SCCP_Mapping_part_3.so SCCP_Mapping_part_3.o #8 49.02 g++ -shared -o SCCP_Mapping_part_4.so SCCP_Mapping_part_4.o #8 49.03 g++ -shared -o SCCP_Mapping_part_5.so SCCP_Mapping_part_5.o #8 49.04 g++ -shared -o SCCP_Mapping_part_6.so SCCP_Mapping_part_6.o #8 49.04 g++ -shared -o SCCP_Mapping_part_7.so SCCP_Mapping_part_7.o #8 49.04 g++ -shared -o StatsD_Checker_part_1.so StatsD_Checker_part_1.o #8 49.04 g++ -shared -o StatsD_Checker_part_2.so StatsD_Checker_part_2.o #8 49.05 g++ -shared -o StatsD_Checker_part_3.so StatsD_Checker_part_3.o #8 49.05 g++ -shared -o StatsD_Checker_part_4.so StatsD_Checker_part_4.o #8 49.05 g++ -shared -o StatsD_Checker_part_5.so StatsD_Checker_part_5.o #8 49.06 g++ -shared -o StatsD_Checker_part_6.so StatsD_Checker_part_6.o #8 49.06 g++ -shared -o StatsD_Checker_part_7.so StatsD_Checker_part_7.o #8 49.06 g++ -shared -o HNBAP_CommonDataTypes.so HNBAP_CommonDataTypes.o #8 49.07 g++ -shared -o HNBAP_Constants.so HNBAP_Constants.o #8 49.07 g++ -shared -o HNBAP_Containers.so HNBAP_Containers.o #8 49.07 g++ -shared -o HNBAP_IEs.so HNBAP_IEs.o #8 49.08 g++ -shared -o HNBAP_PDU_Contents.so HNBAP_PDU_Contents.o #8 49.08 g++ -shared -o HNBAP_PDU_Descriptions.so HNBAP_PDU_Descriptions.o #8 49.09 g++ -shared -o RANAP_CommonDataTypes.so RANAP_CommonDataTypes.o #8 49.09 g++ -shared -o RANAP_Constants.so RANAP_Constants.o #8 49.10 g++ -shared -o RANAP_Containers.so RANAP_Containers.o #8 49.18 g++ -shared -o RANAP_IEs.so RANAP_IEs.o #8 49.20 g++ -shared -o RANAP_PDU_Contents.so RANAP_PDU_Contents.o #8 49.21 g++ -shared -o RANAP_PDU_Descriptions.so RANAP_PDU_Descriptions.o #8 49.21 g++ -shared -o RUA_CommonDataTypes.so RUA_CommonDataTypes.o #8 49.21 g++ -shared -o RUA_Constants.so RUA_Constants.o #8 49.24 g++ -shared -o RUA_Containers.so RUA_Containers.o #8 49.25 g++ -shared -o RUA_IEs.so RUA_IEs.o #8 49.33 g++ -shared -o RUA_PDU_Contents.so RUA_PDU_Contents.o #8 49.34 g++ -shared -o RUA_PDU_Descriptions.so RUA_PDU_Descriptions.o #8 49.35 g++ -shared -o HNBAP_CommonDataTypes_part_1.so HNBAP_CommonDataTypes_part_1.o #8 49.37 g++ -shared -o HNBAP_CommonDataTypes_part_2.so HNBAP_CommonDataTypes_part_2.o #8 49.38 g++ -shared -o HNBAP_CommonDataTypes_part_3.so HNBAP_CommonDataTypes_part_3.o #8 49.39 g++ -shared -o HNBAP_CommonDataTypes_part_4.so HNBAP_CommonDataTypes_part_4.o #8 49.40 g++ -shared -o HNBAP_CommonDataTypes_part_5.so HNBAP_CommonDataTypes_part_5.o #8 49.41 g++ -shared -o HNBAP_CommonDataTypes_part_6.so HNBAP_CommonDataTypes_part_6.o #8 49.41 g++ -shared -o HNBAP_CommonDataTypes_part_7.so HNBAP_CommonDataTypes_part_7.o #8 49.42 g++ -shared -o HNBAP_Constants_part_1.so HNBAP_Constants_part_1.o #8 49.42 g++ -shared -o HNBAP_Constants_part_2.so HNBAP_Constants_part_2.o #8 49.43 g++ -shared -o HNBAP_Constants_part_3.so HNBAP_Constants_part_3.o #8 49.44 g++ -shared -o HNBAP_Constants_part_4.so HNBAP_Constants_part_4.o #8 49.45 g++ -shared -o HNBAP_Constants_part_5.so HNBAP_Constants_part_5.o #8 49.45 g++ -shared -o HNBAP_Constants_part_6.so HNBAP_Constants_part_6.o #8 49.45 g++ -shared -o HNBAP_Constants_part_7.so HNBAP_Constants_part_7.o #8 49.46 g++ -shared -o HNBAP_Containers_part_1.so HNBAP_Containers_part_1.o #8 49.47 g++ -shared -o HNBAP_Containers_part_2.so HNBAP_Containers_part_2.o #8 49.47 g++ -shared -o HNBAP_Containers_part_3.so HNBAP_Containers_part_3.o #8 49.47 g++ -shared -o HNBAP_Containers_part_4.so HNBAP_Containers_part_4.o #8 49.47 g++ -shared -o HNBAP_Containers_part_5.so HNBAP_Containers_part_5.o #8 49.48 g++ -shared -o HNBAP_Containers_part_6.so HNBAP_Containers_part_6.o #8 49.48 g++ -shared -o HNBAP_Containers_part_7.so HNBAP_Containers_part_7.o #8 49.49 g++ -shared -o HNBAP_IEs_part_1.so HNBAP_IEs_part_1.o #8 49.50 g++ -shared -o HNBAP_IEs_part_2.so HNBAP_IEs_part_2.o #8 49.50 g++ -shared -o HNBAP_IEs_part_3.so HNBAP_IEs_part_3.o #8 49.50 g++ -shared -o HNBAP_IEs_part_4.so HNBAP_IEs_part_4.o #8 49.50 g++ -shared -o HNBAP_IEs_part_5.so HNBAP_IEs_part_5.o #8 49.51 g++ -shared -o HNBAP_IEs_part_6.so HNBAP_IEs_part_6.o #8 49.51 g++ -shared -o HNBAP_IEs_part_7.so HNBAP_IEs_part_7.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_1.so HNBAP_PDU_Contents_part_1.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_2.so HNBAP_PDU_Contents_part_2.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_3.so HNBAP_PDU_Contents_part_3.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_4.so HNBAP_PDU_Contents_part_4.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_5.so HNBAP_PDU_Contents_part_5.o #8 49.52 g++ -shared -o HNBAP_PDU_Contents_part_6.so HNBAP_PDU_Contents_part_6.o #8 49.53 g++ -shared -o HNBAP_PDU_Contents_part_7.so HNBAP_PDU_Contents_part_7.o #8 49.53 g++ -shared -o HNBAP_PDU_Descriptions_part_1.so HNBAP_PDU_Descriptions_part_1.o #8 49.53 g++ -shared -o HNBAP_PDU_Descriptions_part_2.so HNBAP_PDU_Descriptions_part_2.o #8 49.53 g++ -shared -o HNBAP_PDU_Descriptions_part_3.so HNBAP_PDU_Descriptions_part_3.o #8 49.54 g++ -shared -o HNBAP_PDU_Descriptions_part_4.so HNBAP_PDU_Descriptions_part_4.o #8 49.54 g++ -shared -o HNBAP_PDU_Descriptions_part_5.so HNBAP_PDU_Descriptions_part_5.o #8 49.55 g++ -shared -o HNBAP_PDU_Descriptions_part_6.so HNBAP_PDU_Descriptions_part_6.o #8 49.55 g++ -shared -o HNBAP_PDU_Descriptions_part_7.so HNBAP_PDU_Descriptions_part_7.o #8 49.55 g++ -shared -o RANAP_CommonDataTypes_part_1.so RANAP_CommonDataTypes_part_1.o #8 49.55 g++ -shared -o RANAP_CommonDataTypes_part_2.so RANAP_CommonDataTypes_part_2.o #8 49.55 g++ -shared -o RANAP_CommonDataTypes_part_3.so RANAP_CommonDataTypes_part_3.o #8 49.56 g++ -shared -o RANAP_CommonDataTypes_part_4.so RANAP_CommonDataTypes_part_4.o #8 49.57 g++ -shared -o RANAP_CommonDataTypes_part_5.so RANAP_CommonDataTypes_part_5.o #8 49.57 g++ -shared -o RANAP_CommonDataTypes_part_6.so RANAP_CommonDataTypes_part_6.o #8 49.57 g++ -shared -o RANAP_CommonDataTypes_part_7.so RANAP_CommonDataTypes_part_7.o #8 49.57 g++ -shared -o RANAP_Constants_part_1.so RANAP_Constants_part_1.o #8 49.57 g++ -shared -o RANAP_Constants_part_2.so RANAP_Constants_part_2.o #8 49.57 g++ -shared -o RANAP_Constants_part_3.so RANAP_Constants_part_3.o #8 49.58 g++ -shared -o RANAP_Constants_part_4.so RANAP_Constants_part_4.o #8 49.59 g++ -shared -o RANAP_Constants_part_5.so RANAP_Constants_part_5.o #8 49.59 g++ -shared -o RANAP_Constants_part_6.so RANAP_Constants_part_6.o #8 49.59 g++ -shared -o RANAP_Constants_part_7.so RANAP_Constants_part_7.o #8 49.59 g++ -shared -o RANAP_Containers_part_1.so RANAP_Containers_part_1.o #8 49.59 g++ -shared -o RANAP_Containers_part_2.so RANAP_Containers_part_2.o #8 49.59 g++ -shared -o RANAP_Containers_part_3.so RANAP_Containers_part_3.o #8 49.60 g++ -shared -o RANAP_Containers_part_4.so RANAP_Containers_part_4.o #8 49.60 g++ -shared -o RANAP_Containers_part_5.so RANAP_Containers_part_5.o #8 49.60 g++ -shared -o RANAP_Containers_part_6.so RANAP_Containers_part_6.o #8 49.62 g++ -shared -o RANAP_Containers_part_7.so RANAP_Containers_part_7.o #8 49.62 g++ -shared -o RANAP_IEs_part_4.so RANAP_IEs_part_4.o #8 49.62 g++ -shared -o RANAP_IEs_part_5.so RANAP_IEs_part_5.o #8 49.62 g++ -shared -o RANAP_IEs_part_6.so RANAP_IEs_part_6.o #8 49.62 g++ -shared -o RANAP_IEs_part_7.so RANAP_IEs_part_7.o #8 49.62 g++ -shared -o RANAP_PDU_Descriptions_part_1.so RANAP_PDU_Descriptions_part_1.o #8 49.62 g++ -shared -o RANAP_PDU_Descriptions_part_2.so RANAP_PDU_Descriptions_part_2.o #8 49.62 g++ -shared -o RANAP_PDU_Descriptions_part_3.so RANAP_PDU_Descriptions_part_3.o #8 49.65 g++ -shared -o RANAP_PDU_Descriptions_part_4.so RANAP_PDU_Descriptions_part_4.o #8 49.65 g++ -shared -o RANAP_PDU_Descriptions_part_5.so RANAP_PDU_Descriptions_part_5.o #8 49.65 g++ -shared -o RANAP_PDU_Descriptions_part_6.so RANAP_PDU_Descriptions_part_6.o #8 49.65 g++ -shared -o RANAP_PDU_Descriptions_part_7.so RANAP_PDU_Descriptions_part_7.o #8 49.65 g++ -shared -o RUA_CommonDataTypes_part_1.so RUA_CommonDataTypes_part_1.o #8 49.65 g++ -shared -o RUA_CommonDataTypes_part_2.so RUA_CommonDataTypes_part_2.o #8 49.65 g++ -shared -o RUA_CommonDataTypes_part_3.so RUA_CommonDataTypes_part_3.o #8 49.65 g++ -shared -o RUA_CommonDataTypes_part_4.so RUA_CommonDataTypes_part_4.o #8 49.67 g++ -shared -o RUA_CommonDataTypes_part_5.so RUA_CommonDataTypes_part_5.o #8 49.67 g++ -shared -o RUA_CommonDataTypes_part_6.so RUA_CommonDataTypes_part_6.o #8 49.67 g++ -shared -o RUA_CommonDataTypes_part_7.so RUA_CommonDataTypes_part_7.o #8 49.67 g++ -shared -o RUA_Constants_part_1.so RUA_Constants_part_1.o #8 49.67 g++ -shared -o RUA_Constants_part_2.so RUA_Constants_part_2.o #8 49.67 g++ -shared -o RUA_Constants_part_3.so RUA_Constants_part_3.o #8 49.67 g++ -shared -o RUA_Constants_part_4.so RUA_Constants_part_4.o #8 49.67 g++ -shared -o RUA_Constants_part_5.so RUA_Constants_part_5.o #8 49.69 g++ -shared -o RUA_Constants_part_6.so RUA_Constants_part_6.o #8 49.70 g++ -shared -o RUA_Constants_part_7.so RUA_Constants_part_7.o #8 49.70 g++ -shared -o RUA_Containers_part_1.so RUA_Containers_part_1.o #8 49.70 g++ -shared -o RUA_Containers_part_2.so RUA_Containers_part_2.o #8 49.70 g++ -shared -o RUA_Containers_part_3.so RUA_Containers_part_3.o #8 49.70 g++ -shared -o RUA_Containers_part_4.so RUA_Containers_part_4.o #8 49.70 g++ -shared -o RUA_Containers_part_5.so RUA_Containers_part_5.o #8 49.70 g++ -shared -o RUA_Containers_part_6.so RUA_Containers_part_6.o #8 49.71 g++ -shared -o RUA_Containers_part_7.so RUA_Containers_part_7.o #8 49.72 g++ -shared -o RUA_IEs_part_1.so RUA_IEs_part_1.o #8 49.72 g++ -shared -o RUA_IEs_part_2.so RUA_IEs_part_2.o #8 49.72 g++ -shared -o RUA_IEs_part_3.so RUA_IEs_part_3.o #8 49.72 g++ -shared -o RUA_IEs_part_4.so RUA_IEs_part_4.o #8 49.73 g++ -shared -o RUA_IEs_part_5.so RUA_IEs_part_5.o #8 49.73 g++ -shared -o RUA_IEs_part_6.so RUA_IEs_part_6.o #8 49.73 g++ -shared -o RUA_IEs_part_7.so RUA_IEs_part_7.o #8 49.74 g++ -shared -o RUA_PDU_Contents_part_1.so RUA_PDU_Contents_part_1.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_2.so RUA_PDU_Contents_part_2.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_3.so RUA_PDU_Contents_part_3.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_4.so RUA_PDU_Contents_part_4.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_5.so RUA_PDU_Contents_part_5.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_6.so RUA_PDU_Contents_part_6.o #8 49.75 g++ -shared -o RUA_PDU_Contents_part_7.so RUA_PDU_Contents_part_7.o #8 49.75 g++ -shared -o RUA_PDU_Descriptions_part_1.so RUA_PDU_Descriptions_part_1.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_2.so RUA_PDU_Descriptions_part_2.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_3.so RUA_PDU_Descriptions_part_3.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_4.so RUA_PDU_Descriptions_part_4.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_5.so RUA_PDU_Descriptions_part_5.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_6.so RUA_PDU_Descriptions_part_6.o #8 49.77 g++ -shared -o RUA_PDU_Descriptions_part_7.so RUA_PDU_Descriptions_part_7.o #8 49.77 g++ -shared -o SDP_parse_.tab.so SDP_parse_.tab.o #8 49.77 g++ -shared -o lex.SDP_parse_.so lex.SDP_parse_.o #8 49.78 g++ -shared -o IPA_CodecPort_CtrlFunctDef.so IPA_CodecPort_CtrlFunctDef.o #8 49.79 g++ -shared -o IPL4asp_PT.so IPL4asp_PT.o #8 49.79 g++ -shared -o IPL4asp_discovery.so IPL4asp_discovery.o #8 49.80 g++ -shared -o IuUP_EncDec.so IuUP_EncDec.o #8 49.80 g++ -shared -o Iuh_CodecPort_CtrlFunctDef.so Iuh_CodecPort_CtrlFunctDef.o #8 49.80 g++ -shared -o Native_FunctionDefs.so Native_FunctionDefs.o #8 49.80 g++ -shared -o RTP_CodecPort_CtrlFunctDef.so RTP_CodecPort_CtrlFunctDef.o #8 49.81 g++ -shared -o RTP_EncDec.so RTP_EncDec.o #8 49.82 g++ -shared -o SCTPasp_PT.so SCTPasp_PT.o #8 49.83 g++ -shared -o SDP_EncDec.so SDP_EncDec.o #8 49.84 g++ -shared -o StatsD_CodecPort_CtrlFunctdef.so StatsD_CodecPort_CtrlFunctdef.o #8 49.88 g++ -shared -o TCCConversion.so TCCConversion.o #8 49.90 g++ -shared -o TCCEncoding.so TCCEncoding.o #8 49.90 g++ -shared -o TCCInterface.so TCCInterface.o #8 49.91 g++ -shared -o TELNETasp_PT.so TELNETasp_PT.o #8 49.91 g++ -shared -o HNBAP_EncDec.so HNBAP_EncDec.o #8 49.91 g++ -shared -o RUA_EncDec.so RUA_EncDec.o #8 49.92 g++ -shared -o RANAP_EncDec.so RANAP_EncDec.o #8 49.93 g++ -shared -o MGCP_CodecPort_CtrlFunctDef.so MGCP_CodecPort_CtrlFunctDef.o #8 49.94 g++ -shared -o UD_PT.so UD_PT.o #8 49.97 g++ -shared -o PFCP_CodecPort_CtrlFunctDef.so PFCP_CodecPort_CtrlFunctDef.o #8 49.98 g++ -shared -o BSSAP_Types_part_1.so BSSAP_Types_part_1.o #8 53.89 g++ -shared -o RANAP_IEs_part_1.so RANAP_IEs_part_1.o #8 55.82 g++ -shared -o RANAP_IEs_part_2.so RANAP_IEs_part_2.o #8 56.07 g++ -shared -o RANAP_IEs_part_3.so RANAP_IEs_part_3.o #8 57.84 g++ -shared -o RANAP_PDU_Contents_part_7.so RANAP_PDU_Contents_part_7.o #8 58.12 g++ -shared -o RANAP_PDU_Contents_part_2.so RANAP_PDU_Contents_part_2.o #8 58.60 g++ -shared -o RANAP_PDU_Contents_part_4.so RANAP_PDU_Contents_part_4.o #8 58.77 g++ -shared -o RANAP_PDU_Contents_part_1.so RANAP_PDU_Contents_part_1.o #8 59.05 g++ -shared -o RANAP_PDU_Contents_part_3.so RANAP_PDU_Contents_part_3.o #8 60.20 g++ -shared -o RANAP_PDU_Contents_part_5.so RANAP_PDU_Contents_part_5.o #8 60.91 g++ -shared -o RANAP_PDU_Contents_part_6.so RANAP_PDU_Contents_part_6.o #8 60.99 if g++ -L /usr/lib/titan-fPIC -o HNBGW_Tests -Wl,--no-as-needed BSSAP_CodecPort.so BSSAP_Types.so DNS_Helpers.so GSM_Types.so General_Types.so HNBAP_Templates.so HNBAP_Types.so HNBGW_Tests.so IPA_CodecPort.so IPA_CodecPort_CtrlFunct.so IPA_Types.so IPL4asp_Functions.so IPL4asp_PortType.so IPL4asp_Types.so IuUP_Emulation.so IuUP_Types.so Iuh_CodecPort.so Iuh_CodecPort_CtrlFunct.so Iuh_Emulation.so Iuh_Types.so L3_Common.so L3_Templates.so M3UA_Emulation.so M3UA_Types.so MGCP_CodecPort.so MGCP_CodecPort_CtrlFunct.so MGCP_Emulation.so MGCP_Templates.so MGCP_Types.so MTP3asp_PortType.so MTP3asp_Types.so Misc_Helpers.so MobileL3_CC_Types.so MobileL3_CommonIE_Types.so MobileL3_GMM_SM_Types.so MobileL3_MM_Types.so MobileL3_RRM_Types.so MobileL3_SMS_Types.so MobileL3_SS_Types.so MobileL3_Types.so Native_Functions.so Osmocom_CTRL_Adapter.so Osmocom_CTRL_Functions.so Osmocom_CTRL_Types.so Osmocom_Types.so Osmocom_VTY_Functions.so PFCP_CodecPort.so PFCP_CodecPort_CtrlFunct.so PFCP_Emulation.so PFCP_Templates.so PFCP_Types.so RANAP_CodecPort.so RANAP_Templates.so RANAP_Types.so RTP_CodecPort.so RTP_CodecPort_CtrlFunct.so RTP_Emulation.so RTP_Types.so RUA_Emulation.so RUA_Templates.so RUA_Types.so SCCP_Emulation.so SCCP_Templates.so SCCP_Types.so SCCPasp_Types.so SCTP_Templates.so SCTPasp_PortType.so SCTPasp_Types.so SDP_Templates.so SDP_Types.so Socket_API_Definitions.so StatsD_CodecPort.so StatsD_CodecPort_CtrlFunct.so StatsD_Types.so TCCConversion_Functions.so TCCEncoding_Functions.so TCCInterface_Functions.so TELNETasp_PortType.so UD_PortType.so UD_Types.so BSSAP_CodecPort_part_1.so BSSAP_CodecPort_part_2.so BSSAP_CodecPort_part_3.so BSSAP_CodecPort_part_4.so BSSAP_CodecPort_part_5.so BSSAP_CodecPort_part_6.so BSSAP_CodecPort_part_7.so BSSAP_Types_part_1.so BSSAP_Types_part_2.so BSSAP_Types_part_3.so BSSAP_Types_part_4.so BSSAP_Types_part_5.so BSSAP_Types_part_6.so BSSAP_Types_part_7.so DNS_Helpers_part_1.so DNS_Helpers_part_2.so DNS_Helpers_part_3.so DNS_Helpers_part_4.so DNS_Helpers_part_5.so DNS_Helpers_part_6.so DNS_Helpers_part_7.so GSM_Types_part_1.so GSM_Types_part_2.so GSM_Types_part_3.so GSM_Types_part_4.so GSM_Types_part_5.so GSM_Types_part_6.so GSM_Types_part_7.so General_Types_part_1.so General_Types_part_2.so General_Types_part_3.so General_Types_part_4.so General_Types_part_5.so General_Types_part_6.so General_Types_part_7.so HNBAP_Templates_part_1.so HNBAP_Templates_part_2.so HNBAP_Templates_part_3.so HNBAP_Templates_part_4.so HNBAP_Templates_part_5.so HNBAP_Templates_part_6.so HNBAP_Templates_part_7.so HNBAP_Types_part_1.so HNBAP_Types_part_2.so HNBAP_Types_part_3.so HNBAP_Types_part_4.so HNBAP_Types_part_5.so HNBAP_Types_part_6.so HNBAP_Types_part_7.so HNBGW_Tests_part_1.so HNBGW_Tests_part_2.so HNBGW_Tests_part_3.so HNBGW_Tests_part_4.so HNBGW_Tests_part_5.so HNBGW_Tests_part_6.so HNBGW_Tests_part_7.so IPA_CodecPort_part_1.so IPA_CodecPort_part_2.so IPA_CodecPort_part_3.so IPA_CodecPort_part_4.so IPA_CodecPort_part_5.so IPA_CodecPort_part_6.so IPA_CodecPort_part_7.so IPA_CodecPort_CtrlFunct_part_1.so IPA_CodecPort_CtrlFunct_part_2.so IPA_CodecPort_CtrlFunct_part_3.so IPA_CodecPort_CtrlFunct_part_4.so IPA_CodecPort_CtrlFunct_part_5.so IPA_CodecPort_CtrlFunct_part_6.so IPA_CodecPort_CtrlFunct_part_7.so IPA_Types_part_1.so IPA_Types_part_2.so IPA_Types_part_3.so IPA_Types_part_4.so IPA_Types_part_5.so IPA_Types_part_6.so IPA_Types_part_7.so IPL4asp_Functions_part_1.so IPL4asp_Functions_part_2.so IPL4asp_Functions_part_3.so IPL4asp_Functions_part_4.so IPL4asp_Functions_part_5.so IPL4asp_Functions_part_6.so IPL4asp_Functions_part_7.so IPL4asp_PortType_part_1.so IPL4asp_PortType_part_2.so IPL4asp_PortType_part_3.so IPL4asp_PortType_part_4.so IPL4asp_PortType_part_5.so IPL4asp_PortType_part_6.so IPL4asp_PortType_part_7.so IPL4asp_Types_part_1.so IPL4asp_Types_part_2.so IPL4asp_Types_part_3.so IPL4asp_Types_part_4.so IPL4asp_Types_part_5.so IPL4asp_Types_part_6.so IPL4asp_Types_part_7.so IuUP_Emulation_part_1.so IuUP_Emulation_part_2.so IuUP_Emulation_part_3.so IuUP_Emulation_part_4.so IuUP_Emulation_part_5.so IuUP_Emulation_part_6.so IuUP_Emulation_part_7.so IuUP_Types_part_1.so IuUP_Types_part_2.so IuUP_Types_part_3.so IuUP_Types_part_4.so IuUP_Types_part_5.so IuUP_Types_part_6.so IuUP_Types_part_7.so Iuh_CodecPort_part_1.so Iuh_CodecPort_part_2.so Iuh_CodecPort_part_3.so Iuh_CodecPort_part_4.so Iuh_CodecPort_part_5.so Iuh_CodecPort_part_6.so Iuh_CodecPort_part_7.so Iuh_CodecPort_CtrlFunct_part_1.so Iuh_CodecPort_CtrlFunct_part_2.so Iuh_CodecPort_CtrlFunct_part_3.so Iuh_CodecPort_CtrlFunct_part_4.so Iuh_CodecPort_CtrlFunct_part_5.so Iuh_CodecPort_CtrlFunct_part_6.so Iuh_CodecPort_CtrlFunct_part_7.so Iuh_Emulation_part_1.so Iuh_Emulation_part_2.so Iuh_Emulation_part_3.so Iuh_Emulation_part_4.so Iuh_Emulation_part_5.so Iuh_Emulation_part_6.so Iuh_Emulation_part_7.so Iuh_Types_part_1.so Iuh_Types_part_2.so Iuh_Types_part_3.so Iuh_Types_part_4.so Iuh_Types_part_5.so Iuh_Types_part_6.so Iuh_Types_part_7.so L3_Common_part_1.so L3_Common_part_2.so L3_Common_part_3.so L3_Common_part_4.so L3_Common_part_5.so L3_Common_part_6.so L3_Common_part_7.so L3_Templates_part_1.so L3_Templates_part_2.so L3_Templates_part_3.so L3_Templates_part_4.so L3_Templates_part_5.so L3_Templates_part_6.so L3_Templates_part_7.so M3UA_Emulation_part_1.so M3UA_Emulation_part_2.so M3UA_Emulation_part_3.so M3UA_Emulation_part_4.so M3UA_Emulation_part_5.so M3UA_Emulation_part_6.so M3UA_Emulation_part_7.so M3UA_Types_part_1.so M3UA_Types_part_2.so M3UA_Types_part_3.so M3UA_Types_part_4.so M3UA_Types_part_5.so M3UA_Types_part_6.so M3UA_Types_part_7.so MGCP_CodecPort_part_1.so MGCP_CodecPort_part_2.so MGCP_CodecPort_part_3.so MGCP_CodecPort_part_4.so MGCP_CodecPort_part_5.so MGCP_CodecPort_part_6.so MGCP_CodecPort_part_7.so MGCP_CodecPort_CtrlFunct_part_1.so MGCP_CodecPort_CtrlFunct_part_2.so MGCP_CodecPort_CtrlFunct_part_3.so MGCP_CodecPort_CtrlFunct_part_4.so MGCP_CodecPort_CtrlFunct_part_5.so MGCP_CodecPort_CtrlFunct_part_6.so MGCP_CodecPort_CtrlFunct_part_7.so MGCP_Emulation_part_1.so MGCP_Emulation_part_2.so MGCP_Emulation_part_3.so MGCP_Emulation_part_4.so MGCP_Emulation_part_5.so MGCP_Emulation_part_6.so MGCP_Emulation_part_7.so MGCP_Templates_part_1.so MGCP_Templates_part_2.so MGCP_Templates_part_3.so MGCP_Templates_part_4.so MGCP_Templates_part_5.so MGCP_Templates_part_6.so MGCP_Templates_part_7.so MGCP_Types_part_1.so MGCP_Types_part_2.so MGCP_Types_part_3.so MGCP_Types_part_4.so MGCP_Types_part_5.so MGCP_Types_part_6.so MGCP_Types_part_7.so MTP3asp_PortType_part_1.so MTP3asp_PortType_part_2.so MTP3asp_PortType_part_3.so MTP3asp_PortType_part_4.so MTP3asp_PortType_part_5.so MTP3asp_PortType_part_6.so MTP3asp_PortType_part_7.so MTP3asp_Types_part_1.so MTP3asp_Types_part_2.so MTP3asp_Types_part_3.so MTP3asp_Types_part_4.so MTP3asp_Types_part_5.so MTP3asp_Types_part_6.so MTP3asp_Types_part_7.so Misc_Helpers_part_1.so Misc_Helpers_part_2.so Misc_Helpers_part_3.so Misc_Helpers_part_4.so Misc_Helpers_part_5.so Misc_Helpers_part_6.so Misc_Helpers_part_7.so MobileL3_CC_Types_part_1.so MobileL3_CC_Types_part_2.so MobileL3_CC_Types_part_3.so MobileL3_CC_Types_part_4.so MobileL3_CC_Types_part_5.so MobileL3_CC_Types_part_6.so MobileL3_CC_Types_part_7.so MobileL3_CommonIE_Types_part_1.so MobileL3_CommonIE_Types_part_2.so MobileL3_CommonIE_Types_part_3.so MobileL3_CommonIE_Types_part_4.so MobileL3_CommonIE_Types_part_5.so MobileL3_CommonIE_Types_part_6.so MobileL3_CommonIE_Types_part_7.so MobileL3_GMM_SM_Types_part_1.so MobileL3_GMM_SM_Types_part_2.so MobileL3_GMM_SM_Types_part_3.so MobileL3_GMM_SM_Types_part_4.so MobileL3_GMM_SM_Types_part_5.so MobileL3_GMM_SM_Types_part_6.so MobileL3_GMM_SM_Types_part_7.so MobileL3_MM_Types_part_1.so MobileL3_MM_Types_part_2.so MobileL3_MM_Types_part_3.so MobileL3_MM_Types_part_4.so MobileL3_MM_Types_part_5.so MobileL3_MM_Types_part_6.so MobileL3_MM_Types_part_7.so MobileL3_RRM_Types_part_1.so MobileL3_RRM_Types_part_2.so MobileL3_RRM_Types_part_3.so MobileL3_RRM_Types_part_4.so MobileL3_RRM_Types_part_5.so MobileL3_RRM_Types_part_6.so MobileL3_RRM_Types_part_7.so MobileL3_SMS_Types_part_1.so MobileL3_SMS_Types_part_2.so MobileL3_SMS_Types_part_3.so MobileL3_SMS_Types_part_4.so MobileL3_SMS_Types_part_5.so MobileL3_SMS_Types_part_6.so MobileL3_SMS_Types_part_7.so MobileL3_SS_Types_part_1.so MobileL3_SS_Types_part_2.so MobileL3_SS_Types_part_3.so MobileL3_SS_Types_part_4.so MobileL3_SS_Types_part_5.so MobileL3_SS_Types_part_6.so MobileL3_SS_Types_part_7.so MobileL3_Types_part_1.so MobileL3_Types_part_2.so MobileL3_Types_part_3.so MobileL3_Types_part_4.so MobileL3_Types_part_5.so MobileL3_Types_part_6.so MobileL3_Types_part_7.so Native_Functions_part_1.so Native_Functions_part_2.so Native_Functions_part_3.so Native_Functions_part_4.so Native_Functions_part_5.so Native_Functions_part_6.so Native_Functions_part_7.so Osmocom_CTRL_Adapter_part_1.so Osmocom_CTRL_Adapter_part_2.so Osmocom_CTRL_Adapter_part_3.so Osmocom_CTRL_Adapter_part_4.so Osmocom_CTRL_Adapter_part_5.so Osmocom_CTRL_Adapter_part_6.so Osmocom_CTRL_Adapter_part_7.so Osmocom_CTRL_Functions_part_1.so Osmocom_CTRL_Functions_part_2.so Osmocom_CTRL_Functions_part_3.so Osmocom_CTRL_Functions_part_4.so Osmocom_CTRL_Functions_part_5.so Osmocom_CTRL_Functions_part_6.so Osmocom_CTRL_Functions_part_7.so Osmocom_CTRL_Types_part_1.so Osmocom_CTRL_Types_part_2.so Osmocom_CTRL_Types_part_3.so Osmocom_CTRL_Types_part_4.so Osmocom_CTRL_Types_part_5.so Osmocom_CTRL_Types_part_6.so Osmocom_CTRL_Types_part_7.so Osmocom_Types_part_1.so Osmocom_Types_part_2.so Osmocom_Types_part_3.so Osmocom_Types_part_4.so Osmocom_Types_part_5.so Osmocom_Types_part_6.so Osmocom_Types_part_7.so Osmocom_VTY_Functions_part_1.so Osmocom_VTY_Functions_part_2.so Osmocom_VTY_Functions_part_3.so Osmocom_VTY_Functions_part_4.so Osmocom_VTY_Functions_part_5.so Osmocom_VTY_Functions_part_6.so Osmocom_VTY_Functions_part_7.so PFCP_CodecPort_part_1.so PFCP_CodecPort_part_2.so PFCP_CodecPort_part_3.so PFCP_CodecPort_part_4.so PFCP_CodecPort_part_5.so PFCP_CodecPort_part_6.so PFCP_CodecPort_part_7.so PFCP_CodecPort_CtrlFunct_part_1.so PFCP_CodecPort_CtrlFunct_part_2.so PFCP_CodecPort_CtrlFunct_part_3.so PFCP_CodecPort_CtrlFunct_part_4.so PFCP_CodecPort_CtrlFunct_part_5.so PFCP_CodecPort_CtrlFunct_part_6.so PFCP_CodecPort_CtrlFunct_part_7.so PFCP_Emulation_part_1.so PFCP_Emulation_part_2.so PFCP_Emulation_part_3.so PFCP_Emulation_part_4.so PFCP_Emulation_part_5.so PFCP_Emulation_part_6.so PFCP_Emulation_part_7.so PFCP_Templates_part_1.so PFCP_Templates_part_2.so PFCP_Templates_part_3.so PFCP_Templates_part_4.so PFCP_Templates_part_5.so PFCP_Templates_part_6.so PFCP_Templates_part_7.so PFCP_Types_part_1.so PFCP_Types_part_2.so PFCP_Types_part_3.so PFCP_Types_part_4.so PFCP_Types_part_5.so PFCP_Types_part_6.so PFCP_Types_part_7.so RANAP_CodecPort_part_1.so RANAP_CodecPort_part_2.so RANAP_CodecPort_part_3.so RANAP_CodecPort_part_4.so RANAP_CodecPort_part_5.so RANAP_CodecPort_part_6.so RANAP_CodecPort_part_7.so RANAP_Templates_part_1.so RANAP_Templates_part_2.so RANAP_Templates_part_3.so RANAP_Templates_part_4.so RANAP_Templates_part_5.so RANAP_Templates_part_6.so RANAP_Templates_part_7.so RANAP_Types_part_1.so RANAP_Types_part_2.so RANAP_Types_part_3.so RANAP_Types_part_4.so RANAP_Types_part_5.so RANAP_Types_part_6.so RANAP_Types_part_7.so RTP_CodecPort_part_1.so RTP_CodecPort_part_2.so RTP_CodecPort_part_3.so RTP_CodecPort_part_4.so RTP_CodecPort_part_5.so RTP_CodecPort_part_6.so RTP_CodecPort_part_7.so RTP_CodecPort_CtrlFunct_part_1.so RTP_CodecPort_CtrlFunct_part_2.so RTP_CodecPort_CtrlFunct_part_3.so RTP_CodecPort_CtrlFunct_part_4.so RTP_CodecPort_CtrlFunct_part_5.so RTP_CodecPort_CtrlFunct_part_6.so RTP_CodecPort_CtrlFunct_part_7.so RTP_Emulation_part_1.so RTP_Emulation_part_2.so RTP_Emulation_part_3.so RTP_Emulation_part_4.so RTP_Emulation_part_5.so RTP_Emulation_part_6.so RTP_Emulation_part_7.so RTP_Types_part_1.so RTP_Types_part_2.so RTP_Types_part_3.so RTP_Types_part_4.so RTP_Types_part_5.so RTP_Types_part_6.so RTP_Types_part_7.so RUA_Emulation_part_1.so RUA_Emulation_part_2.so RUA_Emulation_part_3.so RUA_Emulation_part_4.so RUA_Emulation_part_5.so RUA_Emulation_part_6.so RUA_Emulation_part_7.so RUA_Templates_part_1.so RUA_Templates_part_2.so RUA_Templates_part_3.so RUA_Templates_part_4.so RUA_Templates_part_5.so RUA_Templates_part_6.so RUA_Templates_part_7.so RUA_Types_part_1.so RUA_Types_part_2.so RUA_Types_part_3.so RUA_Types_part_4.so RUA_Types_part_5.so RUA_Types_part_6.so RUA_Types_part_7.so SCCP_Emulation_part_1.so SCCP_Emulation_part_2.so SCCP_Emulation_part_3.so SCCP_Emulation_part_4.so SCCP_Emulation_part_5.so SCCP_Emulation_part_6.so SCCP_Emulation_part_7.so SCCP_Templates_part_1.so SCCP_Templates_part_2.so SCCP_Templates_part_3.so SCCP_Templates_part_4.so SCCP_Templates_part_5.so SCCP_Templates_part_6.so SCCP_Templates_part_7.so SCCP_Types_part_1.so SCCP_Types_part_2.so SCCP_Types_part_3.so SCCP_Types_part_4.so SCCP_Types_part_5.so SCCP_Types_part_6.so SCCP_Types_part_7.so SCCPasp_Types_part_1.so SCCPasp_Types_part_2.so SCCPasp_Types_part_3.so SCCPasp_Types_part_4.so SCCPasp_Types_part_5.so SCCPasp_Types_part_6.so SCCPasp_Types_part_7.so SCTP_Templates_part_1.so SCTP_Templates_part_2.so SCTP_Templates_part_3.so SCTP_Templates_part_4.so SCTP_Templates_part_5.so SCTP_Templates_part_6.so SCTP_Templates_part_7.so SCTPasp_PortType_part_1.so SCTPasp_PortType_part_2.so SCTPasp_PortType_part_3.so SCTPasp_PortType_part_4.so SCTPasp_PortType_part_5.so SCTPasp_PortType_part_6.so SCTPasp_PortType_part_7.so SCTPasp_Types_part_1.so SCTPasp_Types_part_2.so SCTPasp_Types_part_3.so SCTPasp_Types_part_4.so SCTPasp_Types_part_5.so SCTPasp_Types_part_6.so SCTPasp_Types_part_7.so SDP_Templates_part_1.so SDP_Templates_part_2.so SDP_Templates_part_3.so SDP_Templates_part_4.so SDP_Templates_part_5.so SDP_Templates_part_6.so SDP_Templates_part_7.so SDP_Types_part_1.so SDP_Types_part_2.so SDP_Types_part_3.so SDP_Types_part_4.so SDP_Types_part_5.so SDP_Types_part_6.so SDP_Types_part_7.so Socket_API_Definitions_part_1.so Socket_API_Definitions_part_2.so Socket_API_Definitions_part_3.so Socket_API_Definitions_part_4.so Socket_API_Definitions_part_5.so Socket_API_Definitions_part_6.so Socket_API_Definitions_part_7.so StatsD_CodecPort_part_1.so StatsD_CodecPort_part_2.so StatsD_CodecPort_part_3.so StatsD_CodecPort_part_4.so StatsD_CodecPort_part_5.so StatsD_CodecPort_part_6.so StatsD_CodecPort_part_7.so StatsD_CodecPort_CtrlFunct_part_1.so StatsD_CodecPort_CtrlFunct_part_2.so StatsD_CodecPort_CtrlFunct_part_3.so StatsD_CodecPort_CtrlFunct_part_4.so StatsD_CodecPort_CtrlFunct_part_5.so StatsD_CodecPort_CtrlFunct_part_6.so StatsD_CodecPort_CtrlFunct_part_7.so StatsD_Types_part_1.so StatsD_Types_part_2.so StatsD_Types_part_3.so StatsD_Types_part_4.so StatsD_Types_part_5.so StatsD_Types_part_6.so StatsD_Types_part_7.so TCCConversion_Functions_part_1.so TCCConversion_Functions_part_2.so TCCConversion_Functions_part_3.so TCCConversion_Functions_part_4.so TCCConversion_Functions_part_5.so TCCConversion_Functions_part_6.so TCCConversion_Functions_part_7.so TCCEncoding_Functions_part_1.so TCCEncoding_Functions_part_2.so TCCEncoding_Functions_part_3.so TCCEncoding_Functions_part_4.so TCCEncoding_Functions_part_5.so TCCEncoding_Functions_part_6.so TCCEncoding_Functions_part_7.so TCCInterface_Functions_part_1.so TCCInterface_Functions_part_2.so TCCInterface_Functions_part_3.so TCCInterface_Functions_part_4.so TCCInterface_Functions_part_5.so TCCInterface_Functions_part_6.so TCCInterface_Functions_part_7.so TELNETasp_PortType_part_1.so TELNETasp_PortType_part_2.so TELNETasp_PortType_part_3.so TELNETasp_PortType_part_4.so TELNETasp_PortType_part_5.so TELNETasp_PortType_part_6.so TELNETasp_PortType_part_7.so UD_PortType_part_1.so UD_PortType_part_2.so UD_PortType_part_3.so UD_PortType_part_4.so UD_PortType_part_5.so UD_PortType_part_6.so UD_PortType_part_7.so UD_Types_part_1.so UD_Types_part_2.so UD_Types_part_3.so UD_Types_part_4.so UD_Types_part_5.so UD_Types_part_6.so UD_Types_part_7.so IPA_Emulation.so RAN_Adapter.so RAN_Emulation.so SCCP_Mapping.so StatsD_Checker.so IPA_Emulation_part_1.so IPA_Emulation_part_2.so IPA_Emulation_part_3.so IPA_Emulation_part_4.so IPA_Emulation_part_5.so IPA_Emulation_part_6.so IPA_Emulation_part_7.so RAN_Adapter_part_1.so RAN_Adapter_part_2.so RAN_Adapter_part_3.so RAN_Adapter_part_4.so RAN_Adapter_part_5.so RAN_Adapter_part_6.so RAN_Adapter_part_7.so RAN_Emulation_part_1.so RAN_Emulation_part_2.so RAN_Emulation_part_3.so RAN_Emulation_part_4.so RAN_Emulation_part_5.so RAN_Emulation_part_6.so RAN_Emulation_part_7.so SCCP_Mapping_part_1.so SCCP_Mapping_part_2.so SCCP_Mapping_part_3.so SCCP_Mapping_part_4.so SCCP_Mapping_part_5.so SCCP_Mapping_part_6.so SCCP_Mapping_part_7.so StatsD_Checker_part_1.so StatsD_Checker_part_2.so StatsD_Checker_part_3.so StatsD_Checker_part_4.so StatsD_Checker_part_5.so StatsD_Checker_part_6.so StatsD_Checker_part_7.so HNBAP_CommonDataTypes.so HNBAP_Constants.so HNBAP_Containers.so HNBAP_IEs.so HNBAP_PDU_Contents.so HNBAP_PDU_Descriptions.so RANAP_CommonDataTypes.so RANAP_Constants.so RANAP_Containers.so RANAP_IEs.so RANAP_PDU_Contents.so RANAP_PDU_Descriptions.so RUA_CommonDataTypes.so RUA_Constants.so RUA_Containers.so RUA_IEs.so RUA_PDU_Contents.so RUA_PDU_Descriptions.so HNBAP_CommonDataTypes_part_1.so HNBAP_CommonDataTypes_part_2.so HNBAP_CommonDataTypes_part_3.so HNBAP_CommonDataTypes_part_4.so HNBAP_CommonDataTypes_part_5.so HNBAP_CommonDataTypes_part_6.so HNBAP_CommonDataTypes_part_7.so HNBAP_Constants_part_1.so HNBAP_Constants_part_2.so HNBAP_Constants_part_3.so HNBAP_Constants_part_4.so HNBAP_Constants_part_5.so HNBAP_Constants_part_6.so HNBAP_Constants_part_7.so HNBAP_Containers_part_1.so HNBAP_Containers_part_2.so HNBAP_Containers_part_3.so HNBAP_Containers_part_4.so HNBAP_Containers_part_5.so HNBAP_Containers_part_6.so HNBAP_Containers_part_7.so HNBAP_IEs_part_1.so HNBAP_IEs_part_2.so HNBAP_IEs_part_3.so HNBAP_IEs_part_4.so HNBAP_IEs_part_5.so HNBAP_IEs_part_6.so HNBAP_IEs_part_7.so HNBAP_PDU_Contents_part_1.so HNBAP_PDU_Contents_part_2.so HNBAP_PDU_Contents_part_3.so HNBAP_PDU_Contents_part_4.so HNBAP_PDU_Contents_part_5.so HNBAP_PDU_Contents_part_6.so HNBAP_PDU_Contents_part_7.so HNBAP_PDU_Descriptions_part_1.so HNBAP_PDU_Descriptions_part_2.so HNBAP_PDU_Descriptions_part_3.so HNBAP_PDU_Descriptions_part_4.so HNBAP_PDU_Descriptions_part_5.so HNBAP_PDU_Descriptions_part_6.so HNBAP_PDU_Descriptions_part_7.so RANAP_CommonDataTypes_part_1.so RANAP_CommonDataTypes_part_2.so RANAP_CommonDataTypes_part_3.so RANAP_CommonDataTypes_part_4.so RANAP_CommonDataTypes_part_5.so RANAP_CommonDataTypes_part_6.so RANAP_CommonDataTypes_part_7.so RANAP_Constants_part_1.so RANAP_Constants_part_2.so RANAP_Constants_part_3.so RANAP_Constants_part_4.so RANAP_Constants_part_5.so RANAP_Constants_part_6.so RANAP_Constants_part_7.so RANAP_Containers_part_1.so RANAP_Containers_part_2.so RANAP_Containers_part_3.so RANAP_Containers_part_4.so RANAP_Containers_part_5.so RANAP_Containers_part_6.so RANAP_Containers_part_7.so RANAP_IEs_part_1.so RANAP_IEs_part_2.so RANAP_IEs_part_3.so RANAP_IEs_part_4.so RANAP_IEs_part_5.so RANAP_IEs_part_6.so RANAP_IEs_part_7.so RANAP_PDU_Contents_part_1.so RANAP_PDU_Contents_part_2.so RANAP_PDU_Contents_part_3.so RANAP_PDU_Contents_part_4.so RANAP_PDU_Contents_part_5.so RANAP_PDU_Contents_part_6.so RANAP_PDU_Contents_part_7.so RANAP_PDU_Descriptions_part_1.so RANAP_PDU_Descriptions_part_2.so RANAP_PDU_Descriptions_part_3.so RANAP_PDU_Descriptions_part_4.so RANAP_PDU_Descriptions_part_5.so RANAP_PDU_Descriptions_part_6.so RANAP_PDU_Descriptions_part_7.so RUA_CommonDataTypes_part_1.so RUA_CommonDataTypes_part_2.so RUA_CommonDataTypes_part_3.so RUA_CommonDataTypes_part_4.so RUA_CommonDataTypes_part_5.so RUA_CommonDataTypes_part_6.so RUA_CommonDataTypes_part_7.so RUA_Constants_part_1.so RUA_Constants_part_2.so RUA_Constants_part_3.so RUA_Constants_part_4.so RUA_Constants_part_5.so RUA_Constants_part_6.so RUA_Constants_part_7.so RUA_Containers_part_1.so RUA_Containers_part_2.so RUA_Containers_part_3.so RUA_Containers_part_4.so RUA_Containers_part_5.so RUA_Containers_part_6.so RUA_Containers_part_7.so RUA_IEs_part_1.so RUA_IEs_part_2.so RUA_IEs_part_3.so RUA_IEs_part_4.so RUA_IEs_part_5.so RUA_IEs_part_6.so RUA_IEs_part_7.so RUA_PDU_Contents_part_1.so RUA_PDU_Contents_part_2.so RUA_PDU_Contents_part_3.so RUA_PDU_Contents_part_4.so RUA_PDU_Contents_part_5.so RUA_PDU_Contents_part_6.so RUA_PDU_Contents_part_7.so RUA_PDU_Descriptions_part_1.so RUA_PDU_Descriptions_part_2.so RUA_PDU_Descriptions_part_3.so RUA_PDU_Descriptions_part_4.so RUA_PDU_Descriptions_part_5.so RUA_PDU_Descriptions_part_6.so RUA_PDU_Descriptions_part_7.so SDP_parse_.tab.so lex.SDP_parse_.so IPA_CodecPort_CtrlFunctDef.so IPL4asp_PT.so IPL4asp_discovery.so IuUP_EncDec.so Iuh_CodecPort_CtrlFunctDef.so Native_FunctionDefs.so RTP_CodecPort_CtrlFunctDef.so RTP_EncDec.so SCTPasp_PT.so SDP_EncDec.so StatsD_CodecPort_CtrlFunctdef.so TCCConversion.so TCCEncoding.so TCCInterface.so TELNETasp_PT.so HNBAP_EncDec.so RUA_EncDec.so RANAP_EncDec.so MGCP_CodecPort_CtrlFunctDef.so UD_PT.so PFCP_CodecPort_CtrlFunctDef.so \ #8 60.99 -L/usr/lib/titan -lttcn3-parallel-dynamic \ #8 60.99 -L/lib -lcrypto \ #8 60.99 -L/usr/lib -lxml2 -lsctp -lfftranscode -lssl -lpthread; \ #8 60.99 then : ; else /usr/bin/titanver BSSAP_CodecPort.o BSSAP_Types.o DNS_Helpers.o GSM_Types.o General_Types.o HNBAP_Templates.o HNBAP_Types.o HNBGW_Tests.o IPA_CodecPort.o IPA_CodecPort_CtrlFunct.o IPA_Types.o IPL4asp_Functions.o IPL4asp_PortType.o IPL4asp_Types.o IuUP_Emulation.o IuUP_Types.o Iuh_CodecPort.o Iuh_CodecPort_CtrlFunct.o Iuh_Emulation.o Iuh_Types.o L3_Common.o L3_Templates.o M3UA_Emulation.o M3UA_Types.o MGCP_CodecPort.o MGCP_CodecPort_CtrlFunct.o MGCP_Emulation.o MGCP_Templates.o MGCP_Types.o MTP3asp_PortType.o MTP3asp_Types.o Misc_Helpers.o MobileL3_CC_Types.o MobileL3_CommonIE_Types.o MobileL3_GMM_SM_Types.o MobileL3_MM_Types.o MobileL3_RRM_Types.o MobileL3_SMS_Types.o MobileL3_SS_Types.o MobileL3_Types.o Native_Functions.o Osmocom_CTRL_Adapter.o Osmocom_CTRL_Functions.o Osmocom_CTRL_Types.o Osmocom_Types.o Osmocom_VTY_Functions.o PFCP_CodecPort.o PFCP_CodecPort_CtrlFunct.o PFCP_Emulation.o PFCP_Templates.o PFCP_Types.o RANAP_CodecPort.o RANAP_Templates.o RANAP_Types.o RTP_CodecPort.o RTP_CodecPort_CtrlFunct.o RTP_Emulation.o RTP_Types.o RUA_Emulation.o RUA_Templates.o RUA_Types.o SCCP_Emulation.o SCCP_Templates.o SCCP_Types.o SCCPasp_Types.o SCTP_Templates.o SCTPasp_PortType.o SCTPasp_Types.o SDP_Templates.o SDP_Types.o Socket_API_Definitions.o StatsD_CodecPort.o StatsD_CodecPort_CtrlFunct.o StatsD_Types.o TCCConversion_Functions.o TCCEncoding_Functions.o TCCInterface_Functions.o TELNETasp_PortType.o UD_PortType.o UD_Types.o BSSAP_CodecPort_part_1.o BSSAP_CodecPort_part_2.o BSSAP_CodecPort_part_3.o BSSAP_CodecPort_part_4.o BSSAP_CodecPort_part_5.o BSSAP_CodecPort_part_6.o BSSAP_CodecPort_part_7.o BSSAP_Types_part_1.o BSSAP_Types_part_2.o BSSAP_Types_part_3.o BSSAP_Types_part_4.o BSSAP_Types_part_5.o BSSAP_Types_part_6.o BSSAP_Types_part_7.o DNS_Helpers_part_1.o DNS_Helpers_part_2.o DNS_Helpers_part_3.o DNS_Helpers_part_4.o DNS_Helpers_part_5.o DNS_Helpers_part_6.o DNS_Helpers_part_7.o GSM_Types_part_1.o GSM_Types_part_2.o GSM_Types_part_3.o GSM_Types_part_4.o GSM_Types_part_5.o GSM_Types_part_6.o GSM_Types_part_7.o General_Types_part_1.o General_Types_part_2.o General_Types_part_3.o General_Types_part_4.o General_Types_part_5.o General_Types_part_6.o General_Types_part_7.o HNBAP_Templates_part_1.o HNBAP_Templates_part_2.o HNBAP_Templates_part_3.o HNBAP_Templates_part_4.o HNBAP_Templates_part_5.o HNBAP_Templates_part_6.o HNBAP_Templates_part_7.o HNBAP_Types_part_1.o HNBAP_Types_part_2.o HNBAP_Types_part_3.o HNBAP_Types_part_4.o HNBAP_Types_part_5.o HNBAP_Types_part_6.o HNBAP_Types_part_7.o HNBGW_Tests_part_1.o HNBGW_Tests_part_2.o HNBGW_Tests_part_3.o HNBGW_Tests_part_4.o HNBGW_Tests_part_5.o HNBGW_Tests_part_6.o HNBGW_Tests_part_7.o IPA_CodecPort_part_1.o IPA_CodecPort_part_2.o IPA_CodecPort_part_3.o IPA_CodecPort_part_4.o IPA_CodecPort_part_5.o IPA_CodecPort_part_6.o IPA_CodecPort_part_7.o IPA_CodecPort_CtrlFunct_part_1.o IPA_CodecPort_CtrlFunct_part_2.o IPA_CodecPort_CtrlFunct_part_3.o IPA_CodecPort_CtrlFunct_part_4.o IPA_CodecPort_CtrlFunct_part_5.o IPA_CodecPort_CtrlFunct_part_6.o IPA_CodecPort_CtrlFunct_part_7.o IPA_Types_part_1.o IPA_Types_part_2.o IPA_Types_part_3.o IPA_Types_part_4.o IPA_Types_part_5.o IPA_Types_part_6.o IPA_Types_part_7.o IPL4asp_Functions_part_1.o IPL4asp_Functions_part_2.o IPL4asp_Functions_part_3.o IPL4asp_Functions_part_4.o IPL4asp_Functions_part_5.o IPL4asp_Functions_part_6.o IPL4asp_Functions_part_7.o IPL4asp_PortType_part_1.o IPL4asp_PortType_part_2.o IPL4asp_PortType_part_3.o IPL4asp_PortType_part_4.o IPL4asp_PortType_part_5.o IPL4asp_PortType_part_6.o IPL4asp_PortType_part_7.o IPL4asp_Types_part_1.o IPL4asp_Types_part_2.o IPL4asp_Types_part_3.o IPL4asp_Types_part_4.o IPL4asp_Types_part_5.o IPL4asp_Types_part_6.o IPL4asp_Types_part_7.o IuUP_Emulation_part_1.o IuUP_Emulation_part_2.o IuUP_Emulation_part_3.o IuUP_Emulation_part_4.o IuUP_Emulation_part_5.o IuUP_Emulation_part_6.o IuUP_Emulation_part_7.o IuUP_Types_part_1.o IuUP_Types_part_2.o IuUP_Types_part_3.o IuUP_Types_part_4.o IuUP_Types_part_5.o IuUP_Types_part_6.o IuUP_Types_part_7.o Iuh_CodecPort_part_1.o Iuh_CodecPort_part_2.o Iuh_CodecPort_part_3.o Iuh_CodecPort_part_4.o Iuh_CodecPort_part_5.o Iuh_CodecPort_part_6.o Iuh_CodecPort_part_7.o Iuh_CodecPort_CtrlFunct_part_1.o Iuh_CodecPort_CtrlFunct_part_2.o Iuh_CodecPort_CtrlFunct_part_3.o Iuh_CodecPort_CtrlFunct_part_4.o Iuh_CodecPort_CtrlFunct_part_5.o Iuh_CodecPort_CtrlFunct_part_6.o Iuh_CodecPort_CtrlFunct_part_7.o Iuh_Emulation_part_1.o Iuh_Emulation_part_2.o Iuh_Emulation_part_3.o Iuh_Emulation_part_4.o Iuh_Emulation_part_5.o Iuh_Emulation_part_6.o Iuh_Emulation_part_7.o Iuh_Types_part_1.o Iuh_Types_part_2.o Iuh_Types_part_3.o Iuh_Types_part_4.o Iuh_Types_part_5.o Iuh_Types_part_6.o Iuh_Types_part_7.o L3_Common_part_1.o L3_Common_part_2.o L3_Common_part_3.o L3_Common_part_4.o L3_Common_part_5.o L3_Common_part_6.o L3_Common_part_7.o L3_Templates_part_1.o L3_Templates_part_2.o L3_Templates_part_3.o L3_Templates_part_4.o L3_Templates_part_5.o L3_Templates_part_6.o L3_Templates_part_7.o M3UA_Emulation_part_1.o M3UA_Emulation_part_2.o M3UA_Emulation_part_3.o M3UA_Emulation_part_4.o M3UA_Emulation_part_5.o M3UA_Emulation_part_6.o M3UA_Emulation_part_7.o M3UA_Types_part_1.o M3UA_Types_part_2.o M3UA_Types_part_3.o M3UA_Types_part_4.o M3UA_Types_part_5.o M3UA_Types_part_6.o M3UA_Types_part_7.o MGCP_CodecPort_part_1.o MGCP_CodecPort_part_2.o MGCP_CodecPort_part_3.o MGCP_CodecPort_part_4.o MGCP_CodecPort_part_5.o MGCP_CodecPort_part_6.o MGCP_CodecPort_part_7.o MGCP_CodecPort_CtrlFunct_part_1.o MGCP_CodecPort_CtrlFunct_part_2.o MGCP_CodecPort_CtrlFunct_part_3.o MGCP_CodecPort_CtrlFunct_part_4.o MGCP_CodecPort_CtrlFunct_part_5.o MGCP_CodecPort_CtrlFunct_part_6.o MGCP_CodecPort_CtrlFunct_part_7.o MGCP_Emulation_part_1.o MGCP_Emulation_part_2.o MGCP_Emulation_part_3.o MGCP_Emulation_part_4.o MGCP_Emulation_part_5.o MGCP_Emulation_part_6.o MGCP_Emulation_part_7.o MGCP_Templates_part_1.o MGCP_Templates_part_2.o MGCP_Templates_part_3.o MGCP_Templates_part_4.o MGCP_Templates_part_5.o MGCP_Templates_part_6.o MGCP_Templates_part_7.o MGCP_Types_part_1.o MGCP_Types_part_2.o MGCP_Types_part_3.o MGCP_Types_part_4.o MGCP_Types_part_5.o MGCP_Types_part_6.o MGCP_Types_part_7.o MTP3asp_PortType_part_1.o MTP3asp_PortType_part_2.o MTP3asp_PortType_part_3.o MTP3asp_PortType_part_4.o MTP3asp_PortType_part_5.o MTP3asp_PortType_part_6.o MTP3asp_PortType_part_7.o MTP3asp_Types_part_1.o MTP3asp_Types_part_2.o MTP3asp_Types_part_3.o MTP3asp_Types_part_4.o MTP3asp_Types_part_5.o MTP3asp_Types_part_6.o MTP3asp_Types_part_7.o Misc_Helpers_part_1.o Misc_Helpers_part_2.o Misc_Helpers_part_3.o Misc_Helpers_part_4.o Misc_Helpers_part_5.o Misc_Helpers_part_6.o Misc_Helpers_part_7.o MobileL3_CC_Types_part_1.o MobileL3_CC_Types_part_2.o MobileL3_CC_Types_part_3.o MobileL3_CC_Types_part_4.o MobileL3_CC_Types_part_5.o MobileL3_CC_Types_part_6.o MobileL3_CC_Types_part_7.o MobileL3_CommonIE_Types_part_1.o MobileL3_CommonIE_Types_part_2.o MobileL3_CommonIE_Types_part_3.o MobileL3_CommonIE_Types_part_4.o MobileL3_CommonIE_Types_part_5.o MobileL3_CommonIE_Types_part_6.o MobileL3_CommonIE_Types_part_7.o MobileL3_GMM_SM_Types_part_1.o MobileL3_GMM_SM_Types_part_2.o MobileL3_GMM_SM_Types_part_3.o MobileL3_GMM_SM_Types_part_4.o MobileL3_GMM_SM_Types_part_5.o MobileL3_GMM_SM_Types_part_6.o MobileL3_GMM_SM_Types_part_7.o MobileL3_MM_Types_part_1.o MobileL3_MM_Types_part_2.o MobileL3_MM_Types_part_3.o MobileL3_MM_Types_part_4.o MobileL3_MM_Types_part_5.o MobileL3_MM_Types_part_6.o MobileL3_MM_Types_part_7.o MobileL3_RRM_Types_part_1.o MobileL3_RRM_Types_part_2.o MobileL3_RRM_Types_part_3.o MobileL3_RRM_Types_part_4.o MobileL3_RRM_Types_part_5.o MobileL3_RRM_Types_part_6.o MobileL3_RRM_Types_part_7.o MobileL3_SMS_Types_part_1.o MobileL3_SMS_Types_part_2.o MobileL3_SMS_Types_part_3.o MobileL3_SMS_Types_part_4.o MobileL3_SMS_Types_part_5.o MobileL3_SMS_Types_part_6.o MobileL3_SMS_Types_part_7.o MobileL3_SS_Types_part_1.o MobileL3_SS_Types_part_2.o MobileL3_SS_Types_part_3.o MobileL3_SS_Types_part_4.o MobileL3_SS_Types_part_5.o MobileL3_SS_Types_part_6.o MobileL3_SS_Types_part_7.o MobileL3_Types_part_1.o MobileL3_Types_part_2.o MobileL3_Types_part_3.o MobileL3_Types_part_4.o MobileL3_Types_part_5.o MobileL3_Types_part_6.o MobileL3_Types_part_7.o Native_Functions_part_1.o Native_Functions_part_2.o Native_Functions_part_3.o Native_Functions_part_4.o Native_Functions_part_5.o Native_Functions_part_6.o Native_Functions_part_7.o Osmocom_CTRL_Adapter_part_1.o Osmocom_CTRL_Adapter_part_2.o Osmocom_CTRL_Adapter_part_3.o Osmocom_CTRL_Adapter_part_4.o Osmocom_CTRL_Adapter_part_5.o Osmocom_CTRL_Adapter_part_6.o Osmocom_CTRL_Adapter_part_7.o Osmocom_CTRL_Functions_part_1.o Osmocom_CTRL_Functions_part_2.o Osmocom_CTRL_Functions_part_3.o Osmocom_CTRL_Functions_part_4.o Osmocom_CTRL_Functions_part_5.o Osmocom_CTRL_Functions_part_6.o Osmocom_CTRL_Functions_part_7.o Osmocom_CTRL_Types_part_1.o Osmocom_CTRL_Types_part_2.o Osmocom_CTRL_Types_part_3.o Osmocom_CTRL_Types_part_4.o Osmocom_CTRL_Types_part_5.o Osmocom_CTRL_Types_part_6.o Osmocom_CTRL_Types_part_7.o Osmocom_Types_part_1.o Osmocom_Types_part_2.o Osmocom_Types_part_3.o Osmocom_Types_part_4.o Osmocom_Types_part_5.o Osmocom_Types_part_6.o Osmocom_Types_part_7.o Osmocom_VTY_Functions_part_1.o Osmocom_VTY_Functions_part_2.o Osmocom_VTY_Functions_part_3.o Osmocom_VTY_Functions_part_4.o Osmocom_VTY_Functions_part_5.o Osmocom_VTY_Functions_part_6.o Osmocom_VTY_Functions_part_7.o PFCP_CodecPort_part_1.o PFCP_CodecPort_part_2.o PFCP_CodecPort_part_3.o PFCP_CodecPort_part_4.o PFCP_CodecPort_part_5.o PFCP_CodecPort_part_6.o PFCP_CodecPort_part_7.o PFCP_CodecPort_CtrlFunct_part_1.o PFCP_CodecPort_CtrlFunct_part_2.o PFCP_CodecPort_CtrlFunct_part_3.o PFCP_CodecPort_CtrlFunct_part_4.o PFCP_CodecPort_CtrlFunct_part_5.o PFCP_CodecPort_CtrlFunct_part_6.o PFCP_CodecPort_CtrlFunct_part_7.o PFCP_Emulation_part_1.o PFCP_Emulation_part_2.o PFCP_Emulation_part_3.o PFCP_Emulation_part_4.o PFCP_Emulation_part_5.o PFCP_Emulation_part_6.o PFCP_Emulation_part_7.o PFCP_Templates_part_1.o PFCP_Templates_part_2.o PFCP_Templates_part_3.o PFCP_Templates_part_4.o PFCP_Templates_part_5.o PFCP_Templates_part_6.o PFCP_Templates_part_7.o PFCP_Types_part_1.o PFCP_Types_part_2.o PFCP_Types_part_3.o PFCP_Types_part_4.o PFCP_Types_part_5.o PFCP_Types_part_6.o PFCP_Types_part_7.o RANAP_CodecPort_part_1.o RANAP_CodecPort_part_2.o RANAP_CodecPort_part_3.o RANAP_CodecPort_part_4.o RANAP_CodecPort_part_5.o RANAP_CodecPort_part_6.o RANAP_CodecPort_part_7.o RANAP_Templates_part_1.o RANAP_Templates_part_2.o RANAP_Templates_part_3.o RANAP_Templates_part_4.o RANAP_Templates_part_5.o RANAP_Templates_part_6.o RANAP_Templates_part_7.o RANAP_Types_part_1.o RANAP_Types_part_2.o RANAP_Types_part_3.o RANAP_Types_part_4.o RANAP_Types_part_5.o RANAP_Types_part_6.o RANAP_Types_part_7.o RTP_CodecPort_part_1.o RTP_CodecPort_part_2.o RTP_CodecPort_part_3.o RTP_CodecPort_part_4.o RTP_CodecPort_part_5.o RTP_CodecPort_part_6.o RTP_CodecPort_part_7.o RTP_CodecPort_CtrlFunct_part_1.o RTP_CodecPort_CtrlFunct_part_2.o RTP_CodecPort_CtrlFunct_part_3.o RTP_CodecPort_CtrlFunct_part_4.o RTP_CodecPort_CtrlFunct_part_5.o RTP_CodecPort_CtrlFunct_part_6.o RTP_CodecPort_CtrlFunct_part_7.o RTP_Emulation_part_1.o RTP_Emulation_part_2.o RTP_Emulation_part_3.o RTP_Emulation_part_4.o RTP_Emulation_part_5.o RTP_Emulation_part_6.o RTP_Emulation_part_7.o RTP_Types_part_1.o RTP_Types_part_2.o RTP_Types_part_3.o RTP_Types_part_4.o RTP_Types_part_5.o RTP_Types_part_6.o RTP_Types_part_7.o RUA_Emulation_part_1.o RUA_Emulation_part_2.o RUA_Emulation_part_3.o RUA_Emulation_part_4.o RUA_Emulation_part_5.o RUA_Emulation_part_6.o RUA_Emulation_part_7.o RUA_Templates_part_1.o RUA_Templates_part_2.o RUA_Templates_part_3.o RUA_Templates_part_4.o RUA_Templates_part_5.o RUA_Templates_part_6.o RUA_Templates_part_7.o RUA_Types_part_1.o RUA_Types_part_2.o RUA_Types_part_3.o RUA_Types_part_4.o RUA_Types_part_5.o RUA_Types_part_6.o RUA_Types_part_7.o SCCP_Emulation_part_1.o SCCP_Emulation_part_2.o SCCP_Emulation_part_3.o SCCP_Emulation_part_4.o SCCP_Emulation_part_5.o SCCP_Emulation_part_6.o SCCP_Emulation_part_7.o SCCP_Templates_part_1.o SCCP_Templates_part_2.o SCCP_Templates_part_3.o SCCP_Templates_part_4.o SCCP_Templates_part_5.o SCCP_Templates_part_6.o SCCP_Templates_part_7.o SCCP_Types_part_1.o SCCP_Types_part_2.o SCCP_Types_part_3.o SCCP_Types_part_4.o SCCP_Types_part_5.o SCCP_Types_part_6.o SCCP_Types_part_7.o SCCPasp_Types_part_1.o SCCPasp_Types_part_2.o SCCPasp_Types_part_3.o SCCPasp_Types_part_4.o SCCPasp_Types_part_5.o SCCPasp_Types_part_6.o SCCPasp_Types_part_7.o SCTP_Templates_part_1.o SCTP_Templates_part_2.o SCTP_Templates_part_3.o SCTP_Templates_part_4.o SCTP_Templates_part_5.o SCTP_Templates_part_6.o SCTP_Templates_part_7.o SCTPasp_PortType_part_1.o SCTPasp_PortType_part_2.o SCTPasp_PortType_part_3.o SCTPasp_PortType_part_4.o SCTPasp_PortType_part_5.o SCTPasp_PortType_part_6.o SCTPasp_PortType_part_7.o SCTPasp_Types_part_1.o SCTPasp_Types_part_2.o SCTPasp_Types_part_3.o SCTPasp_Types_part_4.o SCTPasp_Types_part_5.o SCTPasp_Types_part_6.o SCTPasp_Types_part_7.o SDP_Templates_part_1.o SDP_Templates_part_2.o SDP_Templates_part_3.o SDP_Templates_part_4.o SDP_Templates_part_5.o SDP_Templates_part_6.o SDP_Templates_part_7.o SDP_Types_part_1.o SDP_Types_part_2.o SDP_Types_part_3.o SDP_Types_part_4.o SDP_Types_part_5.o SDP_Types_part_6.o SDP_Types_part_7.o Socket_API_Definitions_part_1.o Socket_API_Definitions_part_2.o Socket_API_Definitions_part_3.o Socket_API_Definitions_part_4.o Socket_API_Definitions_part_5.o Socket_API_Definitions_part_6.o Socket_API_Definitions_part_7.o StatsD_CodecPort_part_1.o StatsD_CodecPort_part_2.o StatsD_CodecPort_part_3.o StatsD_CodecPort_part_4.o StatsD_CodecPort_part_5.o StatsD_CodecPort_part_6.o StatsD_CodecPort_part_7.o StatsD_CodecPort_CtrlFunct_part_1.o StatsD_CodecPort_CtrlFunct_part_2.o StatsD_CodecPort_CtrlFunct_part_3.o StatsD_CodecPort_CtrlFunct_part_4.o StatsD_CodecPort_CtrlFunct_part_5.o StatsD_CodecPort_CtrlFunct_part_6.o StatsD_CodecPort_CtrlFunct_part_7.o StatsD_Types_part_1.o StatsD_Types_part_2.o StatsD_Types_part_3.o StatsD_Types_part_4.o StatsD_Types_part_5.o StatsD_Types_part_6.o StatsD_Types_part_7.o TCCConversion_Functions_part_1.o TCCConversion_Functions_part_2.o TCCConversion_Functions_part_3.o TCCConversion_Functions_part_4.o TCCConversion_Functions_part_5.o TCCConversion_Functions_part_6.o TCCConversion_Functions_part_7.o TCCEncoding_Functions_part_1.o TCCEncoding_Functions_part_2.o TCCEncoding_Functions_part_3.o TCCEncoding_Functions_part_4.o TCCEncoding_Functions_part_5.o TCCEncoding_Functions_part_6.o TCCEncoding_Functions_part_7.o TCCInterface_Functions_part_1.o TCCInterface_Functions_part_2.o TCCInterface_Functions_part_3.o TCCInterface_Functions_part_4.o TCCInterface_Functions_part_5.o TCCInterface_Functions_part_6.o TCCInterface_Functions_part_7.o TELNETasp_PortType_part_1.o TELNETasp_PortType_part_2.o TELNETasp_PortType_part_3.o TELNETasp_PortType_part_4.o TELNETasp_PortType_part_5.o TELNETasp_PortType_part_6.o TELNETasp_PortType_part_7.o UD_PortType_part_1.o UD_PortType_part_2.o UD_PortType_part_3.o UD_PortType_part_4.o UD_PortType_part_5.o UD_PortType_part_6.o UD_PortType_part_7.o UD_Types_part_1.o UD_Types_part_2.o UD_Types_part_3.o UD_Types_part_4.o UD_Types_part_5.o UD_Types_part_6.o UD_Types_part_7.o IPA_Emulation.o RAN_Adapter.o RAN_Emulation.o SCCP_Mapping.o StatsD_Checker.o IPA_Emulation_part_1.o IPA_Emulation_part_2.o IPA_Emulation_part_3.o IPA_Emulation_part_4.o IPA_Emulation_part_5.o IPA_Emulation_part_6.o IPA_Emulation_part_7.o RAN_Adapter_part_1.o RAN_Adapter_part_2.o RAN_Adapter_part_3.o RAN_Adapter_part_4.o RAN_Adapter_part_5.o RAN_Adapter_part_6.o RAN_Adapter_part_7.o RAN_Emulation_part_1.o RAN_Emulation_part_2.o RAN_Emulation_part_3.o RAN_Emulation_part_4.o RAN_Emulation_part_5.o RAN_Emulation_part_6.o RAN_Emulation_part_7.o SCCP_Mapping_part_1.o SCCP_Mapping_part_2.o SCCP_Mapping_part_3.o SCCP_Mapping_part_4.o SCCP_Mapping_part_5.o SCCP_Mapping_part_6.o SCCP_Mapping_part_7.o StatsD_Checker_part_1.o StatsD_Checker_part_2.o StatsD_Checker_part_3.o StatsD_Checker_part_4.o StatsD_Checker_part_5.o StatsD_Checker_part_6.o StatsD_Checker_part_7.o HNBAP_CommonDataTypes.o HNBAP_Constants.o HNBAP_Containers.o HNBAP_IEs.o HNBAP_PDU_Contents.o HNBAP_PDU_Descriptions.o RANAP_CommonDataTypes.o RANAP_Constants.o RANAP_Containers.o RANAP_IEs.o RANAP_PDU_Contents.o RANAP_PDU_Descriptions.o RUA_CommonDataTypes.o RUA_Constants.o RUA_Containers.o RUA_IEs.o RUA_PDU_Contents.o RUA_PDU_Descriptions.o HNBAP_CommonDataTypes_part_1.o HNBAP_CommonDataTypes_part_2.o HNBAP_CommonDataTypes_part_3.o HNBAP_CommonDataTypes_part_4.o HNBAP_CommonDataTypes_part_5.o HNBAP_CommonDataTypes_part_6.o HNBAP_CommonDataTypes_part_7.o HNBAP_Constants_part_1.o HNBAP_Constants_part_2.o HNBAP_Constants_part_3.o HNBAP_Constants_part_4.o HNBAP_Constants_part_5.o HNBAP_Constants_part_6.o HNBAP_Constants_part_7.o HNBAP_Containers_part_1.o HNBAP_Containers_part_2.o HNBAP_Containers_part_3.o HNBAP_Containers_part_4.o HNBAP_Containers_part_5.o HNBAP_Containers_part_6.o HNBAP_Containers_part_7.o HNBAP_IEs_part_1.o HNBAP_IEs_part_2.o HNBAP_IEs_part_3.o HNBAP_IEs_part_4.o HNBAP_IEs_part_5.o HNBAP_IEs_part_6.o HNBAP_IEs_part_7.o HNBAP_PDU_Contents_part_1.o HNBAP_PDU_Contents_part_2.o HNBAP_PDU_Contents_part_3.o HNBAP_PDU_Contents_part_4.o HNBAP_PDU_Contents_part_5.o HNBAP_PDU_Contents_part_6.o HNBAP_PDU_Contents_part_7.o HNBAP_PDU_Descriptions_part_1.o HNBAP_PDU_Descriptions_part_2.o HNBAP_PDU_Descriptions_part_3.o HNBAP_PDU_Descriptions_part_4.o HNBAP_PDU_Descriptions_part_5.o HNBAP_PDU_Descriptions_part_6.o HNBAP_PDU_Descriptions_part_7.o RANAP_CommonDataTypes_part_1.o RANAP_CommonDataTypes_part_2.o RANAP_CommonDataTypes_part_3.o RANAP_CommonDataTypes_part_4.o RANAP_CommonDataTypes_part_5.o RANAP_CommonDataTypes_part_6.o RANAP_CommonDataTypes_part_7.o RANAP_Constants_part_1.o RANAP_Constants_part_2.o RANAP_Constants_part_3.o RANAP_Constants_part_4.o RANAP_Constants_part_5.o RANAP_Constants_part_6.o RANAP_Constants_part_7.o RANAP_Containers_part_1.o RANAP_Containers_part_2.o RANAP_Containers_part_3.o RANAP_Containers_part_4.o RANAP_Containers_part_5.o RANAP_Containers_part_6.o RANAP_Containers_part_7.o RANAP_IEs_part_1.o RANAP_IEs_part_2.o RANAP_IEs_part_3.o RANAP_IEs_part_4.o RANAP_IEs_part_5.o RANAP_IEs_part_6.o RANAP_IEs_part_7.o RANAP_PDU_Contents_part_1.o RANAP_PDU_Contents_part_2.o RANAP_PDU_Contents_part_3.o RANAP_PDU_Contents_part_4.o RANAP_PDU_Contents_part_5.o RANAP_PDU_Contents_part_6.o RANAP_PDU_Contents_part_7.o RANAP_PDU_Descriptions_part_1.o RANAP_PDU_Descriptions_part_2.o RANAP_PDU_Descriptions_part_3.o RANAP_PDU_Descriptions_part_4.o RANAP_PDU_Descriptions_part_5.o RANAP_PDU_Descriptions_part_6.o RANAP_PDU_Descriptions_part_7.o RUA_CommonDataTypes_part_1.o RUA_CommonDataTypes_part_2.o RUA_CommonDataTypes_part_3.o RUA_CommonDataTypes_part_4.o RUA_CommonDataTypes_part_5.o RUA_CommonDataTypes_part_6.o RUA_CommonDataTypes_part_7.o RUA_Constants_part_1.o RUA_Constants_part_2.o RUA_Constants_part_3.o RUA_Constants_part_4.o RUA_Constants_part_5.o RUA_Constants_part_6.o RUA_Constants_part_7.o RUA_Containers_part_1.o RUA_Containers_part_2.o RUA_Containers_part_3.o RUA_Containers_part_4.o RUA_Containers_part_5.o RUA_Containers_part_6.o RUA_Containers_part_7.o RUA_IEs_part_1.o RUA_IEs_part_2.o RUA_IEs_part_3.o RUA_IEs_part_4.o RUA_IEs_part_5.o RUA_IEs_part_6.o RUA_IEs_part_7.o RUA_PDU_Contents_part_1.o RUA_PDU_Contents_part_2.o RUA_PDU_Contents_part_3.o RUA_PDU_Contents_part_4.o RUA_PDU_Contents_part_5.o RUA_PDU_Contents_part_6.o RUA_PDU_Contents_part_7.o RUA_PDU_Descriptions_part_1.o RUA_PDU_Descriptions_part_2.o RUA_PDU_Descriptions_part_3.o RUA_PDU_Descriptions_part_4.o RUA_PDU_Descriptions_part_5.o RUA_PDU_Descriptions_part_6.o RUA_PDU_Descriptions_part_7.o SDP_parse_.tab.o lex.SDP_parse_.o IPA_CodecPort_CtrlFunctDef.o IPL4asp_PT.o IPL4asp_discovery.o IuUP_EncDec.o Iuh_CodecPort_CtrlFunctDef.o Native_FunctionDefs.o RTP_CodecPort_CtrlFunctDef.o RTP_EncDec.o SCTPasp_PT.o SDP_EncDec.o StatsD_CodecPort_CtrlFunctdef.o TCCConversion.o TCCEncoding.o TCCInterface.o TELNETasp_PT.o HNBAP_EncDec.o RUA_EncDec.o RANAP_EncDec.o MGCP_CodecPort_CtrlFunctDef.o UD_PT.o PFCP_CodecPort_CtrlFunctDef.o; exit 1; fi #8 61.61 make[1]: Leaving directory '/osmo-ttcn3-hacks/hnbgw' #8 DONE 62.3s #9 [4/4] COPY HNBGW_TESTS.CFG /data/HNBGW_Tests.cfg #9 DONE 0.2s #10 exporting to image #10 exporting layers #10 exporting layers 4.7s done #10 writing image sha256:ac8a3f0d3c6556c0f909dae2a06855d5923381209f8024f1ba4e573e0327926c done #10 naming to docker.io/osmocom-build/ttcn3-hnbgw-test:latest 0.0s done #10 DONE 4.8s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test' + docker_image_exists ttcn3-hnbgw-test + docker images -q osmocom-build/ttcn3-hnbgw-test + test -n ac8a3f0d3c65 + list_osmo_packages debian-bookworm ttcn3-hnbgw-test + local distro=debian-bookworm + local image=ttcn3-hnbgw-test + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/ttcn3-hnbgw-test -c + [ -n ] + return + set_clean_up_trap + trap clean_up_common EXIT INT TERM 0 + set -e + VOL_BASE_DIR_PFCP=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + network_create + SUBNET=999567 + seq 1 30 + echo (999567 + 1) % 256 + bc + SUBNET=144 + NET_NAME=ttcn3-hnbgw-test-144 + SUB4=172.18.144.0/24 + SUB6=fd02:db8:144::/64 + set +x Creating network ttcn3-hnbgw-test-144, trying SUBNET=144... + docker network create --internal --subnet 172.18.144.0/24 --ipv6 --subnet fd02:db8:144::/64 ttcn3-hnbgw-test-144 33847f5c24eefcb19aa4daa06f44b484a7d958318781cdc4016f522550e2b60a + set +x ### Network ttcn3-hnbgw-test-144 created (SUBNET=144) ### + return + echo Testing without PFCP Testing without PFCP + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs HNBGW_Tests.cfg osmo-stp.cfg osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + tests_cfg=HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/unix + cp HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/unix + cp osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 144 200 + NET=144 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.200 --ip6 fd02:db8:144::200 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.200 --ip6 fd02:db8:144::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp:/data --name jenkins-ttcn3-hnbgw-test-1005-stp -d osmocom-build/osmo-stp-master 9f0b6d4474859ab32aa8ee77fb78f392a3731a8bfafbae54ee9f89aa1fb294ab + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 144 20 + NET=144 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.20 --ip6 fd02:db8:144::20 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.20 --ip6 fd02:db8:144::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-1005-hnbgw -d osmocom-build/osmo-hnbgw-master 882376e52a1e6bac29a679cd32c15dc681572d477142300f0087e560087d348e + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 144 203 + NET=144 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.203 --ip6 fd02:db8:144::203 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.203 --ip6 fd02:db8:144::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.144.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-1005-ttcn3-hnbgw-test osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@b9dad4e9983f: Unix server socket created successfully. MC@b9dad4e9983f: Listening on TCP port 42567. MC2> b9dad4e9983f is the default spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests b9dad4e9983f 42567 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@b9dad4e9983f: New HC connected from 172.18.144.203 [172.18.144.203]. b9dad4e9983f: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@b9dad4e9983f: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@b9dad4e9983f: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@b9dad4e9983f: Configuration file was processed on all HCs. MC@b9dad4e9983f: Creating MTC on host 172.18.144.203. MC@b9dad4e9983f: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Tue Oct 8 07:48:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(9)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(9)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(7)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(12)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(10)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(8)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(8)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(11)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(11)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(11)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(7)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register-Iuh0-RUA(5)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(8)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(3)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(13)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_hnb_register finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Tue Oct 8 07:48:57 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=159101) Waiting for packet dumper to finish... 1 (prev_count=159101, count=214366) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Tue Oct 8 07:49:00 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(22)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(22)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(20)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate-Iuh0-RUA(16)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1-RUA(18)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1(17)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(20)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(21)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(14)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(26)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Tue Oct 8 07:49:02 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82187) Waiting for packet dumper to finish... 1 (prev_count=82187, count=140662) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Tue Oct 8 07:49:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(33)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(33)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(31)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(36)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@b9dad4e9983f: M3UA emulation initiated, the test can be started MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(35)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(32)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(37)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(35)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(27)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Tue Oct 8 07:49:07 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80233) Waiting for packet dumper to finish... 1 (prev_count=80233, count=138320) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Tue Oct 8 07:49:09 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(44)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(44)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(42)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(47)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(45)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@b9dad4e9983f: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b9dad4e9983f: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b9dad4e9983f: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_hnb_disconnected_timeout-Iuh0(49)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_hnb_disconnected_timeout-Iuh0(49)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b9dad4e9983f: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(45)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(38)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(46)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(43)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(48)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(38): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(48): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_hnb_disconnected_timeout finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout pass'. Tue Oct 8 07:49:25 UTC 2024 ====== HNBGW_Tests.TC_hnb_disconnected_timeout pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=145546) Waiting for packet dumper to finish... 1 (prev_count=145546, count=146046) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Tue Oct 8 07:49:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(57)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(57)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(55)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(60)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(58)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(56)@b9dad4e9983f: Final verdict of PTC: none TC_ue_register-Iuh0-RUA(53)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(59)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(55)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(61)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@b9dad4e9983f: Final verdict of PTC: none TC_ue_register-Iuh0(52)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(51)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_ue_register finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Tue Oct 8 07:49:30 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82703) Waiting for packet dumper to finish... 1 (prev_count=82703, count=137097) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Tue Oct 8 07:49:32 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ue_register_tmsi_lai started. MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(68)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(68)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(66)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_tmsi_lai-Iuh0-RUA(64)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(66)@b9dad4e9983f: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(67)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(62)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(72)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Tue Oct 8 07:49:35 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82592) Waiting for packet dumper to finish... 1 (prev_count=82592, count=136969) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Tue Oct 8 07:49:37 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(79)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(79)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(77)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(82)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(80)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(81)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(81)@b9dad4e9983f: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0-RUA(75)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(77)@b9dad4e9983f: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(73)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(78)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(83)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Tue Oct 8 07:49:39 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80140) Waiting for packet dumper to finish... 1 (prev_count=80140, count=134878) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Tue Oct 8 07:49:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(90)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(90)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(93)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(91)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: f_create_expect(l3 := '8524F43A21C46611FC1B'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: Created Expect[0] for '8524F43A21C46611FC1B'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_initial_ue0(95)8718977 HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: Found Expect[0] for l3='8524F43A21C46611FC1B'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_initial_ue0(95)4391651 HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@b9dad4e9983f: setverdict(pass): none -> pass TC_ranap_cs_initial_ue0(95)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(89)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(84)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0-RUA(86)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(91)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(94)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Tue Oct 8 07:49:45 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118562) Waiting for packet dumper to finish... 1 (prev_count=118562, count=157163) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Tue Oct 8 07:49:48 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(102)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(102)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(100)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(102)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(105)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: f_create_expect(l3 := 'AB944A4B6D83630AFE11'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: Created Expect[0] for 'AB944A4B6D83630AFE11'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_initial_ue0(107)9731814 HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: Found Expect[0] for l3='AB944A4B6D83630AFE11'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_initial_ue0(107)722865 HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@b9dad4e9983f: setverdict(pass): none -> pass TC_ranap_ps_initial_ue0(107)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue-Iuh0-RUA(98)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(100)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(101)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(96)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(106)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Tue Oct 8 07:49:51 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118336) Waiting for packet dumper to finish... 1 (prev_count=118336, count=157182) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Tue Oct 8 07:49:53 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(114)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(114)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)10304843 HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)15718554 HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@b9dad4e9983f: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(112)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(118)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(113)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(108)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Tue Oct 8 07:49:57 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124271) Waiting for packet dumper to finish... 1 (prev_count=124271, count=165896) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Tue Oct 8 07:49:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(126)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(126)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(124)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)15352498 HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)9838485 HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@b9dad4e9983f: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(125)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(120)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(124)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(128)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(130)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Tue Oct 8 07:50:02 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124255) Waiting for packet dumper to finish... 1 (prev_count=124255, count=165825) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Tue Oct 8 07:50:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(138)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(138)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(141)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(139)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: f_create_expect(l3 := '1B92895BD3D556B87F28'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: Created Expect[0] for '1B92895BD3D556B87F28'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_bidir0(143)6204877 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: Found Expect[0] for l3='1B92895BD3D556B87F28'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_bidir0(143)10962110 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Session index based on connection ID:0 TC_ranap_cs_bidir0(143)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: vl_len:22 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A31795FF879BBFC2BB1E2'O TC_ranap_cs_bidir0(143)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: vl_len:20 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_bidir-Iuh0-RUA(134)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(137)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(136)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(132)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(142)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Tue Oct 8 07:50:08 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=122975) Waiting for packet dumper to finish... 1 (prev_count=122975, count=174637) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Tue Oct 8 07:50:11 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(150)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(150)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(148)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(153)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(153)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: f_create_expect(l3 := '14BFF673977BD3C6D9FA'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: Created Expect[0] for '14BFF673977BD3C6D9FA'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_bidir0(155)6637669 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: Found Expect[0] for l3='14BFF673977BD3C6D9FA'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_bidir0(155)3756836 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_bidir0(155)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A170F1AEE441C63A6D0FF'O TC_ranap_ps_bidir0(155)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_bidir-Iuh0-RUA(146)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(148)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(144)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(151)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(154)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Tue Oct 8 07:50:15 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119818) Waiting for packet dumper to finish... 1 (prev_count=119818, count=172153) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Tue Oct 8 07:50:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(162)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(162)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: f_create_expect(l3 := '0F1DF66A25D674219F64'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: Created Expect[0] for '0F1DF66A25D674219F64'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@b9dad4e9983f: Added conn table entry 0TC_rab_assignment0(167)106614 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: Found Expect[0] for l3='0F1DF66A25D674219F64'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: Added conn table entry 0TC_rab_assignment0(167)12450897 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): none -> pass VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1a07617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1a07617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b9dad4e9983f: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1a07617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@b9dad4e9983f: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1a07617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: vl_len:12 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1a07617" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assignment-Iuh0-RUA(158)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(161)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(166)@b9dad4e9983f: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(156)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_assignment finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Tue Oct 8 07:50:21 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119818) Waiting for packet dumper to finish... 1 (prev_count=119818, count=233072) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Tue Oct 8 07:50:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(174)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(174)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: f_create_expect(l3 := '68AF84D6FB67BD7EBDEF'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: Created Expect[0] for '68AF84D6FB67BD7EBDEF'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@b9dad4e9983f: Added conn table entry 0TC_rab_release0(179)10592928 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: Found Expect[0] for l3='68AF84D6FB67BD7EBDEF'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: Added conn table entry 0TC_rab_release0(179)7663860 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a1a2a017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a1a2a017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b9dad4e9983f: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a1a2a017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@b9dad4e9983f: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a1a2a017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: vl_len:21 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a1a2a017" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(172)@b9dad4e9983f: Final verdict of PTC: none TC_rab_release-Iuh0-RUA(170)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(178)@b9dad4e9983f: Final verdict of PTC: none TC_rab_release-Iuh0(169)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(174)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(168)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_release finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Tue Oct 8 07:50:27 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119773) Waiting for packet dumper to finish... 1 (prev_count=119773, count=226729) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Tue Oct 8 07:50:30 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(186)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(189)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(187)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: f_create_expect(l3 := '4A6FAEE6A1B094A2E39E'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: Created Expect[0] for '4A6FAEE6A1B094A2E39E'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@b9dad4e9983f: Added conn table entry 0TC_rab_release_abnormal0(191)12522677 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: Found Expect[0] for l3='4A6FAEE6A1B094A2E39E'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: Added conn table entry 0TC_rab_release_abnormal0(191)15018828 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Session index based on connection ID:0 TC_rab_release_abnormal0(191)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf14b517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf14b517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b9dad4e9983f: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf14b517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@b9dad4e9983f: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf14b517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: vl_len:21 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf14b517" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(185)@b9dad4e9983f: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0-RUA(182)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(188)@b9dad4e9983f: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(190)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(180)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Tue Oct 8 07:50:33 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124542) Waiting for packet dumper to finish... 1 (prev_count=124542, count=232006) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Tue Oct 8 07:50:36 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(198)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: f_create_expect(l3 := 'A8F938B6FD8B02ADF8F3'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: Created Expect[0] for 'A8F938B6FD8B02ADF8F3'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_fail0(203)3483255 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: Found Expect[0] for l3='A8F938B6FD8B02ADF8F3'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_fail0(203)12960691 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Session index based on connection ID:0 TC_rab_assign_fail0(203)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "35267717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "35267717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "35267717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "35267717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "35267717" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_fail-Iuh0-RUA(194)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@b9dad4e9983f: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(200)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(201)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(202)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(192)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_assign_fail finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Tue Oct 8 07:50:39 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124551) Waiting for packet dumper to finish... 1 (prev_count=124551, count=208812) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Tue Oct 8 07:50:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(210)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(213)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(211)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: f_create_expect(l3 := '1895130D2F849160AFF7'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: Created Expect[0] for '1895130D2F849160AFF7'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_mgcp_to0(215)1872478 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: Found Expect[0] for l3='1895130D2F849160AFF7'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_mgcp_to0(215)16236992 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgcp_to0(215)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1c925e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1c925e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@b9dad4e9983f: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1c925e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1c925e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: vl_len:12 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgcp_to-Iuh0-RUA(206)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(211)@b9dad4e9983f: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(214)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(204)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Tue Oct 8 07:50:49 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=153058) Waiting for packet dumper to finish... 1 (prev_count=153058, count=198658) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Tue Oct 8 07:50:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(222)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(222)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(225)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(223)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: f_create_expect(l3 := '185BC469F7380026D451'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: Created Expect[0] for '185BC469F7380026D451'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)2745534 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: Found Expect[0] for l3='185BC469F7380026D451'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)1583676 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Session index based on connection ID:0 TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "29e4be17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "29e4be17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "29e4be17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "29e4be17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@b9dad4e9983f: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: vl_len:12 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "29e4be17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(220)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(221)@b9dad4e9983f: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(226)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(216)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Tue Oct 8 07:50:55 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=239771) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Tue Oct 8 07:50:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(234)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(234)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(237)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(235)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: f_create_expect(l3 := 'B622C79F8550C83D12FB'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: Created Expect[0] for 'B622C79F8550C83D12FB'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)9469991 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: Found Expect[0] for l3='B622C79F8550C83D12FB'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)14967583 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Session index based on connection ID:0 TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: vl_len:22 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A02719E81FF2CABB40183'O TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b9dad4e9983f: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)9469991 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)14967583 TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(236)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(232)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(233)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(228)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(238)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Tue Oct 8 07:51:06 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=162268) Waiting for packet dumper to finish... 1 (prev_count=162268, count=193633) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Tue Oct 8 07:51:08 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(246)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(246)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(249)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(247)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: f_create_expect(l3 := 'A4DA7B458D092EE83BAC'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: Created Expect[0] for 'A4DA7B458D092EE83BAC'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)16615021 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: Found Expect[0] for l3='A4DA7B458D092EE83BAC'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)660073 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: vl_len:22 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A10D6DE23A0AC8E452239'O TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b9dad4e9983f: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)16615021 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)660073 TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(245)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(240)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@b9dad4e9983f: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(249)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(250)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Tue Oct 8 07:51:17 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=148095) Waiting for packet dumper to finish... 1 (prev_count=148095, count=174743) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_without_pfcp ------ Tue Oct 8 07:51:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_ps_rab_assignment_without_pfcp started. TC_ps_rab_assignment_without_pfcp-Iuh0(253)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_ps_rab_assignment_without_pfcp-Iuh1(255)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(260)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(260)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(260)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(258)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(263)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(263)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(263)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(260)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(263)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(259)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(259)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_without_pfcp-PFCP(265)@b9dad4e9983f: f_PFCPEM_conns_bcast_add(): vc_conn TC_ps_rab_assignment_without_pfcp0(266) subscribed for broadcast HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: f_create_expect(l3 := '35F7660C45FCB12A3319'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: Created Expect[0] for '35F7660C45FCB12A3319'O to be handled at TC_ps_rab_assignment_without_pfcp0(266) TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@b9dad4e9983f: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)16142581 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: Found Expect[0] for l3='35F7660C45FCB12A3319'O handled at TC_ps_rab_assignment_without_pfcp0(266) HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)2252486 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: vl_len:91 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: vl_len:12 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp0(266)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(258)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(262)@b9dad4e9983f: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(252)@b9dad4e9983f: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1(255)@b9dad4e9983f: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(259)@b9dad4e9983f: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh0(253)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(261)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(260)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(263)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(264)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(257)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp-PFCP(265)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0(253): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1(255): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(257): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(258): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(259): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(260): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(261): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(262): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(263): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(264): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-PFCP(265): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_ps_rab_assignment_without_pfcp0(266): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_ps_rab_assignment_without_pfcp finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass'. Tue Oct 8 07:51:28 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=158465) Waiting for packet dumper to finish... 1 (prev_count=158465, count=183502) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Tue Oct 8 07:51:30 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(275)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(275)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(275)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(278)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(278)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(278)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(276)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(275)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(278)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(277)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(277)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)12409932 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)10731763 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)3804573 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)13891651 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(282) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)6902496 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: First idle individual index:2 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(282) HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)1183380 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(282)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(282)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(283) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@b9dad4e9983f: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)4978342 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: First idle individual index:3 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(283) HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)3744626 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(283)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(283)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(274)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(278)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(279)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(276)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(267)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(277)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(275)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(273)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(272)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(267): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(272): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(273): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(274): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(275): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(276): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(277): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(278): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(279): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(282): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(283): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Tue Oct 8 07:51:37 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=215277) Waiting for packet dumper to finish... 1 (prev_count=215277, count=283213) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Tue Oct 8 07:51:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(292)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(292)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(292)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(295)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(295)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(295)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(298)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(298)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(298)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(296)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(301)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(301)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(301)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(299)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(292)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(295)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(298)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(301)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(297)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(297)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(300)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(300)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)3521932 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)10605514 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(304)3597942 HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(304)2663838 HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(304)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(304)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(305)4453650 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(305)7995675 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(305)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(305)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(302)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(301)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(299)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(291)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(297)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(300)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(293)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(296)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(295)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(289)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(298)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(292)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(284)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(290)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(294)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(284): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(289): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(290): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(291): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(292): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(293): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(294): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(295): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(296): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(297): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(298): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(299): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(300): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(301): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(302): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(304): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(305): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Tue Oct 8 07:51:46 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243331) Waiting for packet dumper to finish... 1 (prev_count=243331, count=310923) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Tue Oct 8 07:51:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(314)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(314)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(314)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(317)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(317)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(317)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(320)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(320)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(320)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(318)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(323)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(323)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(323)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(321)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(314)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(317)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(320)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(323)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(319)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(319)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(322)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(322)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)10167363 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)5301440 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@b9dad4e9983f: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)4862534 HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)16590129 HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@b9dad4e9983f: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)14702930 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)4656041 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-SCCP(321)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(312)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(322)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(320)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(319)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(313)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(311)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(318)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(316)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(323)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(306)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(315)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(317)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(314)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(324)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(306): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(311): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(312): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(313): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(314): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(315): none (pass -> pass) Tue Oct 8 07:51:55 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(316): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(317): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(318): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(319): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(320): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(321): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(322): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(323): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(324): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=243781) Waiting for packet dumper to finish... 1 (prev_count=243781, count=303578) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Tue Oct 8 07:51:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(336)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(336)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(336)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(339)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(339)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(339)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(342)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(342)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(342)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(340)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(345)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(345)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(345)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(343)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(336)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(339)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(342)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(345)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(341)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(341)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(344)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(344)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)15163236 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)2571981 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@b9dad4e9983f: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)15715569 HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)9255013 HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@b9dad4e9983f: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)9464871 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)786703 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(343)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(335)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(345)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(338)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(328)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(341)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(334)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(333)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(339)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(337)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(336)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(346)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(340)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(344)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(342)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(328): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(333): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(334): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(335): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(336): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(337): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(338): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(339): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(340): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(341): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(342): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(343): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(344): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(345): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(346): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Tue Oct 8 07:52:04 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=249013) Waiting for packet dumper to finish... 1 (prev_count=249013, count=314290) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Tue Oct 8 07:52:07 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(358)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(358)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(358)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(361)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(361)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(361)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(364)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(364)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(364)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(362)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(367)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(367)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(367)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(365)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(358)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(361)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(364)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(367)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(363)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(363)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(366)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(366)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)11252200 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)7918174 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)8034879 HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)564285 HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)1772609 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)10391205 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(365)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(362)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(363)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(358)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(360)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(366)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(356)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(364)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(355)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(361)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(350)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(368)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(367)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(359)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(357)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(350): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(355): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(356): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(357): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(358): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(359): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(360): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(361): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(362): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(363): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(364): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(365): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(366): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(367): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(368): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Tue Oct 8 07:52:13 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=248118) Waiting for packet dumper to finish... 1 (prev_count=248118, count=316741) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Tue Oct 8 07:52:16 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(380)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(380)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(380)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(383)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(383)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(383)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(386)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(386)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(386)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(384)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(389)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(389)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(389)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(387)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(380)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(383)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(386)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(389)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(385)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(385)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(388)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(388)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)4113366 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)8322759 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)12977219 HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)14923909 HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)10390340 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)7831718 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(379)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(384)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(381)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(378)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(388)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(386)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(389)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(383)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(382)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(387)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(385)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(380)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(377)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(372)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(390)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(372): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(377): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(378): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(379): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(380): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(381): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(382): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(383): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(384): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(385): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(386): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(387): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(388): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(389): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(390): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Tue Oct 8 07:52:23 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=256427) Waiting for packet dumper to finish... 1 (prev_count=256427, count=321497) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Tue Oct 8 07:52:25 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(402)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(402)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(402)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(400)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(405)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(405)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(405)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(408)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(408)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(408)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(406)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(411)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(411)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(411)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(409)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(402)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(405)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(408)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(411)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(401)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(401)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(407)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(407)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(410)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(410)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)5830994 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)8300872 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)8851343 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)12522742 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)5763612 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: First idle individual index:2 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)9590205 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(407)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(400)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(411)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(408)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(402)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(410)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(404)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(401)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(394)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(403)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(409)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(412)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(399)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(406)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(405)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(394): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(399): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(400): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(401): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(402): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(403): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(404): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(405): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(406): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(407): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(408): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(409): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(410): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(411): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(412): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Tue Oct 8 07:52:32 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=269068) Waiting for packet dumper to finish... 1 (prev_count=269068, count=337406) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Tue Oct 8 07:52:34 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(424)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(424)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(424)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(422)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(427)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(427)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(427)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(430)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(430)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(430)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(433)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(433)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(433)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(431)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(436)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(436)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(436)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(434)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(439)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-M3UA(439)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(439)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-SCCP(437)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(424)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(427)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(430)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(433)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(436)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(439)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(423)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(423)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(432)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(432)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(435)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(435)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(438)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(438)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)9631116 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)15437772 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)10891457 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)3599066 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@b9dad4e9983f: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)4229658 HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)8574433 HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(433)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(431)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(429)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(434)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(432)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(427)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(430)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(425)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(426)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(421)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(424)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(437)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(422)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(423)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(416)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(438)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(435)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(439)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(428)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(436)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(440)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(416): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(421): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(422): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(423): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(424): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(425): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(426): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(427): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(428): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(429): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(430): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(431): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(432): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(433): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(434): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(435): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(436): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(437): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-RAN(438): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(439): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(440): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Tue Oct 8 07:52:41 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=388699) Waiting for packet dumper to finish... 1 (prev_count=388699, count=398523) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Tue Oct 8 07:52:44 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(452)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(452)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(452)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(455)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(455)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(455)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(453)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(458)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(458)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(458)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(461)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(461)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(461)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(459)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(464)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(464)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(464)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(462)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(467)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-M3UA(467)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(467)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-SCCP(465)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(452)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(455)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(458)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(461)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(464)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(467)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(454)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(454)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(460)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(460)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(463)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(463)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(466)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(466)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)9305296 HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)5592769 HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@b9dad4e9983f: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)9247746 HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)12340109 HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(457)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(459)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(463)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(458)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(462)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(456)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(461)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(453)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(452)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(444)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(450)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(465)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(451)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(449)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(460)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(455)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(464)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(454)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(467)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(466)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(468)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(444): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(449): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(450): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(451): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(452): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(453): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(454): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(455): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(456): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(457): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(458): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(459): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(460): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(461): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(462): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(463): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(464): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(465): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-RAN(466): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(467): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(468): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(469): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(470): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Tue Oct 8 07:52:49 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=360612) Waiting for packet dumper to finish... 1 (prev_count=360612, count=365759) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Tue Oct 8 07:52:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(472)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(474)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(479)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(479)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(479)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(482)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(482)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(482)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(480)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(485)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(485)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(485)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(483)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(488)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(488)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(488)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(486)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(479)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(482)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(485)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(488)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(481)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(481)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(484)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(484)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(487)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(487)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh0-RUA(473)@b9dad4e9983f: UnitdataCallback TC_mscpool_paging_imsi-Iuh1-RUA(475)@b9dad4e9983f: UnitdataCallback HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(490) TC_mscpool_paging_imsi-Iuh0-RUA(473)@b9dad4e9983f: Added conn table entry 0TC_mscpool_paging_imsi0(490)10083566 HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(490) HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: Added conn table entry 0TC_mscpool_paging_imsi0(490)16715954 HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(490)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(490)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_imsi-Iuh0-RUA(473)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(481)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(487)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(482)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(486)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(478)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(483)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(472)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(474)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(477)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(480)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(471)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(485)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(479)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1-RUA(475)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(476)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(488)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(484)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(489)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(471): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(472): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(473): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(474): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(475): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(476): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(477): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(478): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(479): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(480): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(481): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(482): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(483): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(484): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(485): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(486): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(487): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(488): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(489): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_imsi0(490): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Tue Oct 8 07:52:58 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243848) Waiting for packet dumper to finish... 1 (prev_count=243848, count=286579) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Tue Oct 8 07:53:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(492)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(494)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(499)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(499)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(499)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(502)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(502)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(502)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(500)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(505)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(505)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(505)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(503)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(508)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(508)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(508)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(506)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(499)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(502)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(505)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(508)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(501)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(501)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(504)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(504)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(507)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(507)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(510)@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh0-RUA(493)@b9dad4e9983f: UnitdataCallback TC_mscpool_paging_tmsi-Iuh1-RUA(495)@b9dad4e9983f: UnitdataCallback TC_mscpool_paging_tmsi0(510)@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(510) TC_mscpool_paging_tmsi-Iuh0-RUA(493)@b9dad4e9983f: Added conn table entry 0TC_mscpool_paging_tmsi0(510)1312273 HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(510) HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: Added conn table entry 0TC_mscpool_paging_tmsi0(510)14864730 HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(510)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_paging_tmsi0(510)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-RAN(504)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1-RUA(495)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0-RUA(493)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(506)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(507)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(499)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(498)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(503)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(501)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(500)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(508)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(494)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(497)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(505)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(492)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(509)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(496)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(502)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(491)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(491): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(492): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(493): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(494): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(495): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(496): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(497): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(498): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(499): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(500): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(501): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(502): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(503): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(504): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(505): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(506): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(507): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(508): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(509): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_paging_tmsi0(510): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Tue Oct 8 07:53:07 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=232529) Waiting for packet dumper to finish... 1 (prev_count=232529, count=270071) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Tue Oct 8 07:53:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(519)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(519)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(519)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(522)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(522)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(522)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(520)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(525)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(525)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(525)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(528)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(528)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(528)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(526)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(519)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(522)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(525)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(528)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(521)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(521)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(527)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(527)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)9005922 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)14463591 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(531) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@b9dad4e9983f: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(531)14357446 HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(531) HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(531)7845995 HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(531)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(531)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(532) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@b9dad4e9983f: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(532)2891099 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(532) HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(532)26808 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(532)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(532)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(524)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(528)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(525)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(527)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(526)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(523)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(518)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(521)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(511)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(529)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(519)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(516)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(522)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(520)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(517)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(511): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(512): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(514): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(516): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(517): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(518): none (pass -> pass) Tue Oct 8 07:53:16 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(519): none (pass -> pass)Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(520): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(521): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(522): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(523): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(524): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(525): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(526): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(527): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(528): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(529): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(531): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(532): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=268561) Waiting for packet dumper to finish... 1 (prev_count=268561, count=337291) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Tue Oct 8 07:53:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(541)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(541)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(541)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(544)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(544)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(544)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(547)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(547)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(547)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(550)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(550)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(550)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(548)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(541)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(544)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(547)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(550)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(549)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(549)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)1085256 HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)14925903 HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(552)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(553) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@b9dad4e9983f: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(553)823680 HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(553) HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(553)6358326 HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(553)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(553)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(554) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@b9dad4e9983f: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(554)4181789 HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(554) HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(554)12565813 HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(554)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(554)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(549)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(539)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(550)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(543)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(548)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(542)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(545)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(547)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(551)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(544)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(541)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(538)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(533)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(546)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(540)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(533): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(534): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(536): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(538): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(539): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(540): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(541): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(542): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(543): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(544): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(545): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(546): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(547): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(548): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(549): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(550): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(551): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(553): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(554): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Tue Oct 8 07:53:26 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=261437) Waiting for packet dumper to finish... 1 (prev_count=261437, count=326597) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Tue Oct 8 07:53:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(563)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(563)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(563)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(566)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(566)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(566)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(569)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(569)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(569)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(567)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(572)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(572)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(572)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(570)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(563)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(566)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(569)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(572)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(568)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(568)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(571)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(571)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)1631440 HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)15975321 HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@b9dad4e9983f: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)8637750 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)6914417 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: "disconnecting msc0" HNBGW_Test.msc0-RAN(562)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(563)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(561)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@b9dad4e9983f: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)1631440 HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)12400338 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)3848229 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(568)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(565)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(573)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(564)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(570)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(567)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(555)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(572)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(560)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(569)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(566)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(571)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(555): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(560): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(561): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(562): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(563): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(564): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(565): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(566): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(567): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(568): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(569): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(570): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(571): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(572): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(573): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Tue Oct 8 07:53:35 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=258885) Waiting for packet dumper to finish... 1 (prev_count=258885, count=324642) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Tue Oct 8 07:53:38 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(585)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(585)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(585)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(588)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(588)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(588)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(586)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(585)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(588)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(587)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(587)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)12358378 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)12818557 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@b9dad4e9983f: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)13274874 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)14329016 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: "connecting cnlink 1" MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(594)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(594)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(594)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(594)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@b9dad4e9983f: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)7488203 HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)7769685 HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@b9dad4e9983f: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(586)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(582)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(587)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(584)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(577)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(583)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(588)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(592)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(585)@b9dad4e9983f: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(594)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(589)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(593)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(577): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(582): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(583): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(584): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(585): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(586): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(587): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(588): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(589): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(592): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(593): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(594): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Tue Oct 8 07:53:45 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=232742) Waiting for packet dumper to finish... 1 (prev_count=232742, count=312535) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Tue Oct 8 07:53:48 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(604)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(604)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(604)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(602)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(607)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(607)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(607)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(604)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(607)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(603)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(603)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)7002227 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)3904771 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)6770615 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)8133323 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)5628683 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)14093421 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(611)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(611)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@b9dad4e9983f: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)5092773 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)2177949 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(612)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(612)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(605)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(606)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(607)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(596)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(603)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(602)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(604)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(601)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(608)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(596): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(601): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(602): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(603): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(604): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(605): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(606): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(607): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(608): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(611): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(612): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Tue Oct 8 07:53:54 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=219010) Waiting for packet dumper to finish... 1 (prev_count=219010, count=287790) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Tue Oct 8 07:53:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(621)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(621)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(621)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(619)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(624)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(624)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(624)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(622)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(627)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(627)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(627)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(630)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(630)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(630)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(621)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(624)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(627)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(630)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(620)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(620)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(623)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(623)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)13551046 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)1749854 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(633)14566006 HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(633)2638585 HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(634)4455213 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(634)7494999 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(621)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(629)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(625)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(628)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(623)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(626)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(619)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(620)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(613)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(630)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(624)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(627)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(618)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(631)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(622)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(613): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(618): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(619): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(620): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(621): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(622): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(623): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(624): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(625): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(626): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(627): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(628): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(629): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(630): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(631): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(633): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(634): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Tue Oct 8 07:54:03 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=251408) Waiting for packet dumper to finish... 1 (prev_count=251408, count=315863) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Tue Oct 8 07:54:06 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(643)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(643)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(643)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(641)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(646)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(646)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(646)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(644)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(649)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(649)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(649)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(647)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(652)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(652)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(652)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(643)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(646)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(649)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(652)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(642)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(642)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(645)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(645)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(648)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(648)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)1898026 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)1634281 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(655) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)7039772 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(655) HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)5823998 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(655)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(655)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(656) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)11571291 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(656) HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)12883278 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(656)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(656)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(651)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(652)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(650)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(642)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(641)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(645)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(648)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(635)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(644)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(647)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(653)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(640)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(649)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(646)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(643)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(635): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(640): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(641): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(642): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(643): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(644): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(645): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(646): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(647): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(648): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(649): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(650): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(651): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(652): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(653): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(655): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(656): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Tue Oct 8 07:54:12 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=252327) Waiting for packet dumper to finish... 1 (prev_count=252327, count=321069) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Tue Oct 8 07:54:15 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(665)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(665)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(665)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(663)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(668)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(668)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(668)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(666)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(671)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(671)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(671)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(669)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(674)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(674)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(674)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(672)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(677)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(677)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(677)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(680)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(680)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(680)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(665)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(668)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(671)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(674)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(677)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(680)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(664)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(664)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(667)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(667)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(670)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(670)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(673)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(673)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)798616 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)1841867 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(683) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)10771395 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(683) HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)6924558 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(683)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(683)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(684) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(684)6713512 HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(684) HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(684)4450509 HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(684)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(684)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(668)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(669)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(676)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(675)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(679)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(677)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(671)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(672)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(666)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(663)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(662)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(664)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(665)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(667)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(674)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(673)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(680)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(681)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(678)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(657)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(670)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(657): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(662): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(663): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(664): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(665): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(666): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(667): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(668): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(669): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(670): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(671): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(672): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(673): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(674): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(675): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(676): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(677): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(678): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-RAN(679): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(680): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(681): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(683): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(684): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Tue Oct 8 07:54:22 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=381371) Waiting for packet dumper to finish... 1 (prev_count=381371, count=391207) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Tue Oct 8 07:54:25 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(693)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(693)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(693)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(691)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(696)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(696)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(696)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(694)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(699)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-M3UA(699)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(699)@b9dad4e9983f: ************************************************* HNBGW_Test.msc2-SCCP(697)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(702)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(702)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(702)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(705)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(705)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(705)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(703)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(708)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-M3UA(708)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(708)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(693)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(696)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(699)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(702)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(705)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(708)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(692)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(692)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(695)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(695)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(698)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(698)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(704)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(704)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b9dad4e9983f: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(710) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)67162 HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(710) HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)6608781 HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(710)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(710)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(711) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(711)9500046 HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(711) HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(711)15165261 HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(711)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(711)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-SCCP(694)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(697)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(704)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(692)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(695)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(708)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(690)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(691)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(706)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(696)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(705)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(702)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(685)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(699)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc2-RAN(698)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(701)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(707)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(703)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(709)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(700)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(693)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(685): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(686): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(688): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(690): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(691): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(692): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(693): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(694): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(695): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(696): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-SCCP(697): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-RAN(698): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc2-M3UA(699): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(700): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(701): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(702): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(703): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(704): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(705): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(706): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-RAN(707): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(708): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(709): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(710): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(711): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Tue Oct 8 07:54:30 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=357222) Waiting for packet dumper to finish... 1 (prev_count=357222, count=362378) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Tue Oct 8 07:54:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(720)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(720)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(720)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(718)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(723)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-M3UA(723)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(723)@b9dad4e9983f: ************************************************* HNBGW_Test.msc1-SCCP(721)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(726)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(726)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(726)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(729)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(729)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(729)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(720)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(723)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(726)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(729)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(719)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(722)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(722)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(719)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)7475293 HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)911722 HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)8617020 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)7606165 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(725)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(726)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(724)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@b9dad4e9983f: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)7475293 HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)7213462 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)3519484 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-RAN(728)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(718)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(729)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(719)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(717)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-RAN(722)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(730)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(721)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(727)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(723)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(720)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(712)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(712): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(717): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(718): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(719): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(720): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-SCCP(721): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-RAN(722): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc1-M3UA(723): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(724): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(725): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(726): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(727): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(728): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(729): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(730): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Tue Oct 8 07:54:39 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=282241) Waiting for packet dumper to finish... 1 (prev_count=282241, count=345317) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Tue Oct 8 07:54:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(742)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(742)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(742)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(740)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(745)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(745)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(745)@b9dad4e9983f: ************************************************* MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(742)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(745)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(741)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(741)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)13148446 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)15492570 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)5026698 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)4508304 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: "connecting cnlink 1" MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(751)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-M3UA(751)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(751)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(751)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 MTC@b9dad4e9983f: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@b9dad4e9983f: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)9152023 HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)7197132 HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@b9dad4e9983f: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(743)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(739)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(751)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(750)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(741)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(744)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(740)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(749)@b9dad4e9983f: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(745)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(742)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(734)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(746)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(734): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(739): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(740): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(741): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(742): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(743): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(744): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(745): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(746): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748): pass (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(749): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-RAN(750): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(751): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Tue Oct 8 07:54:49 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=253300) Waiting for packet dumper to finish... 1 (prev_count=253300, count=331379) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Tue Oct 8 07:54:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(754)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(759)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(759)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(759)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(762)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(762)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(762)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(760)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(759)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(762)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(761)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(761)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(763)@b9dad4e9983f: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: f_create_expect(l3 := 'B0C5DB9FBC16754BFDF0'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: Created Expect[0] for 'B0C5DB9FBC16754BFDF0'O to be handled at TC_second_rab_assignment0(764) TC_second_rab_assignment-Iuh0-RUA(755)@b9dad4e9983f: Added conn table entry 0TC_second_rab_assignment0(764)7776679 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: Found Expect[0] for l3='B0C5DB9FBC16754BFDF0'O handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: Added conn table entry 0TC_second_rab_assignment0(764)16374136 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_len:91 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(763)@b9dad4e9983f: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "76a9a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(764) TC_second_rab_assignment0(764)@b9dad4e9983f: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "76a9a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@b9dad4e9983f: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "76a9a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@b9dad4e9983f: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "76a9a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_len:63 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_len:12 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@b9dad4e9983f: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(764)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(764)@b9dad4e9983f: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "76a9a717" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(760)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(758)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(763)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(753)@b9dad4e9983f: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(754)@b9dad4e9983f: Final verdict of PTC: none TC_second_rab_assignment-Iuh0-RUA(755)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(762)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(761)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(757)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(759)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(756)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(753): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_second_rab_assignment-Iuh0(754): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(755): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(756): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(757): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(758): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(759): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(760): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(761): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(762): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(763): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_second_rab_assignment0(764): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_second_rab_assignment finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Tue Oct 8 07:54:56 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=233338) Waiting for packet dumper to finish... 1 (prev_count=233338, count=233838) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Tue Oct 8 07:54:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(771)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(771)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(771)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(769)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(774)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(774)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(774)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(772)@b9dad4e9983f: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(771)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(774)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(770)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(770)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(773)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(773)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(769)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(765)@b9dad4e9983f: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(768)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(773)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(770)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(772)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(774)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(771)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(775)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(765): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(768): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(769): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(770): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(771): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(772): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(773): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(774): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(775): none (pass -> pass) MTC@b9dad4e9983f: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Tue Oct 8 07:55:01 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=91089) Waiting for packet dumper to finish... 1 (prev_count=91089, count=150193) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Tue Oct 8 07:55:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@b9dad4e9983f: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(777)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(779)@b9dad4e9983f: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(784)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-M3UA(784)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(784)@b9dad4e9983f: ************************************************* HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b9dad4e9983f: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(787)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-M3UA(787)@b9dad4e9983f: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(787)@b9dad4e9983f: ************************************************* HNBGW_Test.sgsn0-SCCP(785)@b9dad4e9983f: v_sccp_pdu_maxlen:268 MTC@b9dad4e9983f: setverdict(pass): none -> pass MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(784)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(787)@b9dad4e9983f: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(786)@b9dad4e9983f: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(786)@b9dad4e9983f: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(789) TC_apply_sccp-Iuh0-RUA(778)@b9dad4e9983f: Added conn table entry 0TC_apply_sccp0(789)1262476 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: First idle individual index:0 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(789) HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: Added conn table entry 0TC_apply_sccp0(789)7679831 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(789)@b9dad4e9983f: setverdict(pass): none -> pass TC_apply_sccp0(789)@b9dad4e9983f: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(789)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: vl_len:22 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: vl_from0 HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A8594E5C764E6301765A0'O TC_apply_sccp0(789)@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(789)@b9dad4e9983f: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Session index based on local reference:0 HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: Deleted conn table entry 0TC_apply_sccp0(789)7679831 TC_apply_sccp-Iuh0-RUA(778)@b9dad4e9983f: Deleted conn table entry 0TC_apply_sccp0(789)1262476 TC_apply_sccp0(789)@b9dad4e9983f: Final verdict of PTC: pass MTC@b9dad4e9983f: ok: talloc reports "asn1_context" = 1 bytes TC_apply_sccp-Iuh0-RUA(778)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-RAN(783)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(786)@b9dad4e9983f: Final verdict of PTC: none TC_apply_sccp-Iuh0(777)@b9dad4e9983f: Final verdict of PTC: none TC_apply_sccp-Iuh1(779)@b9dad4e9983f: Final verdict of PTC: none TC_apply_sccp-Iuh1-RUA(780)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(785)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(782)@b9dad4e9983f: Final verdict of PTC: none VirtHNBGW-STATS(776)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(787)@b9dad4e9983f: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(784)@b9dad4e9983f: Final verdict of PTC: none HNBGW-MGCP(788)@b9dad4e9983f: Final verdict of PTC: none IPA-CTRL-CLI-IPA(781)@b9dad4e9983f: Final verdict of PTC: none MTC@b9dad4e9983f: setverdict(pass): pass -> pass, component reason not changed MTC@b9dad4e9983f: Setting final verdict of the test case. MTC@b9dad4e9983f: Local verdict of MTC: pass MTC@b9dad4e9983f: Local verdict of PTC VirtHNBGW-STATS(776): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_apply_sccp-Iuh0(777): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(778): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_apply_sccp-Iuh1(779): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(780): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC IPA-CTRL-CLI-IPA(781): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-SCCP(782): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-RAN(783): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.msc0-M3UA(784): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(785): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-RAN(786): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(787): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC HNBGW-MGCP(788): none (pass -> pass) MTC@b9dad4e9983f: Local verdict of PTC TC_apply_sccp0(789): pass (pass -> pass) MTC@b9dad4e9983f: Test case TC_apply_sccp finished. Verdict: pass MTC@b9dad4e9983f: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Tue Oct 8 07:55:11 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=180493) Waiting for packet dumper to finish... 1 (prev_count=180493, count=204969) MTC@b9dad4e9983f: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@b9dad4e9983f: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@b9dad4e9983f: Terminating MTC. MC@b9dad4e9983f: MTC terminated. MC2> exit MC@b9dad4e9983f: Shutting down session. MC@b9dad4e9983f: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-20.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: PASS HNBGW_Tests.TC_hnb_disconnected_timeout Summary: pass: 47 NEW: PASS: 1 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-1005-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-1005-hnbgw jenkins-ttcn3-hnbgw-test-1005-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-1005-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-1005-stp + docker kill jenkins-ttcn3-hnbgw-test-1005-stp jenkins-ttcn3-hnbgw-test-1005-stp + docker wait jenkins-ttcn3-hnbgw-test-1005-stp 137 + echo Testing with PFCP Testing with PFCP + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp with-pfcp/HNBGW_Tests.cfg osmo-stp.cfg with-pfcp/osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + tests_cfg=with-pfcp/HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=with-pfcp/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/unix + cp with-pfcp/HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/unix + cp with-pfcp/osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp/osmo-stp.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=144 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 144 200 + NET=144 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.200 --ip6 fd02:db8:144::200 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.200 --ip6 fd02:db8:144::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp:/data --name jenkins-ttcn3-hnbgw-test-1005-stp -d osmocom-build/osmo-stp-master 6c64325fc850dc332b5ce7395edab5105fdc0af521b8c58b20cd7ff5b7d4c56f + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 144 20 + NET=144 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.20 --ip6 fd02:db8:144::20 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.20 --ip6 fd02:db8:144::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-1005-hnbgw -d osmocom-build/osmo-hnbgw-master a5bb108bade803592a2149d3ae2d8d40b58415212e9a2066b14c6e3a85a99fd2 + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 144 203 + NET=144 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-144 --ip 172.18.144.203 --ip6 fd02:db8:144::203 + docker run --rm --network ttcn3-hnbgw-test-144 --ip 172.18.144.203 --ip6 fd02:db8:144::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.144.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-1005-ttcn3-hnbgw-test osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@b4f118497d00: Unix server socket created successfully. MC@b4f118497d00: Listening on TCP port 46379. b4f118497d00 is the default MC2> spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests b4f118497d00 46379 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@b4f118497d00: New HC connected from 172.18.144.203 [172.18.144.203]. b4f118497d00: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@b4f118497d00: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@b4f118497d00: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@b4f118497d00: Configuration file was processed on all HCs. MC@b4f118497d00: Creating MTC on host 172.18.144.203. MC@b4f118497d00: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Tue Oct 8 07:55:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(9)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(9)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(7)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(12)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(10)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(8)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(8)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(11)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(11)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(8)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(7)@b4f118497d00: Final verdict of PTC: none TC_hnb_register-Iuh0-RUA(5)@b4f118497d00: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(3)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(11)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(13)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@b4f118497d00: Test case TC_hnb_register finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Tue Oct 8 07:55:19 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=148755) Waiting for packet dumper to finish... 1 (prev_count=148755, count=204292) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Tue Oct 8 07:55:22 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(22)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(22)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(20)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(21)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1-RUA(18)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1(17)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(20)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0-RUA(16)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(14)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(26)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@b4f118497d00: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Tue Oct 8 07:55:24 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82536) Waiting for packet dumper to finish... 1 (prev_count=82536, count=140530) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Tue Oct 8 07:55:26 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(33)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(33)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(31)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(36)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(35)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(32)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(27)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(37)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(35)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@b4f118497d00: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@b4f118497d00: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Tue Oct 8 07:55:28 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=81645) Waiting for packet dumper to finish... 1 (prev_count=81645, count=139144) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Tue Oct 8 07:55:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(44)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(44)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(42)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(47)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(45)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@b4f118497d00: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@b4f118497d00: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b4f118497d00: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b4f118497d00: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") TC_hnb_disconnected_timeout-Iuh0(49)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_hnb_disconnected_timeout-Iuh0(49)@b4f118497d00: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@b4f118497d00: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(43)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(45)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(48)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(38)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(46)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(38): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(48): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (pass -> pass) MTC@b4f118497d00: Test case TC_hnb_disconnected_timeout finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout pass'. Tue Oct 8 07:55:47 UTC 2024 ====== HNBGW_Tests.TC_hnb_disconnected_timeout pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=151039) Waiting for packet dumper to finish... 1 (prev_count=151039, count=151539) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Tue Oct 8 07:55:50 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(57)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(57)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(55)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(60)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(58)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register-Iuh0-RUA(53)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(56)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(55)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(51)@b4f118497d00: Final verdict of PTC: none TC_ue_register-Iuh0(52)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(59)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(61)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@b4f118497d00: Test case TC_ue_register finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Tue Oct 8 07:55:52 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=84507) Waiting for packet dumper to finish... 1 (prev_count=84507, count=138420) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Tue Oct 8 07:55:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ue_register_tmsi_lai started. MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(68)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(68)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(66)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(66)@b4f118497d00: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0-RUA(64)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(62)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@b4f118497d00: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(67)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(72)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@b4f118497d00: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Tue Oct 8 07:55:57 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=100005) Waiting for packet dumper to finish... 1 (prev_count=100005, count=137032) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Tue Oct 8 07:55:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(79)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(79)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(77)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(82)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(80)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.sgsn0-RAN(81)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_before_hnb_register-Iuh0-RUA(75)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(81)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(77)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@b4f118497d00: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(73)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(78)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(83)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@b4f118497d00: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Tue Oct 8 07:56:01 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80380) Waiting for packet dumper to finish... 1 (prev_count=80380, count=136049) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Tue Oct 8 07:56:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(90)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(90)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(88)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(93)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(91)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@b4f118497d00: f_create_expect(l3 := 'AF27B47B798F3BF8F566'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@b4f118497d00: Created Expect[0] for 'AF27B47B798F3BF8F566'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@b4f118497d00: Added conn table entry 0TC_ranap_cs_initial_ue0(95)11656938 HNBGW_Test.msc0-SCCP(88)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@b4f118497d00: Found Expect[0] for l3='AF27B47B798F3BF8F566'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@b4f118497d00: Added conn table entry 0TC_ranap_cs_initial_ue0(95)7344428 HNBGW_Test.msc0-SCCP(88)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(88)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@b4f118497d00: setverdict(pass): none -> pass TC_ranap_cs_initial_ue0(95)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue-Iuh0-RUA(86)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(91)@b4f118497d00: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(89)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(84)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(94)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Tue Oct 8 07:56:07 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120366) Waiting for packet dumper to finish... 1 (prev_count=120366, count=159763) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Tue Oct 8 07:56:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(102)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(102)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(100)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(102)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(105)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: f_create_expect(l3 := '6A29536792B6E9DF5C40'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: Created Expect[0] for '6A29536792B6E9DF5C40'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@b4f118497d00: Added conn table entry 0TC_ranap_ps_initial_ue0(107)5889128 HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: Found Expect[0] for l3='6A29536792B6E9DF5C40'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: Added conn table entry 0TC_ranap_ps_initial_ue0(107)3096791 HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: Session index based on connection ID:0 TC_ranap_ps_initial_ue0(107)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue-Iuh0-RUA(98)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@b4f118497d00: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(101)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(100)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(106)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(96)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Tue Oct 8 07:56:13 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119402) Waiting for packet dumper to finish... 1 (prev_count=119402, count=157859) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Tue Oct 8 07:56:16 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(114)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(114)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(112)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@b4f118497d00: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@b4f118497d00: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@b4f118497d00: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)3710332 HNBGW_Test.msc0-SCCP(112)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@b4f118497d00: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@b4f118497d00: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)1271309 HNBGW_Test.msc0-SCCP(112)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@b4f118497d00: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(112)@b4f118497d00: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(108)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(113)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(118)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Tue Oct 8 07:56:19 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124896) Waiting for packet dumper to finish... 1 (prev_count=124896, count=168506) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Tue Oct 8 07:56:22 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(126)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(126)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(124)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@b4f118497d00: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)1340690 HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)11159916 HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@b4f118497d00: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(124)@b4f118497d00: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(128)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(125)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(120)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(130)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Tue Oct 8 07:56:25 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126315) Waiting for packet dumper to finish... 1 (prev_count=126315, count=167301) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Tue Oct 8 07:56:27 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(138)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(138)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(136)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(141)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(139)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@b4f118497d00: f_create_expect(l3 := '2C71DC6A63AE25247968'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@b4f118497d00: Created Expect[0] for '2C71DC6A63AE25247968'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@b4f118497d00: Added conn table entry 0TC_ranap_cs_bidir0(143)7849985 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@b4f118497d00: Found Expect[0] for l3='2C71DC6A63AE25247968'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@b4f118497d00: Added conn table entry 0TC_ranap_cs_bidir0(143)14658112 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_bidir0(143)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: vl_len:22 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A471BD3B2A77FEFD92D50'O TC_ranap_cs_bidir0(143)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: vl_len:20 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(136)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(137)@b4f118497d00: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0-RUA(134)@b4f118497d00: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(132)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(136)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(142)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Tue Oct 8 07:56:31 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=123508) Waiting for packet dumper to finish... 1 (prev_count=123508, count=174945) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Tue Oct 8 07:56:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(150)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(150)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(148)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(153)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(153)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: f_create_expect(l3 := '86C745285D42AF125750'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: Created Expect[0] for '86C745285D42AF125750'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@b4f118497d00: Added conn table entry 0TC_ranap_ps_bidir0(155)7801784 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: Found Expect[0] for l3='86C745285D42AF125750'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: Added conn table entry 0TC_ranap_ps_bidir0(155)11163810 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_bidir0(155)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A991D67C63E16FF773E88'O TC_ranap_ps_bidir0(155)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_bidir-Iuh0-RUA(146)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@b4f118497d00: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(148)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(151)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(154)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(144)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Tue Oct 8 07:56:37 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=121230) Waiting for packet dumper to finish... 1 (prev_count=121230, count=172813) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Tue Oct 8 07:56:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(162)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(162)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(160)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@b4f118497d00: f_create_expect(l3 := '87270726EF1A2A81CBE5'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@b4f118497d00: Created Expect[0] for '87270726EF1A2A81CBE5'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@b4f118497d00: Added conn table entry 0TC_rab_assignment0(167)15825867 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@b4f118497d00: Found Expect[0] for l3='87270726EF1A2A81CBE5'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@b4f118497d00: Added conn table entry 0TC_rab_assignment0(167)9996006 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): none -> pass VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f17bcb17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f17bcb17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b4f118497d00: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f17bcb17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@b4f118497d00: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f17bcb17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: vl_len:12 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "f17bcb17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(161)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@b4f118497d00: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@b4f118497d00: Final verdict of PTC: none TC_rab_assignment-Iuh0-RUA(158)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(166)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(156)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_assignment finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Tue Oct 8 07:56:43 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=121622) Waiting for packet dumper to finish... 1 (prev_count=121622, count=234625) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Tue Oct 8 07:56:46 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(174)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(174)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(172)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@b4f118497d00: f_create_expect(l3 := 'DDF51279673DEEFD8B22'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@b4f118497d00: Created Expect[0] for 'DDF51279673DEEFD8B22'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@b4f118497d00: Added conn table entry 0TC_rab_release0(179)14092792 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@b4f118497d00: Found Expect[0] for l3='DDF51279673DEEFD8B22'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@b4f118497d00: Added conn table entry 0TC_rab_release0(179)3064271 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d709f817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d709f817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b4f118497d00: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d709f817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@b4f118497d00: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d709f817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: vl_len:21 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(172)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d709f817" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release-Iuh0-RUA(170)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(172)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@b4f118497d00: Final verdict of PTC: none TC_rab_release-Iuh0(169)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(174)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(178)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(168)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_release finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Tue Oct 8 07:56:49 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120306) Waiting for packet dumper to finish... 1 (prev_count=120306, count=228425) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Tue Oct 8 07:56:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(186)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(184)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(189)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(187)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@b4f118497d00: f_create_expect(l3 := 'E08F103DD31F832213E0'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@b4f118497d00: Created Expect[0] for 'E08F103DD31F832213E0'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@b4f118497d00: Added conn table entry 0TC_rab_release_abnormal0(191)13081129 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@b4f118497d00: Found Expect[0] for l3='E08F103DD31F832213E0'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@b4f118497d00: Added conn table entry 0TC_rab_release_abnormal0(191)8577979 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release_abnormal0(191)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c79a2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c79a2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b4f118497d00: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c79a2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@b4f118497d00: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c79a2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: vl_len:21 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(184)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c79a2917" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release_abnormal-Iuh0-RUA(182)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@b4f118497d00: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(185)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(188)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(190)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(180)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Tue Oct 8 07:56:55 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=125954) Waiting for packet dumper to finish... 1 (prev_count=125954, count=234114) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Tue Oct 8 07:56:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(198)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(196)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@b4f118497d00: f_create_expect(l3 := '33B3FECC8BD46C0619B0'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@b4f118497d00: Created Expect[0] for '33B3FECC8BD46C0619B0'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@b4f118497d00: Added conn table entry 0TC_rab_assign_fail0(203)13556160 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@b4f118497d00: Found Expect[0] for l3='33B3FECC8BD46C0619B0'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@b4f118497d00: Added conn table entry 0TC_rab_assign_fail0(203)3902522 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Session index based on connection ID:0 TC_rab_assign_fail0(203)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "ced9c017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ced9c017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "ced9c017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ced9c017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "ced9c017" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_fail-Iuh0-RUA(194)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@b4f118497d00: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(200)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(201)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(202)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(192)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_assign_fail finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Tue Oct 8 07:57:01 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126355) Waiting for packet dumper to finish... 1 (prev_count=126355, count=212228) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Tue Oct 8 07:57:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(210)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(208)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(213)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(211)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@b4f118497d00: f_create_expect(l3 := 'EC4DA5B97BD9D2D9264B'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@b4f118497d00: Created Expect[0] for 'EC4DA5B97BD9D2D9264B'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@b4f118497d00: Added conn table entry 0TC_rab_assign_mgcp_to0(215)11867680 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@b4f118497d00: Found Expect[0] for l3='EC4DA5B97BD9D2D9264B'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@b4f118497d00: Added conn table entry 0TC_rab_assign_mgcp_to0(215)4701804 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgcp_to0(215)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "b5162017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "b5162017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@b4f118497d00: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "b5162017" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "b5162017", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: vl_len:12 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgcp_to-Iuh0-RUA(206)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(211)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@b4f118497d00: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(204)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(214)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Tue Oct 8 07:57:11 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=154786) Waiting for packet dumper to finish... 1 (prev_count=154786, count=199691) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Tue Oct 8 07:57:14 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(222)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(222)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(220)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(225)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(223)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@b4f118497d00: f_create_expect(l3 := 'CA1A422D6E56D565D1D1'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@b4f118497d00: Created Expect[0] for 'CA1A422D6E56D565D1D1'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@b4f118497d00: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)3171723 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@b4f118497d00: Found Expect[0] for l3='CA1A422D6E56D565D1D1'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@b4f118497d00: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)4157814 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Session index based on connection ID:0 TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "30658b17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "30658b17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "30658b17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "30658b17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@b4f118497d00: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: vl_len:12 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "30658b17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(220)@b4f118497d00: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(221)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(226)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(216)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@b4f118497d00: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Tue Oct 8 07:57:18 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=241127) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Tue Oct 8 07:57:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(234)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(234)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(232)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(237)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(235)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@b4f118497d00: f_create_expect(l3 := '690EF5D7B2015A8B614D'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@b4f118497d00: Created Expect[0] for '690EF5D7B2015A8B614D'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b4f118497d00: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)3717896 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@b4f118497d00: Found Expect[0] for l3='690EF5D7B2015A8B614D'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@b4f118497d00: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)15735201 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: vl_len:22 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A7BB36C95A7DDA7E236C0'O TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b4f118497d00: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)3717896 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@b4f118497d00: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)15735201 TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(228)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@b4f118497d00: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(233)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(232)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(236)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(238)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Tue Oct 8 07:57:28 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=164654) Waiting for packet dumper to finish... 1 (prev_count=164654, count=195247) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Tue Oct 8 07:57:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(246)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(246)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(244)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(249)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(247)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@b4f118497d00: f_create_expect(l3 := 'BCF2D5B4C89D45B7B578'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@b4f118497d00: Created Expect[0] for 'BCF2D5B4C89D45B7B578'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b4f118497d00: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)16036037 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@b4f118497d00: Found Expect[0] for l3='BCF2D5B4C89D45B7B578'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@b4f118497d00: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)13702013 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Session index based on connection ID:0 TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: vl_len:22 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A0559AFD2F715A5AB016C'O TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b4f118497d00: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)16036037 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@b4f118497d00: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)13702013 TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(245)@b4f118497d00: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(240)@b4f118497d00: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(249)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(250)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Tue Oct 8 07:57:39 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=150881) Waiting for packet dumper to finish... 1 (prev_count=150881, count=177048) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_with_pfcp ------ Tue Oct 8 07:57:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_ps_rab_assignment_with_pfcp started. TC_ps_rab_assignment_with_pfcp-Iuh0(253)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(258)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(258)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(258)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(256)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(261)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(261)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(261)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(258)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(261)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(257)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(257)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: f_PFCPEM_conns_bcast_add(): vc_conn TC_ps_rab_assignment_with_pfcp0(264) subscribed for broadcast TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.144.20", remote_port := 8805 }, pdu := { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 5, lengthIndicator := 26, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC129014'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 4, time_value := 3937362916 }, up_function_features := omit, cp_function_features := { elementIdentifier := 89, lengthIndicator := 1, features := '10'O }, UP_IP_resource_list := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: broadcasting to TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): none -> pass TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 0, time_value := 1234 }, up_function_features := omit, cp_function_features := omit, UP_IP_resource_list := omit } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: f_PFCPEM_conns_bcast_del(): vc_conn TC_ps_rab_assignment_with_pfcp0(264) unsubscribed from broadcast HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: f_create_expect(l3 := 'CFCEF2AB254E49F5572E'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: Created Expect[0] for 'CFCEF2AB254E49F5572E'O to be handled at TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@b4f118497d00: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)3455818 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: Found Expect[0] for l3='CFCEF2AB254E49F5572E'O handled at TC_ps_rab_assignment_with_pfcp0(264) HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)4113328 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Session index based on connection ID:0 TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: vl_len:91 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '0000030025006C000400000002002C0002020000040013002A0001010054000A0100101010107F000001'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.144.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 50, lengthIndicator := 187, seid := '0000000000000000'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC129014'O }, CP_F_SEID := { elementIdentifier := 57, lengthIndicator := 13, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '0000000000000001'O, ipv4_address := 'AC129014'O, ipv6_address := omit }, create_PDR_list := { { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 1, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } }, { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 0, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 2 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } } }, create_FAR_list := { { elementIdentifier := 3, lengthIndicator := 14, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '1'B, forw := '0'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint_list := omit, pdn_type := omit, node_list := omit, up_inactivity_timer := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: found destination TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_ie := omit, UP_F_SEID := { elementIdentifier := 57, lengthIndicator := 0, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '1111111111111111'O, ipv4_address := '7F000001'O, ipv6_address := omit }, created_PDR_list := { { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '22002200'O, ipv4_address := '7F000002'O, ipv6_address := omit, choose_id := omit } } }, { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '30303030'O ("0000"), ipv4_address := '7F000003'O, ipv6_address := omit, choose_id := omit } } } }, load_control_information := omit, overload_control_information := omit, node_list := omit, failed_rule_id := omit, created_traffic_endpoint_list := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '00000B000E0054000A0100440044007F000004'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.144.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 52, lengthIndicator := 48, seid := '1111111111111111'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_request := { f_seid := omit, remove_PDR_list := omit, remove_FAR_list := omit, remove_URR_list := omit, remove_QER_list := omit, remove_BAR := omit, remove_traffic_endpoint := omit, create_PDR_list := omit, create_FAR_list := omit, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint := omit, update_PDR_list := omit, update_FAR_list := { { elementIdentifier := 10, lengthIndicator := 32, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '0'B, forw := '1'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, update_URR_list := omit, update_QER_list := omit, update_BAR := omit, update_traffic_endpoint := omit, pfcpSMReq_flags := omit, query_URR_list := omit, node_list := omit, up_inactivity_timer := omit, querry_urr_reference := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: found destination TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, created_PDR := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit, failed_rule_id := omit, additional_usage_reports_information := omit, created_updated_traffic_endpoint := omit } } } HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: vl_len:12 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.144.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 54, lengthIndicator := 12, seid := '1111111111111111'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_request := { } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: found destination TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(258)@b4f118497d00: Final verdict of PTC: none TC_ps_rab_assignment_with_pfcp-Iuh0(253)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(252)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(260)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(257)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(261)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(256)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(259)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(262)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(255)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0(253): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(255): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(256): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(257): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(258): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(259): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(260): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(261): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(262): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-PFCP(263): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_ps_rab_assignment_with_pfcp0(264): pass (pass -> pass) MTC@b4f118497d00: Test case TC_ps_rab_assignment_with_pfcp finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass'. Tue Oct 8 07:57:53 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=180583) Waiting for packet dumper to finish... 1 (prev_count=180583, count=204322) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Tue Oct 8 07:57:56 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(273)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(273)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(273)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(271)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(276)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(276)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(276)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(274)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(273)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(276)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(272)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(272)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(275)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(275)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(278) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)617490 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(272)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(278) HNBGW_Test.msc0-RAN(272)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)10700536 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(278)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(278)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@b4f118497d00: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@b4f118497d00: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(279) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)6757095 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(272)@b4f118497d00: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(279) HNBGW_Test.msc0-RAN(272)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)706010 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(279)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(279)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@b4f118497d00: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@b4f118497d00: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)13959525 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: First idle individual index:2 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(272)@b4f118497d00: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(272)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)2221112 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@b4f118497d00: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@b4f118497d00: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@b4f118497d00: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)8442385 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: First idle individual index:3 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(272)@b4f118497d00: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(272)@b4f118497d00: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)6736229 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(272)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(275)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(270)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(265)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(273)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(271)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(274)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(276)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(277)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(265): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(270): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(271): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(272): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(273): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(274): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(275): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(276): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(277): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(278): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(279): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Tue Oct 8 07:58:02 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=216031) Waiting for packet dumper to finish... 1 (prev_count=216031, count=283184) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Tue Oct 8 07:58:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(290)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(290)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(290)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(288)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(293)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(293)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(293)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(291)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(296)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(296)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(296)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(294)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(299)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(299)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(299)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(297)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(290)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(293)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(296)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(299)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(289)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(289)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(292)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(292)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(295)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(295)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(298)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(298)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)14292949 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(289)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) HNBGW_Test.msc0-RAN(289)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)12848619 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(301)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(301)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(292)@b4f118497d00: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(292)@b4f118497d00: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(302)7469532 HNBGW_Test.msc1-SCCP(291)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(291)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(292)@b4f118497d00: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) HNBGW_Test.msc1-RAN(292)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(302)10695927 HNBGW_Test.msc1-SCCP(291)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(291)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(302)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(302)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@b4f118497d00: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@b4f118497d00: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(303)5635741 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(289)@b4f118497d00: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(289)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(303)9427857 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(295)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(298)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(290)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(296)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(289)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(297)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(299)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(292)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(294)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(291)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(288)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(293)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(282)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(287)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(300)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(282): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(287): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(288): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(289): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(290): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(291): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(292): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(293): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(294): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(295): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(296): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(297): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(298): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(299): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(300): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(301): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(302): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Tue Oct 8 07:58:11 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243331) Waiting for packet dumper to finish... 1 (prev_count=243331, count=308533) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Tue Oct 8 07:58:14 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(312)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(312)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(312)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(310)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(315)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(315)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(315)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(313)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(318)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(318)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(318)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(316)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(321)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(321)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(321)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(319)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(312)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(315)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(318)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(321)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(311)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(311)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(314)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(314)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(317)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(317)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(320)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(320)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)13221114 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(311)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) HNBGW_Test.msc0-RAN(311)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)2462317 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(314)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(314)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@b4f118497d00: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)12471119 HNBGW_Test.msc1-SCCP(313)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(313)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(314)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) HNBGW_Test.msc1-RAN(314)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)9215755 HNBGW_Test.msc1-SCCP(313)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(313)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@b4f118497d00: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)14830409 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(311)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(311)@b4f118497d00: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)9416642 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(320)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(310)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(304)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(318)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(309)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(311)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(319)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(316)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(315)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(321)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(313)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(317)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(322)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(314)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(312)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(304): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(309): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(310): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(311): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(312): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(313): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(314): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(315): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(316): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(317): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(318): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(319): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(320): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(321): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(322): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Tue Oct 8 07:58:21 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=246155) Waiting for packet dumper to finish... 1 (prev_count=246155, count=315761) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Tue Oct 8 07:58:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(334)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(334)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(334)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(332)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(337)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(337)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(337)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(335)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(340)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(340)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(340)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(338)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(343)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(343)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(343)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(341)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(334)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(337)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(340)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(343)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(333)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(333)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(336)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(336)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(339)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(339)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(342)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(342)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)3661511 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(333)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) HNBGW_Test.msc0-RAN(333)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)5206044 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(336)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(336)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@b4f118497d00: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)10671353 HNBGW_Test.msc1-SCCP(335)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(335)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(336)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) HNBGW_Test.msc1-RAN(336)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)3677031 HNBGW_Test.msc1-SCCP(335)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(335)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@b4f118497d00: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)7856554 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(333)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(333)@b4f118497d00: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)13519932 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(333)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(341)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(338)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(335)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(336)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(334)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(339)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(332)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(326)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(344)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(343)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(342)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(337)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(331)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(340)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(326): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(331): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(332): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(333): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(334): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(335): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(336): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(337): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(338): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(339): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(340): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(341): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(342): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(343): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(344): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Tue Oct 8 07:58:30 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=246022) Waiting for packet dumper to finish... 1 (prev_count=246022, count=315284) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Tue Oct 8 07:58:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(356)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(356)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(356)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(354)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(359)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(359)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(359)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(357)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(362)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(362)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(362)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(360)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(365)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(365)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(365)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(363)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(356)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(359)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(362)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(365)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(355)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(355)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(358)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(358)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(361)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(361)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(364)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(364)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)12900097 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(355)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) HNBGW_Test.msc0-RAN(355)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)2299043 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(358)@b4f118497d00: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(358)@b4f118497d00: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)671589 HNBGW_Test.msc1-SCCP(357)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(357)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(358)@b4f118497d00: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) HNBGW_Test.msc1-RAN(358)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)12205543 HNBGW_Test.msc1-SCCP(357)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(357)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@b4f118497d00: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@b4f118497d00: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)15163118 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(355)@b4f118497d00: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(355)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)1298756 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(364)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(360)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(361)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(362)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(348)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(359)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(355)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(363)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(356)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(357)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(353)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(365)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(354)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(358)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(366)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(348): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(353): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(354): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(355): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(356): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(357): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(358): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(359): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(360): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(361): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(362): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(363): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(364): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(365): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(366): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Tue Oct 8 07:58:39 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=245912) Waiting for packet dumper to finish... 1 (prev_count=245912, count=314568) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Tue Oct 8 07:58:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(378)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(378)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(378)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(376)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(381)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(381)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(381)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(379)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(384)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(384)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(384)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(382)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(387)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(387)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(387)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(385)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(378)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(381)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(384)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(387)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(377)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(377)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(380)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(380)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(383)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(383)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(386)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(386)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)3288087 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(377)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) HNBGW_Test.msc0-RAN(377)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)8645762 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(380)@b4f118497d00: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(380)@b4f118497d00: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)9134858 HNBGW_Test.msc1-SCCP(379)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(379)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(380)@b4f118497d00: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) HNBGW_Test.msc1-RAN(380)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)10888358 HNBGW_Test.msc1-SCCP(379)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(379)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@b4f118497d00: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@b4f118497d00: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)4847795 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(377)@b4f118497d00: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(377)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)693541 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(386)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(385)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(378)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(376)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(375)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(380)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(388)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(379)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(383)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(382)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(381)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(387)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(370)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(384)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(377)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(370): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(375): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(376): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(377): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(378): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(379): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(380): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(381): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(382): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(383): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(384): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(385): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(386): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(387): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(388): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Tue Oct 8 07:58:48 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=324866) Waiting for packet dumper to finish... 1 (prev_count=324866, count=334708) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Tue Oct 8 07:58:51 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(400)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(400)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(400)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(398)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(403)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(403)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(403)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(401)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(406)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(406)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(406)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(404)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(409)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(409)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(409)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(407)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(400)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(403)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(406)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(409)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(399)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(399)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(402)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(402)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(405)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(405)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(408)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(408)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)645461 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(402)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) HNBGW_Test.msc1-RAN(402)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)10531792 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@b4f118497d00: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@b4f118497d00: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)876344 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(402)@b4f118497d00: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) HNBGW_Test.msc1-RAN(402)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)4356545 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@b4f118497d00: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@b4f118497d00: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)3566252 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: First idle individual index:2 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(402)@b4f118497d00: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(402)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)9458752 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(407)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(408)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(392)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(399)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(402)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(403)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(398)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(404)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(409)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(397)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(406)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(410)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(405)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(400)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(401)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(392): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(397): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(398): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(399): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(400): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(401): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(402): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(403): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(404): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(405): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(406): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(407): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(408): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(409): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(410): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Tue Oct 8 07:58:57 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=266689) Waiting for packet dumper to finish... 1 (prev_count=266689, count=339469) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Tue Oct 8 07:59:00 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(422)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(422)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(422)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(420)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(425)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(425)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(425)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(423)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(428)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(428)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(428)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(426)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(431)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(431)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(431)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(429)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(434)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(434)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(434)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(432)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(437)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-M3UA(437)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(437)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-SCCP(435)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(422)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(425)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(428)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(431)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(434)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(437)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(421)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(421)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(424)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(424)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(427)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(427)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(430)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(430)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(433)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(433)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(436)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(436)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)4668804 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(427)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) HNBGW_Test.msc2-RAN(427)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)10402696 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@b4f118497d00: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@b4f118497d00: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)1023555 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(427)@b4f118497d00: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) HNBGW_Test.msc2-RAN(427)@b4f118497d00: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)11999993 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(424)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(424)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@b4f118497d00: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)4400062 HNBGW_Test.msc1-SCCP(423)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(423)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(424)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc1-RAN(424)@b4f118497d00: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)14955945 HNBGW_Test.msc1-SCCP(423)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(423)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-M3UA(422)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(437)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(435)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(430)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(420)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(414)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(428)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(425)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(433)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(429)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(419)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(432)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(434)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(431)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(436)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(427)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(421)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(438)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(426)@b4f118497d00: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(423)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(424)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(414): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(419): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(420): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(421): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(422): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(423): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(424): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(425): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(426): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(427): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(428): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(429): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(430): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(431): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(432): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(433): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(434): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(435): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-RAN(436): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(437): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(438): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Tue Oct 8 07:59:07 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=376455) Waiting for packet dumper to finish... 1 (prev_count=376455, count=386279) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Tue Oct 8 07:59:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(450)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(448)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(450)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(450)@b4f118497d00: ************************************************* MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(453)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(453)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(453)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(451)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(456)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(456)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(456)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(454)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(459)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(459)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(459)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(457)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(450)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(462)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(462)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(462)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(460)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(453)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(465)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-M3UA(465)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(465)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-SCCP(463)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc2-M3UA(456)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-M3UA(459)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(462)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(465)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(449)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(449)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(452)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(452)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(455)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(455)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(458)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(458)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(461)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(461)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(464)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(464)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(449)@b4f118497d00: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(449)@b4f118497d00: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)5388192 HNBGW_Test.msc0-SCCP(448)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(448)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(449)@b4f118497d00: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) HNBGW_Test.msc0-RAN(449)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)5546914 HNBGW_Test.msc0-SCCP(448)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(448)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(455)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(455)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@b4f118497d00: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)3275407 HNBGW_Test.msc2-SCCP(454)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc2-SCCP(454)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(455)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) HNBGW_Test.msc2-RAN(455)@b4f118497d00: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)11473738 HNBGW_Test.msc2-SCCP(454)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(454)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-M3UA(459)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(458)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(457)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(460)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(463)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(448)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(462)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(465)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(451)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(452)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(456)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(450)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(453)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(466)@b4f118497d00: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(455)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(442)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(454)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(447)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(449)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(461)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(464)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(442): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(447): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(448): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(449): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(450): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(451): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(452): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(453): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(454): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(455): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(456): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(457): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(458): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(459): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(460): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(461): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(462): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(463): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-RAN(464): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(465): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(466): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(467): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(468): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Tue Oct 8 07:59:16 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=356608) Waiting for packet dumper to finish... 1 (prev_count=356608, count=369047) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Tue Oct 8 07:59:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(470)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(472)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(477)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(477)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(477)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(475)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(480)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(480)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(480)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(478)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(483)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(483)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(483)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(481)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(477)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(486)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(486)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(486)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(480)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(484)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc2-M3UA(483)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(486)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(476)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(476)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(479)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(479)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(482)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(482)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(485)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(485)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh1-RUA(473)@b4f118497d00: UnitdataCallback TC_mscpool_paging_imsi-Iuh0-RUA(471)@b4f118497d00: UnitdataCallback HNBGW_Test.msc0-RAN(476)@b4f118497d00: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(476)@b4f118497d00: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(488) TC_mscpool_paging_imsi-Iuh0-RUA(471)@b4f118497d00: Added conn table entry 0TC_mscpool_paging_imsi0(488)4748759 HNBGW_Test.msc0-SCCP(475)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(475)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(476)@b4f118497d00: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(488) HNBGW_Test.msc0-RAN(476)@b4f118497d00: Added conn table entry 0TC_mscpool_paging_imsi0(488)5976486 HNBGW_Test.msc0-SCCP(475)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(475)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(488)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(488)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-RAN(482)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(481)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(477)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(478)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1-RUA(473)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(476)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(483)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(474)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(475)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(480)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(472)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(470)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(469)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0-RUA(471)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(486)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(479)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(485)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(484)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(487)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(469): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(470): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(471): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(472): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(473): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(474): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(475): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(476): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(477): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(478): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(479): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(480): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(481): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(482): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(483): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(484): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(485): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(486): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(487): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_imsi0(488): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Tue Oct 8 07:59:26 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=281254) Waiting for packet dumper to finish... 1 (prev_count=281254, count=286413) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Tue Oct 8 07:59:29 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(490)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(492)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(497)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(497)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(497)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(495)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(500)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(500)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(500)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(498)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(503)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(503)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(503)@b4f118497d00: ************************************************* HNBGW_Test.msc2-SCCP(501)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(506)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(506)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(506)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(504)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(497)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(500)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(503)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(506)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(496)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(496)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(499)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(499)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(502)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(502)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(505)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(505)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(508)@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh0-RUA(491)@b4f118497d00: UnitdataCallback TC_mscpool_paging_tmsi-Iuh1-RUA(493)@b4f118497d00: UnitdataCallback TC_mscpool_paging_tmsi0(508)@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(496)@b4f118497d00: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(496)@b4f118497d00: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(508) TC_mscpool_paging_tmsi-Iuh0-RUA(491)@b4f118497d00: Added conn table entry 0TC_mscpool_paging_tmsi0(508)11107269 HNBGW_Test.msc0-SCCP(495)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(495)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(496)@b4f118497d00: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(508) HNBGW_Test.msc0-RAN(496)@b4f118497d00: Added conn table entry 0TC_mscpool_paging_tmsi0(508)2984624 HNBGW_Test.msc0-SCCP(495)@b4f118497d00: Session index based on connection ID:0 TC_mscpool_paging_tmsi0(508)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(495)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(508)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_tmsi-Iuh1-RUA(493)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0-RUA(491)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(501)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(500)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(506)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(502)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(489)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(496)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(503)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(504)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(497)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(498)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(495)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(490)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(499)@b4f118497d00: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(492)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(505)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(494)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(507)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(489): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(490): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(491): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(492): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(493): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(494): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(495): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(496): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(497): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(498): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(499): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(500): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(501): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(502): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(503): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(504): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(505): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(506): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(507): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_paging_tmsi0(508): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Tue Oct 8 07:59:35 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=220414) Waiting for packet dumper to finish... 1 (prev_count=220414, count=263521) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Tue Oct 8 07:59:38 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(517)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(517)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(517)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(515)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(520)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(520)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(520)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(518)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(523)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(523)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(523)@b4f118497d00: ************************************************* HNBGW_Test.msc2-SCCP(521)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(526)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(526)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(526)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(524)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(517)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(520)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(523)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(526)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(516)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(516)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(519)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(519)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(522)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(522)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(525)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(525)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(528) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)14096930 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(516)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(528) HNBGW_Test.msc0-RAN(516)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)1165257 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(528)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(528)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(522)@b4f118497d00: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(522)@b4f118497d00: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(529) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@b4f118497d00: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(529)5864839 HNBGW_Test.msc2-SCCP(521)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc2-SCCP(521)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(522)@b4f118497d00: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(529) HNBGW_Test.msc2-RAN(522)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(529)8343631 HNBGW_Test.msc2-SCCP(521)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(521)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(529)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(529)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@b4f118497d00: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@b4f118497d00: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@b4f118497d00: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(530)15977194 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(516)@b4f118497d00: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(516)@b4f118497d00: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(530)9176862 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(515)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(516)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(514)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(526)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(517)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(522)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(524)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(525)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(519)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(521)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(527)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(523)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(520)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(509)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(518)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(509): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(510): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(512): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(514): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(515): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(516): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(517): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(518): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(519): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(520): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(521): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(522): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(523): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(524): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(525): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(526): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(527): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(528): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(529): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Tue Oct 8 07:59:44 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=269762) Waiting for packet dumper to finish... 1 (prev_count=269762, count=334456) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Tue Oct 8 07:59:47 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(539)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(539)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(539)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(537)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(542)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(542)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(542)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(540)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(545)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(545)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(545)@b4f118497d00: ************************************************* HNBGW_Test.msc2-SCCP(543)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(548)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(548)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(548)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(546)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(539)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(542)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(545)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(548)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(538)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(538)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(541)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(541)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(544)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(544)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(547)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(547)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(541)@b4f118497d00: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(541)@b4f118497d00: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(550) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)736816 HNBGW_Test.msc1-SCCP(540)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(540)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(541)@b4f118497d00: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(550) HNBGW_Test.msc1-RAN(541)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)7278813 HNBGW_Test.msc1-SCCP(540)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(540)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(550)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(550)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(538)@b4f118497d00: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(538)@b4f118497d00: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(551) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@b4f118497d00: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(551)11603888 HNBGW_Test.msc0-SCCP(537)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(537)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(538)@b4f118497d00: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(551) HNBGW_Test.msc0-RAN(538)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(551)10928085 HNBGW_Test.msc0-SCCP(537)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(537)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(551)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(551)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(544)@b4f118497d00: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(544)@b4f118497d00: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@b4f118497d00: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(552)8314820 HNBGW_Test.msc2-SCCP(543)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc2-SCCP(543)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(544)@b4f118497d00: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc2-RAN(544)@b4f118497d00: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)15675781 HNBGW_Test.msc2-SCCP(543)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(543)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(552)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(547)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(544)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(546)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(545)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(538)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(537)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(541)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(540)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(536)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(543)@b4f118497d00: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(539)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(549)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(548)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(531)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(542)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(531): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(532): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(534): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(536): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(537): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(538): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(539): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(540): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(541): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(542): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(543): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(544): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(545): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(546): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(547): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(548): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(549): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(550): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(551): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Tue Oct 8 07:59:53 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=268537) Waiting for packet dumper to finish... 1 (prev_count=268537, count=336718) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Tue Oct 8 07:59:56 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(561)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(561)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(561)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(559)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(564)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(564)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(564)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(562)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(567)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(567)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(567)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(565)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(570)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(570)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(570)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(568)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(561)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(564)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(567)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(570)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(560)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(560)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(563)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(563)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(566)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(566)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(569)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(569)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(560)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(560)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)12015250 HNBGW_Test.msc0-SCCP(559)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(559)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(560)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) HNBGW_Test.msc0-RAN(560)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)6887256 HNBGW_Test.msc0-SCCP(559)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(559)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(563)@b4f118497d00: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@b4f118497d00: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@b4f118497d00: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)14560514 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(563)@b4f118497d00: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) HNBGW_Test.msc1-RAN(563)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)9177062 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: "disconnecting msc0" HNBGW_Test.msc0-RAN(560)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(561)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(559)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@b4f118497d00: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)12015250 HNBGW_Test.msc1-RAN(563)@b4f118497d00: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@b4f118497d00: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)7025279 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(563)@b4f118497d00: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc1-RAN(563)@b4f118497d00: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)1880993 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(569)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(562)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(570)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(563)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(565)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(566)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(558)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(571)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(568)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(567)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(564)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(553)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(553): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(558): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(559): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(560): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(561): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(562): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(563): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(564): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(565): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(566): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(567): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(568): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(569): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(570): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(571): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Tue Oct 8 08:00:02 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=272075) Waiting for packet dumper to finish... 1 (prev_count=272075, count=331219) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Tue Oct 8 08:00:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(583)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(583)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(583)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(581)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(586)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(586)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(586)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(584)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(583)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(586)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(582)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(582)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(585)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(585)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)4883630 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(582)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) HNBGW_Test.msc0-RAN(582)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)856404 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@b4f118497d00: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@b4f118497d00: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@b4f118497d00: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)4475578 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: First idle individual index:1 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(582)@b4f118497d00: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) HNBGW_Test.msc0-RAN(582)@b4f118497d00: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)3064199 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: "connecting cnlink 1" MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(592)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(592)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(592)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(590)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(592)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(591)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(591)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(591)@b4f118497d00: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(591)@b4f118497d00: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@b4f118497d00: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)3699104 HNBGW_Test.msc1-SCCP(590)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc1-SCCP(590)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(591)@b4f118497d00: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) HNBGW_Test.msc1-RAN(591)@b4f118497d00: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)2351280 HNBGW_Test.msc1-SCCP(590)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(590)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@b4f118497d00: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(591)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(584)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(592)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(586)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(590)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(582)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(581)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@b4f118497d00: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(583)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(585)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(587)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(580)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(575)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(575): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(580): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(581): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(582): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(583): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(584): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(585): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(586): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(587): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(590): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(591): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(592): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593): pass (pass -> pass) MTC@b4f118497d00: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Tue Oct 8 08:00:13 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=231117) Waiting for packet dumper to finish... 1 (prev_count=231117, count=310520) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Tue Oct 8 08:00:15 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(602)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(602)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(602)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(600)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(605)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(605)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(605)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(602)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(605)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(601)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(601)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)4618989 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)14586248 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(607)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(607)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)10131290 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)10747435 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(608)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(608)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)3647371 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)12264829 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@b4f118497d00: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)8541454 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)869363 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(603)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(599)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(604)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(605)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(594)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(601)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(600)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(602)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(606)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(594): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(599): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(600): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(601): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(602): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(603): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(604): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(605): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(606): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(607): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(608): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Tue Oct 8 08:00:22 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=220915) Waiting for packet dumper to finish... 1 (prev_count=220915, count=289553) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Tue Oct 8 08:00:24 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(619)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(619)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(619)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(617)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(622)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(622)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(622)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(620)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(625)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(625)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(625)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(628)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(628)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(628)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(619)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(622)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(625)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(628)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(618)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(618)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(621)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(621)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)11038691 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)6910803 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(631)1385987 HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(631)2083632 HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(632)11723621 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(632)8775050 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(627)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(618)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(623)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(624)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(617)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(622)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(620)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(626)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(616)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(628)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(619)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(611)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(625)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(629)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(621)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(611): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(616): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(617): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(618): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(619): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(620): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(621): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(622): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(623): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(624): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(625): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(626): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(627): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(628): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(629): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(630): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(631): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Tue Oct 8 08:00:31 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=246991) Waiting for packet dumper to finish... 1 (prev_count=246991, count=315436) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Tue Oct 8 08:00:34 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(641)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(641)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(641)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(639)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(644)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(644)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(644)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(642)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(647)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(647)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(647)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(645)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(650)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(650)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(650)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(641)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(644)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(647)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(650)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(640)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(640)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(643)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(643)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(646)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(646)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(652) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)320290 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(652) HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)5189364 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(652)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(652)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(653) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)14624003 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(653) HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)8315239 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(653)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(653)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)7771758 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)13883989 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(646)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(644)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(649)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(641)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(645)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(648)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(642)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(643)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(650)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(640)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(639)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(647)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(638)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(633)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(651)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(633): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(638): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(639): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(640): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(641): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(642): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(643): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(644): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(645): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(646): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(647): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(648): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(649): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(650): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(651): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(652): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(653): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Tue Oct 8 08:00:40 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=317187) Waiting for packet dumper to finish... 1 (prev_count=317187, count=328603) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Tue Oct 8 08:00:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(663)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(663)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(663)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(661)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(666)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(666)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(666)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(664)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(669)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(669)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(669)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(667)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(672)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(672)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(672)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(670)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(675)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(675)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(675)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(678)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-M3UA(678)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(678)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(663)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(666)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(669)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(672)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(675)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(678)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(662)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(662)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(665)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(665)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(668)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(668)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(671)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(671)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(680) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)11125962 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(680) HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)6598553 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(680)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(680)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(681) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)13454427 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(681) HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)10976672 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(681)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(681)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@b4f118497d00: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(682)12204051 HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)13315177 HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(662)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(671)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(675)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(670)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(672)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(661)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(669)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(665)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(667)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(676)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(664)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(668)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(678)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(677)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(660)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(666)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(673)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(655)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(674)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(679)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(663)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(655): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(660): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(661): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(662): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(663): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(664): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(665): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(666): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(667): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(668): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(669): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(670): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(671): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(672): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(673): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(674): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(675): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(676): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-RAN(677): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(678): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(679): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(680): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(681): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Tue Oct 8 08:00:49 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=390120) Waiting for packet dumper to finish... 1 (prev_count=390120, count=395300) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Tue Oct 8 08:00:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(691)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(691)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(691)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(689)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(694)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(694)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(694)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(692)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(697)@b4f118497d00: ************************************************* HNBGW_Test.msc2-M3UA(697)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(697)@b4f118497d00: ************************************************* HNBGW_Test.msc2-SCCP(695)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(700)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(700)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(700)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(703)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(703)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(703)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(701)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(706)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-M3UA(706)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(706)@b4f118497d00: ************************************************* HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(691)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(694)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc2-M3UA(697)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23909 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(700)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(703)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(706)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23910 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(690)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(690)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(693)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(693)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(696)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(696)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(702)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(702)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@b4f118497d00: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(708) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@b4f118497d00: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)16259847 HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(708) HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)8269757 HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(708)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(708)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(709) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@b4f118497d00: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(709)4461553 HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(709) HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(709)2063597 HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(709)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(709)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(694)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(703)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(704)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(702)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(701)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(690)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(699)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-RAN(696)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(693)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(691)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(689)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(695)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(700)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(688)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(683)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(697)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(698)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(706)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(707)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(692)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(705)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(683): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(684): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(686): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(688): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(689): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(690): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(691): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(692): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(693): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(694): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-SCCP(695): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-RAN(696): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc2-M3UA(697): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(698): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(699): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(700): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(701): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(702): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(703): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(704): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-RAN(705): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(706): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(707): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(708): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(709): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Tue Oct 8 08:00:58 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=350009) Waiting for packet dumper to finish... 1 (prev_count=350009, count=355165) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Tue Oct 8 08:01:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(718)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(718)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(718)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(716)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(721)@b4f118497d00: ************************************************* HNBGW_Test.msc1-M3UA(721)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(721)@b4f118497d00: ************************************************* HNBGW_Test.msc1-SCCP(719)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(724)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(724)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(724)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(727)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(727)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(727)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(718)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc1-M3UA(721)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23907 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(724)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(727)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(717)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(720)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(720)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(717)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)15112010 HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)8067253 HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@b4f118497d00: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)10119109 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)1982929 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(723)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(724)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(722)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@b4f118497d00: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)15112010 HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)4093007 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)5996369 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(717)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(721)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(726)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(715)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(719)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(716)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc1-RAN(720)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(718)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(725)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(710)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(728)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(727)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(710): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(715): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(716): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(717): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(718): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-SCCP(719): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-RAN(720): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc1-M3UA(721): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(722): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(723): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(724): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(725): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(726): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(727): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(728): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Tue Oct 8 08:01:07 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=284964) Waiting for packet dumper to finish... 1 (prev_count=284964, count=345125) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Tue Oct 8 08:01:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(740)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(740)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(740)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(738)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(743)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(743)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(743)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(740)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(743)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(739)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(739)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)15665585 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)9268190 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@b4f118497d00: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)12497670 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)5368081 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: "connecting cnlink 1" MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(749)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-M3UA(749)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(749)@b4f118497d00: ************************************************* HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(749)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23908 to server: "172.18.144.200":2905 association #8 MTC@b4f118497d00: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.144.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@b4f118497d00: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)15738364 HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)5048234 HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@b4f118497d00: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(748)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(738)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(747)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(732)@b4f118497d00: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(742)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(739)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(741)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(743)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(740)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(749)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(737)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(744)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(732): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(737): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(738): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(739): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(740): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(741): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(742): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(743): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(744): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746): pass (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(747): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-RAN(748): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(749): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750): pass (pass -> pass) MTC@b4f118497d00: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Tue Oct 8 08:01:17 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=253300) Waiting for packet dumper to finish... 1 (prev_count=253300, count=330162) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Tue Oct 8 08:01:20 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(752)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(757)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(757)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(757)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(755)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(760)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(760)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(760)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(758)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(757)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(760)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(756)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(756)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(759)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(759)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(761)@b4f118497d00: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@b4f118497d00: f_create_expect(l3 := '29DAD4FA39E52B5F8712'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(756)@b4f118497d00: Created Expect[0] for '29DAD4FA39E52B5F8712'O to be handled at TC_second_rab_assignment0(762) TC_second_rab_assignment-Iuh0-RUA(753)@b4f118497d00: Added conn table entry 0TC_second_rab_assignment0(762)12534493 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(756)@b4f118497d00: Found Expect[0] for l3='29DAD4FA39E52B5F8712'O handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@b4f118497d00: Added conn table entry 0TC_second_rab_assignment0(762)14337321 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_len:91 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(761)@b4f118497d00: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf42dd17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(762) TC_second_rab_assignment0(762)@b4f118497d00: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf42dd17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.144.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@b4f118497d00: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf42dd17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@b4f118497d00: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bf42dd17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.144.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_len:63 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_len:12 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@b4f118497d00: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(762)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(762)@b4f118497d00: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bf42dd17" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_second_rab_assignment-Iuh0-RUA(753)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(758)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(755)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(757)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(759)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(756)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(754)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(760)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(751)@b4f118497d00: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(752)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(761)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(751): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_second_rab_assignment-Iuh0(752): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(753): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(754): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(755): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(756): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(757): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(758): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(759): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(760): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(761): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_second_rab_assignment0(762): pass (pass -> pass) MTC@b4f118497d00: Test case TC_second_rab_assignment finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Tue Oct 8 08:01:23 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=228468) Waiting for packet dumper to finish... 1 (prev_count=228468, count=228968) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Tue Oct 8 08:01:26 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(769)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(769)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(769)@b4f118497d00: ************************************************* MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(767)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(772)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(772)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(772)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(770)@b4f118497d00: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(769)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(772)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(768)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(768)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(771)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(771)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: talloc reports "struct hnb_context" x 1, expecting 1 MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(768)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(767)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(769)@b4f118497d00: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(763)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(770)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(771)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(766)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(772)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(773)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(763): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(766): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(767): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(768): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(769): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(770): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(771): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(772): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(773): none (pass -> pass) MTC@b4f118497d00: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Tue Oct 8 08:01:28 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=91089) Waiting for packet dumper to finish... 1 (prev_count=91089, count=149421) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Tue Oct 8 08:01:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@b4f118497d00: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@b4f118497d00: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(775)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(777)@b4f118497d00: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(782)@b4f118497d00: ************************************************* HNBGW_Test.msc0-M3UA(782)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(782)@b4f118497d00: ************************************************* HNBGW_Test.msc0-SCCP(780)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@b4f118497d00: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(785)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-M3UA(785)@b4f118497d00: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(785)@b4f118497d00: ************************************************* HNBGW_Test.sgsn0-SCCP(783)@b4f118497d00: v_sccp_pdu_maxlen:268 MTC@b4f118497d00: setverdict(pass): none -> pass MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(782)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23905 to server: "172.18.144.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(785)@b4f118497d00: SCTP_ConnectResult -> connection established from: "172.18.144.203":23906 to server: "172.18.144.200":2905 association #8 HNBGW_Test.msc0-RAN(781)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(781)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(784)@b4f118497d00: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(784)@b4f118497d00: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(781)@b4f118497d00: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(781)@b4f118497d00: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(787) TC_apply_sccp-Iuh0-RUA(776)@b4f118497d00: Added conn table entry 0TC_apply_sccp0(787)10897936 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: First idle individual index:0 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(781)@b4f118497d00: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(787) HNBGW_Test.msc0-RAN(781)@b4f118497d00: Added conn table entry 0TC_apply_sccp0(787)4821557 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(787)@b4f118497d00: setverdict(pass): none -> pass TC_apply_sccp0(787)@b4f118497d00: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@b4f118497d00: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@b4f118497d00: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(787)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: vl_len:22 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: vl_from0 HNBGW_Test.msc0-SCCP(780)@b4f118497d00: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A3D05148772E1C5F02E75'O TC_apply_sccp0(787)@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(787)@b4f118497d00: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Session index based on local reference:0 HNBGW_Test.msc0-RAN(781)@b4f118497d00: Deleted conn table entry 0TC_apply_sccp0(787)4821557 TC_apply_sccp-Iuh0-RUA(776)@b4f118497d00: Deleted conn table entry 0TC_apply_sccp0(787)10897936 TC_apply_sccp0(787)@b4f118497d00: Final verdict of PTC: pass MTC@b4f118497d00: ok: talloc reports "asn1_context" = 1 bytes TC_apply_sccp-Iuh0-RUA(776)@b4f118497d00: Final verdict of PTC: none TC_apply_sccp-Iuh1-RUA(778)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(783)@b4f118497d00: Final verdict of PTC: none TC_apply_sccp-Iuh1(777)@b4f118497d00: Final verdict of PTC: none TC_apply_sccp-Iuh0(775)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(784)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-RAN(781)@b4f118497d00: Final verdict of PTC: none VirtHNBGW-STATS(774)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(780)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(782)@b4f118497d00: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(785)@b4f118497d00: Final verdict of PTC: none HNBGW-MGCP(786)@b4f118497d00: Final verdict of PTC: none IPA-CTRL-CLI-IPA(779)@b4f118497d00: Final verdict of PTC: none MTC@b4f118497d00: setverdict(pass): pass -> pass, component reason not changed MTC@b4f118497d00: Setting final verdict of the test case. MTC@b4f118497d00: Local verdict of MTC: pass MTC@b4f118497d00: Local verdict of PTC VirtHNBGW-STATS(774): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_apply_sccp-Iuh0(775): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(776): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_apply_sccp-Iuh1(777): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(778): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC IPA-CTRL-CLI-IPA(779): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-SCCP(780): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-RAN(781): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.msc0-M3UA(782): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(783): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-RAN(784): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(785): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC HNBGW-MGCP(786): none (pass -> pass) MTC@b4f118497d00: Local verdict of PTC TC_apply_sccp0(787): pass (pass -> pass) MTC@b4f118497d00: Test case TC_apply_sccp finished. Verdict: pass MTC@b4f118497d00: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Tue Oct 8 08:01:38 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.144.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=180272) Waiting for packet dumper to finish... 1 (prev_count=180272, count=206100) MTC@b4f118497d00: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@b4f118497d00: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@b4f118497d00: Terminating MTC. MC@b4f118497d00: MTC terminated. MC2> exit MC@b4f118497d00: Shutting down session. MC@b4f118497d00: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-with-pfcp-21.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: PASS HNBGW_Tests.TC_hnb_disconnected_timeout NEW: PASS HNBGW_Tests.TC_ps_rab_assignment_with_pfcp Summary: pass: 46 NEW: PASS: 2 skip: 1 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-1005-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-1005-hnbgw jenkins-ttcn3-hnbgw-test-1005-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-1005-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-1005-stp + docker kill jenkins-ttcn3-hnbgw-test-1005-stp jenkins-ttcn3-hnbgw-test-1005-stp + docker wait jenkins-ttcn3-hnbgw-test-1005-stp 137 + clean_up_common + set +e + set +x ### Clean up ### + trap - EXIT INT TERM 0 + type clean_up + clean_up + sed -i s/classname='\([^']\+\)'/classname='\1:with-pfcp'/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/junit-xml-with-pfcp-21.log + network_clean + docker network inspect ttcn3-hnbgw-test-144 + grep Name + cut -d : -f2 + awk -F" NR>1{print $2} + local containers= + [ -n ] + network_remove + set +x Removing network ttcn3-hnbgw-test-144 + docker network remove ttcn3-hnbgw-test-144 ttcn3-hnbgw-test-144 + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix + fix_perms + set +x Fixing permissions + id -u + id -g + docker run --rm -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/_cache:/cache --name jenkins-ttcn3-hnbgw-test-1005-cleaner debian:bookworm sh -e -x -c chmod -R a+rX /data/ /cache/ chown -R 1000:1000 /data /cache + chmod -R a+rX /data/ /cache/ + chown -R 1000:1000 /data /cache + collect_logs + cat /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/junit-xml-20.log Recording test results [Checks API] No suitable checks publisher found. Sending e-mails to: jenkins-notifications@lists.osmocom.org Archiving artifacts Finished: SUCCESS