Started by timer Running as SYSTEM Building remotely on build4-deb12build-ansible (ttcn3 obs ttcn3_with_linux_6.1_or_higher qemu io_uring osmocom-gerrit coverity osmocom-master) in workspace /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring The recommended git tool is: NONE No credentials specified Wiping out workspace first. Cloning the remote Git repository Cloning repository https://gerrit.osmocom.org/docker-playground > git init /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring # timeout=10 Fetching upstream changes from https://gerrit.osmocom.org/docker-playground > git --version # timeout=10 > git --version # 'git version 2.39.2' > git fetch --tags --force --progress -- https://gerrit.osmocom.org/docker-playground +refs/heads/*:refs/remotes/origin/* # timeout=10 > git config remote.origin.url https://gerrit.osmocom.org/docker-playground # timeout=10 > git config --add remote.origin.fetch +refs/heads/*:refs/remotes/origin/* # timeout=10 Avoid second fetch Seen branch in repository origin/arehbein/devtests Seen branch in repository origin/arehbein/devtests%topic=fixes Seen branch in repository origin/daniel/bscnat_tests Seen branch in repository origin/daniel/training Seen branch in repository origin/daniel/wip Seen branch in repository origin/fixeria/confmerge Seen branch in repository origin/fixeria/sccplite Seen branch in repository origin/fixeria/testing Seen branch in repository origin/jolly/testing Seen branch in repository origin/laforge/ergw Seen branch in repository origin/laforge/fr Seen branch in repository origin/laforge/ns Seen branch in repository origin/laforge/podman Seen branch in repository origin/lynxis/gerrit-comment-ci Seen branch in repository origin/master Seen branch in repository origin/neels/hnbgw-pfcp Seen branch in repository origin/neels/wip Seen branch in repository origin/osmith/fix-registry-pull Seen branch in repository origin/osmith/fix-rpi-gnutls Seen branch in repository origin/osmith/obs-2021q1 Seen branch in repository origin/osmith/rpm-local Seen branch in repository origin/osmith/ttcn3-pass-args Seen branch in repository origin/osmith/wip Seen branch in repository origin/osmith/wip-4g-only Seen branch in repository origin/osmith/wip-asan Seen branch in repository origin/pespin/bts-perf Seen branch in repository origin/pespin/ergw Seen branch in repository origin/pespin/gtp1 Seen branch in repository origin/pespin/master Seen branch in repository origin/pmaier/pcuif Seen branch in repository origin/refsf/for/master/dyn-pdch Seen 31 remote branches > git show-ref --tags -d # timeout=10 Checking out Revision affe733c8c1194a7ece649d13c272b5820897f0f (origin/master) > git config core.sparsecheckout # timeout=10 > git checkout -f affe733c8c1194a7ece649d13c272b5820897f0f # timeout=10 Commit message: "debian-buster-jenkins: remove pysim" > git rev-list --no-walk affe733c8c1194a7ece649d13c272b5820897f0f # timeout=10 [ttcn3-hnbgw-test-io_uring] $ /bin/sh -xe /tmp/jenkins10916031203599564500.sh + export REGISTRY_HOST=registry.osmocom.org + echo ttcn3-hnbgw-test-io_uring + sed s/-io_uring$// + DIR=ttcn3-hnbgw-test + export DOCKER_ARGS= -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json + cd ttcn3-hnbgw-test + ./jenkins.sh + [ x = x ] + REPO_USER=osmocom-build + [ x/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring = x ] + VOL_BASE_DIR=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs + mkdir -p /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs + [ ! -d /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs ] + [ xjenkins-ttcn3-hnbgw-test-io_uring-192 = x ] + basename /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/ttcn3-hnbgw-test + SUITE_NAME=ttcn3-hnbgw-test + IMAGE_SUFFIX=master + docker_images_require osmo-stp-master osmo-hnbgw-master ttcn3-hnbgw-test + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-stp-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/debian-bookworm-build' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.1s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 5.76kB done #2 DONE 0.1s #3 [auth] sharing credentials for registry.osmocom.org #3 DONE 0.0s #4 [internal] load metadata for registry.osmocom.org/debian:bookworm #4 DONE 0.1s #5 [internal] load build context #5 DONE 0.0s #6 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #6 DONE 0.0s #7 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #7 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf 0.1s done #7 DONE 0.1s #8 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #8 DONE 0.2s #9 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #9 DONE 0.2s #10 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #10 DONE 0.3s #11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #11 DONE 0.3s #5 [internal] load build context #5 transferring context: 1.96kB done #5 DONE 0.0s #12 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #12 CACHED #13 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #13 CACHED #14 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #14 CACHED #15 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #15 CACHED #16 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #16 CACHED #17 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #17 CACHED #18 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #18 CACHED #19 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #19 CACHED #20 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #20 CACHED #21 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #21 CACHED #22 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #22 CACHED #23 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #23 CACHED #24 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #24 CACHED #25 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #25 DONE 0.1s #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 0.340 + echo deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./ #26 0.340 + apt-get update #26 0.413 Hit:1 http://deb.debian.org/debian bookworm InRelease #26 0.413 Get:2 http://deb.debian.org/debian bookworm-updates InRelease [55.4 kB] #26 0.415 Get:3 http://deb.debian.org/debian-security bookworm-security InRelease [48.0 kB] #26 0.536 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease [1579 B] #26 0.632 Get:5 http://deb.debian.org/debian bookworm-updates/main amd64 Packages.diff/Index [11.7 kB] #26 0.642 Get:6 http://deb.debian.org/debian bookworm-updates/main amd64 Packages T-2024-09-10-2011.55-F-2024-09-10-2011.55.pdiff [1116 B] #26 0.656 Get:6 http://deb.debian.org/debian bookworm-updates/main amd64 Packages T-2024-09-10-2011.55-F-2024-09-10-2011.55.pdiff [1116 B] #26 0.743 Get:7 http://deb.debian.org/debian-security bookworm-security/main amd64 Packages [182 kB] #26 0.805 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ Packages [192 kB] #26 0.827 Fetched 492 kB in 0s (1047 kB/s) #26 0.827 Reading package lists... #26 1.089 + apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev #26 1.092 Reading package lists... #26 1.339 Building dependency tree... #26 1.392 Reading state information... #26 1.462 The following additional packages will be installed: #26 1.462 libcurl4-gnutls-dev liblimesuite23.11-1 libmicrohttpd-dev libmicrohttpd12 #26 1.463 liborcania-dev liborcania2.3 libsystemd-dev libuhd4.3.0 libulfius2.7 #26 1.463 libyder-dev libyder2.0 #26 1.463 Suggested packages: #26 1.463 libcurl4-doc libidn-dev libldap2-dev librtmp-dev libssh2-1-dev uhd-doc #26 1.463 uhd-host #26 1.463 Recommended packages: #26 1.463 limesuite-udev limesuite-images gnuradio-dev #26 1.533 The following NEW packages will be installed: #26 1.533 libcurl4-gnutls-dev liblimesuite-dev liblimesuite23.11-1 libmicrohttpd-dev #26 1.533 libmicrohttpd12 liborcania-dev liborcania2.3 libsystemd-dev libuhd-dev #26 1.533 libuhd4.3.0 libulfius-dev libulfius2.7 libyder-dev libyder2.0 #26 1.555 0 upgraded, 14 newly installed, 0 to remove and 6 not upgraded. #26 1.555 Need to get 5782 kB of archives. #26 1.555 After this operation, 24.8 MB of additional disk space will be used. #26 1.555 Get:1 http://deb.debian.org/debian bookworm/main amd64 libcurl4-gnutls-dev amd64 7.88.1-10+deb12u7 [485 kB] #26 1.558 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ liblimesuite23.11-1 23.11.0.1.2141.9dce.202409182026 [263 kB] #26 1.586 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ liblimesuite-dev 23.11.0.1.2141.9dce.202409182026 [53.0 kB] #26 1.590 Get:4 http://deb.debian.org/debian bookworm/main amd64 libmicrohttpd12 amd64 0.9.75-6 [119 kB] #26 1.592 Get:5 http://deb.debian.org/debian bookworm/main amd64 libmicrohttpd-dev amd64 0.9.75-6 [291 kB] #26 1.596 Get:6 http://deb.debian.org/debian bookworm/main amd64 liborcania2.3 amd64 2.3.2-1 [13.6 kB] #26 1.597 Get:7 http://deb.debian.org/debian bookworm/main amd64 liborcania-dev amd64 2.3.2-1 [115 kB] #26 1.598 Get:8 http://deb.debian.org/debian bookworm/main amd64 libsystemd-dev amd64 252.30-1~deb12u2 [354 kB] #26 1.602 Get:9 http://deb.debian.org/debian bookworm/main amd64 libuhd4.3.0 amd64 4.3.0.0+ds1-5 [3445 kB] #26 1.638 Get:10 http://deb.debian.org/debian bookworm/main amd64 libuhd-dev amd64 4.3.0.0+ds1-5 [219 kB] #26 1.639 Get:11 http://deb.debian.org/debian bookworm/main amd64 libyder2.0 amd64 1.4.19-1 [9420 B] #26 1.639 Get:12 http://deb.debian.org/debian bookworm/main amd64 libulfius2.7 amd64 2.7.13-1 [55.3 kB] #26 1.639 Get:13 http://deb.debian.org/debian bookworm/main amd64 libyder-dev amd64 1.4.19-1 [103 kB] #26 1.649 Get:14 http://deb.debian.org/debian bookworm/main amd64 libulfius-dev amd64 2.7.13-1 [256 kB] #26 1.757 debconf: delaying package configuration, since apt-utils is not installed #26 1.799 Fetched 5782 kB in 0s (50.4 MB/s) #26 1.864 Selecting previously unselected package libcurl4-gnutls-dev:amd64. #26 1.864 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 115747 files and directories currently installed.) #26 1.901 Preparing to unpack .../00-libcurl4-gnutls-dev_7.88.1-10+deb12u7_amd64.deb ... #26 1.917 Unpacking libcurl4-gnutls-dev:amd64 (7.88.1-10+deb12u7) ... #26 2.087 Selecting previously unselected package liblimesuite23.11-1:amd64. #26 2.095 Preparing to unpack .../01-liblimesuite23.11-1_23.11.0.1.2141.9dce.202409182026_amd64.deb ... #26 2.130 Unpacking liblimesuite23.11-1:amd64 (23.11.0.1.2141.9dce.202409182026) ... #26 2.253 Selecting previously unselected package liblimesuite-dev. #26 2.271 Preparing to unpack .../02-liblimesuite-dev_23.11.0.1.2141.9dce.202409182026_amd64.deb ... #26 2.288 Unpacking liblimesuite-dev (23.11.0.1.2141.9dce.202409182026) ... #26 2.449 Selecting previously unselected package libmicrohttpd12:amd64. #26 2.456 Preparing to unpack .../03-libmicrohttpd12_0.9.75-6_amd64.deb ... #26 2.473 Unpacking libmicrohttpd12:amd64 (0.9.75-6) ... #26 2.589 Selecting previously unselected package libmicrohttpd-dev:amd64. #26 2.606 Preparing to unpack .../04-libmicrohttpd-dev_0.9.75-6_amd64.deb ... #26 2.623 Unpacking libmicrohttpd-dev:amd64 (0.9.75-6) ... #26 2.779 Selecting previously unselected package liborcania2.3:amd64. #26 2.787 Preparing to unpack .../05-liborcania2.3_2.3.2-1_amd64.deb ... #26 2.804 Unpacking liborcania2.3:amd64 (2.3.2-1) ... #26 2.922 Selecting previously unselected package liborcania-dev:amd64. #26 2.940 Preparing to unpack .../06-liborcania-dev_2.3.2-1_amd64.deb ... #26 2.957 Unpacking liborcania-dev:amd64 (2.3.2-1) ... #26 3.091 Selecting previously unselected package libsystemd-dev:amd64. #26 3.108 Preparing to unpack .../07-libsystemd-dev_252.30-1~deb12u2_amd64.deb ... #26 3.126 Unpacking libsystemd-dev:amd64 (252.30-1~deb12u2) ... #26 3.334 Selecting previously unselected package libuhd4.3.0:amd64. #26 3.343 Preparing to unpack .../08-libuhd4.3.0_4.3.0.0+ds1-5_amd64.deb ... #26 3.390 Unpacking libuhd4.3.0:amd64 (4.3.0.0+ds1-5) ... #26 3.703 Selecting previously unselected package libuhd-dev:amd64. #26 3.720 Preparing to unpack .../09-libuhd-dev_4.3.0.0+ds1-5_amd64.deb ... #26 3.738 Unpacking libuhd-dev:amd64 (4.3.0.0+ds1-5) ... #26 3.906 Selecting previously unselected package libyder2.0:amd64. #26 3.924 Preparing to unpack .../10-libyder2.0_1.4.19-1_amd64.deb ... #26 3.941 Unpacking libyder2.0:amd64 (1.4.19-1) ... #26 4.087 Selecting previously unselected package libulfius2.7:amd64. #26 4.105 Preparing to unpack .../11-libulfius2.7_2.7.13-1_amd64.deb ... #26 4.126 Unpacking libulfius2.7:amd64 (2.7.13-1) ... #26 4.241 Selecting previously unselected package libyder-dev:amd64. #26 4.258 Preparing to unpack .../12-libyder-dev_1.4.19-1_amd64.deb ... #26 4.279 Unpacking libyder-dev:amd64 (1.4.19-1) ... #26 4.411 Selecting previously unselected package libulfius-dev:amd64. #26 4.428 Preparing to unpack .../13-libulfius-dev_2.7.13-1_amd64.deb ... #26 4.445 Unpacking libulfius-dev:amd64 (2.7.13-1) ... #26 4.624 Setting up libuhd4.3.0:amd64 (4.3.0.0+ds1-5) ... #26 4.676 Setting up libcurl4-gnutls-dev:amd64 (7.88.1-10+deb12u7) ... #26 4.736 Setting up libmicrohttpd12:amd64 (0.9.75-6) ... #26 4.789 Setting up liborcania2.3:amd64 (2.3.2-1) ... #26 4.848 Setting up liblimesuite23.11-1:amd64 (23.11.0.1.2141.9dce.202409182026) ... #26 4.902 Setting up libyder2.0:amd64 (1.4.19-1) ... #26 4.964 Setting up libmicrohttpd-dev:amd64 (0.9.75-6) ... #26 5.017 Setting up libuhd-dev:amd64 (4.3.0.0+ds1-5) ... #26 5.071 Setting up libsystemd-dev:amd64 (252.30-1~deb12u2) ... #26 5.134 Setting up liblimesuite-dev (23.11.0.1.2141.9dce.202409182026) ... #26 5.196 Setting up liborcania-dev:amd64 (2.3.2-1) ... #26 5.250 Setting up libulfius2.7:amd64 (2.7.13-1) ... #26 5.304 Setting up libyder-dev:amd64 (1.4.19-1) ... #26 5.357 Setting up libulfius-dev:amd64 (2.7.13-1) ... #26 5.419 Processing triggers for man-db (2.11.2-2) ... #26 5.477 Processing triggers for libc-bin (2.36-9+deb12u8) ... #26 5.618 + apt-get clean #26 DONE 5.9s #27 exporting to image #27 exporting layers #27 exporting layers 0.5s done #27 writing image sha256:6c7a4d7c27a9d66fc3d3eabfe3cdd305222f3a95d35d7c4e1bc66905523b735b done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest 0.0s done #27 DONE 0.5s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 6c7a4d7c27a9 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-stp-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-stp-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-stp-master + echo osmo-stp-master + dir=osmo-stp-master + pull_arg=--pull + grep ^FROM ../osmo-stp-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + grep -q $USER + echo FROM $USER/$DISTRO-build + pull_arg= + set +x Building image: osmo-stp-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-stp-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-stp-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/osmo-stp-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-stp-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.24kB done #2 DONE 0.1s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [internal] load build context #4 transferring context: 1.13kB done #4 DONE 0.1s #5 [1/7] FROM docker.io/osmocom-build/debian-bookworm-build #5 ... #6 https://gerrit.osmocom.org/plugins/gitiles/libosmo-sigtran/+/master?format=TEXT #6 CACHED #5 [1/7] FROM docker.io/osmocom-build/debian-bookworm-build #5 DONE 0.3s #7 [2/7] RUN CASE "debian-bookworm" in debian*) apt-get update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-netif-dev && apt-get clean ;; centos*) dnf install -y "pkgconfig(libosmo-netif)" "pkgconfig(libosmocore)" "pkgconfig(libosmogsm)" "pkgconfig(libosmovty)" ;; esac #7 0.338 Hit:1 http://deb.debian.org/debian bookworm InRelease #7 0.338 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #7 0.338 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #7 0.338 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #7 0.884 Reading package lists... #7 1.149 Reading package lists... #7 1.396 Building dependency tree... #7 1.449 Reading state information... #7 1.511 The following additional packages will be installed: #7 1.511 libosmocodec4 libosmocoding0 libosmocore libosmocore22 libosmoctrl0 #7 1.511 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 libosmousb0 #7 1.512 libosmovty13 osmocom-nightly #7 1.522 The following NEW packages will be installed: #7 1.522 libosmo-netif-dev libosmocodec4 libosmocoding0 libosmocore libosmocore-dev #7 1.522 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #7 1.522 libosmonetif11 libosmosim2 libosmousb0 libosmovty13 osmocom-nightly #7 1.543 0 upgraded, 15 newly installed, 0 to remove and 6 not upgraded. #7 1.543 Need to get 2046 kB of archives. #7 1.543 After this operation, 7278 kB of additional disk space will be used. #7 1.543 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202409182026 [1176 B] #7 1.571 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.12.6e1e.202409182026 [168 kB] #7 1.575 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.12.6e1e.202409182026 [50.5 kB] #7 1.576 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.12.6e1e.202409182026 [69.7 kB] #7 1.578 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.12.6e1e.202409182026 [227 kB] #7 1.581 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.12.6e1e.202409182026 [70.3 kB] #7 1.582 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.12.6e1e.202409182026 [103 kB] #7 1.584 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.12.6e1e.202409182026 [177 kB] #7 1.587 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.12.6e1e.202409182026 [58.8 kB] #7 1.589 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.12.6e1e.202409182026 [62.9 kB] #7 1.590 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.12.6e1e.202409182026 [49.6 kB] #7 1.592 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.12.6e1e.202409182026 [42.9 kB] #7 1.594 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.12.6e1e.202409182026 [846 kB] #7 1.603 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202409182026 [53.8 kB] #7 1.604 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202409182026 [66.0 kB] #7 1.715 debconf: delaying package configuration, since apt-utils is not installed #7 1.768 Fetched 2046 kB in 0s (25.6 MB/s) #7 1.827 Selecting previously unselected package osmocom-nightly. #7 1.827 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117405 files and directories currently installed.) #7 1.863 Preparing to unpack .../00-osmocom-nightly_202409182026_amd64.deb ... #7 1.880 Unpacking osmocom-nightly (202409182026) ... #7 2.017 Selecting previously unselected package libosmocore22:amd64. #7 2.025 Preparing to unpack .../01-libosmocore22_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.060 Unpacking libosmocore22:amd64 (1.10.0.12.6e1e.202409182026) ... #7 2.208 Selecting previously unselected package libosmocodec4:amd64. #7 2.216 Preparing to unpack .../02-libosmocodec4_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.233 Unpacking libosmocodec4:amd64 (1.10.0.12.6e1e.202409182026) ... #7 2.381 Selecting previously unselected package libosmoisdn0:amd64. #7 2.399 Preparing to unpack .../03-libosmoisdn0_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.417 Unpacking libosmoisdn0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 2.563 Selecting previously unselected package libosmogsm20:amd64. #7 2.571 Preparing to unpack .../04-libosmogsm20_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.592 Unpacking libosmogsm20:amd64 (1.10.0.12.6e1e.202409182026) ... #7 2.742 Selecting previously unselected package libosmocoding0:amd64. #7 2.750 Preparing to unpack .../05-libosmocoding0_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.767 Unpacking libosmocoding0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 2.919 Selecting previously unselected package libosmovty13:amd64. #7 2.927 Preparing to unpack .../06-libosmovty13_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 2.945 Unpacking libosmovty13:amd64 (1.10.0.12.6e1e.202409182026) ... #7 3.092 Selecting previously unselected package libosmogb14:amd64. #7 3.100 Preparing to unpack .../07-libosmogb14_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.118 Unpacking libosmogb14:amd64 (1.10.0.12.6e1e.202409182026) ... #7 3.276 Selecting previously unselected package libosmoctrl0:amd64. #7 3.284 Preparing to unpack .../08-libosmoctrl0_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.301 Unpacking libosmoctrl0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 3.444 Selecting previously unselected package libosmosim2:amd64. #7 3.452 Preparing to unpack .../09-libosmosim2_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.474 Unpacking libosmosim2:amd64 (1.10.0.12.6e1e.202409182026) ... #7 3.616 Selecting previously unselected package libosmousb0:amd64. #7 3.634 Preparing to unpack .../10-libosmousb0_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.651 Unpacking libosmousb0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 3.773 Selecting previously unselected package libosmocore. #7 3.790 Preparing to unpack .../11-libosmocore_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.808 Unpacking libosmocore (1.10.0.12.6e1e.202409182026) ... #7 3.962 Selecting previously unselected package libosmocore-dev:amd64. #7 3.970 Preparing to unpack .../12-libosmocore-dev_1.10.0.12.6e1e.202409182026_amd64.deb ... #7 3.987 Unpacking libosmocore-dev:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.159 Selecting previously unselected package libosmonetif11:amd64. #7 4.177 Preparing to unpack .../13-libosmonetif11_1.5.1.5.89a1.202409182026_amd64.deb ... #7 4.196 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202409182026) ... #7 4.313 Selecting previously unselected package libosmo-netif-dev:amd64. #7 4.331 Preparing to unpack .../14-libosmo-netif-dev_1.5.1.5.89a1.202409182026_amd64.deb ... #7 4.348 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409182026) ... #7 4.519 Setting up osmocom-nightly (202409182026) ... #7 4.571 Setting up libosmocore22:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.631 Setting up libosmocodec4:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.684 Setting up libosmovty13:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.735 Setting up libosmoisdn0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.794 Setting up libosmousb0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.845 Setting up libosmogsm20:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.897 Setting up libosmoctrl0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 4.948 Setting up libosmogb14:amd64 (1.10.0.12.6e1e.202409182026) ... #7 5.006 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202409182026) ... #7 5.058 Setting up libosmocoding0:amd64 (1.10.0.12.6e1e.202409182026) ... #7 5.110 Setting up libosmosim2:amd64 (1.10.0.12.6e1e.202409182026) ... #7 5.162 Setting up libosmocore (1.10.0.12.6e1e.202409182026) ... #7 5.217 Setting up libosmocore-dev:amd64 (1.10.0.12.6e1e.202409182026) ... #7 5.267 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409182026) ... #7 5.320 Processing triggers for libc-bin (2.36-9+deb12u8) ... #7 DONE 5.6s #8 [3/7] WORKDIR /DATA #8 DONE 0.1s #9 [4/7] RUN GIT clone https://gerrit.osmocom.org/libosmo-sigtran.git #9 0.299 Cloning into 'libosmo-sigtran'... #9 DONE 0.6s #10 [5/7] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/LIBOSMO-SIGTRAN/+/MASTER?FORMAT=TEXT /tmp/commit-libosmo-sigtran #10 DONE 0.1s #11 [6/7] RUN CD libosmo-sigtran && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure && make "-j$(nproc)" install && install examples/.libs/sccp_demo_user /usr/local/bin/ && ldconfig #11 0.393 Already on 'master' #11 0.394 Your branch is up to date with 'origin/master'. #11 0.395 refs/heads/master #11 0.415 HEAD is now at e1adfb8 SS7: Support secondary point codes #11 0.416 master #11 0.417 e1adfb8db007a71707e9a0fbdfd8ca778f52cf2b #11 2.672 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.672 libtoolize: copying file './ltmain.sh' #11 3.108 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 3.108 libtoolize: and rerunning libtoolize and aclocal. #11 3.108 libtoolize: Consider adding '-I m4' to ACLOCAL_AMFLAGS in Makefile.am. #11 3.835 configure.ac:167: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.835 configure.ac:167: You should run autoupdate. #11 3.835 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.835 configure.ac:167: the top level #11 3.835 configure.ac:184: warning: AC_OUTPUT should be used without arguments. #11 3.835 configure.ac:184: You should run autoupdate. #11 4.297 configure.ac:23: installing './compile' #11 4.301 configure.ac:25: installing './config.guess' #11 4.306 configure.ac:25: installing './config.sub' #11 4.311 configure.ac:9: installing './install-sh' #11 4.316 configure.ac:9: installing './missing' #11 4.376 examples/Makefile.am: installing './depcomp' #11 4.525 checking for a BSD-compatible install... /usr/bin/install -c #11 4.531 checking whether build environment is sane... yes #11 4.539 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.541 checking for gawk... gawk #11 4.542 checking whether make sets $(MAKE)... yes #11 4.560 checking whether make supports nested variables... yes #11 4.576 checking whether make supports nested variables... (cached) yes #11 4.576 checking whether make sets $(MAKE)... (cached) yes #11 4.582 checking for gcc... gcc #11 4.650 checking whether the C compiler works... yes #11 4.715 checking for C compiler default output file name... a.out #11 4.716 checking for suffix of executables... #11 4.742 checking whether we are cross compiling... no #11 4.770 checking for suffix of object files... o #11 4.787 checking whether the compiler supports GNU C... yes #11 4.798 checking whether gcc accepts -g... yes #11 4.815 checking for gcc option to enable C11 features... none needed #11 4.849 checking whether gcc understands -c and -o together... yes #11 4.875 checking whether make supports the include directive... yes (GNU style) #11 4.881 checking dependency style of gcc... gcc3 #11 4.938 checking build system type... x86_64-pc-linux-gnu #11 5.041 checking host system type... x86_64-pc-linux-gnu #11 5.042 checking how to print strings... printf #11 5.067 checking for a sed that does not truncate output... /usr/bin/sed #11 5.069 checking for grep that handles long lines and -e... /usr/bin/grep #11 5.070 checking for egrep... /usr/bin/grep -E #11 5.071 checking for fgrep... /usr/bin/grep -F #11 5.071 checking for ld used by gcc... /usr/bin/ld #11 5.073 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 5.075 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 5.076 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 5.087 checking whether ln -s works... yes #11 5.087 checking the maximum length of command line arguments... 1572864 #11 5.092 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 5.092 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 5.092 checking for /usr/bin/ld option to reload object files... -r #11 5.092 checking for file... file #11 5.092 checking for objdump... objdump #11 5.093 checking how to recognize dependent libraries... pass_all #11 5.093 checking for dlltool... no #11 5.093 checking how to associate runtime and link libraries... printf %s\n #11 5.093 checking for ar... ar #11 5.094 checking for archiver @FILE support... @ #11 5.124 checking for strip... strip #11 5.125 checking for ranlib... ranlib #11 5.125 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 5.250 checking for sysroot... no #11 5.250 checking for a working dd... /usr/bin/dd #11 5.253 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 5.265 checking for mt... no #11 5.265 checking if : is a manifest tool... no #11 5.268 checking for stdio.h... yes #11 5.289 checking for stdlib.h... yes #11 5.317 checking for string.h... yes #11 5.340 checking for inttypes.h... yes #11 5.364 checking for stdint.h... yes #11 5.388 checking for strings.h... yes #11 5.402 checking for sys/stat.h... yes #11 5.416 checking for sys/types.h... yes #11 5.441 checking for unistd.h... yes #11 5.465 checking for dlfcn.h... yes #11 5.489 checking for objdir... .libs #11 5.560 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.597 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.597 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.635 checking if gcc static flag -static works... yes #11 5.685 checking if gcc supports -c -o file.o... yes #11 5.697 checking if gcc supports -c -o file.o... (cached) yes #11 5.697 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.702 checking whether -lc should be explicitly linked in... no #11 5.724 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.795 checking how to hardcode library paths into programs... immediate #11 5.795 checking whether stripping libraries is possible... yes #11 5.797 checking if libtool supports shared libraries... yes #11 5.797 checking whether to build shared libraries... yes #11 5.797 checking whether to build static libraries... yes #11 5.797 checking for pkg-config... /usr/bin/pkg-config #11 5.798 checking for pkg-config... /usr/bin/pkg-config #11 5.798 checking pkg-config is at least version 0.20... yes #11 5.799 checking for libosmocore >= 1.10.0... yes #11 5.808 checking for libosmovty >= 1.10.0... yes #11 5.818 checking for libosmogsm >= 1.10.0... yes #11 5.829 checking for libosmo-netif >= 1.5.0... yes #11 5.847 checking for library containing sctp_recvmsg... -lsctp #11 5.942 checking if gcc supports -fvisibility=hidden... yes #11 5.959 checking for doxygen... /usr/bin/doxygen #11 5.965 checking whether to enable VTY/CTRL tests... no #11 5.965 CFLAGS=" -std=gnu11 -Wall" #11 5.965 CPPFLAGS=" -Wall" #11 6.003 checking that generated files are newer than configure... done #11 6.004 configure: creating ./config.status #11 7.097 config.status: creating libosmo-sigtran.pc #11 7.128 config.status: creating include/osmocom/Makefile #11 7.167 config.status: creating include/osmocom/sccp/Makefile #11 7.206 config.status: creating include/osmocom/sigtran/Makefile #11 7.246 config.status: creating include/Makefile #11 7.285 config.status: creating src/Makefile #11 7.327 config.status: creating tests/Makefile #11 7.367 config.status: creating tests/m2ua/Makefile #11 7.406 config.status: creating tests/xua/Makefile #11 7.446 config.status: creating tests/ss7/Makefile #11 7.486 config.status: creating tests/vty/Makefile #11 7.526 config.status: creating examples/Makefile #11 7.565 config.status: creating stp/Makefile #11 7.605 config.status: creating doc/Makefile #11 7.645 config.status: creating doc/examples/Makefile #11 7.684 config.status: creating doc/manuals/Makefile #11 7.724 config.status: creating contrib/Makefile #11 7.763 config.status: creating contrib/systemd/Makefile #11 7.779 config.status: creating Doxyfile #11 7.794 config.status: creating Makefile #11 7.823 config.status: executing tests/atconfig commands #11 7.826 config.status: executing depfiles commands #11 8.352 config.status: executing libtool commands #11 8.466 echo 2.0.0.3-e1ad > .version-t && mv .version-t .version #11 8.471 make install-recursive #11 8.479 make[1]: Entering directory '/data/libosmo-sigtran' #11 8.488 Making install in include #11 8.492 make[2]: Entering directory '/data/libosmo-sigtran/include' #11 8.500 Making install in osmocom #11 8.505 make[3]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.513 Making install in sccp #11 8.517 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.523 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.523 make[5]: Nothing to be done for 'install-exec-am'. #11 8.526 /usr/bin/mkdir -p '/usr/local/include/osmocom/sccp' #11 8.532 /usr/bin/install -c -m 644 sccp_types.h '/usr/local/include/osmocom/sccp' #11 8.536 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.536 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.537 Making install in sigtran #11 8.541 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.547 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.547 make[5]: Nothing to be done for 'install-exec-am'. #11 8.551 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran' #11 8.552 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran/protocol' #11 8.556 /usr/bin/install -c -m 644 xua_types.h xua_msg.h m2ua_types.h sccp_sap.h sigtran_sap.h sccp_helpers.h mtp_sap.h osmo_ss7.h '/usr/local/include/osmocom/sigtran' #11 8.557 /usr/bin/install -c -m 644 protocol/sua.h protocol/m3ua.h protocol/mtp.h protocol/sccp_scmg.h '/usr/local/include/osmocom/sigtran/protocol' #11 8.562 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.562 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.566 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.572 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.572 make[5]: Nothing to be done for 'install-exec-am'. #11 8.572 make[5]: Nothing to be done for 'install-data-am'. #11 8.572 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.572 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.573 make[3]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.578 make[3]: Entering directory '/data/libosmo-sigtran/include' #11 8.583 make[4]: Entering directory '/data/libosmo-sigtran/include' #11 8.583 make[4]: Nothing to be done for 'install-exec-am'. #11 8.583 make[4]: Nothing to be done for 'install-data-am'. #11 8.583 make[4]: Leaving directory '/data/libosmo-sigtran/include' #11 8.584 make[3]: Leaving directory '/data/libosmo-sigtran/include' #11 8.584 make[2]: Leaving directory '/data/libosmo-sigtran/include' #11 8.585 Making install in src #11 8.591 make[2]: Entering directory '/data/libosmo-sigtran/src' #11 8.594 CC libxua_a-xua_msg.o #11 8.594 CC ipa.lo #11 8.595 CC m3ua.lo #11 8.596 CC osmo_ss7.lo #11 8.597 CC osmo_ss7_as.lo #11 8.598 CC osmo_ss7_asp_peer.lo #11 8.599 CC osmo_ss7_asp.lo #11 8.599 CC osmo_ss7_hmrt.lo #11 8.601 CC osmo_ss7_vty.lo #11 8.602 CC osmo_ss7_xua_srv.lo #11 8.602 CC sccp2sua.lo #11 8.602 CC sccp_helpers.lo #11 8.602 CC sccp_lbcs.lo #11 8.603 CC sccp_sap.lo #11 8.603 CC sccp_sclc.lo #11 8.603 CC sccp_scmg.lo #11 8.603 CC sccp_scrc.lo #11 8.604 CC sccp_scoc.lo #11 8.604 CC sccp_types.lo #11 8.604 CC sccp_user.lo #11 8.670 sccp_scoc.c: In function 'scoc_fsm_active': #11 8.670 sccp_scoc.c:1200:9: note: '#pragma message: TODO: internal disco: send N-DISCONNECT.ind to user' #11 8.670 1200 | #pragma message ("TODO: internal disco: send N-DISCONNECT.ind to user") #11 8.670 | ^~~~~~~ #11 8.723 CC sccp_vty.lo #11 8.732 CC sua.lo #11 8.732 CC xua_asp_fsm.lo #11 8.743 CC xua_as_fsm.lo #11 8.761 CC xua_default_lm_fsm.lo #11 8.761 CC xua_msg.lo #11 8.762 CC xua_rkm.lo #11 8.763 CC xua_shared.lo #11 8.773 CC xua_snm.lo #11 8.783 AR libxua.a #11 8.783 ar: `u' modifier ignored since `D' is the default (see `U') #11 9.010 CCLD libosmo-sigtran.la #11 9.652 make[3]: Entering directory '/data/libosmo-sigtran/src' #11 9.652 make[3]: Nothing to be done for 'install-data-am'. #11 9.653 /usr/bin/mkdir -p '/usr/local/lib' #11 9.653 /bin/bash ../libtool --mode=install /usr/bin/install -c libosmo-sigtran.la '/usr/local/lib' #11 9.692 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.so.10.0.1 /usr/local/lib/libosmo-sigtran.so.10.0.1 #11 9.702 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10 || { rm -f libosmo-sigtran.so.10 && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10; }; }) #11 9.711 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so || { rm -f libosmo-sigtran.so && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so; }; }) #11 9.726 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.lai /usr/local/lib/libosmo-sigtran.la #11 9.740 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.a /usr/local/lib/libosmo-sigtran.a #11 9.751 libtool: install: chmod 644 /usr/local/lib/libosmo-sigtran.a #11 9.759 libtool: install: ranlib /usr/local/lib/libosmo-sigtran.a #11 9.805 libtool: finish: PATH="/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/sbin" ldconfig -n /usr/local/lib #11 9.805 ---------------------------------------------------------------------- #11 9.805 Libraries have been installed in: #11 9.805 /usr/local/lib #11 9.805 #11 9.805 If you ever happen to want to link against installed libraries #11 9.805 in a given directory, LIBDIR, you must either use libtool, and #11 9.805 specify the full pathname of the library, or use the '-LLIBDIR' #11 9.805 flag during linking and do at least one of the following: #11 9.805 - add LIBDIR to the 'LD_LIBRARY_PATH' environment variable #11 9.805 during execution #11 9.805 - add LIBDIR to the 'LD_RUN_PATH' environment variable #11 9.805 during linking #11 9.805 - use the '-Wl,-rpath -Wl,LIBDIR' linker flag #11 9.805 - have your system administrator add LIBDIR to '/etc/ld.so.conf' #11 9.805 #11 9.805 See any operating system documentation about shared libraries for #11 9.805 more information, such as the ld(1) and ld.so(8) manual pages. #11 9.805 ---------------------------------------------------------------------- #11 9.806 make[3]: Leaving directory '/data/libosmo-sigtran/src' #11 9.806 make[2]: Leaving directory '/data/libosmo-sigtran/src' #11 9.806 Making install in tests #11 9.807 make[2]: Entering directory '/data/libosmo-sigtran/tests' #11 9.808 Making install in xua #11 9.810 make[3]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.811 make[4]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.811 make[4]: Nothing to be done for 'install-exec-am'. #11 9.811 make[4]: Nothing to be done for 'install-data-am'. #11 9.811 make[4]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.811 make[3]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.811 Making install in m2ua #11 9.813 make[3]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.815 make[4]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.815 make[4]: Nothing to be done for 'install-exec-am'. #11 9.815 make[4]: Nothing to be done for 'install-data-am'. #11 9.815 make[4]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.815 make[3]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.815 Making install in ss7 #11 9.817 make[3]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.820 make[4]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.820 make[4]: Nothing to be done for 'install-exec-am'. #11 9.820 make[4]: Nothing to be done for 'install-data-am'. #11 9.820 make[4]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.820 make[3]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.820 Making install in vty #11 9.823 make[3]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.828 make[4]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.828 make[4]: Nothing to be done for 'install-exec-am'. #11 9.828 make[4]: Nothing to be done for 'install-data-am'. #11 9.828 make[4]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.828 make[3]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.830 make[3]: Entering directory '/data/libosmo-sigtran/tests' #11 9.834 make[4]: Entering directory '/data/libosmo-sigtran/tests' #11 9.834 make[4]: Nothing to be done for 'install-exec-am'. #11 9.834 make[4]: Nothing to be done for 'install-data-am'. #11 9.834 make[4]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.834 make[3]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.835 make[2]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.835 Making install in examples #11 9.837 make[2]: Entering directory '/data/libosmo-sigtran/examples' #11 9.839 CC sccp_demo_user.o #11 9.839 CC sccp_test_server.o #11 9.840 CC sccp_test_vty.o #11 9.886 CCLD sccp_demo_user #11 10.15 make[3]: Entering directory '/data/libosmo-sigtran/examples' #11 10.15 make[3]: Nothing to be done for 'install-exec-am'. #11 10.15 make[3]: Nothing to be done for 'install-data-am'. #11 10.15 make[3]: Leaving directory '/data/libosmo-sigtran/examples' #11 10.15 make[2]: Leaving directory '/data/libosmo-sigtran/examples' #11 10.15 Making install in stp #11 10.15 make[2]: Entering directory '/data/libosmo-sigtran/stp' #11 10.15 CC stp_main.o #11 10.21 CCLD osmo-stp #11 10.46 make[3]: Entering directory '/data/libosmo-sigtran/stp' #11 10.46 make[3]: Nothing to be done for 'install-data-am'. #11 10.46 /usr/bin/mkdir -p '/usr/local/bin' #11 10.47 /bin/bash ../libtool --mode=install /usr/bin/install -c osmo-stp '/usr/local/bin' #11 10.50 libtool: install: /usr/bin/install -c .libs/osmo-stp /usr/local/bin/osmo-stp #11 10.50 make[3]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.50 make[2]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.50 Making install in doc #11 10.50 make[2]: Entering directory '/data/libosmo-sigtran/doc' #11 10.51 Making install in examples #11 10.51 make[3]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.52 make[4]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.52 make[4]: Nothing to be done for 'install-exec-am'. #11 10.52 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.52 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 10.53 /usr/bin/install -c -m 644 osmo-stp.cfg osmo-stp-multihome.cfg '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.53 /usr/bin/install -c -m 644 osmo-stp.cfg '/usr/local/etc/osmocom' #11 10.53 make[4]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.53 make[3]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.53 Making install in manuals #11 10.54 make[3]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.54 make[4]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.54 make[4]: Nothing to be done for 'install-exec-am'. #11 10.54 make[4]: Nothing to be done for 'install-data-am'. #11 10.54 make[4]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.54 make[3]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.55 make[3]: Entering directory '/data/libosmo-sigtran/doc' #11 10.55 make[4]: Entering directory '/data/libosmo-sigtran/doc' #11 10.55 make[4]: Nothing to be done for 'install-exec-am'. #11 10.55 make[4]: Nothing to be done for 'install-data-am'. #11 10.55 make[4]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.55 make[3]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.55 make[2]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.55 Making install in contrib #11 10.56 make[2]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.57 Making install in systemd #11 10.57 make[3]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.58 make[4]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.58 make[4]: Nothing to be done for 'install-exec-am'. #11 10.58 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.59 /usr/bin/install -c -m 644 osmo-stp.service '/lib/systemd/system' #11 10.59 make[4]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.59 make[3]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.59 make[3]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.60 make[4]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.60 make[4]: Nothing to be done for 'install-exec-am'. #11 10.60 make[4]: Nothing to be done for 'install-data-am'. #11 10.60 make[4]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.60 make[3]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.60 make[2]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.61 make[2]: Entering directory '/data/libosmo-sigtran' #11 10.61 mkdir -p doc/sigtran #11 10.62 /usr/bin/doxygen Doxyfile #11 10.64 warning: Tag 'SYMBOL_CACHE_SIZE' at line 310 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'SHOW_DIRECTORIES' at line 519 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'COLS_IN_ALPHA_INDEX' at line 799 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'HTML_ALIGN_MEMBERS' at line 900 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'USE_INLINE_TREES' at line 1087 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'LATEX_SOURCE_CODE' at line 1247 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'XML_SCHEMA' at line 1339 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'XML_DTD' at line 1345 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'PERL_PATH' at line 1510 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'CLASS_DIAGRAMS' at line 1522 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: Tag 'MSCGEN_PATH' at line 1531 of file 'Doxyfile' has become obsolete. #11 10.64 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.64 warning: argument 'a4wide' for option PAPER_TYPE is not a valid enum value #11 10.64 Using the default: a4! #11 10.67 Doxygen version used: 1.9.4 #11 10.67 Searching for include files... #11 10.67 Searching for example files... #11 10.67 Searching for images... #11 10.67 Searching for dot files... #11 10.67 Searching for msc files... #11 10.67 Searching for dia files... #11 10.67 Searching for files to exclude #11 10.67 Searching INPUT for files to process... #11 10.67 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran #11 10.67 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran/protocol #11 10.67 Searching for files in directory /data/libosmo-sigtran/src #11 10.67 Reading and parsing tag files #11 10.67 Parsing files #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.67 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.67 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.67 Preprocessing /data/libosmo-sigtran/src/ipa.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/ipa.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/m3ua.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/m3ua.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp2sua.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp2sua.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_internal.h... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp_internal.h... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_sap.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp_sap.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.67 Parsing file /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.67 Preprocessing /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.67 Pars/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.73 ing file /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sccp_types.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sccp_types.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sccp_user.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sccp_user.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sccp_vty.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sccp_vty.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/ss7_internal.h... #11 10.73 Parsing file /data/libosmo-sigtran/src/ss7_internal.h... #11 10.73 Preprocessing /data/libosmo-sigtran/src/sua.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/sua.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_internal.h... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_internal.h... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_msg.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_msg.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_rkm.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_rkm.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_shared.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_shared.c... #11 10.73 Preprocessing /data/libosmo-sigtran/src/xua_snm.c... #11 10.73 Parsing file /data/libosmo-sigtran/src/xua_snm.c... #11 10.73 Building macro definition list... #11 10.73 Building group list... #11 10.73 Building directory list... #11 10.73 Building namespace list... #11 10.73 Building file list... #11 10.73 Building class list... #11 10.73 Building concept list... #11 10.73 Computing nesting relations for classes... #11 10.73 Associating documentation with classes... #11 10.73 Associating documentation with concepts... #11 10.73 Building example list... #11 10.73 Searching for enumerations... #11 10.73 Searching for documented typedefs... #11 10.73 Searching for members imported via using declarations... #11 10.73 Searching for included using directives... #11 10.73 Searching for documented variables... #11 10.73 Building interface member list... #11 10.73 Building member list... #11 10.73 Searching for friends... #11 10.73 Searching for documented defines... #11 10.73 Computing class inheritance relations... #11 10.73 Computing class usage relations... #11 10.73 Flushing cached template relations that have become invalid... #11 10.73 Computing class relations... #11 10.73 Add enum values to enums... #11 10.73 Searching for member function documentation... #11 10.73 Creating members for template instances... #11 10.73 Building page list... #11 10.73 Search for main page... #11 10.73 Computing page relations... #11 10.73 Determining the scope of groups... #11 10.73 Sorting lists... #11 10.73 Determining which enums are documented #11 10.73 Computing member relations... #11 10.73 Building full member lists recursively... #11 10.73 Adding members to member groups. #11 10.73 Computing member references... #11 10.73 Inheriting documentation... #11 10.73 Generating disk names... #11 10.73 Adding source references... #11 10.73 Adding xrefitems... #11 10.73 Sorting member lists... #11 10.73 Setting anonymous enum type... #11 10.73 Computing dependencies between directories... #11 10.73 Generating citations page... #11 10.73 Counting members... #11 10.73 Counting data structures... #11 10.73 Resolving user defined references... #11 10.73 Finding anchors and sections in the documentation... #11 10.73 Transferring function references... #11 10.73 Combining using relations... #11 10.73 Adding members to index pages... #11 10.73 Correcting members for VHDL... #11 10.73 Computing tooltip texts... #11 10.73 Generating style sheet... #11 10.73 Generating search indices... #11 10.73 Generating example documentation... #11 10.73 Generating file sources... #11 10.73 Generating code for file include/osmocom/sigtran/m2ua_types.h... #11 10.73 Generating code for file include/osmocom/sigtran/mtp_sap.h... #11 10.73 Generating code for file include/osmocom/sigtran/osmo_ss7.h... #11 10.73 Generating code for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.73 Generating code for file in/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: argument 'ppid_sid' of command @param is not found in the argument list of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) #11 10.81 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: The following parameter of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) is not documented: #11 10.81 parameter 'ppid_mux' #11 10.81 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.81 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.81 parameter 'inst' #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.81 parameter 'asp_name' #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.81 parameter 'asp_name' #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.81 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.82 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.82 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.82 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.82 parameter 'inst' #11 10.82 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.82 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.82 parameter 'addr' #11 10.82 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.82 parameter 'prim_cb' #11 10.82 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.82 parameter 'prim_cb' #11 10.83 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.83 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.83 parameter 'num_maps' #11 10.83 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.83 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.83 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.83 parameter 'info_str' #11 10.83 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.83 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.84 parameter 'asp_name' #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.84 parameter 'asp_name' #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.84 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.84 parameter 'trans_proto' #11 10.85 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.85 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.85 parameter 'addr' #11 10.85 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.85 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.85 parameter 'inst' #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:92: warning: unable to resolve reference to 'in_digits' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:320: warning: unable to resolve reference to 'addr' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:682: warning: The following parameter of sccp_msg_add_sua_opt(enum sccp_message_types type, struct msgb *msg, const struct xua_msg_part *opt) is not documented: #11 10.85 parameter 'type' #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1176: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1140: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1209: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1300: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1638: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1599: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1429: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1559: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:797: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1271: warning: unable to resolve reference to 'xua' for \ref command #11 10.85 /data/libosmo-sigtran/src/sccp2sua.c:1238: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1332: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1468: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1382: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1519: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1189: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1156: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:1221: warning: unable to resolve reference to 'xua' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp2sua.c:565: warning: unable to resolve reference to 'opt' for \ref command #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.86 parameter 'oph' #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.86 parameter 'oph' #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.86 parameter 'oph' #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.86 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.86 parameter 'oph' #11 10.87 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.87 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.87 parameter 'inst' #11 10.87 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.87 parameter 'prim_cb' #11 10.87 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.87 parameter 'prim_cb' #11 10.87 /data/libosmo-sigtran/src/sccp_user.c:88: warning: The following parameter of sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.87 parameter 'prim_cb' #11 10.88 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.88 parameter 'trans_proto' #11 10.88 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.88 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.88 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.88 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.88 parameter 'info_str' #11 10.88 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.89 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.89 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.89 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.89 parameter 'info_str' #11 10.89 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.89 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.89 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.89 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.89 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.89 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.89 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.89 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.89 parameter 'info_str' #11 10.89 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.89 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.89 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.89 parameter 'num_maps' #11 10.89 clude/osmocom/sigtran/protocol/mtp.h... #11 10.89 Generating code for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.89 Generating code for file include/osmocom/sigtran/protocol/sua.h... #11 10.89 Generating code for file include/osmocom/sigtran/sccp_helpers.h... #11 10.89 Generating code for file include/osmocom/sigtran/sccp_sap.h... #11 10.89 Generating code for file include/osmocom/sigtran/sigtran_sap.h... #11 10.89 Generating code for file include/osmocom/sigtran/xua_msg.h... #11 10.89 Generating code for file include/osmocom/sigtran/xua_types.h... #11 10.89 Parsing code for file src/ipa.c... #11 10.89 Parsing code for file src/m3ua.c... #11 10.89 Parsing code for file src/osmo_ss7.c... #11 10.89 Parsing code for file src/osmo_ss7_as.c... #11 10.89 Parsing code for file src/osmo_ss7_asp.c... #11 10.89 Parsing code for file src/osmo_ss7_asp_peer.c... #11 10.89 Parsing code for file src/osmo_ss7_hmrt.c... #11 10.89 Parsing code for file src/osmo_ss7_vty.c... #11 10.89 Parsing code for file src/osmo_ss7_xua_srv.c... #11 10.89 Parsing code for file src/sccp2sua.c... #11 10.89 Parsing code for file src/sccp_helpers.c... #11 10.89 Generating code for file src/sccp_internal.h... #11 10.89 Parsing code for file src/sccp_lbcs.c... #11 10.89 Parsing code for file src/sccp_sap.c... #11 10.89 Parsing code for file src/sccp_sclc.c... #11 10.89 Parsing code for file src/sccp_scmg.c... #11 10.89 Parsing code for file src/sccp_scoc.c... #11 10.89 Parsing code for file src/sccp_scrc.c... #11 10.89 Parsing code for file src/sccp_types.c... #11 10.89 Parsing code for file src/sccp_user.c... #11 10.89 Parsing code for file src/sccp_vty.c... #11 10.89 Generating code for file src/ss7_internal.h... #11 10.89 Parsing code for file src/sua.c... #11 10.89 Parsing code for file src/xua_as_fsm.c... #11 10.89 Generating code for file src/xua_as_fsm.h... #11 10.89 Parsing code for file src/xua_asp_fsm.c... #11 10.89 Generating code for file src/xua_asp_fsm.h... #11 10.89 Parsing code for file src/xua_default_lm_fsm.c... #11 10.89 Generating code for file src/xua_internal.h... #11 10.89 Parsing code for file src/xua_msg.c... #11 10.89 Parsing code for file src/xua_rkm.c... #11 10.89 Parsing code for file src/xua_shared.c... #11 10.89 Parsing code for file src/xua_snm.c... #11 10.89 Generating file documentation... #11 10.89 Generating docs for file include/osmocom/sigtran/m2ua_types.h... #11 10.89 Generating docs for file include/osmocom/sigtran/mtp_sap.h... #11 10.89 Generating docs for file include/osmocom/sigtran/osmo_ss7.h... #11 10.89 Generating docs for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.89 Generating docs for file include/osmocom/sigtran/protocol/mtp.h... #11 10.89 Generating docs for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.89 Generating docs for file include/osmocom/sigtran/protocol/sua.h... #11 10.89 Generating docs for file include/osmocom/sigtran/sccp_helpers.h... #11 10.89 Generating docs for file include/osmocom/sigtran/sccp_sap.h... #11 10.89 Generating docs for file include/osmocom/sigtran/sigtran_sap.h... #11 10.89 Generating docs for file include/osmocom/sigtran/xua_msg.h... #11 10.89 Generating docs for file include/osmocom/sigtran/xua_types.h... #11 10.89 Generating docs for file src/ipa.c... #11 10.89 Generating docs for file src/m3ua.c... #11 10.89 Generating docs for file src/osmo_ss7.c... #11 10.89 Generating docs for file src/osmo_ss7_as.c... #11 10.89 Generating docs for file src/osmo_ss7_asp.c... #11 10.89 Generating docs for file src/osmo_ss7_asp_peer.c... #11 10.89 Generating docs for file src/osmo_ss7_hmrt.c... #11 10.89 Generating docs for file src/osmo_ss7_vty.c... #11 10.89 Generating docs for file src/osmo_ss7_xua_srv.c... #11 10.89 Generating docs for file src/sccp2sua.c... #11 10.89 Generating docs for file src/sccp_helpers.c... #11 10.89 Generating docs for file src/sccp_internal.h... #11 10.89 Generating docs for file src/sccp_lbcs.c... #11 10.89 Generating docs for file src/sccp_sap.c... #11 10.89 Generating docs for file src/sccp_sclc.c... #11 10.89 Generating docs for file src/sccp_scmg.c... #11 10.89 Generating docs for file src/sccp_scoc.c... #11 10.89 Generating docs for file src/sccp_scrc.c... #11 10.89 Generating docs for file src/sccp_types.c... #11 10.89 Generating docs for file src/sccp_user.c... #11 10.89 Generating docs for file src/sccp_vty.c... #11 10.89 Generating docs for file src/ss7_internal.h... #11 10.89 Generating docs for file src/sua.c... #11 10.89 Generating docs for file src/xua_as_fsm.c... #11 10.89 Generating docs for file src/xua_as_fsm.h... #11 10.89 Generating docs for file src/xua_asp_fsm.c... #11 10.89 Generating docs for file src/xua_asp_fsm.h... #11 10.89 Generating docs for file src/xua_default_lm_fsm.c... #11 10.89 Generating docs for file src/xua_internal.h... #11 10.89 Generating docs for file src/xua_msg.c... #11 10.89 Generating docs for fil/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.91 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.96 e src/xua_rkm.c... #11 10.96 Generating docs for file src/xua_shared.c... #11 10.96 Generating docs for file src/xua_snm.c... #11 10.96 Generating page documentation... #11 10.96 Generating group documentation... #11 10.96 Generating class documentation... #11 10.96 Generating docs for compound ipa_asp_fsm_priv... #11 10.96 Generating docs for compound lm_fsm_priv... #11 10.96 Generating docs for compound m3ua_data_hdr... #11 10.96 Generating docs for compound osmo_mtp_pause_param... #11 10.96 Generating docs for compound osmo_mtp_prim... #11 10.96 Generating docs for compound osmo_mtp_resume_param... #11 10.96 Generating docs for compound osmo_mtp_status_param... #11 10.96 Generating docs for compound osmo_mtp_transfer_param... #11 10.96 Generating docs for compound osmo_sccp_addr... #11 10.96 Generating docs for compound osmo_sccp_addr_entry... #11 10.96 Generating docs for compound osmo_sccp_gt... #11 10.96 Generating docs for compound osmo_sccp_instance... #11 10.96 Generating docs for compound osmo_sccp_user... #11 10.96 Generating docs for compound osmo_scu_connect_param... #11 10.96 Generating docs for compound osmo_scu_data_param... #11 10.96 Generating docs for compound osmo_scu_disconn_param... #11 10.96 Generating docs for compound osmo_scu_notice_param... #11 10.96 Generating docs for compound osmo_scu_pcstate_param... #11 10.96 Generating docs for compound osmo_scu_prim... #11 10.96 Generating docs for compound osmo_scu_reset_param... #11 10.96 Generating docs for compound osmo_scu_state_param... #11 10.96 Generating docs for compound osmo_scu_unitdata_param... #11 10.96 Generating docs for compound osmo_ss7_as... #11 10.96 Generating docs for compound osmo_ss7_asp... #11 10.96 Generating docs for compound osmo_ss7_asp_peer... #11 10.96 Generating docs for compound osmo_ss7_instance... #11 10.96 Generating docs for compound osmo_ss7_link... #11 10.96 Generating docs for compound osmo_ss7_linkset... #11 10.96 Generating docs for compound osmo_ss7_pc_fmt... #11 10.96 Generating docs for compound osmo_ss7_route... #11 10.96 Generating docs for compound osmo_ss7_route_table... #11 10.96 Generating docs for compound osmo_ss7_routing_key... #11 10.96 Generating docs for compound osmo_ss7_user... #11 10.96 Generating docs for compound osmo_xlm_prim... #11 10.96 Generating docs for compound osmo_xlm_prim_error... #11 10.96 Generating docs for compound osmo_xlm_prim_notify... #11 10.96 Generating docs for compound osmo_xlm_prim_rk_dereg... #11 10.96 Generating docs for compound osmo_xlm_prim_rk_reg... #11 10.96 Generating docs for compound osmo_xua_layer_manager... #11 10.96 Generating docs for compound osmo_xua_server... #11 10.96 Generating docs for compound sccp_connection... #11 10.96 Generating docs for compound sccp_scmg_msg... #11 10.96 Generating docs for compound xua_as_fsm_priv... #11 10.96 Generating docs for compound xua_asp_fsm_priv... #11 10.96 Generating docs for compound xua_common_hdr... #11 10.96 Generating docs for compound xua_dialect... #11 10.96 Generating docs for compound xua_msg... #11 10.96 Generating docs for compound xua_msg_class... #11 10.96 Generating docs for compound xua_msg_event_map... #11 10.96 Generating docs for compound xua_msg_part... #11 10.96 Generating docs for compound xua_parameter_hdr... #11 10.96 Generating concept documentation... #11 10.96 Generating namespace index... #11 10.96 Generating graph info page... #11 10.96 Generating directory documentation... #11 10.96 Generating index page... #11 10.96 Generating page index... #11 10.96 Generating module index... #11 10.96 Generating namespace index... #11 10.96 Generating namespace member index... #11 10.96 Generating concept index... #11 10.96 Generating annotated compound index... #11 10.96 Generating alphabetical compound index... #11 10.96 Generating hierarchical class index... #11 10.96 Generating member index... #11 10.96 Generating file index... #11 10.96 Generating file member index... #11 10.96 Generating example index... #11 10.96 finalizing index lists... #11 10.96 writing tag file... #11 10.96 Running plantuml with JAVA... #11 10.96 lookup cache used 2094/65536 hits=24055 misses=2248 #11 10.96 finished... #11 10.97 cd ./doc && tar cf html.tar */html #11 10.98 make[3]: Entering directory '/data/libosmo-sigtran' #11 10.98 make[3]: Nothing to be done for 'install-exec-am'. #11 10.98 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran' #11 10.98 /usr/bin/mkdir -p '/usr/local/lib/pkgconfig' #11 10.98 /usr/bin/install -c -m 644 ./doc/html.tar '/usr/local/share/doc/libosmo-sigtran' #11 10.98 /usr/bin/install -c -m 644 libosmo-sigtran.pc '/usr/local/lib/pkgconfig' #11 10.99 make install-data-hook #11 10.99 make[4]: Entering directory '/data/libosmo-sigtran' #11 10.99 cd /usr/local/share/doc/libosmo-sigtran && tar xf html.tar && rm -f html.tar #11 11.01 make[4]: Leaving directory '/data/libosmo-sigtran' #11 11.01 make[3]: Leaving directory '/data/libosmo-sigtran' #11 11.01 make[2]: Leaving directory '/data/libosmo-sigtran' #11 11.01 make[1]: Leaving directory '/data/libosmo-sigtran' #11 DONE 11.5s #12 [7/7] COPY OSMO-STP.CFG /data/ #12 DONE 0.2s #13 exporting to image #13 exporting layers #13 exporting layers 0.4s done #13 writing image sha256:f3b1ffefa1869f4bdc8e372fa11e2c922f1e4ee9c6633ec3c514a317a4ae2b64 0.0s done #13 naming to docker.io/osmocom-build/osmo-stp-master:latest 0.0s done #13 DONE 0.5s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/osmo-stp-master' + docker_image_exists osmo-stp-master + docker images -q osmocom-build/osmo-stp-master + test -n f3b1ffefa186 + list_osmo_packages debian-bookworm osmo-stp-master + local distro=debian-bookworm + local image=osmo-stp-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-stp-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-stp-master ### ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202409182026 amd64 Development headers for Osmocom network interface ii libosmocodec4:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo coding library ii libosmocore 1.10.0.12.6e1e.202409182026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.12.6e1e.202409182026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202409182026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo SIM library ii libosmousb0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo VTY library ii osmocom-nightly 202409182026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-hnbgw-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/debian-bookworm-build' rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/common .common docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load build definition from Dockerfile #1 transferring dockerfile: 5.76kB done #1 DONE 0.0s #2 [internal] load .dockerignore #2 transferring context: 2B done #2 DONE 0.1s #3 [auth] sharing credentials for registry.osmocom.org #3 DONE 0.0s #4 [internal] load metadata for registry.osmocom.org/debian:bookworm #4 DONE 0.0s #5 [internal] load build context #5 DONE 0.0s #6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #6 DONE 0.0s #7 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #7 DONE 0.0s #8 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf 0.1s done #8 DONE 0.1s #5 [internal] load build context #5 transferring context: 1.96kB done #5 DONE 0.2s #9 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #9 DONE 0.2s #10 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #10 DONE 0.2s #11 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #11 DONE 0.2s #12 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #12 CACHED #13 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #13 CACHED #14 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #14 CACHED #15 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #15 CACHED #16 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #16 CACHED #17 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #17 CACHED #18 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #18 CACHED #19 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #19 CACHED #20 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #20 CACHED #21 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #21 CACHED #22 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #22 CACHED #23 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #23 CACHED #24 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #24 CACHED #25 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #25 CACHED #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 CACHED #27 exporting to image #27 exporting layers done #27 writing image sha256:6c7a4d7c27a9d66fc3d3eabfe3cdd305222f3a95d35d7c4e1bc66905523b735b 0.0s done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest 0.0s done #27 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 6c7a4d7c27a9 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-hnbgw-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-hnbgw-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-hnbgw-master + echo osmo-hnbgw-master + dir=osmo-hnbgw-master + pull_arg=--pull + grep ^FROM ../osmo-hnbgw-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + echo FROM $USER/$DISTRO-build + grep -q $USER + pull_arg= + set +x Building image: osmo-hnbgw-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-hnbgw-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-hnbgw-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/osmo-hnbgw-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-hnbgw-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.16kB done #2 DONE 0.0s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [internal] load build context #4 DONE 0.0s #5 [1/8] FROM docker.io/osmocom-build/debian-bookworm-build #5 CACHED #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 ... #7 https://gerrit.osmocom.org/plugins/gitiles/osmo-hnbgw/+/master?format=TEXT #7 CACHED #4 [internal] load build context #4 transferring context: 864B done #4 DONE 0.0s #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 0.371 Hit:1 http://deb.debian.org/debian bookworm InRelease #6 0.371 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #6 0.371 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #6 0.371 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #6 0.926 Reading package lists... #6 1.193 Reading package lists... #6 1.440 Building dependency tree... #6 1.493 Reading state information... #6 1.556 The following additional packages will be installed: #6 1.556 libasn1c1 libosmo-gtlv-dev libosmo-gtlv1 libosmo-hnbap0 #6 1.556 libosmo-mgcp-client14 libosmo-pfcp0 libosmo-ranap7 libosmo-rua0 #6 1.556 libosmo-sigtran10 libosmoabis13 libosmocodec4 libosmocoding0 libosmocore #6 1.556 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #6 1.557 libosmonetif11 libosmosim2 libosmotrau10 libosmousb0 libosmovty13 #6 1.557 osmocom-nightly #6 1.569 The following NEW packages will be installed: #6 1.569 libasn1c-dev libasn1c1 libosmo-abis-dev libosmo-gtlv-dev libosmo-gtlv1 #6 1.569 libosmo-hnbap-dev libosmo-hnbap0 libosmo-mgcp-client-dev #6 1.569 libosmo-mgcp-client14 libosmo-netif-dev libosmo-pfcp-dev libosmo-pfcp0 #6 1.569 libosmo-ranap-dev libosmo-ranap7 libosmo-rua-dev libosmo-rua0 #6 1.569 libosmo-sigtran-dev libosmo-sigtran10 libosmoabis13 libosmocodec4 #6 1.569 libosmocoding0 libosmocore libosmocore-dev libosmocore22 libosmoctrl0 #6 1.569 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 #6 1.570 libosmotrau10 libosmousb0 libosmovty13 osmocom-nightly #6 1.591 0 upgraded, 34 newly installed, 0 to remove and 6 not upgraded. #6 1.591 Need to get 4002 kB of archives. #6 1.591 After this operation, 17.9 MB of additional disk space will be used. #6 1.591 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202409182026 [1176 B] #6 1.618 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.12.6e1e.202409182026 [168 kB] #6 1.623 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.12.6e1e.202409182026 [50.5 kB] #6 1.624 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmotrau10 1.6.0.11.0d73.202409182026 [31.6 kB] #6 1.625 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.12.6e1e.202409182026 [69.7 kB] #6 1.626 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.12.6e1e.202409182026 [227 kB] #6 1.629 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.12.6e1e.202409182026 [103 kB] #6 1.631 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoabis13 1.6.0.11.0d73.202409182026 [73.2 kB] #6 1.631 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-abis-dev 1.6.0.11.0d73.202409182026 [114 kB] #6 1.634 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv1 0.4.0.1.c4dc.202409182026 [16.5 kB] #6 1.635 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.12.6e1e.202409182026 [70.3 kB] #6 1.637 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.12.6e1e.202409182026 [177 kB] #6 1.639 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.12.6e1e.202409182026 [58.8 kB] #6 1.641 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.12.6e1e.202409182026 [62.9 kB] #6 1.643 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.12.6e1e.202409182026 [49.6 kB] #6 1.644 Get:16 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.12.6e1e.202409182026 [42.9 kB] #6 1.646 Get:17 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.12.6e1e.202409182026 [846 kB] #6 1.654 Get:18 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv-dev 0.4.0.1.c4dc.202409182026 [57.3 kB] #6 1.655 Get:19 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202409182026 [53.8 kB] #6 1.655 Get:20 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202409182026 [66.0 kB] #6 1.656 Get:21 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp0 0.4.0.1.c4dc.202409182026 [40.7 kB] #6 1.656 Get:22 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp-dev 0.4.0.1.c4dc.202409182026 [170 kB] #6 1.658 Get:23 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran10 2.0.0.3.e1ad.202409182026 [125 kB] #6 1.659 Get:24 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran-dev 2.0.0.3.e1ad.202409182026 [586 kB] #6 1.664 Get:25 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c1 0.9.37.202409182026 [75.4 kB] #6 1.665 Get:26 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c-dev 0.9.37.202409182026 [106 kB] #6 1.666 Get:27 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap0 1.6.0.1.4a6b5.202409182026 [51.8 kB] #6 1.667 Get:28 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap-dev 1.6.0.1.4a6b5.202409182026 [24.9 kB] #6 1.667 Get:29 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client14 1.13.1.202409182026 [57.8 kB] #6 1.667 Get:30 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client-dev 1.13.1.202409182026 [66.5 kB] #6 1.668 Get:31 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap7 1.6.0.1.4a6b5.202409182026 [225 kB] #6 1.670 Get:32 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap-dev 1.6.0.1.4a6b5.202409182026 [92.1 kB] #6 1.671 Get:33 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua0 1.6.0.1.4a6b5.202409182026 [28.1 kB] #6 1.671 Get:34 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua-dev 1.6.0.1.4a6b5.202409182026 [14.7 kB] #6 1.774 debconf: delaying package configuration, since apt-utils is not installed #6 1.825 Fetched 4002 kB in 0s (40.5 MB/s) #6 1.886 Selecting previously unselected package osmocom-nightly. #6 1.886 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117405 files and directories currently installed.) #6 1.917 Preparing to unpack .../00-osmocom-nightly_202409182026_amd64.deb ... #6 1.934 Unpacking osmocom-nightly (202409182026) ... #6 2.071 Selecting previously unselected package libosmocore22:amd64. #6 2.089 Preparing to unpack .../01-libosmocore22_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 2.128 Unpacking libosmocore22:amd64 (1.10.0.12.6e1e.202409182026) ... #6 2.267 Selecting previously unselected package libosmocodec4:amd64. #6 2.285 Preparing to unpack .../02-libosmocodec4_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 2.303 Unpacking libosmocodec4:amd64 (1.10.0.12.6e1e.202409182026) ... #6 2.449 Selecting previously unselected package libosmotrau10:amd64. #6 2.467 Preparing to unpack .../03-libosmotrau10_1.6.0.11.0d73.202409182026_amd64.deb ... #6 2.485 Unpacking libosmotrau10:amd64 (1.6.0.11.0d73.202409182026) ... #6 2.633 Selecting previously unselected package libosmoisdn0:amd64. #6 2.651 Preparing to unpack .../04-libosmoisdn0_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 2.669 Unpacking libosmoisdn0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 2.819 Selecting previously unselected package libosmogsm20:amd64. #6 2.837 Preparing to unpack .../05-libosmogsm20_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 2.855 Unpacking libosmogsm20:amd64 (1.10.0.12.6e1e.202409182026) ... #6 3.022 Selecting previously unselected package libosmovty13:amd64. #6 3.040 Preparing to unpack .../06-libosmovty13_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 3.058 Unpacking libosmovty13:amd64 (1.10.0.12.6e1e.202409182026) ... #6 3.203 Selecting previously unselected package libosmoabis13:amd64. #6 3.221 Preparing to unpack .../07-libosmoabis13_1.6.0.11.0d73.202409182026_amd64.deb ... #6 3.239 Unpacking libosmoabis13:amd64 (1.6.0.11.0d73.202409182026) ... #6 3.372 Selecting previously unselected package libosmo-abis-dev:amd64. #6 3.390 Preparing to unpack .../08-libosmo-abis-dev_1.6.0.11.0d73.202409182026_amd64.deb ... #6 3.408 Unpacking libosmo-abis-dev:amd64 (1.6.0.11.0d73.202409182026) ... #6 3.549 Selecting previously unselected package libosmo-gtlv1:amd64. #6 3.567 Preparing to unpack .../09-libosmo-gtlv1_0.4.0.1.c4dc.202409182026_amd64.deb ... #6 3.585 Unpacking libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202409182026) ... #6 3.730 Selecting previously unselected package libosmocoding0:amd64. #6 3.738 Preparing to unpack .../10-libosmocoding0_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 3.759 Unpacking libosmocoding0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 3.906 Selecting previously unselected package libosmogb14:amd64. #6 3.924 Preparing to unpack .../11-libosmogb14_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 3.943 Unpacking libosmogb14:amd64 (1.10.0.12.6e1e.202409182026) ... #6 4.084 Selecting previously unselected package libosmoctrl0:amd64. #6 4.102 Preparing to unpack .../12-libosmoctrl0_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 4.120 Unpacking libosmoctrl0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 4.259 Selecting previously unselected package libosmosim2:amd64. #6 4.277 Preparing to unpack .../13-libosmosim2_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 4.294 Unpacking libosmosim2:amd64 (1.10.0.12.6e1e.202409182026) ... #6 4.444 Selecting previously unselected package libosmousb0:amd64. #6 4.452 Preparing to unpack .../14-libosmousb0_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 4.469 Unpacking libosmousb0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 4.598 Selecting previously unselected package libosmocore. #6 4.617 Preparing to unpack .../15-libosmocore_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 4.634 Unpacking libosmocore (1.10.0.12.6e1e.202409182026) ... #6 4.766 Selecting previously unselected package libosmocore-dev:amd64. #6 4.774 Preparing to unpack .../16-libosmocore-dev_1.10.0.12.6e1e.202409182026_amd64.deb ... #6 4.791 Unpacking libosmocore-dev:amd64 (1.10.0.12.6e1e.202409182026) ... #6 4.972 Selecting previously unselected package libosmo-gtlv-dev:amd64. #6 4.992 Preparing to unpack .../17-libosmo-gtlv-dev_0.4.0.1.c4dc.202409182026_amd64.deb ... #6 5.010 Unpacking libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202409182026) ... #6 5.156 Selecting previously unselected package libosmonetif11:amd64. #6 5.163 Preparing to unpack .../18-libosmonetif11_1.5.1.5.89a1.202409182026_amd64.deb ... #6 5.180 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202409182026) ... #6 5.293 Selecting previously unselected package libosmo-netif-dev:amd64. #6 5.301 Preparing to unpack .../19-libosmo-netif-dev_1.5.1.5.89a1.202409182026_amd64.deb ... #6 5.318 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409182026) ... #6 5.463 Selecting previously unselected package libosmo-pfcp0:amd64. #6 5.481 Preparing to unpack .../20-libosmo-pfcp0_0.4.0.1.c4dc.202409182026_amd64.deb ... #6 5.498 Unpacking libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202409182026) ... #6 5.622 Selecting previously unselected package libosmo-pfcp-dev:amd64. #6 5.640 Preparing to unpack .../21-libosmo-pfcp-dev_0.4.0.1.c4dc.202409182026_amd64.deb ... #6 5.657 Unpacking libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202409182026) ... #6 5.817 Selecting previously unselected package libosmo-sigtran10:amd64. #6 5.826 Preparing to unpack .../22-libosmo-sigtran10_2.0.0.3.e1ad.202409182026_amd64.deb ... #6 5.842 Unpacking libosmo-sigtran10:amd64 (2.0.0.3.e1ad.202409182026) ... #6 5.970 Selecting previously unselected package libosmo-sigtran-dev:amd64. #6 5.988 Preparing to unpack .../23-libosmo-sigtran-dev_2.0.0.3.e1ad.202409182026_amd64.deb ... #6 6.004 Unpacking libosmo-sigtran-dev:amd64 (2.0.0.3.e1ad.202409182026) ... #6 6.165 Selecting previously unselected package libasn1c1:amd64. #6 6.173 Preparing to unpack .../24-libasn1c1_0.9.37.202409182026_amd64.deb ... #6 6.190 Unpacking libasn1c1:amd64 (0.9.37.202409182026) ... #6 6.311 Selecting previously unselected package libasn1c-dev:amd64. #6 6.329 Preparing to unpack .../25-libasn1c-dev_0.9.37.202409182026_amd64.deb ... #6 6.349 Unpacking libasn1c-dev:amd64 (0.9.37.202409182026) ... #6 6.489 Selecting previously unselected package libosmo-hnbap0:amd64. #6 6.508 Preparing to unpack .../26-libosmo-hnbap0_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 6.529 Unpacking libosmo-hnbap0:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 6.655 Selecting previously unselected package libosmo-hnbap-dev:amd64. #6 6.673 Preparing to unpack .../27-libosmo-hnbap-dev_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 6.690 Unpacking libosmo-hnbap-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 6.852 Selecting previously unselected package libosmo-mgcp-client14:amd64. #6 6.860 Preparing to unpack .../28-libosmo-mgcp-client14_1.13.1.202409182026_amd64.deb ... #6 6.877 Unpacking libosmo-mgcp-client14:amd64 (1.13.1.202409182026) ... #6 7.012 Selecting previously unselected package libosmo-mgcp-client-dev:amd64. #6 7.030 Preparing to unpack .../29-libosmo-mgcp-client-dev_1.13.1.202409182026_amd64.deb ... #6 7.047 Unpacking libosmo-mgcp-client-dev:amd64 (1.13.1.202409182026) ... #6 7.195 Selecting previously unselected package libosmo-ranap7:amd64. #6 7.203 Preparing to unpack .../30-libosmo-ranap7_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 7.220 Unpacking libosmo-ranap7:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 7.358 Selecting previously unselected package libosmo-ranap-dev:amd64. #6 7.366 Preparing to unpack .../31-libosmo-ranap-dev_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 7.383 Unpacking libosmo-ranap-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 7.563 Selecting previously unselected package libosmo-rua0:amd64. #6 7.571 Preparing to unpack .../32-libosmo-rua0_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 7.588 Unpacking libosmo-rua0:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 7.705 Selecting previously unselected package libosmo-rua-dev:amd64. #6 7.723 Preparing to unpack .../33-libosmo-rua-dev_1.6.0.1.4a6b5.202409182026_amd64.deb ... #6 7.744 Unpacking libosmo-rua-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 7.920 Setting up osmocom-nightly (202409182026) ... #6 7.977 Setting up libosmocore22:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.027 Setting up libosmocodec4:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.088 Setting up libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202409182026) ... #6 8.143 Setting up libasn1c1:amd64 (0.9.37.202409182026) ... #6 8.196 Setting up libosmo-hnbap0:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 8.253 Setting up libosmovty13:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.303 Setting up libosmo-rua0:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 8.358 Setting up libosmoisdn0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.407 Setting up libosmotrau10:amd64 (1.6.0.11.0d73.202409182026) ... #6 8.458 Setting up libasn1c-dev:amd64 (0.9.37.202409182026) ... #6 8.514 Setting up libosmo-rua-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 8.562 Setting up libosmousb0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.619 Setting up libosmo-mgcp-client14:amd64 (1.13.1.202409182026) ... #6 8.669 Setting up libosmogsm20:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.725 Setting up libosmoabis13:amd64 (1.6.0.11.0d73.202409182026) ... #6 8.778 Setting up libosmoctrl0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.830 Setting up libosmo-hnbap-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 8.888 Setting up libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202409182026) ... #6 8.941 Setting up libosmogb14:amd64 (1.10.0.12.6e1e.202409182026) ... #6 8.999 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202409182026) ... #6 9.050 Setting up libosmo-abis-dev:amd64 (1.6.0.11.0d73.202409182026) ... #6 9.104 Setting up libosmo-mgcp-client-dev:amd64 (1.13.1.202409182026) ... #6 9.158 Setting up libosmocoding0:amd64 (1.10.0.12.6e1e.202409182026) ... #6 9.210 Setting up libosmosim2:amd64 (1.10.0.12.6e1e.202409182026) ... #6 9.260 Setting up libosmocore (1.10.0.12.6e1e.202409182026) ... #6 9.317 Setting up libosmo-sigtran10:amd64 (2.0.0.3.e1ad.202409182026) ... #6 9.366 Setting up libosmo-ranap7:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 9.414 Setting up libosmocore-dev:amd64 (1.10.0.12.6e1e.202409182026) ... #6 9.463 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409182026) ... #6 9.511 Setting up libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202409182026) ... #6 9.559 Setting up libosmo-ranap-dev:amd64 (1.6.0.1.4a6b5.202409182026) ... #6 9.607 Setting up libosmo-sigtran-dev:amd64 (2.0.0.3.e1ad.202409182026) ... #6 9.656 Setting up libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202409182026) ... #6 9.705 Processing triggers for libc-bin (2.36-9+deb12u8) ... #6 DONE 10.0s #8 [3/8] WORKDIR /TMP #8 DONE 0.1s #9 [4/8] RUN GIT clone https://gerrit.osmocom.org/osmo-hnbgw.git #9 0.366 Cloning into 'osmo-hnbgw'... #9 DONE 0.5s #10 [5/8] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-HNBGW/+/MASTER?FORMAT=TEXT /tmp/commit-osmo-hnbgw #10 DONE 0.1s #11 [6/8] RUN CD osmo-hnbgw && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure --enable-pfcp && make "-j$(nproc)" install && ldconfig #11 0.366 Already on 'master' #11 0.366 Your branch is up to date with 'origin/master'. #11 0.368 refs/heads/master #11 0.376 HEAD is now at 30068ad contrib/jenkins: libosmo-sccp -> libosmo-sigtran #11 0.376 master #11 0.377 30068ad3912cc8306d649e1e6d5cf1b601ba471f #11 1.446 aclocal: warning: couldn't open directory 'm4': No such file or directory #11 2.544 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.544 libtoolize: copying file './ltmain.sh' #11 2.676 libtoolize: putting macros in 'm4'. #11 2.676 libtoolize: copying file 'm4/libtool.m4' #11 2.726 libtoolize: copying file 'm4/ltoptions.m4' #11 2.781 libtoolize: copying file 'm4/ltsugar.m4' #11 2.835 libtoolize: copying file 'm4/ltversion.m4' #11 2.890 libtoolize: copying file 'm4/lt~obsolete.m4' #11 2.979 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 2.979 libtoolize: and rerunning libtoolize and aclocal. #11 3.772 configure.ac:84: warning: The macro `AC_HEADER_STDC' is obsolete. #11 3.772 configure.ac:84: You should run autoupdate. #11 3.772 ./lib/autoconf/headers.m4:704: AC_HEADER_STDC is expanded from... #11 3.772 configure.ac:84: the top level #11 3.772 configure.ac:132: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.772 configure.ac:132: You should run autoupdate. #11 3.772 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.772 configure.ac:132: the top level #11 3.772 configure.ac:153: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.772 configure.ac:153: You should run autoupdate. #11 3.772 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.772 configure.ac:153: the top level #11 3.772 configure.ac:232: warning: 'AM_CONFIG_HEADER': this macro is obsolete. #11 3.772 configure.ac:232: You should use the 'AC_CONFIG_HEADERS' macro instead. #11 3.772 ./lib/autoconf/general.m4:2434: AC_DIAGNOSE is expanded from... #11 3.772 aclocal.m4:1089: AM_CONFIG_HEADER is expanded from... #11 3.772 configure.ac:232: the top level #11 3.772 configure.ac:234: warning: AC_OUTPUT should be used without arguments. #11 3.772 configure.ac:234: You should run autoupdate. #11 4.279 configure.ac:23: installing './compile' #11 4.281 configure.ac:25: installing './config.guess' #11 4.284 configure.ac:25: installing './config.sub' #11 4.287 configure.ac:9: installing './install-sh' #11 4.291 configure.ac:9: installing './missing' #11 4.339 doc/charts/Makefile.am:10: warning: '%'-style pattern rules are a GNU make extension #11 4.339 doc/charts/Makefile.am:13: warning: '%'-style pattern rules are a GNU make extension #11 4.339 doc/charts/Makefile.am:18: warning: ':='-style assignments are not portable #11 4.393 src/osmo-hnbgw/Makefile.am: installing './depcomp' #11 4.474 checking for a BSD-compatible install... /usr/bin/install -c #11 4.478 checking whether build environment is sane... yes #11 4.484 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.485 checking for gawk... gawk #11 4.485 checking whether make sets $(MAKE)... yes #11 4.492 checking whether make supports nested variables... yes #11 4.497 checking whether make supports nested variables... (cached) yes #11 4.497 checking whether make sets $(MAKE)... (cached) yes #11 4.499 checking for gcc... gcc #11 4.532 checking whether the C compiler works... yes #11 4.576 checking for C compiler default output file name... a.out #11 4.577 checking for suffix of executables... #11 4.610 checking whether we are cross compiling... no #11 4.645 checking for suffix of object files... o #11 4.665 checking whether the compiler supports GNU C... yes #11 4.687 checking whether gcc accepts -g... yes #11 4.711 checking for gcc option to enable C11 features... none needed #11 4.744 checking whether gcc understands -c and -o together... yes #11 4.761 checking whether make supports the include directive... yes (GNU style) #11 4.765 checking dependency style of gcc... gcc3 #11 4.795 checking build system type... x86_64-pc-linux-gnu #11 4.901 checking host system type... x86_64-pc-linux-gnu #11 4.901 checking how to print strings... printf #11 4.929 checking for a sed that does not truncate output... /usr/bin/sed #11 4.931 checking for grep that handles long lines and -e... /usr/bin/grep #11 4.932 checking for egrep... /usr/bin/grep -E #11 4.933 checking for fgrep... /usr/bin/grep -F #11 4.933 checking for ld used by gcc... /usr/bin/ld #11 4.936 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 4.937 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 4.938 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 4.963 checking whether ln -s works... yes #11 4.963 checking the maximum length of command line arguments... 1572864 #11 4.977 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 4.977 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 4.978 checking for /usr/bin/ld option to reload object files... -r #11 4.978 checking for file... file #11 4.979 checking for objdump... objdump #11 4.980 checking how to recognize dependent libraries... pass_all #11 4.981 checking for dlltool... no #11 4.982 checking how to associate runtime and link libraries... printf %s\n #11 4.982 checking for ar... ar #11 4.983 checking for archiver @FILE support... @ #11 5.023 checking for strip... strip #11 5.023 checking for ranlib... ranlib #11 5.024 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 5.117 checking for sysroot... no #11 5.117 checking for a working dd... /usr/bin/dd #11 5.121 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 5.152 checking for mt... no #11 5.152 checking if : is a manifest tool... no #11 5.164 checking for stdio.h... yes #11 5.194 checking for stdlib.h... yes #11 5.221 checking for string.h... yes #11 5.245 checking for inttypes.h... yes #11 5.261 checking for stdint.h... yes #11 5.278 checking for strings.h... yes #11 5.295 checking for sys/stat.h... yes #11 5.320 checking for sys/types.h... yes #11 5.337 checking for unistd.h... yes #11 5.363 checking for dlfcn.h... yes #11 5.387 checking for objdir... .libs #11 5.473 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.490 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.490 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.521 checking if gcc static flag -static works... yes #11 5.581 checking if gcc supports -c -o file.o... yes #11 5.594 checking if gcc supports -c -o file.o... (cached) yes #11 5.594 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.598 checking whether -lc should be explicitly linked in... no #11 5.622 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.699 checking how to hardcode library paths into programs... immediate #11 5.699 checking whether stripping libraries is possible... yes #11 5.701 checking if libtool supports shared libraries... yes #11 5.701 checking whether to build shared libraries... yes #11 5.701 checking whether to build static libraries... yes #11 5.702 checking for pkg-config... /usr/bin/pkg-config #11 5.702 checking for pkg-config... /usr/bin/pkg-config #11 5.703 checking pkg-config is at least version 0.20... yes #11 5.704 checking for library containing sctp_recvmsg... -lsctp #11 5.795 checking for libasn1c >= 0.9.30... yes #11 5.803 checking for libosmocore >= 1.10.0... yes #11 5.820 checking for libosmovty >= 1.10.0... yes #11 5.842 checking for libosmoctrl >= 1.10.0... yes #11 5.865 checking for libosmogsm >= 1.10.0... yes #11 5.887 checking for libosmo-netif >= 1.5.0... yes #11 5.908 checking for libosmo-sigtran >= 1.9.0... yes #11 5.926 checking for libosmo-rua >= 1.6.0... yes #11 5.944 checking for libosmo-ranap >= 1.6.0... yes #11 5.965 checking for libosmo-hnbap >= 1.6.0... yes #11 5.985 checking for libosmo-mgcp-client >= 1.13.0... yes #11 6.006 checking for libosmo-pfcp >= 0.4.0... yes #11 6.025 checking for egrep... (cached) /usr/bin/grep -E #11 6.026 checking if gcc supports -fvisibility=hidden... yes #11 6.061 checking whether to enable code coverage support... no #11 6.062 checking whether to enable VTY/CTRL tests... no #11 6.069 CFLAGS=" -std=gnu11" #11 6.069 CPPFLAGS="" #11 6.122 checking that generated files are newer than configure... done #11 6.124 configure: creating ./config.status #11 7.218 config.status: creating include/Makefile #11 7.258 config.status: creating include/osmocom/Makefile #11 7.298 config.status: creating include/osmocom/hnbgw/Makefile #11 7.337 config.status: creating src/Makefile #11 7.377 config.status: creating src/osmo-hnbgw/Makefile #11 7.418 config.status: creating tests/Makefile #11 7.457 config.status: creating tests/atlocal #11 7.497 config.status: creating tests/ranap_rab_ass/Makefile #11 7.538 config.status: creating tests/umts_cell_id/Makefile #11 7.577 config.status: creating doc/Makefile #11 7.617 config.status: creating doc/examples/Makefile #11 7.657 config.status: creating doc/manuals/Makefile #11 7.697 config.status: creating doc/charts/Makefile #11 7.736 config.status: creating contrib/Makefile #11 7.776 config.status: creating contrib/systemd/Makefile #11 7.815 config.status: creating Makefile #11 7.847 config.status: creating config.h #11 7.882 config.status: executing tests/atconfig commands #11 7.888 config.status: executing depfiles commands #11 8.286 config.status: executing libtool commands #11 8.406 echo 1.6.0.7-3006 > .version-t && mv .version-t .version #11 8.411 make install-recursive #11 8.419 make[1]: Entering directory '/tmp/osmo-hnbgw' #11 8.427 Making install in include #11 8.432 make[2]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.441 Making install in osmocom #11 8.445 make[3]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.454 Making install in hnbgw #11 8.459 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.465 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.465 make[5]: Nothing to be done for 'install-exec-am'. #11 8.465 make[5]: Nothing to be done for 'install-data-am'. #11 8.465 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.465 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.470 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.476 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.476 make[5]: Nothing to be done for 'install-exec-am'. #11 8.476 make[5]: Nothing to be done for 'install-data-am'. #11 8.476 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.476 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.477 make[3]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.482 make[3]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.488 make[4]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.488 make[4]: Nothing to be done for 'install-exec-am'. #11 8.488 make[4]: Nothing to be done for 'install-data-am'. #11 8.488 make[4]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.488 make[3]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.489 make[2]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.490 Making install in src #11 8.494 make[2]: Entering directory '/tmp/osmo-hnbgw/src' #11 8.503 Making install in osmo-hnbgw #11 8.510 make[3]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 8.512 CC osmo_hnbgw_main.o #11 8.513 CC hnbgw.lo #11 8.514 CC hnbgw_hnbap.lo #11 8.515 CC hnbgw_l3.lo #11 8.516 CC hnbgw_rua.lo #11 8.517 CC hnbgw_ranap.lo #11 8.518 CC hnbgw_vty.lo #11 8.519 CC context_map.lo #11 8.520 CC context_map_rua.lo #11 8.521 CC context_map_sccp.lo #11 8.521 CC hnbgw_cn.lo #11 8.522 CC cnlink.lo #11 8.522 CC ranap_rab_ass.lo #11 8.522 CC mgw_fsm.lo #11 8.522 CC kpi_dtap.lo #11 8.522 CC kpi_ranap.lo #11 8.523 CC tdefs.lo #11 8.523 CC nft_kpi.lo #11 8.524 CC hnbgw_pfcp.lo #11 8.524 CC ps_rab_ass_fsm.lo #11 8.641 CC ps_rab_fsm.lo #11 8.711 mgw_fsm.c: In function 'mgw_fsm_crcx_hnb_onenter': #11 8.711 mgw_fsm.c:180:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.711 180 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.711 | ^~~~~~~~ #11 8.712 In file included from /usr/include/osmocom/mgcp_client/mgcp_client_endpoint_fsm.h:4, #11 8.712 from mgw_fsm.c:48: #11 8.712 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.712 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.712 | ^~~~~~ #11 8.712 mgw_fsm.c:181:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.712 181 | mgw_info.codecs_len = 1; #11 8.712 | ^~~~~~~~ #11 8.712 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.712 35 | unsigned int codecs_len #11 8.712 | ^~~~~~~~~~ #11 8.716 mgw_fsm.c: In function 'mgw_fsm_mdcx_hnb_onenter': #11 8.716 mgw_fsm.c:368:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.716 368 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.716 | ^~~~~~~~ #11 8.716 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.716 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.716 | ^~~~~~ #11 8.716 mgw_fsm.c:369:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.716 369 | mgw_info.codecs_len = 1; #11 8.716 | ^~~~~~~~ #11 8.716 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.716 35 | unsigned int codecs_len #11 8.716 | ^~~~~~~~~~ #11 8.718 mgw_fsm.c: In function 'mgw_fsm_crcx_msc_onenter': #11 8.718 mgw_fsm.c:452:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.718 452 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.718 | ^~~~~~~~ #11 8.718 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.718 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.718 | ^~~~~~ #11 8.718 mgw_fsm.c:453:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.718 453 | mgw_info.codecs_len = 1; #11 8.718 | ^~~~~~~~ #11 8.718 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.718 35 | unsigned int codecs_len #11 8.718 | ^~~~~~~~~~ #11 8.989 CCLD libhnbgw.la #11 9.752 CCLD osmo-hnbgw #11 10.35 make[4]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 10.35 make[4]: Nothing to be done for 'install-data-am'. #11 10.35 /usr/bin/mkdir -p '/usr/local/bin' #11 10.36 /bin/bash ../../libtool --mode=install /usr/bin/install -c osmo-hnbgw '/usr/local/bin' #11 10.37 libtool: install: /usr/bin/install -c osmo-hnbgw /usr/local/bin/osmo-hnbgw #11 10.37 make[4]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 10.37 make[3]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 10.37 make[3]: Entering directory '/tmp/osmo-hnbgw/src' #11 10.38 make[4]: Entering directory '/tmp/osmo-hnbgw/src' #11 10.38 make[4]: Nothing to be done for 'install-exec-am'. #11 10.38 make[4]: Nothing to be done for 'install-data-am'. #11 10.38 make[4]: Leaving directory '/tmp/osmo-hnbgw/src' #11 10.38 make[3]: Leaving directory '/tmp/osmo-hnbgw/src' #11 10.38 make[2]: Leaving directory '/tmp/osmo-hnbgw/src' #11 10.38 Making install in tests #11 10.38 make[2]: Entering directory '/tmp/osmo-hnbgw/tests' #11 10.38 Making install in ranap_rab_ass #11 10.38 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 10.38 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 10.38 make[4]: Nothing to be done for 'install-exec-am'. #11 10.38 make[4]: Nothing to be done for 'install-data-am'. #11 10.38 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 10.38 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 10.39 Making install in umts_cell_id #11 10.39 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 10.39 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 10.39 make[4]: Nothing to be done for 'install-exec-am'. #11 10.39 make[4]: Nothing to be done for 'install-data-am'. #11 10.39 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 10.39 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 10.39 make[3]: Entering directory '/tmp/osmo-hnbgw/tests' #11 10.40 make[4]: Entering directory '/tmp/osmo-hnbgw/tests' #11 10.40 make[4]: Nothing to be done for 'install-exec-am'. #11 10.40 make[4]: Nothing to be done for 'install-data-am'. #11 10.40 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.40 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.40 make[2]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.40 Making install in doc #11 10.40 make[2]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.40 Making install in examples #11 10.41 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.42 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.42 make[4]: Nothing to be done for 'install-exec-am'. #11 10.42 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 10.42 /usr/bin/install -c -m 644 osmo-hnbgw/osmo-hnbgw.cfg '/usr/local/etc/osmocom' #11 10.43 make install-data-hook #11 10.43 make[5]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.43 for f in $(find . -name '*.cfg*' | sed -e 's,^.,,'); do \ #11 10.43 j="/usr/local/share/doc/osmo-hnbgw/examples/$f" && \ #11 10.43 mkdir -p "$(dirname $j)" && \ #11 10.43 /usr/bin/install -c -m 644 ./$f $j; \ #11 10.43 done #11 10.47 make[5]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.47 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.47 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.47 Making install in manuals #11 10.48 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.48 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.48 make[4]: Nothing to be done for 'install-exec-am'. #11 10.48 make[4]: Nothing to be done for 'install-data-am'. #11 10.48 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.48 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.48 Making install in charts #11 10.49 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.49 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.49 make[4]: Nothing to be done for 'install-exec-am'. #11 10.49 make[4]: Nothing to be done for 'install-data-am'. #11 10.49 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.49 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.50 make[3]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.50 make[4]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.50 make[4]: Nothing to be done for 'install-exec-am'. #11 10.50 make[4]: Nothing to be done for 'install-data-am'. #11 10.50 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.50 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.50 make[2]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.51 Making install in contrib #11 10.51 make[2]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.52 Making install in systemd #11 10.52 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.53 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.53 make[4]: Nothing to be done for 'install-exec-am'. #11 10.53 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.54 /usr/bin/install -c -m 644 osmo-hnbgw.service '/lib/systemd/system' #11 10.54 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.54 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.55 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.55 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.55 make[4]: Nothing to be done for 'install-exec-am'. #11 10.55 make[4]: Nothing to be done for 'install-data-am'. #11 10.55 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.55 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.55 make[2]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.56 make[2]: Entering directory '/tmp/osmo-hnbgw' #11 10.57 make[3]: Entering directory '/tmp/osmo-hnbgw' #11 10.57 make[3]: Nothing to be done for 'install-exec-am'. #11 10.57 make[3]: Nothing to be done for 'install-data-am'. #11 10.57 make[3]: Leaving directory '/tmp/osmo-hnbgw' #11 10.57 make[2]: Leaving directory '/tmp/osmo-hnbgw' #11 10.57 make[1]: Leaving directory '/tmp/osmo-hnbgw' #11 DONE 10.8s #12 [7/8] COPY OSMO-HNBGW.CFG /data/osmo-hnbgw.cfg #12 DONE 0.2s #13 [8/8] WORKDIR /DATA #13 DONE 0.1s #14 exporting to image #14 exporting layers #14 exporting layers 0.6s done #14 writing image sha256:93bca8ffee93e804531ce4448683973ebf3576e11c81ecd69cc5812b1a039b6c done #14 naming to docker.io/osmocom-build/osmo-hnbgw-master:latest 0.0s done #14 DONE 0.7s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/osmo-hnbgw-master' + docker_image_exists osmo-hnbgw-master + docker images -q osmocom-build/osmo-hnbgw-master + test -n 93bca8ffee93 + list_osmo_packages debian-bookworm osmo-hnbgw-master + local distro=debian-bookworm + local image=osmo-hnbgw-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-hnbgw-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-hnbgw-master ### ii libosmo-abis-dev:amd64 1.6.0.11.0d73.202409182026 amd64 Development headers for A-bis interface ii libosmo-gtlv-dev:amd64 0.4.0.1.c4dc.202409182026 amd64 Development files for libosmo-gtlv ii libosmo-gtlv1:amd64 0.4.0.1.c4dc.202409182026 amd64 Generic TLV and TLIV protocol support ii libosmo-hnbap-dev:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-hnbap0:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-mgcp-client-dev:amd64 1.13.1.202409182026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-mgcp-client14:amd64 1.13.1.202409182026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202409182026 amd64 Development headers for Osmocom network interface ii libosmo-pfcp-dev:amd64 0.4.0.1.c4dc.202409182026 amd64 Development files for libosmo-pfcp ii libosmo-pfcp0:amd64 0.4.0.1.c4dc.202409182026 amd64 PFCP protocol support ii libosmo-ranap-dev:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-ranap7:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua-dev:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua0:amd64 1.6.0.1.4a6b5.202409182026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-sigtran-dev:amd64 2.0.0.3.e1ad.202409182026 amd64 Development headers for the Osmocom SIGTRAN library ii libosmo-sigtran10:amd64 2.0.0.3.e1ad.202409182026 amd64 Osmocom SIGTRAN library (SCCP, SUA, M3UA and more) ii libosmoabis13:amd64 1.6.0.11.0d73.202409182026 amd64 GSM A-bis handling ii libosmocodec4:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo coding library ii libosmocore 1.10.0.12.6e1e.202409182026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.12.6e1e.202409182026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202409182026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo SIM library ii libosmotrau10:amd64 1.6.0.11.0d73.202409182026 amd64 GSM trau handling ii libosmousb0:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.12.6e1e.202409182026 amd64 Osmo VTY library ii osmocom-nightly 202409182026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends ttcn3-hnbgw-test + local feed + echo debian-bookworm-titan + depends=debian-bookworm-titan + [ -n debian-bookworm-titan ] + docker_images_require debian-bookworm-titan + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker pull registry.osmocom.org/osmocom-build/debian-bookworm-titan Using default tag: latest latest: Pulling from osmocom-build/debian-bookworm-titan Digest: sha256:bfb27fd6544bfe3e93b2db283286be3fe0ff95d87f2a4b900297eaafb305834c Status: Image is up to date for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest + continue + docker_distro_from_image_name ttcn3-hnbgw-test + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name ttcn3-hnbgw-test + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name ttcn3-hnbgw-test + echo ttcn3-hnbgw-test + dir=ttcn3-hnbgw-test + pull_arg=--pull + grep ^FROM ../ttcn3-hnbgw-test/Dockerfile + from_line=FROM $REGISTRY/$USER/debian-bookworm-titan + echo FROM $REGISTRY/$USER/debian-bookworm-titan + grep -q $USER + pull_arg= + set +x Building image: ttcn3-hnbgw-test (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../ttcn3-hnbgw-test BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/ttcn3-hnbgw-test OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/ttcn3-hnbgw-test' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/ttcn3-hnbgw-test:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 395B done #2 DONE 0.0s #3 [internal] load metadata for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest #3 DONE 0.0s #4 [1/4] FROM registry.osmocom.org/osmocom-build/debian-bookworm-titan #4 DONE 0.0s #5 [internal] load build context #5 transferring context: 3.38kB done #5 DONE 0.0s #6 https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT #6 DONE 0.1s #7 [2/4] ADD https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT /tmp/commit #7 CACHED #8 [3/4] RUN TTCN3-DOCKER-PREPARE "master" hnbgw #8 CACHED #9 [4/4] COPY HNBGW_TESTS.CFG /data/HNBGW_Tests.cfg #9 CACHED #10 exporting to image #10 exporting layers done #10 writing image sha256:7c9ca99cb9d78485d2fc58f5b78366be2839c77cc1e8791decde2b69e61979a1 0.0s done #10 naming to docker.io/osmocom-build/ttcn3-hnbgw-test:latest done #10 DONE 0.1s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/ttcn3-hnbgw-test' + docker_image_exists ttcn3-hnbgw-test + docker images -q osmocom-build/ttcn3-hnbgw-test + test -n 7c9ca99cb9d7 + list_osmo_packages debian-bookworm ttcn3-hnbgw-test + local distro=debian-bookworm + local image=ttcn3-hnbgw-test + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/ttcn3-hnbgw-test -c + [ -n ] + return + set_clean_up_trap + trap clean_up_common EXIT INT TERM 0 + set -e + VOL_BASE_DIR_PFCP=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp + network_create + SUBNET=1423833 + seq 1 30 + + bc echo (1423833 + 1) % 256 + SUBNET=218 + NET_NAME=ttcn3-hnbgw-test-218 + SUB4=172.18.218.0/24 + SUB6=fd02:db8:218::/64 + set +x Creating network ttcn3-hnbgw-test-218, trying SUBNET=218... + docker network create --internal --subnet 172.18.218.0/24 --ipv6 --subnet fd02:db8:218::/64 ttcn3-hnbgw-test-218 1554549cacad90e5e0bd83877d4f6db7ed6189884851f2443eb3147f95221297 + set +x ### Network ttcn3-hnbgw-test-218 created (SUBNET=218) ### + return + echo Testing without PFCP Testing without PFCP + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs HNBGW_Tests.cfg osmo-stp.cfg osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs + tests_cfg=HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/unix + cp HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw/unix + cp osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 218 200 + NET=218 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.200 --ip6 fd02:db8:218::200 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.200 --ip6 fd02:db8:218::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/stp:/data --name jenkins-ttcn3-hnbgw-test-io_uring-192-stp -d -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/osmo-stp-master 6504d145c5a6b3d92763e0b595dc77e6010c5839d4a81d4b434464f0bff687ba + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 218 20 + NET=218 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.20 --ip6 fd02:db8:218::20 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.20 --ip6 fd02:db8:218::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw -d -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/osmo-hnbgw-master 4c1df21e197c1b3ff67dd08047ab1a1bdeb3b8d033b3e52e64383849a7803bee + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 218 203 + NET=218 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.203 --ip6 fd02:db8:218::203 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.203 --ip6 fd02:db8:218::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.218.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-io_uring-192-ttcn3-hnbgw-test -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@4fe6ec57101e: Unix server socket created successfully. MC@4fe6ec57101e: Listening on TCP port 36985. MC2> 4fe6ec57101e is the default spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests 4fe6ec57101e 36985 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@4fe6ec57101e: New HC connected from 172.18.218.203 [172.18.218.203]. 4fe6ec57101e: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@4fe6ec57101e: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@4fe6ec57101e: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@4fe6ec57101e: Configuration file was processed on all HCs. MC@4fe6ec57101e: Creating MTC on host 172.18.218.203. MC@4fe6ec57101e: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Thu Sep 19 11:06:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(9)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(9)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(7)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(12)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(10)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(8)@4fe6ec57101e: RANAP: Received RESET-ACK in response to RESET, we're ready to go! HNBGW_Test.sgsn0-RAN(11)@4fe6ec57101e: RANAP: Received RESET-ACK in response to RESET, we're ready to go! MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(7)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register-Iuh0-RUA(5)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(3)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(8)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(11)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(13)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_hnb_register finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Thu Sep 19 11:06:57 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=145066) Waiting for packet dumper to finish... 1 (prev_count=145066, count=186851) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Thu Sep 19 11:06:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(22)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(22)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(20)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: talloc reports "struct hnb_context" x 1, expecting 1 MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate-Iuh0-RUA(16)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1(17)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(20)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1-RUA(18)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(14)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(21)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(26)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Thu Sep 19 11:07:02 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82095) Waiting for packet dumper to finish... 1 (prev_count=82095, count=139526) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Thu Sep 19 11:07:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(33)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(33)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(31)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(36)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(35)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: talloc reports "struct hnb_context" x 1, expecting 1 MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(27)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(32)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(35)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(37)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Thu Sep 19 11:07:06 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80233) Waiting for packet dumper to finish... 1 (prev_count=80233, count=137368) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Thu Sep 19 11:07:09 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(44)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(44)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(42)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(47)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(45)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@4fe6ec57101e: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") TC_hnb_disconnected_timeout-Iuh0(49)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@4fe6ec57101e: setverdict(fail): pass -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", new component reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" TC_hnb_disconnected_timeout-Iuh0(49)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@4fe6ec57101e: setverdict(fail): fail -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", component reason not changed MTC@4fe6ec57101e: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(43)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(45)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(38)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(46)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(48)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(38): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(48): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (fail -> fail) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (fail -> fail) MTC@4fe6ec57101e: Test case TC_hnb_disconnected_timeout finished. Verdict: fail reason: Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail'. Thu Sep 19 11:07:25 UTC 2024 ------ HNBGW_Tests.TC_hnb_disconnected_timeout fail ------ Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=145936) Waiting for packet dumper to finish... 1 (prev_count=145936, count=146436) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Thu Sep 19 11:07:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(57)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(57)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(55)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(60)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(58)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(56)@4fe6ec57101e: Final verdict of PTC: none TC_ue_register-Iuh0-RUA(53)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@4fe6ec57101e: Final verdict of PTC: none TC_ue_register-Iuh0(52)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(51)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(59)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(55)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(61)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_ue_register finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Thu Sep 19 11:07:30 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82703) Waiting for packet dumper to finish... 1 (prev_count=82703, count=136053) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Thu Sep 19 11:07:32 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ue_register_tmsi_lai started. MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(68)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(68)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(66)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_tmsi_lai-Iuh0-RUA(64)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(66)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@4fe6ec57101e: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(67)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(62)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(72)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Thu Sep 19 11:07:34 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82603) Waiting for packet dumper to finish... 1 (prev_count=82603, count=136024) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Thu Sep 19 11:07:37 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(79)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(79)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(77)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(82)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(80)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(81)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(78)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(77)@4fe6ec57101e: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@4fe6ec57101e: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0-RUA(75)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(73)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(81)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(83)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Thu Sep 19 11:07:39 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80140) Waiting for packet dumper to finish... 1 (prev_count=80140, count=133834) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Thu Sep 19 11:07:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(90)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(90)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(93)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(91)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: f_create_expect(l3 := '97DC9DFDFD03D0E36ED6'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: Created Expect[0] for '97DC9DFDFD03D0E36ED6'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_initial_ue0(95)5611774 HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: Found Expect[0] for l3='97DC9DFDFD03D0E36ED6'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_initial_ue0(95)6244582 HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@4fe6ec57101e: setverdict(pass): none -> pass TC_ranap_cs_initial_ue0(95)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue-Iuh0-RUA(86)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(89)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(84)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(91)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(94)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Thu Sep 19 11:07:45 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118562) Waiting for packet dumper to finish... 1 (prev_count=118562, count=157381) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Thu Sep 19 11:07:47 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(102)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(102)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(100)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(102)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(105)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: f_create_expect(l3 := 'F3528C9299BEE0EFDD2E'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: Created Expect[0] for 'F3528C9299BEE0EFDD2E'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_initial_ue0(107)13360982 HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: Found Expect[0] for l3='F3528C9299BEE0EFDD2E'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_initial_ue0(107)4481926 HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@4fe6ec57101e: setverdict(pass): none -> pass TC_ranap_ps_initial_ue0(107)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(101)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(100)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0-RUA(98)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(96)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(106)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Thu Sep 19 11:07:51 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118336) Waiting for packet dumper to finish... 1 (prev_count=118336, count=157365) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Thu Sep 19 11:07:53 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(114)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(114)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)1041975 HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)14766033 HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@4fe6ec57101e: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(112)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(108)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(113)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(118)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Thu Sep 19 11:07:57 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124271) Waiting for packet dumper to finish... 1 (prev_count=124271, count=166104) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Thu Sep 19 11:07:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(126)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(126)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(124)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)3781736 HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)1410824 HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@4fe6ec57101e: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(125)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(124)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(120)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(128)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(130)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Thu Sep 19 11:08:02 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124255) Waiting for packet dumper to finish... 1 (prev_count=124255, count=166310) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Thu Sep 19 11:08:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(138)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(138)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(141)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(139)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: f_create_expect(l3 := '4745C8686E519FF38ADE'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: Created Expect[0] for '4745C8686E519FF38ADE'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_bidir0(143)13654624 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: Found Expect[0] for l3='4745C8686E519FF38ADE'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_bidir0(143)13893728 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_bidir0(143)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: vl_len:22 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A0398F4A98008A22C31EA'O TC_ranap_cs_bidir0(143)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: vl_len:20 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(136)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(132)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0-RUA(134)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(137)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(142)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Thu Sep 19 11:08:08 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=122975) Waiting for packet dumper to finish... 1 (prev_count=122975, count=175188) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Thu Sep 19 11:08:11 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(150)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(150)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(148)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(153)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(153)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: f_create_expect(l3 := '3CDA0B5496A6AA59B254'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: Created Expect[0] for '3CDA0B5496A6AA59B254'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_bidir0(155)13304053 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: Found Expect[0] for l3='3CDA0B5496A6AA59B254'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_bidir0(155)12396143 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_bidir0(155)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A8CF01FF5490678129DF1'O TC_ranap_ps_bidir0(155)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(148)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0-RUA(146)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(151)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(144)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(154)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Thu Sep 19 11:08:15 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119818) Waiting for packet dumper to finish... 1 (prev_count=119818, count=172340) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Thu Sep 19 11:08:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(162)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(162)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: f_create_expect(l3 := '8956733E1D46A8197B18'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: Created Expect[0] for '8956733E1D46A8197B18'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@4fe6ec57101e: Added conn table entry 0TC_rab_assignment0(167)1905634 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: Found Expect[0] for l3='8956733E1D46A8197B18'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: Added conn table entry 0TC_rab_assignment0(167)14105480 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): none -> pass VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1d13e217", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1d13e217", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@4fe6ec57101e: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1d13e217", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@4fe6ec57101e: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1d13e217", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: vl_len:12 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1d13e217" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assignment-Iuh0-RUA(158)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(161)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(166)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(156)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_assignment finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Thu Sep 19 11:08:21 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119818) Waiting for packet dumper to finish... 1 (prev_count=119818, count=232198) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Thu Sep 19 11:08:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(174)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(174)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: f_create_expect(l3 := '85F73C60F5A93B6CA898'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: Created Expect[0] for '85F73C60F5A93B6CA898'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@4fe6ec57101e: Added conn table entry 0TC_rab_release0(179)4370665 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: Found Expect[0] for l3='85F73C60F5A93B6CA898'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: Added conn table entry 0TC_rab_release0(179)8963793 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "42b0e917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "42b0e917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@4fe6ec57101e: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "42b0e917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@4fe6ec57101e: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "42b0e917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: vl_len:21 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "42b0e917" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release-Iuh0-RUA(170)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(172)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@4fe6ec57101e: Final verdict of PTC: none TC_rab_release-Iuh0(169)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(174)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(178)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(168)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_release finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Thu Sep 19 11:08:27 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119773) Waiting for packet dumper to finish... 1 (prev_count=119773, count=227460) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Thu Sep 19 11:08:29 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(186)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(189)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(187)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: f_create_expect(l3 := 'C39F9CECFF285D0CD1DB'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: Created Expect[0] for 'C39F9CECFF285D0CD1DB'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@4fe6ec57101e: Added conn table entry 0TC_rab_release_abnormal0(191)1520483 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: Found Expect[0] for l3='C39F9CECFF285D0CD1DB'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: Added conn table entry 0TC_rab_release_abnormal0(191)14276805 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release_abnormal0(191)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "17336317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "17336317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@4fe6ec57101e: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "17336317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@4fe6ec57101e: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "17336317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: vl_len:21 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "17336317" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release_abnormal-Iuh0-RUA(182)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@4fe6ec57101e: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(185)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(188)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(190)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(180)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Thu Sep 19 11:08:33 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124542) Waiting for packet dumper to finish... 1 (prev_count=124542, count=231781) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Thu Sep 19 11:08:36 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(198)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: f_create_expect(l3 := 'E7268773A3AF107B6660'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: Created Expect[0] for 'E7268773A3AF107B6660'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_fail0(203)15851340 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: Found Expect[0] for l3='E7268773A3AF107B6660'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_fail0(203)15382308 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_fail0(203)@4fe6ec57101e: setverdict(pass): none -> pass VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "f1df4c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f1df4c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "f1df4c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "f1df4c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "f1df4c17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(200)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_fail-Iuh0-RUA(194)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(201)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(202)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(192)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_assign_fail finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Thu Sep 19 11:08:39 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124791) Waiting for packet dumper to finish... 1 (prev_count=124791, count=209516) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Thu Sep 19 11:08:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(210)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(213)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(211)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: f_create_expect(l3 := '5078D5D259431243728C'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: Created Expect[0] for '5078D5D259431243728C'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_mgcp_to0(215)1539113 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: Found Expect[0] for l3='5078D5D259431243728C'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_mgcp_to0(215)10873399 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Session index based on connection ID:0 TC_rab_assign_mgcp_to0(215)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "177c2917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "177c2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@4fe6ec57101e: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "177c2917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "177c2917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: vl_len:12 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(211)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(214)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0-RUA(206)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(204)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Thu Sep 19 11:08:49 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=153058) Waiting for packet dumper to finish... 1 (prev_count=153058, count=199114) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Thu Sep 19 11:08:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(222)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(222)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(225)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(223)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: f_create_expect(l3 := '4336EDE5708C3A49227A'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: Created Expect[0] for '4336EDE5708C3A49227A'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)844673 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: Found Expect[0] for l3='4336EDE5708C3A49227A'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)14712332 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): none -> pass VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ce38117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ce38117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ce38117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "ce38117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@4fe6ec57101e: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: vl_len:12 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "ce38117" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(221)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@4fe6ec57101e: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(220)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(226)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(216)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Thu Sep 19 11:08:55 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=238150) Waiting for packet dumper to finish... 1 (prev_count=238150, count=238650) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Thu Sep 19 11:08:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(234)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(234)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(237)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(235)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: f_create_expect(l3 := '93CA6A7AE88EC7678EFC'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: Created Expect[0] for '93CA6A7AE88EC7678EFC'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)3223532 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: Found Expect[0] for l3='93CA6A7AE88EC7678EFC'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)9858068 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: vl_len:22 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A2DE6BF1CC682444905EB'O TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@4fe6ec57101e: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)3223532 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)9858068 TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(228)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(233)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(236)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(232)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(238)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Thu Sep 19 11:09:07 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=189292) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Thu Sep 19 11:09:08 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(246)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(246)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(249)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(247)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: f_create_expect(l3 := '48A75D0367534BE5B73F'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: Created Expect[0] for '48A75D0367534BE5B73F'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)4970477 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: Found Expect[0] for l3='48A75D0367534BE5B73F'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)2564912 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Session index based on connection ID:0 TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: vl_len:22 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AB23D1B28FE1C69ECD7ED'O TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@4fe6ec57101e: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)4970477 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)2564912 TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(240)@4fe6ec57101e: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(245)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(249)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(250)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Thu Sep 19 11:09:17 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=149741) Waiting for packet dumper to finish... 1 (prev_count=149741, count=175739) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_without_pfcp ------ Thu Sep 19 11:09:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_ps_rab_assignment_without_pfcp started. TC_ps_rab_assignment_without_pfcp-Iuh0(253)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_ps_rab_assignment_without_pfcp-Iuh1(255)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(260)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(260)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(260)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(258)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(263)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(263)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(263)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(260)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(263)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(259)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(259)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_without_pfcp-PFCP(265)@4fe6ec57101e: PFCP_Emulation main() CLIENT_PROC.getcall(PFCPEM_register) HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: f_create_expect(l3 := 'C96CCE3D48C9F0AE7531'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: Created Expect[0] for 'C96CCE3D48C9F0AE7531'O to be handled at TC_ps_rab_assignment_without_pfcp0(266) TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@4fe6ec57101e: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)13254316 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: Found Expect[0] for l3='C96CCE3D48C9F0AE7531'O handled at TC_ps_rab_assignment_without_pfcp0(266) HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)8037720 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: vl_len:91 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: vl_len:12 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp0(266)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(262)@4fe6ec57101e: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256)@4fe6ec57101e: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(260)@4fe6ec57101e: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh0(253)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(259)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(261)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(258)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(263)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(264)@4fe6ec57101e: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1(255)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(252)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(257)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp-PFCP(265)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0(253): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1(255): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(257): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(258): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(259): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(260): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(261): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(262): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(263): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(264): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-PFCP(265): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_ps_rab_assignment_without_pfcp0(266): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_ps_rab_assignment_without_pfcp finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass'. Thu Sep 19 11:09:28 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=158428) Waiting for packet dumper to finish... 1 (prev_count=158428, count=182995) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Thu Sep 19 11:09:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(275)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(275)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(275)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(278)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(278)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(278)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(276)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(275)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(278)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(277)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(277)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)2964104 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)3670883 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)13558870 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)5914032 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(282) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)182286 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: First idle individual index:2 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(282) HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)11169318 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(282)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(282)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(283) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@4fe6ec57101e: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)9454798 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: First idle individual index:3 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(283) HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)14461430 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(283)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(283)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(277)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(279)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(274)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(276)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(275)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(278)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(272)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(273)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(267)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(267): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(272): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(273): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(274): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(275): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(276): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(277): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(278): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(279): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(282): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(283): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Thu Sep 19 11:09:37 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=215510) Waiting for packet dumper to finish... 1 (prev_count=215510, count=282797) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Thu Sep 19 11:09:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(292)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(292)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(292)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(295)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(295)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(295)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(298)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(298)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(298)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(296)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(301)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(301)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(301)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(299)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(292)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(295)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(298)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(301)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(297)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(297)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(300)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(300)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)10412206 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)7749307 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(304)2461219 HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(304)2561649 HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(304)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(304)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(305)1700335 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(305)230642 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(305)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(305)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(293)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(299)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(296)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(298)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(301)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(294)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(297)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(300)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(292)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(290)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(289)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(295)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(284)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(302)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(291)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(284): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(289): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(290): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(291): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(292): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(293): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(294): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(295): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(296): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(297): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(298): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(299): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(300): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(301): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(302): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(304): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(305): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Thu Sep 19 11:09:46 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243331) Waiting for packet dumper to finish... 1 (prev_count=243331, count=310707) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Thu Sep 19 11:09:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(314)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(314)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(314)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(317)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(317)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(317)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(320)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(320)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(320)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(318)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(323)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(323)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(323)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(321)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(314)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(317)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(320)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(323)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(319)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(319)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(322)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(322)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)10605946 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)5917606 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@4fe6ec57101e: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)13390492 HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)8293968 HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@4fe6ec57101e: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)14047093 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)15572477 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(319)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(321)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(323)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(322)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(314)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(306)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(318)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(316)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(315)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(312)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(324)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(320)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(313)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(317)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(311)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(306): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(311): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(312): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(313): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(314): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(315): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(316): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(317): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(318): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(319): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(320): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(321): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(322): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(323): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(324): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Thu Sep 19 11:09:55 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=245352) Waiting for packet dumper to finish... 1 (prev_count=245352, count=312284) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Thu Sep 19 11:09:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(336)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(336)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(336)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(339)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(339)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(339)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(342)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(342)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(342)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(340)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(345)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(345)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(345)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(343)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(336)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(339)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(342)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(345)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(341)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(341)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(344)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(344)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)6796714 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)11077235 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@4fe6ec57101e: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)5846507 HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)15854349 HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@4fe6ec57101e: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)1375998 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)8946399 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(345)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(337)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(339)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(344)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(336)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(338)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(343)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(341)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(328)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(342)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(335)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(333)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(346)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(340)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(334)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(328): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(333): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(334): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(335): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(336): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(337): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(338): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(339): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(340): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(341): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(342): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(343): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(344): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(345): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(346): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Thu Sep 19 11:10:04 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=247975) Waiting for packet dumper to finish... 1 (prev_count=247975, count=316295) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Thu Sep 19 11:10:07 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(358)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(358)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(358)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(361)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(361)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(361)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(364)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(364)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(364)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(362)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(367)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(367)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(367)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(365)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(358)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(361)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(364)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(367)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(363)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(363)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(366)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(366)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)5838904 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)445731 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)16577096 HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)16600221 HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)2038094 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)11467770 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(356)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(366)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(364)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(367)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(360)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(361)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(358)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(365)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(357)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(359)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(362)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(368)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(363)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(355)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(350)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(350): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(355): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(356): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(357): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(358): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(359): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(360): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(361): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(362): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(363): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(364): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(365): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(366): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(367): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(368): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Thu Sep 19 11:10:14 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=315121) Waiting for packet dumper to finish... 1 (prev_count=315121, count=320298) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Thu Sep 19 11:10:16 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(380)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(380)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(380)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(383)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(383)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(383)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(386)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(386)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(386)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(384)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(389)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(389)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(389)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(387)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(380)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(383)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(386)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(389)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(385)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(385)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(388)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(388)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)14059721 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)7731718 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)3378725 HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)8884301 HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)10114887 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)5449520 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(386)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(372)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(388)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(385)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(384)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(383)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(387)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(379)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(378)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(381)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(382)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(389)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(380)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(377)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(390)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(372): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(377): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(378): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(379): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(380): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(381): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(382): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(383): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(384): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(385): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(386): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(387): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(388): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(389): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(390): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@4fe6ec57Thu Sep 19 11:10:23 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc 101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=258613) Waiting for packet dumper to finish... 1 (prev_count=258613, count=328008) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Thu Sep 19 11:10:26 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(402)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(402)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(402)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(400)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(405)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(405)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(405)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(408)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(408)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(408)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(406)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(411)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(411)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(411)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(409)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(402)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(405)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(408)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(411)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(401)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(401)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(407)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(407)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(410)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(410)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)12988950 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)1564467 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)15030098 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)10674307 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)4196058 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: First idle individual index:2 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)118996 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-RAN(404)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(409)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(406)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(411)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(400)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(407)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(403)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(410)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(405)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(399)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(408)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(402)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(394)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(412)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(401)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(394): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(399): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(400): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(401): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(402): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(403): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(404): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(405): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(406): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(407): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(408): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(409): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(410): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(411): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(412): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Thu Sep 19 11:10:32 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=266717) Waiting for packet dumper to finish... 1 (prev_count=266717, count=335211) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Thu Sep 19 11:10:35 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(424)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(424)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(424)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(422)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(427)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(427)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(427)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(430)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(430)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(430)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(433)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(433)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(433)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(431)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(436)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(436)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(436)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(434)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(439)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-M3UA(439)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(439)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-SCCP(437)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(424)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(427)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(430)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(433)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(436)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(439)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(423)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(423)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(432)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(432)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(435)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(435)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(438)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(438)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)15435 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)8414552 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)15945030 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)5954664 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@4fe6ec57101e: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)15336227 HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)9864734 HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-RAN(426)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(435)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(422)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(423)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(437)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(432)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(433)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(434)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(431)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(424)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(425)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(429)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(438)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(430)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(428)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(439)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(421)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(440)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(427)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(416)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(436)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(416): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(421): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(422): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(423): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(424): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(425): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(426): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(427): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(428): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(429): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(430): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(431): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(432): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(433): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(434): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(435): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(436): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(437): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-RAN(438): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(439): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(440): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Thu Sep 19 11:10:41 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=391309) Waiting for packet dumper to finish... 1 (prev_count=391309, count=401133) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Thu Sep 19 11:10:44 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(452)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(452)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(452)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(455)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(455)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(455)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(453)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(458)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(458)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(458)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(461)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(461)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(461)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(459)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(464)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(464)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(464)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(462)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(467)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-M3UA(467)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(467)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-SCCP(465)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(452)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(455)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(458)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(461)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(464)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(467)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(454)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(454)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(460)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(460)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(463)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(463)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(466)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(466)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)11833161 HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)9933076 HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@4fe6ec57101e: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)10304394 HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)5763844 HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(460)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(450)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(459)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(457)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(462)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(454)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(463)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(451)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(456)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(466)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(453)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(464)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(458)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(461)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(444)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(455)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(452)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(467)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(468)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(449)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(465)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(444): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(449): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(450): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(451): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(452): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(453): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(454): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(455): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(456): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(457): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(458): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(459): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(460): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(461): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(462): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(463): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(464): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(465): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-RAN(466): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(467): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(468): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(469): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(470): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Thu Sep 19 11:10:49 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=348858) Waiting for packet dumper to finish... 1 (prev_count=348858, count=354005) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Thu Sep 19 11:10:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(472)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(474)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(479)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(479)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(479)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(482)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(482)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(482)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(480)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(485)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(485)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(485)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(483)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(488)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(488)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(488)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(486)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(479)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(482)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(485)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(488)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(481)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(484)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(484)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(487)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(487)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(481)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh1-RUA(475)@4fe6ec57101e: UnitdataCallback TC_mscpool_paging_imsi-Iuh0-RUA(473)@4fe6ec57101e: UnitdataCallback HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(490) TC_mscpool_paging_imsi-Iuh0-RUA(473)@4fe6ec57101e: Added conn table entry 0TC_mscpool_paging_imsi0(490)864024 HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(490) HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: Added conn table entry 0TC_mscpool_paging_imsi0(490)15101529 HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(490)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(490)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_imsi-Iuh0-RUA(473)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1-RUA(475)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(477)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(486)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(483)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(488)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(487)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(482)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(481)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(480)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(478)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(485)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(479)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(472)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(489)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(476)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(474)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(471)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(484)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(471): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(472): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(473): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(474): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(475): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(476): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(477): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(478): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(479): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(480): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(481): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(482): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(483): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(484): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(485): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(486): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(487): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(488): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(489): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_imsi0(490): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Thu Sep 19 11:10:59 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=254596) Waiting for packet dumper to finish... 1 (prev_count=254596, count=296848) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Thu Sep 19 11:11:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(492)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(494)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(499)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(499)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(499)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(502)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(502)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(502)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(500)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(505)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(505)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(505)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-SCCP(503)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(508)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(508)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(508)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(506)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(499)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(502)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(505)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(508)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(501)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(501)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(504)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(504)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(507)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(507)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(510)@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh0-RUA(493)@4fe6ec57101e: UnitdataCallback TC_mscpool_paging_tmsi-Iuh1-RUA(495)@4fe6ec57101e: UnitdataCallback TC_mscpool_paging_tmsi0(510)@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(510) TC_mscpool_paging_tmsi-Iuh0-RUA(493)@4fe6ec57101e: Added conn table entry 0TC_mscpool_paging_tmsi0(510)15961334 HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(510) HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: Added conn table entry 0TC_mscpool_paging_tmsi0(510)2816217 HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(510)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_paging_tmsi0(510)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_tmsi-Iuh0-RUA(493)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1-RUA(495)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(504)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(501)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(506)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(507)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(503)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(497)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(500)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(498)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(494)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(492)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(491)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(502)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(499)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(496)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(505)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(509)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(508)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(491): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(492): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(493): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(494): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(495): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(496): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(497): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(498): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(499): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(500): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(501): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(502): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(503): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(504): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(505): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(506): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(507): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(508): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(509): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_paging_tmsi0(510): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Thu Sep 19 11:11:08 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=237067) Waiting for packet dumper to finish... 1 (prev_count=237067, count=277647) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Thu Sep 19 11:11:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(519)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(519)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(519)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(522)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(522)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(522)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(520)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(525)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(525)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(525)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(528)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(528)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(528)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(526)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(519)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(522)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(525)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(528)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(521)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(521)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(527)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(527)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)9362362 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)308233 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(531) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@4fe6ec57101e: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(531)12754446 HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(531) HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(531)14468868 HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(531)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(531)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(532) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@4fe6ec57101e: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(532)11838976 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(532) HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(532)4632048 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(532)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(532)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-RAN(524)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(521)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(527)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(525)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(519)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(526)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(523)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(520)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(517)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(528)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(522)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(518)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(516)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(511)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(529)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(511): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(512): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(514): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(516): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(517): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(518): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(519): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(520): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(521): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(522): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(523): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(524): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(525): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(526): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(527): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(528): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(529): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(531): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(532): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Thu Sep 19 11:11:17 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=265976) Waiting for packet dumper to finish... 1 (prev_count=265976, count=333864) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Thu Sep 19 11:11:20 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(541)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(541)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(541)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(544)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(544)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(544)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(547)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(547)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(547)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(550)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(550)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(550)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(548)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(541)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(544)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(547)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(550)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(549)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(549)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)14760662 HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)9467750 HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(552)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(553) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@4fe6ec57101e: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(553)1371281 HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(553) HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(553)11359581 HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(553)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(553)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(554) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@4fe6ec57101e: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(554)16333765 HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(554) HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(554)9405226 HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(554)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(554)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(549)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(547)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(538)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(548)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(542)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(545)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(546)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(539)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(551)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(550)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(544)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(541)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(533)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(543)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(540)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(533): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(534): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(536): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(538): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(539): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(540): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(541): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(542): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(543): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(544): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(545): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(546): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(547): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(548): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(549): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(550): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(551): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(553): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(554): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Thu Sep 19 11:11:26 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=261454) Waiting for packet dumper to finish... 1 (prev_count=261454, count=328790) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Thu Sep 19 11:11:29 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(563)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(563)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(563)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(566)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(566)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(566)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(569)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(569)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(569)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(567)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(572)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(572)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(572)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(570)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(563)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(566)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(569)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(572)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(568)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(568)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(571)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(571)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)14082804 HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)14963695 HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@4fe6ec57101e: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)1508976 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)10141516 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: "disconnecting msc0" HNBGW_Test.msc0-RAN(562)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(563)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(561)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@4fe6ec57101e: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)14082804 HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)12614456 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)6048540 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(572)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(570)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(568)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(565)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(566)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(571)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(564)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(567)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(555)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(569)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(560)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(573)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(555): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(560): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(561): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(562): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(563): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(564): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(565): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(566): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(567): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(568): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(569): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(570): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(571): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(572): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(573): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Thu Sep 19 11:11:35 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=256514) Waiting for packet dumper to finish... 1 (prev_count=256514, count=315652) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Thu Sep 19 11:11:38 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(585)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(585)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(585)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(588)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(588)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(588)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(586)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(585)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(588)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(587)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(587)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)3401372 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)943327 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@4fe6ec57101e: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)13624283 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)16430108 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: "connecting cnlink 1" MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(594)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(594)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(594)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(594)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@4fe6ec57101e: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)1795450 HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)5388687 HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@4fe6ec57101e: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(587)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@4fe6ec57101e: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(584)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(582)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(586)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(593)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(585)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(594)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(583)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(592)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(588)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(589)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(577)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(577): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(582): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(583): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(584): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(585): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(586): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(587): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(588): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(589): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(592): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(593): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(594): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Thu Sep 19 11:11:45 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=232736) Waiting for packet dumper to finish... 1 (prev_count=232736, count=310666) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Thu Sep 19 11:11:48 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(604)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(604)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(604)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(602)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(607)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(607)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(607)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(604)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(607)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(603)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(603)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)71774 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)3968167 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)1853609 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)11137206 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)11592495 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)3002005 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(611)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(611)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@4fe6ec57101e: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)6579629 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)4607212 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(612)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(612)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(602)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(605)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(603)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(606)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(601)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(608)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(607)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(604)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(596)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(596): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(601): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(602): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(603): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(604): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(605): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(606): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(607): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(608): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(611): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(612): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Thu Sep 19 11:11:55 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=221368) Waiting for packet dumper to finish... 1 (prev_count=221368, count=290143) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Thu Sep 19 11:11:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(621)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(621)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(621)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(619)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(624)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(624)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(624)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(622)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(627)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(627)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(627)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(630)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(630)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(630)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(621)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(624)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(627)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(630)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(620)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(623)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(620)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(623)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)9336602 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)14708315 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(633)11793977 HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(633)1628443 HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(634)1457305 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(634)8603908 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(626)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(619)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(622)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(627)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(628)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(623)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(620)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(629)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(613)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(621)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(625)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(624)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(618)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(630)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(631)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(613): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(618): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(619): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(620): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(621): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(622): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(623): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(624): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(625): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(626): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(627): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(628): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(629): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(630): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(631): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(633): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(634): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Thu Sep 19 11:12:04 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=251308) Waiting for packet dumper to finish... 1 (prev_count=251308, count=318847) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Thu Sep 19 11:12:06 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(643)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(643)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(643)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(641)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(646)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(646)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(646)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(644)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(649)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(649)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(649)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(647)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(652)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(652)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(652)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(643)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(646)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(649)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(652)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(642)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(642)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(645)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(645)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(648)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(648)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)7916728 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)13109932 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(655) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)7749710 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(655) HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)12162751 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(655)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(655)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(656) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)9587132 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(656) HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)11535439 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(656)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(656)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(648)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(646)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(651)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(650)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(645)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(644)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(640)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(642)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(643)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(641)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(649)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(647)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(635)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(652)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(653)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(635): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(640): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(641): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(642): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(643): none (pass -> pass)Thu Sep 19 11:12:13 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(644): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(645): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(646): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(647): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(648): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(649): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(650): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(651): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(652): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(653): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(655): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(656): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=314251) Waiting for packet dumper to finish... 1 (prev_count=314251, count=325667) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Thu Sep 19 11:12:16 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(665)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(665)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(665)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(663)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(668)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(668)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(668)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(666)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(671)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(671)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(671)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-SCCP(669)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(674)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(674)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(674)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(672)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(677)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(677)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(677)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(680)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-M3UA(680)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(680)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(665)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(668)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(671)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(674)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(677)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(680)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(664)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(664)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(667)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(667)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(670)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(670)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(673)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(673)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)10378986 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)11249667 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(683) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)8550931 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(683) HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)10470245 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(683)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(683)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(684) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(684)2329889 HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(684) HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(684)591256 HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(684)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(684)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(676)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(673)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(667)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(672)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(675)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(678)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(664)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(677)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(666)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(663)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(668)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(670)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(680)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(669)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(674)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(657)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(681)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(665)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(662)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(679)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(671)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(657): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(662): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(663): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(664): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(665): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(666): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(667): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(668): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(669): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(670): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(671): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(672): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(673): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(674): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(675): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(676): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(677): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(678): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-RAN(679): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(680): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(681): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(683): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(684): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Thu Sep 19 11:12:22 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=387807) Waiting for packet dumper to finish... 1 (prev_count=387807, count=397643) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Thu Sep 19 11:12:25 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(693)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(693)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(693)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(691)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(696)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(696)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(696)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(694)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(699)@4fe6ec57101e: ************************************************* HNBGW_Test.msc2-M3UA(699)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(699)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(697)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(702)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(702)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(702)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(705)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(705)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(705)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(703)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(708)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-M3UA(708)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(708)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(693)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(696)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(699)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(702)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(705)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(708)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(692)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(692)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(695)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(695)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(698)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(698)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(704)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(704)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@4fe6ec57101e: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(710) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)11293855 HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(710) HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)10927330 HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: Session index based on connection ID:0 TC_sgsnpool_nri_from_other_PLMN0(710)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(710)@4fe6ec57101e: Final verdict of PTC: pass HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(711) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(711)4217510 HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(711) HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(711)2702232 HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(711)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(711)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(695)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(692)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(702)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(700)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(685)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(693)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(691)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(703)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(699)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(696)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(705)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(690)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(697)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(694)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc2-RAN(698)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(704)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(701)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(707)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(708)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(706)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(709)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(685): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(686): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(688): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(690): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(691): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(692): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(693): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(694): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(695): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(696): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-SCCP(697): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-RAN(698): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc2-M3UA(699): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(700): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(701): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(702): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(703): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(704): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(705): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(706): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-RAN(707): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(708): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(709): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(710): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(711): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Thu Sep 19 11:12:31 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=354383) Waiting for packet dumper to finish... 1 (prev_count=354383, count=359539) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Thu Sep 19 11:12:34 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(720)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(720)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(720)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(718)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(723)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-M3UA(723)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(723)@4fe6ec57101e: ************************************************* HNBGW_Test.msc1-SCCP(721)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(726)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(726)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(726)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(729)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(729)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(729)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(720)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(723)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(726)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(729)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(719)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(722)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(722)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(719)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)13906789 HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)6233256 HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)5499661 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)5783565 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(725)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(726)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(724)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@4fe6ec57101e: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)13906789 HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)10044149 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)3948377 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(720)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(729)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(717)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(718)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(721)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(727)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-RAN(722)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(712)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(723)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(730)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(719)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(728)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(712): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(717): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(718): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(719): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(720): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-SCCP(721): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-RAN(722): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc1-M3UA(723): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(724): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(725): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(726): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(727): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(728): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(729): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(730): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Thu Sep 19 11:12:40 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=282492) Waiting for packet dumper to finish... 1 (prev_count=282492, count=342376) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Thu Sep 19 11:12:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(742)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(742)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(742)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(740)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(745)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(745)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(745)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(742)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(745)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(741)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(741)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)6075174 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)12925979 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)4294896 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)8672267 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: "connecting cnlink 1" MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(751)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-M3UA(751)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(751)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(751)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 MTC@4fe6ec57101e: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@4fe6ec57101e: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)10311711 HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)11137655 HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@4fe6ec57101e: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-RAN(750)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(751)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(744)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(749)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(741)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(743)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(734)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(740)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@4fe6ec57101e: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(742)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(745)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(739)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(746)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(734): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(739): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(740): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(741): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(742): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(743): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(744): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(745): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(746): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748): pass (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(749): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-RAN(750): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(751): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Thu Sep 19 11:12:50 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=253662) Waiting for packet dumper to finish... 1 (prev_count=253662, count=331709) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Thu Sep 19 11:12:53 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(754)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(759)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(759)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(759)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(762)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(762)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(762)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(760)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(759)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(762)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(761)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(761)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(763)@4fe6ec57101e: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: f_create_expect(l3 := '65E6558585899C0C608D'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: Created Expect[0] for '65E6558585899C0C608D'O to be handled at TC_second_rab_assignment0(764) TC_second_rab_assignment-Iuh0-RUA(755)@4fe6ec57101e: Added conn table entry 0TC_second_rab_assignment0(764)3004439 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: Found Expect[0] for l3='65E6558585899C0C608D'O handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: Added conn table entry 0TC_second_rab_assignment0(764)13277520 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_len:91 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(763)@4fe6ec57101e: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2dd81717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(764) TC_second_rab_assignment0(764)@4fe6ec57101e: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2dd81717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@4fe6ec57101e: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2dd81717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@4fe6ec57101e: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2dd81717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_len:63 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_len:12 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@4fe6ec57101e: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(764)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(764)@4fe6ec57101e: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "2dd81717" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_second_rab_assignment-Iuh0-RUA(755)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(757)@4fe6ec57101e: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(754)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(761)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(763)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(758)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(756)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(760)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(762)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(759)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(753)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(753): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_second_rab_assignment-Iuh0(754): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(755): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(756): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(757): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(758): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(759): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(760): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(761): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(762): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(763): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_second_rab_assignment0(764): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_second_rab_assignment finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Thu Sep 19 11:12:56 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=230734) Waiting for packet dumper to finish... 1 (prev_count=230734, count=231234) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Thu Sep 19 11:12:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(771)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(771)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(771)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-SCCP(769)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(774)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(774)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(774)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(772)@4fe6ec57101e: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(771)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(774)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(770)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(770)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(773)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(773)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: talloc reports "struct hnb_context" x 1, expecting 1 MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(770)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(769)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(773)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(768)@4fe6ec57101e: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(765)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(772)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(774)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(771)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(775)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(765): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(768): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(769): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(770): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(771): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(772): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(773): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(774): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(775): none (pass -> pass) MTC@4fe6ec57101e: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Thu Sep 19 11:13:01 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=91073) Waiting for packet dumper to finish... 1 (prev_count=91073, count=150581) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Thu Sep 19 11:13:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@4fe6ec57101e: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(777)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(779)@4fe6ec57101e: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(784)@4fe6ec57101e: ************************************************* HNBGW_Test.msc0-M3UA(784)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(784)@4fe6ec57101e: ************************************************* MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@4fe6ec57101e: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(787)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-M3UA(787)@4fe6ec57101e: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(787)@4fe6ec57101e: ************************************************* HNBGW_Test.sgsn0-SCCP(785)@4fe6ec57101e: v_sccp_pdu_maxlen:268 MTC@4fe6ec57101e: setverdict(pass): none -> pass MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(784)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(787)@4fe6ec57101e: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(786)@4fe6ec57101e: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(786)@4fe6ec57101e: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(789) TC_apply_sccp-Iuh0-RUA(778)@4fe6ec57101e: Added conn table entry 0TC_apply_sccp0(789)13945029 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: First idle individual index:0 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(789) HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: Added conn table entry 0TC_apply_sccp0(789)10041533 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(789)@4fe6ec57101e: setverdict(pass): none -> pass TC_apply_sccp0(789)@4fe6ec57101e: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(789)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: vl_len:22 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: vl_from0 HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A747A275432B0AE929EFB'O TC_apply_sccp0(789)@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(789)@4fe6ec57101e: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Session index based on local reference:0 HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: Deleted conn table entry 0TC_apply_sccp0(789)10041533 TC_apply_sccp-Iuh0-RUA(778)@4fe6ec57101e: Deleted conn table entry 0TC_apply_sccp0(789)13945029 TC_apply_sccp0(789)@4fe6ec57101e: Final verdict of PTC: pass MTC@4fe6ec57101e: ok: talloc reports "asn1_context" = 1 bytes TC_apply_sccp-Iuh0-RUA(778)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(784)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(782)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.msc0-RAN(783)@4fe6ec57101e: Final verdict of PTC: none TC_apply_sccp-Iuh1-RUA(780)@4fe6ec57101e: Final verdict of PTC: none VirtHNBGW-STATS(776)@4fe6ec57101e: Final verdict of PTC: none TC_apply_sccp-Iuh0(777)@4fe6ec57101e: Final verdict of PTC: none TC_apply_sccp-Iuh1(779)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(787)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(785)@4fe6ec57101e: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(786)@4fe6ec57101e: Final verdict of PTC: none HNBGW-MGCP(788)@4fe6ec57101e: Final verdict of PTC: none IPA-CTRL-CLI-IPA(781)@4fe6ec57101e: Final verdict of PTC: none MTC@4fe6ec57101e: setverdict(pass): pass -> pass, component reason not changed MTC@4fe6ec57101e: Setting final verdict of the test case. MTC@4fe6ec57101e: Local verdict of MTC: pass MTC@4fe6ec57101e: Local verdict of PTC VirtHNBGW-STATS(776): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_apply_sccp-Iuh0(777): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(778): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_apply_sccp-Iuh1(779): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(780): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC IPA-CTRL-CLI-IPA(781): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-SCCP(782): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-RAN(783): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.msc0-M3UA(784): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(785): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-RAN(786): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(787): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC HNBGW-MGCP(788): none (pass -> pass) MTC@4fe6ec57101e: Local verdict of PTC TC_apply_sccp0(789): pass (pass -> pass) MTC@4fe6ec57101e: Test case TC_apply_sccp finished. Verdict: pass MTC@4fe6ec57101e: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Thu Sep 19 11:13:12 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=179995) Waiting for packet dumper to finish... 1 (prev_count=179995, count=204100) MTC@4fe6ec57101e: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@4fe6ec57101e: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@4fe6ec57101e: Terminating MTC. MC@4fe6ec57101e: MTC terminated. MC2> exit MC@4fe6ec57101e: Shutting down session. MC@4fe6ec57101e: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-21.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: FAIL HNBGW_Tests.TC_hnb_disconnected_timeout Summary: NEW: FAIL: 1 pass: 47 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-io_uring-192-stp + docker kill jenkins-ttcn3-hnbgw-test-io_uring-192-stp jenkins-ttcn3-hnbgw-test-io_uring-192-stp + docker wait jenkins-ttcn3-hnbgw-test-io_uring-192-stp 137 + echo Testing with PFCP Testing with PFCP + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp with-pfcp/HNBGW_Tests.cfg osmo-stp.cfg with-pfcp/osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp + tests_cfg=with-pfcp/HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=with-pfcp/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/unix + cp with-pfcp/HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw/unix + cp with-pfcp/osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/stp/osmo-stp.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=218 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 218 200 + NET=218 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.200 --ip6 fd02:db8:218::200 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.200 --ip6 fd02:db8:218::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/stp:/data --name jenkins-ttcn3-hnbgw-test-io_uring-192-stp -d -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/osmo-stp-master db3e2535f08730661895334647ff5b7e9391f7ee47280d4068234a34bd11388d + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 218 20 + NET=218 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.20 --ip6 fd02:db8:218::20 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.20 --ip6 fd02:db8:218::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw -d -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/osmo-hnbgw-master a5b103bcf80d9a9c252d7ebbc0e76e5cdf806238fea26344a639decbd966f9e5 + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 218 203 + NET=218 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-218 --ip 172.18.218.203 --ip6 fd02:db8:218::203 + docker run --rm --network ttcn3-hnbgw-test-218 --ip 172.18.218.203 --ip6 fd02:db8:218::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.218.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-io_uring-192-ttcn3-hnbgw-test -e LIBOSMO_IO_BACKEND=IO_URING --ulimit memlock=-1 --security-opt seccomp=../seccomp_profile.json osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@84274d8e1724: Unix server socket created successfully. MC@84274d8e1724: Listening on TCP port 39349. 84274d8e1724 is the default MC2> spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests 84274d8e1724 39349 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@84274d8e1724: New HC connected from 172.18.218.203 [172.18.218.203]. 84274d8e1724: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@84274d8e1724: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@84274d8e1724: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@84274d8e1724: Configuration file was processed on all HCs. MC@84274d8e1724: Creating MTC on host 172.18.218.203. MC@84274d8e1724: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Thu Sep 19 11:13:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(9)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(9)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(7)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(12)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(10)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(8)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(7)@84274d8e1724: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(11)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(3)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@84274d8e1724: Final verdict of PTC: none TC_hnb_register-Iuh0-RUA(5)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(13)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@84274d8e1724: Test case TC_hnb_register finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Thu Sep 19 11:13:20 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=123404) Waiting for packet dumper to finish... 1 (prev_count=123404, count=151946) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Thu Sep 19 11:13:22 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(22)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(22)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(20)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: talloc reports "struct hnb_context" x 1, expecting 1 MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate-Iuh1(17)@84274d8e1724: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0-RUA(16)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@84274d8e1724: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1-RUA(18)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(14)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@84274d8e1724: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(21)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(20)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(26)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@84274d8e1724: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Thu Sep 19 11:13:24 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82720) Waiting for packet dumper to finish... 1 (prev_count=82720, count=141206) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Thu Sep 19 11:13:27 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(33)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(33)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(31)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(36)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(35)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: talloc reports "struct hnb_context" x 1, expecting 1 MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(32)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@84274d8e1724: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(27)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(35)@84274d8e1724: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(37)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@84274d8e1724: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Thu Sep 19 11:13:29 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=81645) Waiting for packet dumper to finish... 1 (prev_count=81645, count=139364) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Thu Sep 19 11:13:32 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(44)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(44)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(42)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(47)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(45)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@84274d8e1724: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@84274d8e1724: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@84274d8e1724: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@84274d8e1724: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_hnb_disconnected_timeout-Iuh0(49)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@84274d8e1724: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@84274d8e1724: setverdict(fail): pass -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", new component reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" TC_hnb_disconnected_timeout-Iuh0(49)@84274d8e1724: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@84274d8e1724: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@84274d8e1724: setverdict(fail): fail -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", component reason not changed MTC@84274d8e1724: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@84274d8e1724: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(43)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(46)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(38)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(45)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(48)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(38): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(48): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (fail -> fail) MTC@84274d8e1724: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (fail -> fail) MTC@84274d8e1724: Test case TC_hnb_disconnected_timeout finished. Verdict: fail reason: Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail'. Thu Sep 19 11:13:48 UTC 2024 ------ HNBGW_Tests.TC_hnb_disconnected_timeout fail ------ Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=149923) Waiting for packet dumper to finish... 1 (prev_count=149923, count=150515) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Thu Sep 19 11:13:51 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(57)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(57)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(55)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(60)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(58)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(59)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@84274d8e1724: Final verdict of PTC: none TC_ue_register-Iuh0(52)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(51)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(61)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@84274d8e1724: Final verdict of PTC: none TC_ue_register-Iuh0-RUA(53)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(56)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(55)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@84274d8e1724: Test case TC_ue_register finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Thu Sep 19 11:13:53 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=84839) Waiting for packet dumper to finish... 1 (prev_count=84839, count=139689) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Thu Sep 19 11:13:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ue_register_tmsi_lai started. MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(68)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(68)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(66)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(67)@84274d8e1724: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0-RUA(64)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(66)@84274d8e1724: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(62)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(72)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@84274d8e1724: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Thu Sep 19 11:13:57 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=83376) Waiting for packet dumper to finish... 1 (prev_count=83376, count=137676) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Thu Sep 19 11:14:00 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(79)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(79)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(77)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(82)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(80)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(81)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(77)@84274d8e1724: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0-RUA(75)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(73)@84274d8e1724: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(83)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(81)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(78)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@84274d8e1724: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Thu Sep 19 11:14:02 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80140) Waiting for packet dumper to finish... 1 (prev_count=80140, count=136213) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Thu Sep 19 11:14:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(90)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(90)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(88)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(93)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(91)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@84274d8e1724: f_create_expect(l3 := '137FA2EC2FDBC4A0E66D'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@84274d8e1724: Created Expect[0] for '137FA2EC2FDBC4A0E66D'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@84274d8e1724: Added conn table entry 0TC_ranap_cs_initial_ue0(95)5311567 HNBGW_Test.msc0-SCCP(88)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@84274d8e1724: Found Expect[0] for l3='137FA2EC2FDBC4A0E66D'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@84274d8e1724: Added conn table entry 0TC_ranap_cs_initial_ue0(95)16679461 HNBGW_Test.msc0-SCCP(88)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(88)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@84274d8e1724: setverdict(pass): none -> pass TC_ranap_cs_initial_ue0(95)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(91)@84274d8e1724: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0-RUA(86)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(89)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(84)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(94)@84274d8e1724: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Thu Sep 19 11:14:08 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120366) Waiting for packet dumper to finish... 1 (prev_count=120366, count=158704) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Thu Sep 19 11:14:11 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(102)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(102)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(100)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.sgsn0-M3UA(105)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-M3UA(102)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: f_create_expect(l3 := 'F182349694DE531E168C'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: Created Expect[0] for 'F182349694DE531E168C'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@84274d8e1724: Added conn table entry 0TC_ranap_ps_initial_ue0(107)14967359 HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: Found Expect[0] for l3='F182349694DE531E168C'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: Added conn table entry 0TC_ranap_ps_initial_ue0(107)14232935 HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: Session index based on connection ID:0 TC_ranap_ps_initial_ue0(107)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(100)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(101)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0-RUA(98)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(96)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(106)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Thu Sep 19 11:14:14 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118869) Waiting for packet dumper to finish... 1 (prev_count=118869, count=157417) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Thu Sep 19 11:14:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(114)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(114)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(112)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@84274d8e1724: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@84274d8e1724: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@84274d8e1724: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)12279284 HNBGW_Test.msc0-SCCP(112)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@84274d8e1724: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@84274d8e1724: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)1128242 HNBGW_Test.msc0-SCCP(112)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@84274d8e1724: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(112)@84274d8e1724: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(108)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(113)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(118)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Thu Sep 19 11:14:20 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126308) Waiting for packet dumper to finish... 1 (prev_count=126308, count=167585) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Thu Sep 19 11:14:22 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(126)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(126)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(124)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@84274d8e1724: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)1481173 HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)10094946 HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@84274d8e1724: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(124)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(125)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(128)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(120)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(130)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Thu Sep 19 11:14:26 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126151) Waiting for packet dumper to finish... 1 (prev_count=126151, count=167541) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Thu Sep 19 11:14:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(138)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(138)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(136)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(141)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(139)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@84274d8e1724: f_create_expect(l3 := '8D5C1D275CD4EB56A0DF'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@84274d8e1724: Created Expect[0] for '8D5C1D275CD4EB56A0DF'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@84274d8e1724: Added conn table entry 0TC_ranap_cs_bidir0(143)14178996 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@84274d8e1724: Found Expect[0] for l3='8D5C1D275CD4EB56A0DF'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@84274d8e1724: Added conn table entry 0TC_ranap_cs_bidir0(143)5993515 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_bidir0(143)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: vl_len:22 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A9D230545FA6EF9F88E38'O TC_ranap_cs_bidir0(143)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: vl_len:20 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(136)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_bidir-Iuh0-RUA(134)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(136)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@84274d8e1724: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(137)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(132)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(142)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Thu Sep 19 11:14:32 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=123600) Waiting for packet dumper to finish... 1 (prev_count=123600, count=175460) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Thu Sep 19 11:14:34 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(150)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(150)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(148)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(153)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(153)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: f_create_expect(l3 := '270CC1D7278C75C6908F'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: Created Expect[0] for '270CC1D7278C75C6908F'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@84274d8e1724: Added conn table entry 0TC_ranap_ps_bidir0(155)3986320 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: Found Expect[0] for l3='270CC1D7278C75C6908F'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: Added conn table entry 0TC_ranap_ps_bidir0(155)6338202 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_bidir0(155)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: data sent by MTP3_SCCP_PORT: '001440120000010010400B0ABF4062D52D7AC81814E0'O TC_ranap_ps_bidir0(155)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(151)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(144)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(148)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0-RUA(146)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(154)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Thu Sep 19 11:14:38 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=121470) Waiting for packet dumper to finish... 1 (prev_count=121470, count=170667) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Thu Sep 19 11:14:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(162)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(162)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(160)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@84274d8e1724: f_create_expect(l3 := '1C8D238FB4AF00E866B7'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@84274d8e1724: Created Expect[0] for '1C8D238FB4AF00E866B7'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@84274d8e1724: Added conn table entry 0TC_rab_assignment0(167)13899155 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@84274d8e1724: Found Expect[0] for l3='1C8D238FB4AF00E866B7'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@84274d8e1724: Added conn table entry 0TC_rab_assignment0(167)13811404 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): none -> pass VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d4159317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d4159317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@84274d8e1724: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d4159317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@84274d8e1724: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d4159317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: vl_len:12 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d4159317" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assignment-Iuh0-RUA(158)@84274d8e1724: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(161)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(166)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(156)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_assignment finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Thu Sep 19 11:14:44 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124233) Waiting for packet dumper to finish... 1 (prev_count=124233, count=237640) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Thu Sep 19 11:14:47 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(174)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(174)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(172)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@84274d8e1724: f_create_expect(l3 := '95AB6CB795EAE916EDD2'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@84274d8e1724: Created Expect[0] for '95AB6CB795EAE916EDD2'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@84274d8e1724: Added conn table entry 0TC_rab_release0(179)1963286 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@84274d8e1724: Found Expect[0] for l3='95AB6CB795EAE916EDD2'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@84274d8e1724: Added conn table entry 0TC_rab_release0(179)8452205 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1df51617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1df51617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@84274d8e1724: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1df51617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@84274d8e1724: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "1df51617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: vl_len:21 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(172)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "1df51617" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(172)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@84274d8e1724: Final verdict of PTC: none TC_rab_release-Iuh0-RUA(170)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@84274d8e1724: Final verdict of PTC: none TC_rab_release-Iuh0(169)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(174)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(178)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(168)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_release finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Thu Sep 19 11:14:50 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=227545) Waiting for packet dumper to finish... 1 (prev_count=227545, count=229606) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Thu Sep 19 11:14:53 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(186)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(184)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(189)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(187)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@84274d8e1724: f_create_expect(l3 := 'E162E48FA394E10A92E3'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@84274d8e1724: Created Expect[0] for 'E162E48FA394E10A92E3'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@84274d8e1724: Added conn table entry 0TC_rab_release_abnormal0(191)4198393 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@84274d8e1724: Found Expect[0] for l3='E162E48FA394E10A92E3'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@84274d8e1724: Added conn table entry 0TC_rab_release_abnormal0(191)4528452 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release_abnormal0(191)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "400ff917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "400ff917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@84274d8e1724: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "400ff917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@84274d8e1724: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "400ff917", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: vl_len:21 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(184)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "400ff917" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(188)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@84274d8e1724: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(185)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@84274d8e1724: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0-RUA(182)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(190)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(180)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Thu Sep 19 11:14:56 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=233913) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Thu Sep 19 11:14:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(198)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(196)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@84274d8e1724: f_create_expect(l3 := '8B80A7F2BEDFC263A12A'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@84274d8e1724: Created Expect[0] for '8B80A7F2BEDFC263A12A'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@84274d8e1724: Added conn table entry 0TC_rab_assign_fail0(203)3032984 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@84274d8e1724: Found Expect[0] for l3='8B80A7F2BEDFC263A12A'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@84274d8e1724: Added conn table entry 0TC_rab_assign_fail0(203)3072902 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_fail0(203)@84274d8e1724: setverdict(pass): none -> pass VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2e479817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2e479817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2e479817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2e479817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "2e479817" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_fail-Iuh0-RUA(194)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@84274d8e1724: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(201)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(200)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(202)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(192)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_assign_fail finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Thu Sep 19 11:15:01 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124726) Waiting for packet dumper to finish... 1 (prev_count=124726, count=211204) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Thu Sep 19 11:15:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(210)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(208)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(213)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(211)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@84274d8e1724: f_create_expect(l3 := 'B5171C06EF2702A8C39D'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@84274d8e1724: Created Expect[0] for 'B5171C06EF2702A8C39D'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@84274d8e1724: Added conn table entry 0TC_rab_assign_mgcp_to0(215)8563486 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@84274d8e1724: Found Expect[0] for l3='B5171C06EF2702A8C39D'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@84274d8e1724: Added conn table entry 0TC_rab_assign_mgcp_to0(215)11768435 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgcp_to0(215)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "82ab1e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "82ab1e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@84274d8e1724: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "82ab1e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "82ab1e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: vl_len:12 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(211)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(204)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@84274d8e1724: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0-RUA(206)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@84274d8e1724: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(214)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Thu Sep 19 11:15:11 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=153907) Waiting for packet dumper to finish... 1 (prev_count=153907, count=200700) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Thu Sep 19 11:15:14 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(222)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(222)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(220)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(225)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(223)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@84274d8e1724: f_create_expect(l3 := '1937325741113A585C57'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@84274d8e1724: Created Expect[0] for '1937325741113A585C57'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@84274d8e1724: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)7362215 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@84274d8e1724: Found Expect[0] for l3='1937325741113A585C57'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@84274d8e1724: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)2387945 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): none -> pass VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "7056a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "7056a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "7056a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "7056a717", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@84274d8e1724: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: vl_len:12 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "7056a717" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@84274d8e1724: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(221)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(220)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(226)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(216)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@84274d8e1724: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Thu Sep 19 11:15:18 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120275) Waiting for packet dumper to finish... 1 (prev_count=120275, count=239937) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Thu Sep 19 11:15:20 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(234)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(234)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(232)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(237)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(235)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@84274d8e1724: f_create_expect(l3 := '371A9535422807A65138'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@84274d8e1724: Created Expect[0] for '371A9535422807A65138'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@84274d8e1724: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)15380780 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@84274d8e1724: Found Expect[0] for l3='371A9535422807A65138'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@84274d8e1724: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)1063917 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Session index based on connection ID:0 TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: vl_len:22 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A7C70B15BE35F42C22A80'O TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@84274d8e1724: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)15380780 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@84274d8e1724: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)1063917 TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(232)@84274d8e1724: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(236)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(238)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(233)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(228)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Thu Sep 19 11:15:29 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=166296) Waiting for packet dumper to finish... 1 (prev_count=166296, count=192974) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Thu Sep 19 11:15:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(246)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(246)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(244)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(249)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(247)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@84274d8e1724: f_create_expect(l3 := '0664B065B4E01B7D2E84'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@84274d8e1724: Created Expect[0] for '0664B065B4E01B7D2E84'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@84274d8e1724: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)3860078 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@84274d8e1724: Found Expect[0] for l3='0664B065B4E01B7D2E84'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@84274d8e1724: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)4663983 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Session index based on connection ID:0 TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: vl_len:22 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AEB427DB46D03B5AC966A'O TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@84274d8e1724: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)3860078 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@84274d8e1724: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)4663983 TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(245)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@84274d8e1724: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(240)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(249)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(250)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Thu Sep 19 11:15:40 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=151041) Waiting for packet dumper to finish... 1 (prev_count=151041, count=176558) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_with_pfcp ------ Thu Sep 19 11:15:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_ps_rab_assignment_with_pfcp started. TC_ps_rab_assignment_with_pfcp-Iuh0(253)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(258)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(258)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(258)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(256)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(261)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(261)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(261)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(258)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(261)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(257)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(257)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() CLIENT_PROC.getcall(PFCPEM_register) TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.218.20", remote_port := 8805 }, pdu := { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 5, lengthIndicator := 26, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC12DA14'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 4, time_value := 3935733197 }, up_function_features := omit, cp_function_features := { elementIdentifier := 89, lengthIndicator := 1, features := '10'O }, UP_IP_resource_list := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := omit, pfcp_msg_sequence_number := omit } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): none -> pass TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 0, time_value := 1234 }, up_function_features := omit, cp_function_features := omit, UP_IP_resource_list := omit } } } HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: f_create_expect(l3 := 'D71B553AD9467BCBC90A'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: Created Expect[0] for 'D71B553AD9467BCBC90A'O to be handled at TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@84274d8e1724: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)14028249 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: Found Expect[0] for l3='D71B553AD9467BCBC90A'O handled at TC_ps_rab_assignment_with_pfcp0(264) HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)138755 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: vl_len:91 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '0000030025006C000400000002002C0002020000040013002A0001010054000A0100101010107F000001'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.218.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 50, lengthIndicator := 187, seid := '0000000000000000'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC12DA14'O }, CP_F_SEID := { elementIdentifier := 57, lengthIndicator := 13, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '0000000000000001'O, ipv4_address := 'AC12DA14'O, ipv6_address := omit }, create_PDR_list := { { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 1, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } }, { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 0, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 2 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } } }, create_FAR_list := { { elementIdentifier := 3, lengthIndicator := 14, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '1'B, forw := '0'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint_list := omit, pdn_type := omit, node_list := omit, up_inactivity_timer := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := omit, pfcp_msg_sequence_number := 10 } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_ie := omit, UP_F_SEID := { elementIdentifier := 57, lengthIndicator := 0, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '1111111111111111'O, ipv4_address := '7F000001'O, ipv6_address := omit }, created_PDR_list := { { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '22002200'O, ipv4_address := '7F000002'O, ipv6_address := omit, choose_id := omit } } }, { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '30303030'O ("0000"), ipv4_address := '7F000003'O, ipv6_address := omit, choose_id := omit } } } }, load_control_information := omit, overload_control_information := omit, node_list := omit, failed_rule_id := omit, created_traffic_endpoint_list := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '00000B000E0054000A0100440044007F000004'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.218.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 52, lengthIndicator := 48, seid := '1111111111111111'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_request := { f_seid := omit, remove_PDR_list := omit, remove_FAR_list := omit, remove_URR_list := omit, remove_QER_list := omit, remove_BAR := omit, remove_traffic_endpoint := omit, create_PDR_list := omit, create_FAR_list := omit, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint := omit, update_PDR_list := omit, update_FAR_list := { { elementIdentifier := 10, lengthIndicator := 32, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '0'B, forw := '1'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, update_URR_list := omit, update_QER_list := omit, update_BAR := omit, update_traffic_endpoint := omit, pfcpSMReq_flags := omit, query_URR_list := omit, node_list := omit, up_inactivity_timer := omit, querry_urr_reference := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := '0000000000000001'O, pfcp_msg_sequence_number := 11 } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, created_PDR := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit, failed_rule_id := omit, additional_usage_reports_information := omit, created_updated_traffic_endpoint := omit } } } HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: vl_len:12 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.218.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 54, lengthIndicator := 12, seid := '1111111111111111'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_request := { } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := '0000000000000001'O, pfcp_msg_sequence_number := 12 } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(258)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(252)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(255)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(260)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(257)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(256)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(259)@84274d8e1724: Final verdict of PTC: none TC_ps_rab_assignment_with_pfcp-Iuh0(253)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(261)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(262)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0(253): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(255): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(256): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(257): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(258): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(259): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(260): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(261): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(262): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-PFCP(263): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_ps_rab_assignment_with_pfcp0(264): pass (pass -> pass) MTC@84274d8e1724: Test case TC_ps_rab_assignment_with_pfcp finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass'. Thu Sep 19 11:15:54 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=185219) Waiting for packet dumper to finish... 1 (prev_count=185219, count=206622) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Thu Sep 19 11:15:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(273)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(273)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(273)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(271)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(276)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(276)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(276)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(274)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(273)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(276)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(272)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(272)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(275)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(275)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(278) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)3760393 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(272)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(278) HNBGW_Test.msc0-RAN(272)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)11474371 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(278)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(278)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@84274d8e1724: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@84274d8e1724: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(279) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)5432107 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(272)@84274d8e1724: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(279) HNBGW_Test.msc0-RAN(272)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)6365566 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(279)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(279)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@84274d8e1724: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@84274d8e1724: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)15089625 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: First idle individual index:2 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(272)@84274d8e1724: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(272)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)1935270 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@84274d8e1724: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@84274d8e1724: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@84274d8e1724: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)1719953 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: First idle individual index:3 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(272)@84274d8e1724: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(272)@84274d8e1724: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)7585394 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(273)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(272)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(265)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(275)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(274)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(276)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(277)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(271)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(270)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(265): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(270): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(271): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(272): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(273): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(274): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(275): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(276): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(277): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(278): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(279): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Thu Sep 19 11:16:03 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=217890) Waiting for packet dumper to finish... 1 (prev_count=217890, count=285460) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Thu Sep 19 11:16:06 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(290)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(290)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(290)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(288)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(293)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(293)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(293)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(291)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(296)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(296)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(296)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(294)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(299)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(299)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(299)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(297)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(290)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(293)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(296)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(299)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(289)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(289)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(292)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(292)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(295)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(295)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(298)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(298)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)16650222 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(289)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) HNBGW_Test.msc0-RAN(289)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)9106134 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(301)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(301)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(292)@84274d8e1724: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(292)@84274d8e1724: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(302)5316861 HNBGW_Test.msc1-SCCP(291)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(291)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(292)@84274d8e1724: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) HNBGW_Test.msc1-RAN(292)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(302)8701612 HNBGW_Test.msc1-SCCP(291)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(291)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(302)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(302)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@84274d8e1724: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@84274d8e1724: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(303)14291904 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(289)@84274d8e1724: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(289)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(303)1928484 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(289)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(298)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(299)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(297)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(288)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(295)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(290)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(282)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(293)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(296)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(294)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(291)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(300)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(287)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(292)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(282): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(287): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(288): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(289): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(290): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(291): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(292): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(293): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(294): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(295): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(296): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(297): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(298): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(299): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(300): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(301): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(302): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Thu Sep 19 11:16:12 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243341) Waiting for packet dumper to finish... 1 (prev_count=243341, count=305143) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Thu Sep 19 11:16:15 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(312)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(312)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(312)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(310)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(315)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(315)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(315)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(313)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(318)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(318)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(318)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(316)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(321)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(321)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(321)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(319)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(312)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(315)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(318)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(321)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(311)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(311)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(314)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(314)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(317)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(317)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(320)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(320)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)8265449 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(311)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) HNBGW_Test.msc0-RAN(311)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)14175064 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(314)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(314)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@84274d8e1724: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)14895246 HNBGW_Test.msc1-SCCP(313)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(313)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(314)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) HNBGW_Test.msc1-RAN(314)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)7648233 HNBGW_Test.msc1-SCCP(313)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(313)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@84274d8e1724: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)1811971 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(311)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(311)@84274d8e1724: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)10719275 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(318)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(320)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(310)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(319)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(317)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(313)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(314)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(311)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(309)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(315)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(312)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(321)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(316)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(304)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(322)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(304): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(309): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(310): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(311): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(312): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(313): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(314): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(315): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(316): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(317): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(318): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(319): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(320): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(321): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(322): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Thu Sep 19 11:16:21 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=248537) Waiting for packet dumper to finish... 1 (prev_count=248537, count=313909) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Thu Sep 19 11:16:24 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(334)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(334)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(334)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(332)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(337)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(337)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(337)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(335)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(340)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(340)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(340)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(338)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(343)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(343)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(343)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(341)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(334)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(337)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(340)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(343)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(333)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(333)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(336)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(336)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(339)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(339)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(342)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(342)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)708411 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(333)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) HNBGW_Test.msc0-RAN(333)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)8094100 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(336)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(336)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@84274d8e1724: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)9724428 HNBGW_Test.msc1-SCCP(335)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(335)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(336)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) HNBGW_Test.msc1-RAN(336)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)10462019 HNBGW_Test.msc1-SCCP(335)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(335)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@84274d8e1724: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)2023844 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(333)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(333)@84274d8e1724: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)10987332 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(339)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(331)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(335)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(337)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(338)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(332)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(333)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(326)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(334)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(340)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(336)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(343)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(341)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(342)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(344)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(326): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(331): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(332): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(333): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(334): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(335): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(336): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(337): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(338): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(339): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(340): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(341): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(342): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(343): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(344): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Thu Sep 19 11:16:30 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=246619) Waiting for packet dumper to finish... 1 (prev_count=246619, count=320462) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Thu Sep 19 11:16:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(356)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(356)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(356)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(354)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(359)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(359)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(359)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(357)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(362)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(362)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(362)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(360)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(365)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(365)@84274d8e1724: M3UA emulation initiated, the test can be started MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(365)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(363)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(356)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(359)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(362)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(365)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(355)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(355)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(358)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(358)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(361)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(361)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(364)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(364)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)13200018 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(355)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) HNBGW_Test.msc0-RAN(355)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)3969025 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(358)@84274d8e1724: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(358)@84274d8e1724: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)679224 HNBGW_Test.msc1-SCCP(357)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(357)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(358)@84274d8e1724: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) HNBGW_Test.msc1-RAN(358)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)12060137 HNBGW_Test.msc1-SCCP(357)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(357)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@84274d8e1724: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@84274d8e1724: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)8071387 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(355)@84274d8e1724: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(355)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)14520858 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-M3UA(359)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(357)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(365)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(362)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(348)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(364)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(361)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(356)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(358)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(355)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(363)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(353)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(354)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(360)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(366)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(348): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(353): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(354): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(355): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(356): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(357): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(358): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(359): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(360): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(361): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(362): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(363): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(364): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(365): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(366): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Thu Sep 19 11:16:40 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=245930) Waiting for packet dumper to finish... 1 (prev_count=245930, count=314536) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Thu Sep 19 11:16:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(378)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(378)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(378)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(376)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(381)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(381)@84274d8e1724: M3UA emulation initiated, the test can be started MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(381)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(379)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(384)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(384)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(384)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(382)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(387)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(387)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(387)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(385)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(378)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(381)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(384)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(387)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(377)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(377)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(380)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(380)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(383)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(383)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(386)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(386)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)3321078 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(377)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) HNBGW_Test.msc0-RAN(377)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)12933879 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(380)@84274d8e1724: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(380)@84274d8e1724: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)8375545 HNBGW_Test.msc1-SCCP(379)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(379)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(380)@84274d8e1724: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) HNBGW_Test.msc1-RAN(380)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)398403 HNBGW_Test.msc1-SCCP(379)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(379)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@84274d8e1724: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@84274d8e1724: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)7816208 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(377)@84274d8e1724: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(377)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)14741028 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(381)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(384)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(383)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(370)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(387)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(385)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(377)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(376)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(386)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(378)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(380)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(379)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(382)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(375)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(388)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(370): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(375): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(376): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(377): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(378): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(379): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(380): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(381): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(382): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(383): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(384): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(385): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(386): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(387): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(388): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Thu Sep 19 11:16:49 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=324280) Waiting for packet dumper to finish... 1 (prev_count=324280, count=334122) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Thu Sep 19 11:16:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(400)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(400)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(400)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(398)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(403)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(403)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(403)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(401)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(406)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(406)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(406)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(404)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(409)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(409)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(409)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(407)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(400)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(403)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(406)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(409)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(399)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(399)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(402)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(402)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(405)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(405)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(408)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(408)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)8659322 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(402)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) HNBGW_Test.msc1-RAN(402)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)6971669 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@84274d8e1724: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@84274d8e1724: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)4389478 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(402)@84274d8e1724: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) HNBGW_Test.msc1-RAN(402)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)9264013 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@84274d8e1724: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@84274d8e1724: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)6536665 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: First idle individual index:2 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(402)@84274d8e1724: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(402)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)14944024 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(398)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(408)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(405)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(403)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(409)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(406)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(402)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(400)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(399)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(397)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(404)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(410)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(407)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(401)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(392)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(392): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(397): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(398): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(399): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(400): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(401): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(402): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(403): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(404): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(405): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(406): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(407): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(408): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(409): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(410): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Thu Sep 19 11:16:58 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=339291) Waiting for packet dumper to finish... 1 (prev_count=339291, count=344468) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Thu Sep 19 11:17:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(422)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(422)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(422)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(420)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(425)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(425)@84274d8e1724: M3UA emulation initiated, the test can be started MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(425)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(423)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(428)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(428)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(428)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(426)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(431)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(431)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(431)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(429)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(434)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(434)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(434)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(432)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(437)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-M3UA(437)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(437)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn2-SCCP(435)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(422)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(425)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(428)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(431)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(434)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(437)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(421)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(421)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(424)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(424)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(427)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(427)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(430)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(430)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(433)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(433)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(436)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(436)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)9101420 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(427)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) HNBGW_Test.msc2-RAN(427)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)7097918 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@84274d8e1724: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@84274d8e1724: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)6498826 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(427)@84274d8e1724: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) HNBGW_Test.msc2-RAN(427)@84274d8e1724: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)10001506 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(424)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(424)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@84274d8e1724: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)5391485 HNBGW_Test.msc1-SCCP(423)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(423)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(424)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc1-RAN(424)@84274d8e1724: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)7290353 HNBGW_Test.msc1-SCCP(423)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(423)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(425)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(427)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(436)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(433)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(428)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(434)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(414)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(429)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(422)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(430)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(432)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(421)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(420)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(423)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(426)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(437)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(435)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(424)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(419)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(438)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(431)@84274d8e1724: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(414): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(419): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(420): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(421): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(422): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(423): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(424): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(425): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(426): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(427): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(428): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(429): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(430): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(431): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(432): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(433): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(434): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(435): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-RAN(436): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(437): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(438): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Thu Sep 19 11:17:07 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=385311) Waiting for packet dumper to finish... 1 (prev_count=385311, count=390488) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Thu Sep 19 11:17:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(450)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(450)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(450)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(448)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(453)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(453)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(453)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(451)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(456)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(456)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(456)@84274d8e1724: ************************************************* HNBGW_Test.msc2-SCCP(454)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(459)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(459)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(459)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(457)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(462)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(462)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(462)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(460)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(465)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-M3UA(465)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(465)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-SCCP(463)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(450)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(453)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(456)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(459)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(462)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(465)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(449)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(452)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(452)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(455)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(455)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(458)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(458)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(461)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(461)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(464)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(464)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(449)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(449)@84274d8e1724: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(449)@84274d8e1724: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)14285724 HNBGW_Test.msc0-SCCP(448)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(448)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(449)@84274d8e1724: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) HNBGW_Test.msc0-RAN(449)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)3992501 HNBGW_Test.msc0-SCCP(448)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(448)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(455)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(455)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@84274d8e1724: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)238559 HNBGW_Test.msc2-SCCP(454)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc2-SCCP(454)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(455)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) HNBGW_Test.msc2-RAN(455)@84274d8e1724: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)11896083 HNBGW_Test.msc2-SCCP(454)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(454)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(452)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(455)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(450)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(459)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(454)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(451)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(453)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(449)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(456)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(447)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(460)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@84274d8e1724: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(457)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(448)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(458)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(463)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(442)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(464)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(461)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(466)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(462)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(465)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(442): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(447): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(448): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(449): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(450): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(451): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(452): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(453): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(454): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(455): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(456): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(457): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(458): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(459): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(460): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(461): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(462): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(463): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-RAN(464): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(465): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(466): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(467): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(468): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Thu Sep 19 11:17:16 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=366783) Waiting for packet dumper to finish... 1 (prev_count=366783, count=371930) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Thu Sep 19 11:17:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(470)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(472)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(477)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(477)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(477)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(475)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(480)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(480)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(480)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(478)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(483)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(483)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(483)@84274d8e1724: ************************************************* HNBGW_Test.msc2-SCCP(481)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(486)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(486)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(486)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(484)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(477)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(480)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(483)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(486)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(476)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(479)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(479)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(482)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(482)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(485)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(485)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(476)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh1-RUA(473)@84274d8e1724: UnitdataCallback TC_mscpool_paging_imsi-Iuh0-RUA(471)@84274d8e1724: UnitdataCallback HNBGW_Test.msc0-RAN(476)@84274d8e1724: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(476)@84274d8e1724: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(488) TC_mscpool_paging_imsi-Iuh0-RUA(471)@84274d8e1724: Added conn table entry 0TC_mscpool_paging_imsi0(488)9998121 HNBGW_Test.msc0-SCCP(475)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(475)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(476)@84274d8e1724: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(488) HNBGW_Test.msc0-RAN(476)@84274d8e1724: Added conn table entry 0TC_mscpool_paging_imsi0(488)2960869 HNBGW_Test.msc0-SCCP(475)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(475)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(488)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(488)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_imsi-Iuh1-RUA(473)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0-RUA(471)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(482)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(485)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(481)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(484)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(479)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(472)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(470)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(475)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(478)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(469)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(486)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(477)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(483)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(480)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(474)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(487)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(476)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(469): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(470): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(471): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(472): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(473): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(474): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(475): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(476): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(477): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(478): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(479): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(480): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(481): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(482): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(483): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(484): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(485): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(486): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(487): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_imsi0(488): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Thu Sep 19 11:17:25 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=248501) Waiting for packet dumper to finish... 1 (prev_count=248501, count=293160) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Thu Sep 19 11:17:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(490)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(492)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(497)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(497)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(497)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(495)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(500)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(500)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(500)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(498)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(503)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(503)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(503)@84274d8e1724: ************************************************* HNBGW_Test.msc2-SCCP(501)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(506)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(506)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(506)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(504)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(497)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(500)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(503)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(506)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(496)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(499)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(502)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(502)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(505)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(505)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(499)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(496)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(508)@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh0-RUA(491)@84274d8e1724: UnitdataCallback TC_mscpool_paging_tmsi-Iuh1-RUA(493)@84274d8e1724: UnitdataCallback TC_mscpool_paging_tmsi0(508)@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(496)@84274d8e1724: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(496)@84274d8e1724: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(508) TC_mscpool_paging_tmsi-Iuh0-RUA(491)@84274d8e1724: Added conn table entry 0TC_mscpool_paging_tmsi0(508)4535078 HNBGW_Test.msc0-SCCP(495)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(495)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(496)@84274d8e1724: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(508) HNBGW_Test.msc0-RAN(496)@84274d8e1724: Added conn table entry 0TC_mscpool_paging_tmsi0(508)4930379 HNBGW_Test.msc0-SCCP(495)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(495)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(508)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_paging_tmsi0(508)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_tmsi-Iuh0-RUA(491)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(502)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(504)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1-RUA(493)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(501)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(496)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(503)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(495)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(506)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(497)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(499)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(500)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(490)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(505)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(489)@84274d8e1724: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(492)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(498)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(507)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(494)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(489): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(490): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(491): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(492): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(493): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(494): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(495): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(496): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(497): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(498): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(499): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(500): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(501): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(502): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(503): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(504): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(505): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(506): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(507): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_paging_tmsi0(508): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Thu Sep 19 11:17:34 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=234375) Waiting for packet dumper to finish... 1 (prev_count=234375, count=270248) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Thu Sep 19 11:17:37 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(517)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(517)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(517)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(515)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(520)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(520)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(520)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(518)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(523)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(523)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(523)@84274d8e1724: ************************************************* HNBGW_Test.msc2-SCCP(521)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(526)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(526)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(526)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(524)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(517)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(520)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(523)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(526)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(516)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(519)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(522)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(522)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(525)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(525)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(519)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(516)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(528) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)13671721 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(516)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(528) HNBGW_Test.msc0-RAN(516)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)14084972 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(528)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(528)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(522)@84274d8e1724: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(522)@84274d8e1724: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(529) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@84274d8e1724: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(529)14402567 HNBGW_Test.msc2-SCCP(521)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc2-SCCP(521)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(522)@84274d8e1724: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(529) HNBGW_Test.msc2-RAN(522)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(529)16527432 HNBGW_Test.msc2-SCCP(521)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(521)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(529)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(529)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@84274d8e1724: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@84274d8e1724: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@84274d8e1724: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(530)6436432 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(516)@84274d8e1724: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(516)@84274d8e1724: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(530)4416343 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes VirtHNBGW-STATS(509)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(515)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(524)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(522)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(517)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(516)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(518)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(520)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(514)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(519)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(525)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(521)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(526)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(523)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(527)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(509): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(510): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(512): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(514): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(515): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(516): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(517): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(518): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(519): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(520): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(521): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(522): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(523): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(524): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(525): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(526): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(527): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(528): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(529): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Thu Sep 19 11:17:43 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=275090) Waiting for packet dumper to finish... 1 (prev_count=275090, count=342871) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Thu Sep 19 11:17:46 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(539)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(539)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(539)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(537)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(542)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(542)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(542)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(540)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(545)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(545)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(545)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(543)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(548)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(548)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(548)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(546)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(539)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(542)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(545)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(548)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(538)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(538)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(541)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(544)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(544)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(547)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(547)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(541)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(541)@84274d8e1724: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(541)@84274d8e1724: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(550) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)5416639 HNBGW_Test.msc1-SCCP(540)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(540)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(541)@84274d8e1724: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(550) HNBGW_Test.msc1-RAN(541)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)14235847 HNBGW_Test.msc1-SCCP(540)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(540)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(550)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(550)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(538)@84274d8e1724: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(538)@84274d8e1724: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(551) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@84274d8e1724: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(551)6161040 HNBGW_Test.msc0-SCCP(537)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(537)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(538)@84274d8e1724: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(551) HNBGW_Test.msc0-RAN(538)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(551)7000684 HNBGW_Test.msc0-SCCP(537)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(537)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(551)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(551)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(544)@84274d8e1724: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(544)@84274d8e1724: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@84274d8e1724: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(552)15815561 HNBGW_Test.msc2-SCCP(543)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc2-SCCP(543)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(544)@84274d8e1724: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc2-RAN(544)@84274d8e1724: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)11396581 HNBGW_Test.msc2-SCCP(543)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(543)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(552)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-SCCP(543)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(546)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(544)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(542)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(541)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(547)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(536)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(548)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(540)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(545)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(538)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(537)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(531)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(539)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(549)@84274d8e1724: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(531): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(532): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(534): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(536): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(537): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(538): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(539): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(540): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(541): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(542): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(543): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(544): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(545): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(546): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(547): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(548): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(549): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(550): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(551): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Thu Sep 19 11:17:52 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=341649) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Thu Sep 19 11:17:54 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(561)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(561)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(561)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(559)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(564)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(564)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(564)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(562)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(567)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(567)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(567)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(565)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(570)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(570)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(570)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(568)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(561)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(564)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(567)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(570)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(560)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(560)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(563)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(563)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(566)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(566)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(569)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(569)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(560)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(560)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)6524704 HNBGW_Test.msc0-SCCP(559)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(559)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(560)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) HNBGW_Test.msc0-RAN(560)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)3498295 HNBGW_Test.msc0-SCCP(559)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(559)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(563)@84274d8e1724: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@84274d8e1724: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@84274d8e1724: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)9299168 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(563)@84274d8e1724: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) HNBGW_Test.msc1-RAN(563)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)13277558 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: "disconnecting msc0" HNBGW_Test.msc0-RAN(560)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(561)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(559)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@84274d8e1724: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)6524704 HNBGW_Test.msc1-RAN(563)@84274d8e1724: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@84274d8e1724: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)14004683 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(563)@84274d8e1724: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc1-RAN(563)@84274d8e1724: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)903527 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-SCCP(562)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(570)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(558)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(563)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(567)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(566)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(568)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(569)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(565)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(564)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(571)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(553)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(553): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(558): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(559): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(560): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(561): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(562): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(563): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(564): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(565): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(566): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(567): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_TestThu Sep 19 11:18:01 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc .sgsn1-SCCP(568): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(569): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(570): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(571): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=261430) Waiting for packet dumper to finish... 1 (prev_count=261430, count=316971) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Thu Sep 19 11:18:03 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(583)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(583)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(583)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(581)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(586)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(586)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(586)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(584)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(583)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(586)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(582)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(582)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(585)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(585)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)14758143 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(582)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) HNBGW_Test.msc0-RAN(582)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)9213173 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@84274d8e1724: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@84274d8e1724: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@84274d8e1724: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)4442095 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: First idle individual index:1 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(582)@84274d8e1724: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) HNBGW_Test.msc0-RAN(582)@84274d8e1724: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)14535404 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: "connecting cnlink 1" MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(592)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(592)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(592)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(590)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(592)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(591)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(591)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(591)@84274d8e1724: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(591)@84274d8e1724: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@84274d8e1724: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)1110090 HNBGW_Test.msc1-SCCP(590)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc1-SCCP(590)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(591)@84274d8e1724: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) HNBGW_Test.msc1-RAN(591)@84274d8e1724: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)14770962 HNBGW_Test.msc1-SCCP(590)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(590)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@84274d8e1724: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(590)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(591)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(592)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(584)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(575)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(585)@84274d8e1724: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(586)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(583)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(581)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(587)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(580)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(582)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(575): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(580): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(581): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(582): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(583): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(584): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(585): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(586): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(587): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(590): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(591): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(592): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593): pass (pass -> pass) MTC@84274d8e1724: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Thu Sep 19 11:18:11 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=235139) Waiting for packet dumper to finish... 1 (prev_count=235139, count=303246) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Thu Sep 19 11:18:13 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(602)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(602)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(602)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(600)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(605)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(605)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(605)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(602)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(605)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(601)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(601)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)3007551 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)629209 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(607)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(607)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)14403448 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)13235208 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(608)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(608)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)14471305 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)14353922 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@84274d8e1724: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)13304984 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)7857506 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(601)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(599)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(604)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(594)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(602)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(600)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(605)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(603)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(606)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(594): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(599): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(600): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(601): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(602): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(603): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(604): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(605): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(606): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(607): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(608): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Thu Sep 19 11:18:20 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=219020) Waiting for packet dumper to finish... 1 (prev_count=219020, count=287589) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Thu Sep 19 11:18:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(619)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(619)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(619)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(617)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(622)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(622)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(622)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(620)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(625)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(625)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(625)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(628)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(628)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(628)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(619)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(622)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(625)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(628)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(618)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(618)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(621)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(621)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)2622844 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)14360025 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(631)15452040 HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(631)8506848 HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(632)9335107 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(632)8623761 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(627)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(628)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(620)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(616)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(623)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(619)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(617)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(618)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(621)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(622)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(625)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(626)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(611)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(624)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(629)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(611): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(616): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(617): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(618): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(619): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(620): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(621): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(622): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(623): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(624): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(625): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(626): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(627): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(628): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(629): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(630): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(631): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Thu Sep 19 11:18:29 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=317639) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Thu Sep 19 11:18:31 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(641)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(641)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(641)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(639)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(644)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(644)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(644)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(642)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(647)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(647)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(647)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(645)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(650)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(650)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(650)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(641)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(644)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(647)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(650)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(640)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(640)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(643)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(643)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(646)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(646)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(652) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)12692001 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(652) HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)15768982 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(652)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(652)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(653) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)8229554 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(653) HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)522033 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(653)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(653)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)14437738 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)13568344 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(646)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(649)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(650)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(647)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(640)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(643)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(642)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(639)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(645)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(648)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(641)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(633)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(644)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(651)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(638)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(633): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(638): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(639): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(640): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(641): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(642): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(643): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(644): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(645): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(646): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(647): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(648): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(649): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(650): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(651): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(652): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(653): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Thu Sep 19 11:18:37 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=272723) Waiting for packet dumper to finish... 1 (prev_count=272723, count=338734) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Thu Sep 19 11:18:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(663)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(663)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(663)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(661)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(666)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(666)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(666)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(664)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(669)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(669)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(669)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(667)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(672)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(672)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(672)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(670)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(675)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(675)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(675)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(678)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-M3UA(678)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(678)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(663)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(666)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(669)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(672)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(675)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(678)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(662)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(662)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(665)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(665)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(668)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(668)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(671)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(671)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(680) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)5380975 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(680) HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)1171883 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(680)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(680)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(681) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)6501790 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(681) HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)6331773 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(681)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(681)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@84274d8e1724: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(682)5928601 HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)5106502 HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(671)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(662)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(667)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(670)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(672)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(655)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(669)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(663)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(668)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(666)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(673)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(664)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(660)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(661)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(676)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(675)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(674)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(678)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(677)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(665)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(679)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(655): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(660): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(661): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(662): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(663): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(664): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(665): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(666): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(667): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(668): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(669): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(670): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(671): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(672): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(673): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(674): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(675): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(676): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-RAN(677): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(678): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(679): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(680): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(681): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Thu Sep 19 11:18:47 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=391697) Waiting for packet dumper to finish... 1 (prev_count=391697, count=396853) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Thu Sep 19 11:18:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(691)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(691)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(691)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(689)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(694)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(694)@84274d8e1724: M3UA emulation initiated, the test can be started MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(694)@84274d8e1724: ************************************************* HNBGW_Test.msc1-SCCP(692)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(697)@84274d8e1724: ************************************************* HNBGW_Test.msc2-M3UA(697)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(697)@84274d8e1724: ************************************************* HNBGW_Test.msc2-SCCP(695)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(700)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(700)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(700)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(703)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(703)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(703)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(701)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(706)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-M3UA(706)@84274d8e1724: M3UA emulation initiated, the test can be started MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(706)@84274d8e1724: ************************************************* HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(691)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(694)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc2-M3UA(697)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23909 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(700)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(703)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(706)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23910 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(690)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(693)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(690)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(693)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(696)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(696)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(702)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(702)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@84274d8e1724: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(708) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@84274d8e1724: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)6856004 HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(708) HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)959655 HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(708)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(708)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(709) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@84274d8e1724: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(709)1115523 HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(709) HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(709)4966261 HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(709)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(709)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(706)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-RAN(693)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-RAN(696)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(699)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(698)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(689)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(702)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(701)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(690)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(691)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(692)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(695)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(694)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(688)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(703)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(700)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(683)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(707)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(697)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(705)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(704)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(683): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(684): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(686): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(688): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(689): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(690): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(691): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(692): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(693): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(694): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-SCCP(695): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-RAN(696): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc2-M3UA(697): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(698): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(699): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(700): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(701): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(702): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(703): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(704): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-RAN(705): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(706): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(707): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(708): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(709): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Thu Sep 19 11:18:55 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=368507) Waiting for packet dumper to finish... 1 (prev_count=368507, count=373663) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Thu Sep 19 11:18:58 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(718)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(718)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(718)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(716)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(721)@84274d8e1724: ************************************************* HNBGW_Test.msc1-M3UA(721)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(721)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(719)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(724)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(724)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(724)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(727)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(727)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(727)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(718)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc1-M3UA(721)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23907 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(724)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(727)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(717)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(717)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(720)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(720)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)6380981 HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)10043352 HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@84274d8e1724: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)12305413 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)223203 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(723)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(724)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(722)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@84274d8e1724: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)6380981 HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)3744017 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)4159358 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc1-RAN(720)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(716)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(725)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(715)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(721)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(717)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(726)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(710)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(727)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(718)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(719)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(728)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(710): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(715): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(716): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(717): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(718): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-SCCP(719): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-RAN(720): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc1-M3UA(721): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(722): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(723): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(724): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(725): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(726): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(727): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(728): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Thu Sep 19 11:19:04 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=289516) Waiting for packet dumper to finish... 1 (prev_count=289516, count=351052) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Thu Sep 19 11:19:07 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(740)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(740)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(740)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(738)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(743)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(743)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(743)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(740)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(743)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(739)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(739)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)2327617 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)10387694 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@84274d8e1724: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)11367328 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)5950864 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: "connecting cnlink 1" MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(749)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-M3UA(749)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(749)@84274d8e1724: ************************************************* HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(749)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23908 to server: "172.18.218.200":2905 association #8 MTC@84274d8e1724: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.218.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@84274d8e1724: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)12904364 HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)6856078 HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@84274d8e1724: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(747)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(748)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(737)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(738)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(739)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(741)@84274d8e1724: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(740)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(743)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(744)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(749)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(732)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(742)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(732): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(737): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(738): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(739): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(740): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(741): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(742): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(743): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(744): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746): pass (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(747): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-RAN(748): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(749): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750): pass (pass -> pass) MTC@84274d8e1724: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Thu Sep 19 11:19:14 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=230168) Waiting for packet dumper to finish... 1 (prev_count=230168, count=308104) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Thu Sep 19 11:19:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(752)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(757)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(757)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(757)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(755)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(760)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(760)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(760)@84274d8e1724: ************************************************* MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(758)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(757)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(760)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(756)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(756)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(759)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(759)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(761)@84274d8e1724: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@84274d8e1724: f_create_expect(l3 := 'EBDB6B78416665299621'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(756)@84274d8e1724: Created Expect[0] for 'EBDB6B78416665299621'O to be handled at TC_second_rab_assignment0(762) TC_second_rab_assignment-Iuh0-RUA(753)@84274d8e1724: Added conn table entry 0TC_second_rab_assignment0(762)5836913 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(756)@84274d8e1724: Found Expect[0] for l3='EBDB6B78416665299621'O handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@84274d8e1724: Added conn table entry 0TC_second_rab_assignment0(762)6582560 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on connection ID:0 TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_len:91 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(761)@84274d8e1724: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "59107117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(762) TC_second_rab_assignment0(762)@84274d8e1724: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "59107117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.218.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@84274d8e1724: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "59107117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@84274d8e1724: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "59107117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.218.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_len:63 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_len:12 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@84274d8e1724: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(762)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(762)@84274d8e1724: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "59107117" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes TC_second_rab_assignment-Iuh0-RUA(753)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(759)@84274d8e1724: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(752)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(761)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(751)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(756)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(758)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(760)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(757)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(755)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(754)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(751): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_second_rab_assignment-Iuh0(752): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(753): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(754): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(755): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(756): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(757): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(758): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(759): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(760): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(761): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_second_rab_assignment0(762): pass (pass -> pass) MTC@84274d8e1724: Test case TC_second_rab_assignment finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Thu Sep 19 11:19:20 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=226984) Waiting for packet dumper to finish... 1 (prev_count=226984, count=227484) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Thu Sep 19 11:19:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(769)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(769)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(769)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(767)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(772)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(772)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(772)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(770)@84274d8e1724: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(769)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(772)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(768)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(768)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(771)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(771)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: talloc reports "struct hnb_context" x 1, expecting 1 MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(767)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(770)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(769)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(763)@84274d8e1724: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(766)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(773)@84274d8e1724: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(771)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(768)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(772)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(763): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(766): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(767): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(768): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(769): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(770): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(771): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(772): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(773): none (pass -> pass) MTC@84274d8e1724: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Thu Sep 19 11:19:26 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=91329) Waiting for packet dumper to finish... 1 (prev_count=91329, count=150283) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Thu Sep 19 11:19:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@84274d8e1724: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@84274d8e1724: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(775)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(777)@84274d8e1724: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(782)@84274d8e1724: ************************************************* HNBGW_Test.msc0-M3UA(782)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(782)@84274d8e1724: ************************************************* HNBGW_Test.msc0-SCCP(780)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@84274d8e1724: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(785)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-M3UA(785)@84274d8e1724: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(785)@84274d8e1724: ************************************************* HNBGW_Test.sgsn0-SCCP(783)@84274d8e1724: v_sccp_pdu_maxlen:268 MTC@84274d8e1724: setverdict(pass): none -> pass MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(782)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23905 to server: "172.18.218.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(785)@84274d8e1724: SCTP_ConnectResult -> connection established from: "172.18.218.203":23906 to server: "172.18.218.200":2905 association #8 HNBGW_Test.msc0-RAN(781)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(781)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(784)@84274d8e1724: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(784)@84274d8e1724: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(781)@84274d8e1724: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(781)@84274d8e1724: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(787) TC_apply_sccp-Iuh0-RUA(776)@84274d8e1724: Added conn table entry 0TC_apply_sccp0(787)738741 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: First idle individual index:0 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(781)@84274d8e1724: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(787) HNBGW_Test.msc0-RAN(781)@84274d8e1724: Added conn table entry 0TC_apply_sccp0(787)1985370 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(787)@84274d8e1724: setverdict(pass): none -> pass TC_apply_sccp0(787)@84274d8e1724: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@84274d8e1724: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@84274d8e1724: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(787)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: vl_len:22 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: vl_from0 HNBGW_Test.msc0-SCCP(780)@84274d8e1724: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AA32060D7A43342482F96'O TC_apply_sccp0(787)@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(787)@84274d8e1724: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Session index based on local reference:0 HNBGW_Test.msc0-RAN(781)@84274d8e1724: Deleted conn table entry 0TC_apply_sccp0(787)1985370 TC_apply_sccp-Iuh0-RUA(776)@84274d8e1724: Deleted conn table entry 0TC_apply_sccp0(787)738741 TC_apply_sccp0(787)@84274d8e1724: Final verdict of PTC: pass MTC@84274d8e1724: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-M3UA(782)@84274d8e1724: Final verdict of PTC: none TC_apply_sccp-Iuh1-RUA(778)@84274d8e1724: Final verdict of PTC: none VirtHNBGW-STATS(774)@84274d8e1724: Final verdict of PTC: none TC_apply_sccp-Iuh0-RUA(776)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-RAN(781)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(784)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(783)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(780)@84274d8e1724: Final verdict of PTC: none TC_apply_sccp-Iuh0(775)@84274d8e1724: Final verdict of PTC: none HNBGW-MGCP(786)@84274d8e1724: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(785)@84274d8e1724: Final verdict of PTC: none IPA-CTRL-CLI-IPA(779)@84274d8e1724: Final verdict of PTC: none TC_apply_sccp-Iuh1(777)@84274d8e1724: Final verdict of PTC: none MTC@84274d8e1724: setverdict(pass): pass -> pass, component reason not changed MTC@84274d8e1724: Setting final verdict of the test case. MTC@84274d8e1724: Local verdict of MTC: pass MTC@84274d8e1724: Local verdict of PTC VirtHNBGW-STATS(774): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_apply_sccp-Iuh0(775): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(776): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_apply_sccp-Iuh1(777): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(778): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC IPA-CTRL-CLI-IPA(779): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-SCCP(780): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-RAN(781): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.msc0-M3UA(782): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(783): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-RAN(784): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(785): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC HNBGW-MGCP(786): none (pass -> pass) MTC@84274d8e1724: Local verdict of PTC TC_apply_sccp0(787): pass (pass -> pass) MTC@84274d8e1724: Test case TC_apply_sccp finished. Verdict: pass MTC@84274d8e1724: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Thu Sep 19 11:19:36 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.218.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=179955) Waiting for packet dumper to finish... 1 (prev_count=179955, count=203542) MTC@84274d8e1724: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@84274d8e1724: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@84274d8e1724: Terminating MTC. MC@84274d8e1724: MTC terminated. MC2> exit MC@84274d8e1724: Shutting down session. MC@84274d8e1724: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-with-pfcp-21.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: FAIL HNBGW_Tests.TC_hnb_disconnected_timeout NEW: PASS HNBGW_Tests.TC_ps_rab_assignment_with_pfcp Summary: NEW: FAIL: 1 pass: 46 NEW: PASS: 1 skip: 1 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-io_uring-192-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-io_uring-192-stp + docker kill jenkins-ttcn3-hnbgw-test-io_uring-192-stp jenkins-ttcn3-hnbgw-test-io_uring-192-stp + docker wait jenkins-ttcn3-hnbgw-test-io_uring-192-stp 137 + clean_up_common + set +e + set +x ### Clean up ### + trap - EXIT INT TERM 0 + type clean_up + clean_up + sed -i s/classname='\([^']\+\)'/classname='\1:with-pfcp'/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/with-pfcp/hnbgw-tester/junit-xml-with-pfcp-21.log + network_clean + docker network inspect ttcn3-hnbgw-test-218 + grep Name + cut -d : -f2 + awk -F" NR>1{print $2} + local containers= + [ -n ] + network_remove + set +x Removing network ttcn3-hnbgw-test-218 + docker network remove ttcn3-hnbgw-test-218 ttcn3-hnbgw-test-218 + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/unix + fix_perms + set +x Fixing permissions + id -u + id -g + docker run --rm -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/_cache:/cache --name jenkins-ttcn3-hnbgw-test-io_uring-192-cleaner debian:bookworm sh -e -x -c chmod -R a+rX /data/ /cache/ chown -R 1000:1000 /data /cache + chmod -R a+rX /data/ /cache/ + chown -R 1000:1000 /data /cache + collect_logs + cat /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test-io_uring/logs/hnbgw-tester/junit-xml-21.log <?xml version="1.0"?> <testsuite name='Titan' tests='47' failures='1' errors='0' skipped='0' inconc='0' time='379.00'> <testcase classname='HNBGW_Tests' name='TC_hnb_register' time='1.118064'/> <testcase classname='HNBGW_Tests' name='TC_hnb_register_duplicate' time='1.103271'/> <testcase classname='HNBGW_Tests' name='TC_hnb_register_duplicate_reuse_sctp_assoc' time='1.155149'/> <testcase classname='HNBGW_Tests' name='TC_hnb_disconnected_timeout' time='15.179760'> <failure type='fail-verdict'>Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 HNBGW_Tests.ttcn:2990 HNBGW_Tests control part HNBGW_Tests.ttcn:1136 TC_hnb_disconnected_timeout testcase </failure> </testcase> <testcase classname='HNBGW_Tests' name='TC_ue_register' time='1.119319'/> <testcase classname='HNBGW_Tests' name='TC_ue_register_tmsi_lai' time='1.099853'/> <testcase classname='HNBGW_Tests' name='TC_ue_register_before_hnb_register' time='1.098222'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_initial_ue' time='2.154886'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_initial_ue' time='2.166345'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_initial_ue_empty_cr' time='2.187471'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_initial_ue_empty_cr' time='2.199058'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_bidir' time='2.389928'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_bidir' time='2.408685'/> <testcase classname='HNBGW_Tests' name='TC_rab_assignment' time='2.459582'/> <testcase classname='HNBGW_Tests' name='TC_rab_release' time='2.465279'/> <testcase classname='HNBGW_Tests' name='TC_rab_release_abnormal' time='2.483959'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_fail' time='2.436557'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_mgcp_to' time='6.396801'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_mgw_iuup_addr_chg' time='2.512432'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_mo_disconnect' time='7.617084'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_mo_disconnect' time='7.557707'/> <testcase classname='HNBGW_Tests' name='TC_ps_rab_assignment_without_pfcp' time='7.509763'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Compl_on_1_cnlink' time='5.355340'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_imsi_round_robin' time='5.383734'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' time='5.330174'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' time='5.359799'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' time='5.420666'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' time='5.346155'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_1' time='5.349124'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_2' time='5.434616'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_from_other_PLMN' time='4.349025'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_paging_imsi' time='5.254320'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_paging_tmsi' time='5.283868'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_no_allow_attach_round_robin' time='5.368769'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_no_allow_attach_valid_nri' time='5.370419'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_sccp_n_pcstate_detaches_cnlink' time='5.365444'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_sccp_n_pcstate_attaches_cnlink' time='6.402839'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Compl_on_1_cnlink' time='5.357125'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_no_nri_round_robin' time='5.379347'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_valid_nri_1' time='5.353439'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_valid_nri_2' time='5.459717'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_nri_from_other_PLMN' time='4.388264'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' time='5.373296'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' time='6.344275'/> <testcase classname='HNBGW_Tests' name='TC_second_rab_assignment' time='2.470502'/> <testcase classname='HNBGW_Tests' name='TC_hnb_reregister_reuse_sctp_assoc' time='1.305725'/> <testcase classname='HNBGW_Tests' name='TC_apply_sccp' time='6.269692'/> </testsuite> Recording test results [Checks API] No suitable checks publisher found. Build step 'Publish JUnit test result report' changed build result to UNSTABLE Archiving artifacts Finished: UNSTABLE