Started by timer Running as SYSTEM Building remotely on build4-deb12build-ansible (ttcn3 obs ttcn3_with_linux_6.1_or_higher qemu io_uring osmocom-gerrit coverity osmocom-master) in workspace /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test The recommended git tool is: NONE No credentials specified Wiping out workspace first. Cloning the remote Git repository Cloning repository https://gerrit.osmocom.org/docker-playground > git init /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test # timeout=10 Fetching upstream changes from https://gerrit.osmocom.org/docker-playground > git --version # timeout=10 > git --version # 'git version 2.39.2' > git fetch --tags --force --progress -- https://gerrit.osmocom.org/docker-playground +refs/heads/*:refs/remotes/origin/* # timeout=10 > git config remote.origin.url https://gerrit.osmocom.org/docker-playground # timeout=10 > git config --add remote.origin.fetch +refs/heads/*:refs/remotes/origin/* # timeout=10 Avoid second fetch Seen branch in repository origin/arehbein/devtests Seen branch in repository origin/arehbein/devtests%topic=fixes Seen branch in repository origin/daniel/bscnat_tests Seen branch in repository origin/daniel/training Seen branch in repository origin/daniel/wip Seen branch in repository origin/fixeria/confmerge Seen branch in repository origin/fixeria/sccplite Seen branch in repository origin/fixeria/testing Seen branch in repository origin/jolly/testing Seen branch in repository origin/laforge/ergw Seen branch in repository origin/laforge/fr Seen branch in repository origin/laforge/ns Seen branch in repository origin/laforge/podman Seen branch in repository origin/lynxis/gerrit-comment-ci Seen branch in repository origin/master Seen branch in repository origin/neels/hnbgw-pfcp Seen branch in repository origin/neels/wip Seen branch in repository origin/osmith/fix-registry-pull Seen branch in repository origin/osmith/fix-rpi-gnutls Seen branch in repository origin/osmith/obs-2021q1 Seen branch in repository origin/osmith/rpm-local Seen branch in repository origin/osmith/ttcn3-pass-args Seen branch in repository origin/osmith/wip Seen branch in repository origin/osmith/wip-4g-only Seen branch in repository origin/osmith/wip-asan Seen branch in repository origin/pespin/bts-perf Seen branch in repository origin/pespin/ergw Seen branch in repository origin/pespin/gtp1 Seen branch in repository origin/pespin/master Seen branch in repository origin/pmaier/pcuif Seen branch in repository origin/refsf/for/master/dyn-pdch Seen 31 remote branches > git show-ref --tags -d # timeout=10 Checking out Revision d6176d12f347626a40592bb7122e0cc8553376e8 (origin/master) > git config core.sparsecheckout # timeout=10 > git checkout -f d6176d12f347626a40592bb7122e0cc8553376e8 # timeout=10 Commit message: "debian-bookworm-titan: chown 1000 for deps" > git rev-list --no-walk d6176d12f347626a40592bb7122e0cc8553376e8 # timeout=10 [ttcn3-hnbgw-test] $ /bin/sh -xe /tmp/jenkins175674051056825480.sh + export REGISTRY_HOST=registry.osmocom.org + DIR=ttcn3-hnbgw-test + export IMAGE_SUFFIX=master + cd ttcn3-hnbgw-test + ./jenkins.sh + [ x = x ] + REPO_USER=osmocom-build + [ x/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test = x ] + VOL_BASE_DIR=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + mkdir -p /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + [ ! -d /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs ] + [ xjenkins-ttcn3-hnbgw-test-990 = x ] + basename /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test + SUITE_NAME=ttcn3-hnbgw-test + IMAGE_SUFFIX=master + docker_images_require osmo-stp-master osmo-hnbgw-master ttcn3-hnbgw-test + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-stp-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.1s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 5.76kB done #2 DONE 0.1s #3 [internal] load metadata for registry.osmocom.org/debian:bookworm #3 DONE 0.1s #4 [auth] sharing credentials for registry.osmocom.org #4 DONE 0.0s #5 [internal] load build context #5 DONE 0.0s #6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #6 DONE 0.0s #7 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #7 DONE 0.0s #8 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf 0.1s done #8 DONE 0.1s #9 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #9 DONE 0.1s #10 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #10 DONE 0.2s #5 [internal] load build context #5 transferring context: 1.96kB done #5 DONE 0.1s #11 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #11 DONE 0.2s #12 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #12 CACHED #13 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #13 CACHED #14 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #14 CACHED #15 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #15 CACHED #16 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #16 CACHED #17 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #17 CACHED #18 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #18 CACHED #19 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #19 CACHED #20 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #20 CACHED #21 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #21 CACHED #22 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #22 CACHED #23 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #23 CACHED #24 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #24 CACHED #25 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #25 CACHED #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 CACHED #27 exporting to image #27 exporting layers done #27 writing image sha256:1ecbeb047988831dc004529ba665ecef5f9d654ff2a1f173e3b5bf72e70fdbc2 done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest 0.0s done #27 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 1ecbeb047988 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-stp-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-stp-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-stp-master + echo osmo-stp-master + dir=osmo-stp-master + pull_arg=--pull + grep ^FROM ../osmo-stp-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + echo FROM $USER/$DISTRO-build + grep -q $USER + pull_arg= + set +x Building image: osmo-stp-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-stp-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-stp-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-stp-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-stp-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.24kB done #2 DONE 0.0s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [1/7] FROM docker.io/osmocom-build/debian-bookworm-build #4 CACHED #5 [internal] load build context #5 transferring context: 1.13kB done #5 DONE 0.0s #6 [2/7] RUN CASE "debian-bookworm" in debian*) apt-get update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-netif-dev && apt-get clean ;; centos*) dnf install -y "pkgconfig(libosmo-netif)" "pkgconfig(libosmocore)" "pkgconfig(libosmogsm)" "pkgconfig(libosmovty)" ;; esac #6 ... #7 https://gerrit.osmocom.org/plugins/gitiles/libosmo-sigtran/+/master?format=TEXT #7 CACHED #6 [2/7] RUN CASE "debian-bookworm" in debian*) apt-get update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-netif-dev && apt-get clean ;; centos*) dnf install -y "pkgconfig(libosmo-netif)" "pkgconfig(libosmocore)" "pkgconfig(libosmogsm)" "pkgconfig(libosmovty)" ;; esac #6 0.428 Hit:1 http://deb.debian.org/debian bookworm InRelease #6 0.428 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #6 0.428 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #6 0.586 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #6 0.981 Reading package lists... #6 1.250 Reading package lists... #6 1.500 Building dependency tree... #6 1.553 Reading state information... #6 1.616 The following additional packages will be installed: #6 1.616 libosmocodec4 libosmocoding0 libosmocore libosmocore22 libosmoctrl0 #6 1.616 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 libosmousb0 #6 1.616 libosmovty13 osmocom-nightly #6 1.626 The following NEW packages will be installed: #6 1.626 libosmo-netif-dev libosmocodec4 libosmocoding0 libosmocore libosmocore-dev #6 1.626 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #6 1.626 libosmonetif11 libosmosim2 libosmousb0 libosmovty13 osmocom-nightly #6 1.643 0 upgraded, 15 newly installed, 0 to remove and 6 not upgraded. #6 1.643 Need to get 2047 kB of archives. #6 1.643 After this operation, 7278 kB of additional disk space will be used. #6 1.643 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202409222026 [1180 B] #6 1.703 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.13.ddc5.202409222026 [168 kB] #6 1.707 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.13.ddc5.202409222026 [50.6 kB] #6 1.708 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.13.ddc5.202409222026 [69.8 kB] #6 1.709 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.13.ddc5.202409222026 [227 kB] #6 1.712 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.13.ddc5.202409222026 [70.3 kB] #6 1.714 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.13.ddc5.202409222026 [103 kB] #6 1.715 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.13.ddc5.202409222026 [177 kB] #6 1.718 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.13.ddc5.202409222026 [58.8 kB] #6 1.718 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.13.ddc5.202409222026 [62.9 kB] #6 1.719 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.13.ddc5.202409222026 [49.6 kB] #6 1.719 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.13.ddc5.202409222026 [43.0 kB] #6 1.720 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.13.ddc5.202409222026 [846 kB] #6 1.727 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202409222026 [53.9 kB] #6 1.728 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202409222026 [66.1 kB] #6 1.836 debconf: delaying package configuration, since apt-utils is not installed #6 1.888 Fetched 2047 kB in 0s (20.6 MB/s) #6 1.951 Selecting previously unselected package osmocom-nightly. #6 1.951 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117405 files and directories currently installed.) #6 1.988 Preparing to unpack .../00-osmocom-nightly_202409222026_amd64.deb ... #6 2.003 Unpacking osmocom-nightly (202409222026) ... #6 2.139 Selecting previously unselected package libosmocore22:amd64. #6 2.156 Preparing to unpack .../01-libosmocore22_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.190 Unpacking libosmocore22:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.334 Selecting previously unselected package libosmocodec4:amd64. #6 2.343 Preparing to unpack .../02-libosmocodec4_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.359 Unpacking libosmocodec4:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.502 Selecting previously unselected package libosmoisdn0:amd64. #6 2.520 Preparing to unpack .../03-libosmoisdn0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.536 Unpacking libosmoisdn0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.674 Selecting previously unselected package libosmogsm20:amd64. #6 2.692 Preparing to unpack .../04-libosmogsm20_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.709 Unpacking libosmogsm20:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.853 Selecting previously unselected package libosmocoding0:amd64. #6 2.870 Preparing to unpack .../05-libosmocoding0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.888 Unpacking libosmocoding0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.040 Selecting previously unselected package libosmovty13:amd64. #6 3.058 Preparing to unpack .../06-libosmovty13_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.076 Unpacking libosmovty13:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.211 Selecting previously unselected package libosmogb14:amd64. #6 3.218 Preparing to unpack .../07-libosmogb14_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.236 Unpacking libosmogb14:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.386 Selecting previously unselected package libosmoctrl0:amd64. #6 3.401 Preparing to unpack .../08-libosmoctrl0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.418 Unpacking libosmoctrl0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.569 Selecting previously unselected package libosmosim2:amd64. #6 3.583 Preparing to unpack .../09-libosmosim2_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.601 Unpacking libosmosim2:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.748 Selecting previously unselected package libosmousb0:amd64. #6 3.765 Preparing to unpack .../10-libosmousb0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.782 Unpacking libosmousb0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.913 Selecting previously unselected package libosmocore. #6 3.931 Preparing to unpack .../11-libosmocore_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.948 Unpacking libosmocore (1.10.0.13.ddc5.202409222026) ... #6 4.075 Selecting previously unselected package libosmocore-dev:amd64. #6 4.093 Preparing to unpack .../12-libosmocore-dev_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 4.111 Unpacking libosmocore-dev:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.280 Selecting previously unselected package libosmonetif11:amd64. #6 4.298 Preparing to unpack .../13-libosmonetif11_1.5.1.5.89a1.202409222026_amd64.deb ... #6 4.316 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202409222026) ... #6 4.439 Selecting previously unselected package libosmo-netif-dev:amd64. #6 4.457 Preparing to unpack .../14-libosmo-netif-dev_1.5.1.5.89a1.202409222026_amd64.deb ... #6 4.474 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409222026) ... #6 4.631 Setting up osmocom-nightly (202409222026) ... #6 4.681 Setting up libosmocore22:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.732 Setting up libosmocodec4:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.782 Setting up libosmovty13:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.831 Setting up libosmoisdn0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.884 Setting up libosmousb0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.934 Setting up libosmogsm20:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.985 Setting up libosmoctrl0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 5.036 Setting up libosmogb14:amd64 (1.10.0.13.ddc5.202409222026) ... #6 5.085 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202409222026) ... #6 5.134 Setting up libosmocoding0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 5.183 Setting up libosmosim2:amd64 (1.10.0.13.ddc5.202409222026) ... #6 5.232 Setting up libosmocore (1.10.0.13.ddc5.202409222026) ... #6 5.281 Setting up libosmocore-dev:amd64 (1.10.0.13.ddc5.202409222026) ... #6 5.331 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409222026) ... #6 5.384 Processing triggers for libc-bin (2.36-9+deb12u8) ... #6 DONE 5.6s #8 [3/7] WORKDIR /DATA #8 DONE 0.1s #9 [4/7] RUN GIT clone https://gerrit.osmocom.org/libosmo-sigtran.git #9 0.329 Cloning into 'libosmo-sigtran'... #9 DONE 0.5s #10 [5/7] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/LIBOSMO-SIGTRAN/+/MASTER?FORMAT=TEXT /tmp/commit-libosmo-sigtran #10 DONE 0.1s #11 [6/7] RUN CD libosmo-sigtran && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure && make "-j$(nproc)" install && install examples/.libs/sccp_demo_user /usr/local/bin/ && ldconfig #11 0.380 Already on 'master' #11 0.380 Your branch is up to date with 'origin/master'. #11 0.382 refs/heads/master #11 0.399 HEAD is now at e1adfb8 SS7: Support secondary point codes #11 0.400 master #11 0.401 e1adfb8db007a71707e9a0fbdfd8ca778f52cf2b #11 2.513 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.513 libtoolize: copying file './ltmain.sh' #11 2.950 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 2.950 libtoolize: and rerunning libtoolize and aclocal. #11 2.950 libtoolize: Consider adding '-I m4' to ACLOCAL_AMFLAGS in Makefile.am. #11 3.692 configure.ac:167: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.692 configure.ac:167: You should run autoupdate. #11 3.692 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.692 configure.ac:167: the top level #11 3.692 configure.ac:184: warning: AC_OUTPUT should be used without arguments. #11 3.692 configure.ac:184: You should run autoupdate. #11 4.127 configure.ac:23: installing './compile' #11 4.128 configure.ac:25: installing './config.guess' #11 4.129 configure.ac:25: installing './config.sub' #11 4.130 configure.ac:9: installing './install-sh' #11 4.131 configure.ac:9: installing './missing' #11 4.190 examples/Makefile.am: installing './depcomp' #11 4.337 checking for a BSD-compatible install... /usr/bin/install -c #11 4.341 checking whether build environment is sane... yes #11 4.347 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.348 checking for gawk... gawk #11 4.348 checking whether make sets $(MAKE)... yes #11 4.355 checking whether make supports nested variables... yes #11 4.362 checking whether make supports nested variables... (cached) yes #11 4.363 checking whether make sets $(MAKE)... (cached) yes #11 4.365 checking for gcc... gcc #11 4.417 checking whether the C compiler works... yes #11 4.461 checking for C compiler default output file name... a.out #11 4.462 checking for suffix of executables... #11 4.526 checking whether we are cross compiling... no #11 4.559 checking for suffix of object files... o #11 4.579 checking whether the compiler supports GNU C... yes #11 4.594 checking whether gcc accepts -g... yes #11 4.620 checking for gcc option to enable C11 features... none needed #11 4.651 checking whether gcc understands -c and -o together... yes #11 4.687 checking whether make supports the include directive... yes (GNU style) #11 4.698 checking dependency style of gcc... gcc3 #11 4.785 checking build system type... x86_64-pc-linux-gnu #11 4.889 checking host system type... x86_64-pc-linux-gnu #11 4.890 checking how to print strings... printf #11 4.917 checking for a sed that does not truncate output... /usr/bin/sed #11 4.919 checking for grep that handles long lines and -e... /usr/bin/grep #11 4.920 checking for egrep... /usr/bin/grep -E #11 4.920 checking for fgrep... /usr/bin/grep -F #11 4.921 checking for ld used by gcc... /usr/bin/ld #11 4.923 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 4.925 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 4.926 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 4.947 checking whether ln -s works... yes #11 4.947 checking the maximum length of command line arguments... 1572864 #11 4.961 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 4.962 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 4.962 checking for /usr/bin/ld option to reload object files... -r #11 4.963 checking for file... file #11 4.963 checking for objdump... objdump #11 4.964 checking how to recognize dependent libraries... pass_all #11 4.965 checking for dlltool... no #11 4.966 checking how to associate runtime and link libraries... printf %s\n #11 4.966 checking for ar... ar #11 4.967 checking for archiver @FILE support... @ #11 5.003 checking for strip... strip #11 5.004 checking for ranlib... ranlib #11 5.004 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 5.114 checking for sysroot... no #11 5.114 checking for a working dd... /usr/bin/dd #11 5.117 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 5.126 checking for mt... no #11 5.126 checking if : is a manifest tool... no #11 5.128 checking for stdio.h... yes #11 5.137 checking for stdlib.h... yes #11 5.147 checking for string.h... yes #11 5.157 checking for inttypes.h... yes #11 5.168 checking for stdint.h... yes #11 5.179 checking for strings.h... yes #11 5.190 checking for sys/stat.h... yes #11 5.201 checking for sys/types.h... yes #11 5.212 checking for unistd.h... yes #11 5.225 checking for dlfcn.h... yes #11 5.239 checking for objdir... .libs #11 5.278 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.294 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.294 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.324 checking if gcc static flag -static works... yes #11 5.378 checking if gcc supports -c -o file.o... yes #11 5.409 checking if gcc supports -c -o file.o... (cached) yes #11 5.410 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.430 checking whether -lc should be explicitly linked in... no #11 5.482 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.562 checking how to hardcode library paths into programs... immediate #11 5.562 checking whether stripping libraries is possible... yes #11 5.563 checking if libtool supports shared libraries... yes #11 5.563 checking whether to build shared libraries... yes #11 5.563 checking whether to build static libraries... yes #11 5.564 checking for pkg-config... /usr/bin/pkg-config #11 5.564 checking for pkg-config... /usr/bin/pkg-config #11 5.564 checking pkg-config is at least version 0.20... yes #11 5.565 checking for libosmocore >= 1.10.0... yes #11 5.571 checking for libosmovty >= 1.10.0... yes #11 5.581 checking for libosmogsm >= 1.10.0... yes #11 5.601 checking for libosmo-netif >= 1.5.0... yes #11 5.621 checking for library containing sctp_recvmsg... -lsctp #11 5.706 checking if gcc supports -fvisibility=hidden... yes #11 5.731 checking for doxygen... /usr/bin/doxygen #11 5.740 checking whether to enable VTY/CTRL tests... no #11 5.740 CFLAGS=" -std=gnu11 -Wall" #11 5.740 CPPFLAGS=" -Wall" #11 5.798 checking that generated files are newer than configure... done #11 5.799 configure: creating ./config.status #11 6.870 config.status: creating libosmo-sigtran.pc #11 6.899 config.status: creating include/osmocom/Makefile #11 6.937 config.status: creating include/osmocom/sccp/Makefile #11 6.977 config.status: creating include/osmocom/sigtran/Makefile #11 7.016 config.status: creating include/Makefile #11 7.055 config.status: creating src/Makefile #11 7.096 config.status: creating tests/Makefile #11 7.135 config.status: creating tests/m2ua/Makefile #11 7.175 config.status: creating tests/xua/Makefile #11 7.214 config.status: creating tests/ss7/Makefile #11 7.254 config.status: creating tests/vty/Makefile #11 7.294 config.status: creating examples/Makefile #11 7.333 config.status: creating stp/Makefile #11 7.373 config.status: creating doc/Makefile #11 7.413 config.status: creating doc/examples/Makefile #11 7.451 config.status: creating doc/manuals/Makefile #11 7.491 config.status: creating contrib/Makefile #11 7.530 config.status: creating contrib/systemd/Makefile #11 7.569 config.status: creating Doxyfile #11 7.608 config.status: creating Makefile #11 7.648 config.status: executing tests/atconfig commands #11 7.654 config.status: executing depfiles commands #11 8.269 config.status: executing libtool commands #11 8.357 echo 2.0.0.3-e1ad > .version-t && mv .version-t .version #11 8.362 make install-recursive #11 8.370 make[1]: Entering directory '/data/libosmo-sigtran' #11 8.378 Making install in include #11 8.383 make[2]: Entering directory '/data/libosmo-sigtran/include' #11 8.391 Making install in osmocom #11 8.396 make[3]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.405 Making install in sccp #11 8.409 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.415 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.415 make[5]: Nothing to be done for 'install-exec-am'. #11 8.418 /usr/bin/mkdir -p '/usr/local/include/osmocom/sccp' #11 8.424 /usr/bin/install -c -m 644 sccp_types.h '/usr/local/include/osmocom/sccp' #11 8.429 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.429 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sccp' #11 8.430 Making install in sigtran #11 8.435 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.441 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.441 make[5]: Nothing to be done for 'install-exec-am'. #11 8.444 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran' #11 8.444 /usr/bin/mkdir -p '/usr/local/include/osmocom/sigtran/protocol' #11 8.450 /usr/bin/install -c -m 644 xua_types.h xua_msg.h m2ua_types.h sccp_sap.h sigtran_sap.h sccp_helpers.h mtp_sap.h osmo_ss7.h '/usr/local/include/osmocom/sigtran' #11 8.451 /usr/bin/install -c -m 644 protocol/sua.h protocol/m3ua.h protocol/mtp.h protocol/sccp_scmg.h '/usr/local/include/osmocom/sigtran/protocol' #11 8.456 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.456 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom/sigtran' #11 8.461 make[4]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.467 make[5]: Entering directory '/data/libosmo-sigtran/include/osmocom' #11 8.467 make[5]: Nothing to be done for 'install-exec-am'. #11 8.467 make[5]: Nothing to be done for 'install-data-am'. #11 8.467 make[5]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.467 make[4]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.468 make[3]: Leaving directory '/data/libosmo-sigtran/include/osmocom' #11 8.472 make[3]: Entering directory '/data/libosmo-sigtran/include' #11 8.478 make[4]: Entering directory '/data/libosmo-sigtran/include' #11 8.478 make[4]: Nothing to be done for 'install-exec-am'. #11 8.478 make[4]: Nothing to be done for 'install-data-am'. #11 8.478 make[4]: Leaving directory '/data/libosmo-sigtran/include' #11 8.479 make[3]: Leaving directory '/data/libosmo-sigtran/include' #11 8.480 make[2]: Leaving directory '/data/libosmo-sigtran/include' #11 8.480 Making install in src #11 8.486 make[2]: Entering directory '/data/libosmo-sigtran/src' #11 8.489 CC libxua_a-xua_msg.o #11 8.490 CC ipa.lo #11 8.490 CC m3ua.lo #11 8.491 CC osmo_ss7.lo #11 8.492 CC osmo_ss7_as.lo #11 8.493 CC osmo_ss7_asp.lo #11 8.494 CC osmo_ss7_asp_peer.lo #11 8.495 CC osmo_ss7_hmrt.lo #11 8.496 CC osmo_ss7_vty.lo #11 8.497 CC osmo_ss7_xua_srv.lo #11 8.498 CC sccp2sua.lo #11 8.499 CC sccp_helpers.lo #11 8.500 CC sccp_lbcs.lo #11 8.501 CC sccp_sap.lo #11 8.502 CC sccp_sclc.lo #11 8.503 CC sccp_scmg.lo #11 8.504 CC sccp_scrc.lo #11 8.506 CC sccp_types.lo #11 8.506 CC sccp_scoc.lo #11 8.506 CC sccp_user.lo #11 8.620 sccp_scoc.c: In function 'scoc_fsm_active': #11 8.620 sccp_scoc.c:1200:9: note: '#pragma message: TODO: internal disco: send N-DISCONNECT.ind to user' #11 8.620 1200 | #pragma message ("TODO: internal disco: send N-DISCONNECT.ind to user") #11 8.620 | ^~~~~~~ #11 8.639 CC sccp_vty.lo #11 8.659 CC sua.lo #11 8.680 CC xua_asp_fsm.lo #11 8.682 CC xua_as_fsm.lo #11 8.683 CC xua_default_lm_fsm.lo #11 8.716 CC xua_msg.lo #11 8.722 CC xua_rkm.lo #11 8.724 CC xua_shared.lo #11 8.724 CC xua_snm.lo #11 8.733 AR libxua.a #11 8.734 ar: `u' modifier ignored since `D' is the default (see `U') #11 8.959 CCLD libosmo-sigtran.la #11 9.593 make[3]: Entering directory '/data/libosmo-sigtran/src' #11 9.593 make[3]: Nothing to be done for 'install-data-am'. #11 9.594 /usr/bin/mkdir -p '/usr/local/lib' #11 9.594 /bin/bash ../libtool --mode=install /usr/bin/install -c libosmo-sigtran.la '/usr/local/lib' #11 9.617 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.so.10.0.1 /usr/local/lib/libosmo-sigtran.so.10.0.1 #11 9.622 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10 || { rm -f libosmo-sigtran.so.10 && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so.10; }; }) #11 9.629 libtool: install: (cd /usr/local/lib && { ln -s -f libosmo-sigtran.so.10.0.1 libosmo-sigtran.so || { rm -f libosmo-sigtran.so && ln -s libosmo-sigtran.so.10.0.1 libosmo-sigtran.so; }; }) #11 9.643 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.lai /usr/local/lib/libosmo-sigtran.la #11 9.657 libtool: install: /usr/bin/install -c .libs/libosmo-sigtran.a /usr/local/lib/libosmo-sigtran.a #11 9.668 libtool: install: chmod 644 /usr/local/lib/libosmo-sigtran.a #11 9.676 libtool: install: ranlib /usr/local/lib/libosmo-sigtran.a #11 9.725 libtool: finish: PATH="/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/sbin" ldconfig -n /usr/local/lib #11 9.726 ---------------------------------------------------------------------- #11 9.726 Libraries have been installed in: #11 9.726 /usr/local/lib #11 9.726 #11 9.726 If you ever happen to want to link against installed libraries #11 9.726 in a given directory, LIBDIR, you must either use libtool, and #11 9.726 specify the full pathname of the library, or use the '-LLIBDIR' #11 9.726 flag during linking and do at least one of the following: #11 9.726 - add LIBDIR to the 'LD_LIBRARY_PATH' environment variable #11 9.726 during execution #11 9.726 - add LIBDIR to the 'LD_RUN_PATH' environment variable #11 9.726 during linking #11 9.726 - use the '-Wl,-rpath -Wl,LIBDIR' linker flag #11 9.726 - have your system administrator add LIBDIR to '/etc/ld.so.conf' #11 9.726 #11 9.726 See any operating system documentation about shared libraries for #11 9.726 more information, such as the ld(1) and ld.so(8) manual pages. #11 9.726 ---------------------------------------------------------------------- #11 9.726 make[3]: Leaving directory '/data/libosmo-sigtran/src' #11 9.726 make[2]: Leaving directory '/data/libosmo-sigtran/src' #11 9.726 Making install in tests #11 9.727 make[2]: Entering directory '/data/libosmo-sigtran/tests' #11 9.729 Making install in xua #11 9.731 make[3]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.732 make[4]: Entering directory '/data/libosmo-sigtran/tests/xua' #11 9.732 make[4]: Nothing to be done for 'install-exec-am'. #11 9.732 make[4]: Nothing to be done for 'install-data-am'. #11 9.732 make[4]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.732 make[3]: Leaving directory '/data/libosmo-sigtran/tests/xua' #11 9.732 Making install in m2ua #11 9.733 make[3]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.734 make[4]: Entering directory '/data/libosmo-sigtran/tests/m2ua' #11 9.734 make[4]: Nothing to be done for 'install-exec-am'. #11 9.734 make[4]: Nothing to be done for 'install-data-am'. #11 9.734 make[4]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.734 make[3]: Leaving directory '/data/libosmo-sigtran/tests/m2ua' #11 9.734 Making install in ss7 #11 9.736 make[3]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.737 make[4]: Entering directory '/data/libosmo-sigtran/tests/ss7' #11 9.737 make[4]: Nothing to be done for 'install-exec-am'. #11 9.737 make[4]: Nothing to be done for 'install-data-am'. #11 9.737 make[4]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.737 make[3]: Leaving directory '/data/libosmo-sigtran/tests/ss7' #11 9.737 Making install in vty #11 9.739 make[3]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.741 make[4]: Entering directory '/data/libosmo-sigtran/tests/vty' #11 9.741 make[4]: Nothing to be done for 'install-exec-am'. #11 9.741 make[4]: Nothing to be done for 'install-data-am'. #11 9.741 make[4]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.741 make[3]: Leaving directory '/data/libosmo-sigtran/tests/vty' #11 9.742 make[3]: Entering directory '/data/libosmo-sigtran/tests' #11 9.744 make[4]: Entering directory '/data/libosmo-sigtran/tests' #11 9.744 make[4]: Nothing to be done for 'install-exec-am'. #11 9.744 make[4]: Nothing to be done for 'install-data-am'. #11 9.744 make[4]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.745 make[3]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.745 make[2]: Leaving directory '/data/libosmo-sigtran/tests' #11 9.745 Making install in examples #11 9.747 make[2]: Entering directory '/data/libosmo-sigtran/examples' #11 9.748 CC sccp_demo_user.o #11 9.749 CC sccp_test_server.o #11 9.749 CC sccp_test_vty.o #11 9.788 CCLD sccp_demo_user #11 10.03 make[3]: Entering directory '/data/libosmo-sigtran/examples' #11 10.03 make[3]: Nothing to be done for 'install-exec-am'. #11 10.03 make[3]: Nothing to be done for 'install-data-am'. #11 10.03 make[3]: Leaving directory '/data/libosmo-sigtran/examples' #11 10.03 make[2]: Leaving directory '/data/libosmo-sigtran/examples' #11 10.03 Making install in stp #11 10.03 make[2]: Entering directory '/data/libosmo-sigtran/stp' #11 10.03 CC stp_main.o #11 10.06 CCLD osmo-stp #11 10.35 make[3]: Entering directory '/data/libosmo-sigtran/stp' #11 10.35 make[3]: Nothing to be done for 'install-data-am'. #11 10.35 /usr/bin/mkdir -p '/usr/local/bin' #11 10.35 /bin/bash ../libtool --mode=install /usr/bin/install -c osmo-stp '/usr/local/bin' #11 10.37 libtool: install: /usr/bin/install -c .libs/osmo-stp /usr/local/bin/osmo-stp #11 10.38 make[3]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.38 make[2]: Leaving directory '/data/libosmo-sigtran/stp' #11 10.38 Making install in doc #11 10.38 make[2]: Entering directory '/data/libosmo-sigtran/doc' #11 10.38 Making install in examples #11 10.39 make[3]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.39 make[4]: Entering directory '/data/libosmo-sigtran/doc/examples' #11 10.39 make[4]: Nothing to be done for 'install-exec-am'. #11 10.39 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.39 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 10.40 /usr/bin/install -c -m 644 osmo-stp.cfg osmo-stp-multihome.cfg '/usr/local/share/doc/libosmo-sigtran/examples/osmo-stp' #11 10.40 /usr/bin/install -c -m 644 osmo-stp.cfg '/usr/local/etc/osmocom' #11 10.40 make[4]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.40 make[3]: Leaving directory '/data/libosmo-sigtran/doc/examples' #11 10.40 Making install in manuals #11 10.40 make[3]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.41 make[4]: Entering directory '/data/libosmo-sigtran/doc/manuals' #11 10.41 make[4]: Nothing to be done for 'install-exec-am'. #11 10.41 make[4]: Nothing to be done for 'install-data-am'. #11 10.41 make[4]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.41 make[3]: Leaving directory '/data/libosmo-sigtran/doc/manuals' #11 10.42 make[3]: Entering directory '/data/libosmo-sigtran/doc' #11 10.42 make[4]: Entering directory '/data/libosmo-sigtran/doc' #11 10.42 make[4]: Nothing to be done for 'install-exec-am'. #11 10.42 make[4]: Nothing to be done for 'install-data-am'. #11 10.42 make[4]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.42 make[3]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.42 make[2]: Leaving directory '/data/libosmo-sigtran/doc' #11 10.42 Making install in contrib #11 10.43 make[2]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.43 Making install in systemd #11 10.44 make[3]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.45 make[4]: Entering directory '/data/libosmo-sigtran/contrib/systemd' #11 10.45 make[4]: Nothing to be done for 'install-exec-am'. #11 10.45 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.45 /usr/bin/install -c -m 644 osmo-stp.service '/lib/systemd/system' #11 10.46 make[4]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.46 make[3]: Leaving directory '/data/libosmo-sigtran/contrib/systemd' #11 10.46 make[3]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.47 make[4]: Entering directory '/data/libosmo-sigtran/contrib' #11 10.47 make[4]: Nothing to be done for 'install-exec-am'. #11 10.47 make[4]: Nothing to be done for 'install-data-am'. #11 10.47 make[4]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.47 make[3]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.47 make[2]: Leaving directory '/data/libosmo-sigtran/contrib' #11 10.48 make[2]: Entering directory '/data/libosmo-sigtran' #11 10.48 mkdir -p doc/sigtran #11 10.48 /usr/bin/doxygen Doxyfile #11 10.51 warning: Tag 'SYMBOL_CACHE_SIZE' at line 310 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'SHOW_DIRECTORIES' at line 519 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'COLS_IN_ALPHA_INDEX' at line 799 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'HTML_ALIGN_MEMBERS' at line 900 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'USE_INLINE_TREES' at line 1087 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'LATEX_SOURCE_CODE' at line 1247 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'XML_SCHEMA' at line 1339 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'XML_DTD' at line 1345 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'PERL_PATH' at line 1510 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'CLASS_DIAGRAMS' at line 1522 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: Tag 'MSCGEN_PATH' at line 1531 of file 'Doxyfile' has become obsolete. #11 10.51 To avoid this warning please remove this line from your configuration file or upgrade it using "doxygen -u" #11 10.51 warning: argument 'a4wide' for option PAPER_TYPE is not a valid enum value #11 10.51 Using the default: a4! #11 10.54 Doxygen version used: 1.9.4 #11 10.54 Searching for include files... #11 10.54 Searching for example files... #11 10.54 Searching for images... #11 10.54 Searching for dot files... #11 10.54 Searching for msc files... #11 10.54 Searching for dia files... #11 10.54 Searching for files to exclude #11 10.54 Searching INPUT for files to process... #11 10.54 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran #11 10.54 Searching for files in directory /data/libosmo-sigtran/include/osmocom/sigtran/protocol #11 10.54 Searching for files in directory /data/libosmo-sigtran/src #11 10.54 Reading and parsing tag files #11 10.54 Parsing files #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/m2ua_types.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/mtp_sap.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/m3ua.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/mtp.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/protocol/sua.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_helpers.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sccp_sap.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/sigtran_sap.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_msg.h... #11 10.54 Preprocessing /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.54 Parsing file /data/libosmo-sigtran/include/osmocom/sigtran/xua_types.h... #11 10.54 Preprocessing /data/libosmo-sigtran/src/ipa.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/ipa.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/m3ua.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/m3ua.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_as.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_asp_peer.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_hmrt.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_vty.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp2sua.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp2sua.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp_helpers.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_internal.h... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp_internal.h... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp_lbcs.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_sap.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp_sap.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.54 Parsing file /data/libosmo-sigtran/src/sccp_sclc.c... #11 10.54 Preprocessing /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.54 Pars/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.60 ing file /data/libosmo-sigtran/src/sccp_scmg.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sccp_scoc.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sccp_scrc.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sccp_types.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sccp_types.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sccp_user.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sccp_user.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sccp_vty.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sccp_vty.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/ss7_internal.h... #11 10.60 Parsing file /data/libosmo-sigtran/src/ss7_internal.h... #11 10.60 Preprocessing /data/libosmo-sigtran/src/sua.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/sua.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_as_fsm.h... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_asp_fsm.h... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_default_lm_fsm.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_internal.h... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_internal.h... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_msg.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_msg.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_rkm.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_rkm.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_shared.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_shared.c... #11 10.60 Preprocessing /data/libosmo-sigtran/src/xua_snm.c... #11 10.60 Parsing file /data/libosmo-sigtran/src/xua_snm.c... #11 10.60 Building macro definition list... #11 10.60 Building group list... #11 10.60 Building directory list... #11 10.60 Building namespace list... #11 10.60 Building file list... #11 10.60 Building class list... #11 10.60 Building concept list... #11 10.60 Computing nesting relations for classes... #11 10.60 Associating documentation with classes... #11 10.60 Associating documentation with concepts... #11 10.60 Building example list... #11 10.60 Searching for enumerations... #11 10.60 Searching for documented typedefs... #11 10.60 Searching for members imported via using declarations... #11 10.60 Searching for included using directives... #11 10.60 Searching for documented variables... #11 10.60 Building interface member list... #11 10.60 Building member list... #11 10.60 Searching for friends... #11 10.60 Searching for documented defines... #11 10.60 Computing class inheritance relations... #11 10.60 Computing class usage relations... #11 10.60 Flushing cached template relations that have become invalid... #11 10.60 Computing class relations... #11 10.60 Add enum values to enums... #11 10.60 Searching for member function documentation... #11 10.60 Creating members for template instances... #11 10.60 Building page list... #11 10.60 Search for main page... #11 10.60 Computing page relations... #11 10.60 Determining the scope of groups... #11 10.60 Sorting lists... #11 10.60 Determining which enums are documented #11 10.60 Computing member relations... #11 10.60 Building full member lists recursively... #11 10.60 Adding members to member groups. #11 10.60 Computing member references... #11 10.60 Inheriting documentation... #11 10.60 Generating disk names... #11 10.60 Adding source references... #11 10.60 Adding xrefitems... #11 10.60 Sorting member lists... #11 10.60 Setting anonymous enum type... #11 10.60 Computing dependencies between directories... #11 10.60 Generating citations page... #11 10.60 Counting members... #11 10.60 Counting data structures... #11 10.60 Resolving user defined references... #11 10.60 Finding anchors and sections in the documentation... #11 10.60 Transferring function references... #11 10.60 Combining using relations... #11 10.60 Adding members to index pages... #11 10.60 Correcting members for VHDL... #11 10.60 Computing tooltip texts... #11 10.60 Generating style sheet... #11 10.60 Generating search indices... #11 10.60 Generating example documentation... #11 10.60 Generating file sources... #11 10.60 Generating code for file include/osmocom/sigtran/m2ua_types.h... #11 10.60 Generating code for file include/osmocom/sigtran/mtp_sap.h... #11 10.60 Generating code for file include/osmocom/sigtran/osmo_ss7.h... #11 10.60 Generating code for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.60 Generating code for file in/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: argument 'ppid_sid' of command @param is not found in the argument list of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) #11 10.68 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:514: warning: The following parameter of osmo_ss7_asp_rx_unknown_cb(struct osmo_ss7_asp *asp, int ppid_mux, struct msgb *msg) is not documented: #11 10.68 parameter 'ppid_mux' #11 10.68 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.68 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.68 parameter 'inst' #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.68 parameter 'asp_name' #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.68 parameter 'asp_name' #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.68 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.69 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.69 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.69 parameter 'inst' #11 10.69 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.69 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.69 parameter 'addr' #11 10.69 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.69 parameter 'prim_cb' #11 10.69 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.69 parameter 'prim_cb' #11 10.69 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.69 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.69 parameter 'num_maps' #11 10.70 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.70 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.70 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.70 parameter 'info_str' #11 10.70 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.70 /data/libosmo-sigtran/src/osmo_ss7.c:1003: warning: unable to resolve reference to 'asp' for \ref command #11 10.70 /data/libosmo-sigtran/src/osmo_ss7.c:734: warning: unable to resolve reference to 'pc' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: unable to resolve reference to 'asp' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:98: warning: unable to resolve reference to 'as' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:97: warning: The following parameter of osmo_ss7_as_add_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.71 parameter 'asp_name' #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: unable to resolve reference to 'asp' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: argument 'asp' of command @param is not found in the argument list of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:129: warning: unable to resolve reference to 'as' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:128: warning: The following parameter of osmo_ss7_as_del_asp(struct osmo_ss7_as *as, const char *asp_name) is not documented: #11 10.71 parameter 'asp_name' #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:178: warning: unable to resolve reference to 'asp' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:179: warning: unable to resolve reference to 'as' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'asp' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_as.c:180: warning: unable to resolve reference to 'as' for \ref command #11 10.71 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.71 parameter 'trans_proto' #11 10.72 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: argument 'name' of command @param is not found in the argument list of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) #11 10.72 /data/libosmo-sigtran/src/osmo_ss7_vty.c:2275: warning: The following parameter of osmo_sccp_name_by_addr(const struct osmo_sccp_addr *addr) is not documented: #11 10.72 parameter 'addr' #11 10.72 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: argument 'ctx' of command @param is not found in the argument list of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) #11 10.72 /data/libosmo-sigtran/src/osmo_ss7_xua_srv.c:251: warning: The following parameter of osmo_ss7_xua_server_create(struct osmo_ss7_instance *inst, enum osmo_ss7_asp_protocol proto, uint16_t local_port, const char *local_host) is not documented: #11 10.72 parameter 'inst' #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:92: warning: unable to resolve reference to 'in_digits' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:320: warning: unable to resolve reference to 'addr' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:682: warning: The following parameter of sccp_msg_add_sua_opt(enum sccp_message_types type, struct msgb *msg, const struct xua_msg_part *opt) is not documented: #11 10.72 parameter 'type' #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1176: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1140: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1209: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1300: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1638: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1599: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1429: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1559: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:797: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1271: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1238: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1332: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1468: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1382: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1519: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1189: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1156: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:1221: warning: unable to resolve reference to 'xua' for \ref command #11 10.72 /data/libosmo-sigtran/src/sccp2sua.c:565: warning: unable to resolve reference to 'opt' for \ref command #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.73 parameter 'oph' #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.73 parameter 'oph' #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:143: warning: The following parameter of sccp_sclc_user_sap_down(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.73 parameter 'oph' #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: argument 'on' of command @param is not found in the argument list of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) #11 10.73 /data/libosmo-sigtran/src/sccp_sclc.c:119: warning: The following parameter of sccp_sclc_user_sap_down_nofree(struct osmo_sccp_user *scu, struct osmo_prim_hdr *oph) is not documented: #11 10.73 parameter 'oph' #11 10.74 /data/libosmo-sigtran/src/sccp_user.c:881: warning: argument 'sccp' of command @param is not found in the argument list of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) #11 10.74 /data/libosmo-sigtran/src/sccp_user.c:881: warning: The following parameter of osmo_sccp_set_max_optional_data(struct osmo_sccp_instance *inst, int val) is not documented: #11 10.74 parameter 'inst' #11 10.74 /data/libosmo-sigtran/src/sccp_user.c:136: warning: The following parameter of osmo_sccp_user_bind(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn) is not documented: #11 10.74 parameter 'prim_cb' #11 10.74 /data/libosmo-sigtran/src/sccp_user.c:123: warning: The following parameter of osmo_sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.74 parameter 'prim_cb' #11 10.74 /data/libosmo-sigtran/src/sccp_user.c:88: warning: The following parameter of sccp_user_bind_pc(struct osmo_sccp_instance *inst, const char *name, osmo_prim_cb prim_cb, uint16_t ssn, uint32_t pc) is not documented: #11 10.74 parameter 'prim_cb' #11 10.74 /data/libosmo-sigtran/src/osmo_ss7_asp.c:459: warning: The following parameter of ss7_asp_find_by_socket_addr(int fd, int trans_proto) is not documented: #11 10.74 parameter 'trans_proto' #11 10.75 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.75 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.75 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.75 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.75 parameter 'info_str' #11 10.75 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.76 /data/libosmo-sigtran/src/m3ua.c:719: warning: unable to resolve reference to 'msg' for \ref command #11 10.76 /data/libosmo-sigtran/src/m3ua.c:935: warning: argument 'info_string' of command @param is not found in the argument list of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.76 /data/libosmo-sigtran/src/m3ua.c:935: warning: The following parameter of m3ua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.76 parameter 'info_str' #11 10.76 /data/libosmo-sigtran/src/m3ua.c:508: warning: unable to resolve reference to 'xua' for \ref command #11 10.76 /data/libosmo-sigtran/src/sccp2sua.c:69: warning: unable to resolve reference to 'in' for \ref command #11 10.76 /data/libosmo-sigtran/src/sccp2sua.c:224: warning: unable to resolve reference to 'msg' for \ref command #11 10.76 /data/libosmo-sigtran/src/sccp2sua.c:116: warning: unable to resolve reference to 'addr' for \ref command #11 10.76 /data/libosmo-sigtran/src/sua.c:504: warning: unable to resolve reference to 'xua' for \ref command #11 10.76 /data/libosmo-sigtran/src/sua.c:678: warning: unable to resolve reference to 'msg' for \ref command #11 10.76 /data/libosmo-sigtran/src/sua.c:914: warning: argument 'info_string' of command @param is not found in the argument list of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) #11 10.76 /data/libosmo-sigtran/src/sua.c:914: warning: The following parameter of sua_tx_dupu(struct osmo_ss7_asp *asp, const uint32_t *rctx, unsigned int num_rctx, uint32_t dpc, uint16_t user, uint16_t cause, const char *info_str) is not documented: #11 10.76 parameter 'info_str' #11 10.76 /data/libosmo-sigtran/src/sua.c:302: warning: unable to resolve reference to 'xua' for \ref command #11 10.76 /data/libosmo-sigtran/src/xua_msg.c:433: warning: unable to resolve reference to 'maps' for \ref command #11 10.76 /data/libosmo-sigtran/src/xua_msg.c:431: warning: The following parameter of xua_msg_event_map(const struct xua_msg *xua, const struct xua_msg_event_map *maps, unsigned int num_maps) is not documented: #11 10.76 parameter 'num_maps' #11 10.76 clude/osmocom/sigtran/protocol/mtp.h... #11 10.76 Generating code for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.76 Generating code for file include/osmocom/sigtran/protocol/sua.h... #11 10.76 Generating code for file include/osmocom/sigtran/sccp_helpers.h... #11 10.76 Generating code for file include/osmocom/sigtran/sccp_sap.h... #11 10.76 Generating code for file include/osmocom/sigtran/sigtran_sap.h... #11 10.76 Generating code for file include/osmocom/sigtran/xua_msg.h... #11 10.76 Generating code for file include/osmocom/sigtran/xua_types.h... #11 10.76 Parsing code for file src/ipa.c... #11 10.76 Parsing code for file src/m3ua.c... #11 10.76 Parsing code for file src/osmo_ss7.c... #11 10.76 Parsing code for file src/osmo_ss7_as.c... #11 10.76 Parsing code for file src/osmo_ss7_asp.c... #11 10.76 Parsing code for file src/osmo_ss7_asp_peer.c... #11 10.76 Parsing code for file src/osmo_ss7_hmrt.c... #11 10.76 Parsing code for file src/osmo_ss7_vty.c... #11 10.76 Parsing code for file src/osmo_ss7_xua_srv.c... #11 10.76 Parsing code for file src/sccp2sua.c... #11 10.76 Parsing code for file src/sccp_helpers.c... #11 10.76 Generating code for file src/sccp_internal.h... #11 10.76 Parsing code for file src/sccp_lbcs.c... #11 10.76 Parsing code for file src/sccp_sap.c... #11 10.76 Parsing code for file src/sccp_sclc.c... #11 10.76 Parsing code for file src/sccp_scmg.c... #11 10.76 Parsing code for file src/sccp_scoc.c... #11 10.76 Parsing code for file src/sccp_scrc.c... #11 10.76 Parsing code for file src/sccp_types.c... #11 10.76 Parsing code for file src/sccp_user.c... #11 10.76 Parsing code for file src/sccp_vty.c... #11 10.76 Generating code for file src/ss7_internal.h... #11 10.76 Parsing code for file src/sua.c... #11 10.76 Parsing code for file src/xua_as_fsm.c... #11 10.76 Generating code for file src/xua_as_fsm.h... #11 10.76 Parsing code for file src/xua_asp_fsm.c... #11 10.76 Generating code for file src/xua_asp_fsm.h... #11 10.76 Parsing code for file src/xua_default_lm_fsm.c... #11 10.76 Generating code for file src/xua_internal.h... #11 10.76 Parsing code for file src/xua_msg.c... #11 10.76 Parsing code for file src/xua_rkm.c... #11 10.76 Parsing code for file src/xua_shared.c... #11 10.76 Parsing code for file src/xua_snm.c... #11 10.76 Generating file documentation... #11 10.76 Generating docs for file include/osmocom/sigtran/m2ua_types.h... #11 10.76 Generating docs for file include/osmocom/sigtran/mtp_sap.h... #11 10.76 Generating docs for file include/osmocom/sigtran/osmo_ss7.h... #11 10.76 Generating docs for file include/osmocom/sigtran/protocol/m3ua.h... #11 10.76 Generating docs for file include/osmocom/sigtran/protocol/mtp.h... #11 10.76 Generating docs for file include/osmocom/sigtran/protocol/sccp_scmg.h... #11 10.76 Generating docs for file include/osmocom/sigtran/protocol/sua.h... #11 10.76 Generating docs for file include/osmocom/sigtran/sccp_helpers.h... #11 10.76 Generating docs for file include/osmocom/sigtran/sccp_sap.h... #11 10.76 Generating docs for file include/osmocom/sigtran/sigtran_sap.h... #11 10.76 Generating docs for file include/osmocom/sigtran/xua_msg.h... #11 10.76 Generating docs for file include/osmocom/sigtran/xua_types.h... #11 10.76 Generating docs for file src/ipa.c... #11 10.76 Generating docs for file src/m3ua.c... #11 10.76 Generating docs for file src/osmo_ss7.c... #11 10.76 Generating docs for file src/osmo_ss7_as.c... #11 10.76 Generating docs for file src/osmo_ss7_asp.c... #11 10.76 Generating docs for file src/osmo_ss7_asp_peer.c... #11 10.76 Generating docs for file src/osmo_ss7_hmrt.c... #11 10.76 Generating docs for file src/osmo_ss7_vty.c... #11 10.76 Generating docs for file src/osmo_ss7_xua_srv.c... #11 10.76 Generating docs for file src/sccp2sua.c... #11 10.76 Generating docs for file src/sccp_helpers.c... #11 10.76 Generating docs for file src/sccp_internal.h... #11 10.76 Generating docs for file src/sccp_lbcs.c... #11 10.76 Generating docs for file src/sccp_sap.c... #11 10.76 Generating docs for file src/sccp_sclc.c... #11 10.76 Generating docs for file src/sccp_scmg.c... #11 10.76 Generating docs for file src/sccp_scoc.c... #11 10.76 Generating docs for file src/sccp_scrc.c... #11 10.76 Generating docs for file src/sccp_types.c... #11 10.76 Generating docs for file src/sccp_user.c... #11 10.76 Generating docs for file src/sccp_vty.c... #11 10.76 Generating docs for file src/ss7_internal.h... #11 10.76 Generating docs for file src/sua.c... #11 10.76 Generating docs for file src/xua_as_fsm.c... #11 10.76 Generating docs for file src/xua_as_fsm.h... #11 10.76 Generating docs for file src/xua_asp_fsm.c... #11 10.76 Generating docs for file src/xua_asp_fsm.h... #11 10.76 Generating docs for file src/xua_default_lm_fsm.c... #11 10.76 Generating docs for file src/xua_internal.h... #11 10.76 Generating docs for file src/xua_msg.c... #11 10.76 Generating docs for fil/data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.78 /data/libosmo-sigtran/include/osmocom/sigtran/osmo_ss7.h:84: warning: unable to resolve reference to 'osmo_xua_servers' for \ref command #11 10.84 e src/xua_rkm.c... #11 10.84 Generating docs for file src/xua_shared.c... #11 10.84 Generating docs for file src/xua_snm.c... #11 10.84 Generating page documentation... #11 10.84 Generating group documentation... #11 10.84 Generating class documentation... #11 10.84 Generating docs for compound ipa_asp_fsm_priv... #11 10.84 Generating docs for compound lm_fsm_priv... #11 10.84 Generating docs for compound m3ua_data_hdr... #11 10.84 Generating docs for compound osmo_mtp_pause_param... #11 10.84 Generating docs for compound osmo_mtp_prim... #11 10.84 Generating docs for compound osmo_mtp_resume_param... #11 10.84 Generating docs for compound osmo_mtp_status_param... #11 10.84 Generating docs for compound osmo_mtp_transfer_param... #11 10.84 Generating docs for compound osmo_sccp_addr... #11 10.84 Generating docs for compound osmo_sccp_addr_entry... #11 10.84 Generating docs for compound osmo_sccp_gt... #11 10.84 Generating docs for compound osmo_sccp_instance... #11 10.84 Generating docs for compound osmo_sccp_user... #11 10.84 Generating docs for compound osmo_scu_connect_param... #11 10.84 Generating docs for compound osmo_scu_data_param... #11 10.84 Generating docs for compound osmo_scu_disconn_param... #11 10.84 Generating docs for compound osmo_scu_notice_param... #11 10.84 Generating docs for compound osmo_scu_pcstate_param... #11 10.84 Generating docs for compound osmo_scu_prim... #11 10.84 Generating docs for compound osmo_scu_reset_param... #11 10.84 Generating docs for compound osmo_scu_state_param... #11 10.84 Generating docs for compound osmo_scu_unitdata_param... #11 10.84 Generating docs for compound osmo_ss7_as... #11 10.84 Generating docs for compound osmo_ss7_asp... #11 10.84 Generating docs for compound osmo_ss7_asp_peer... #11 10.84 Generating docs for compound osmo_ss7_instance... #11 10.84 Generating docs for compound osmo_ss7_link... #11 10.84 Generating docs for compound osmo_ss7_linkset... #11 10.84 Generating docs for compound osmo_ss7_pc_fmt... #11 10.84 Generating docs for compound osmo_ss7_route... #11 10.84 Generating docs for compound osmo_ss7_route_table... #11 10.84 Generating docs for compound osmo_ss7_routing_key... #11 10.84 Generating docs for compound osmo_ss7_user... #11 10.84 Generating docs for compound osmo_xlm_prim... #11 10.84 Generating docs for compound osmo_xlm_prim_error... #11 10.84 Generating docs for compound osmo_xlm_prim_notify... #11 10.84 Generating docs for compound osmo_xlm_prim_rk_dereg... #11 10.84 Generating docs for compound osmo_xlm_prim_rk_reg... #11 10.84 Generating docs for compound osmo_xua_layer_manager... #11 10.84 Generating docs for compound osmo_xua_server... #11 10.84 Generating docs for compound sccp_connection... #11 10.84 Generating docs for compound sccp_scmg_msg... #11 10.84 Generating docs for compound xua_as_fsm_priv... #11 10.84 Generating docs for compound xua_asp_fsm_priv... #11 10.84 Generating docs for compound xua_common_hdr... #11 10.84 Generating docs for compound xua_dialect... #11 10.84 Generating docs for compound xua_msg... #11 10.84 Generating docs for compound xua_msg_class... #11 10.84 Generating docs for compound xua_msg_event_map... #11 10.84 Generating docs for compound xua_msg_part... #11 10.84 Generating docs for compound xua_parameter_hdr... #11 10.84 Generating concept documentation... #11 10.84 Generating namespace index... #11 10.84 Generating graph info page... #11 10.84 Generating directory documentation... #11 10.84 Generating index page... #11 10.84 Generating page index... #11 10.84 Generating module index... #11 10.84 Generating namespace index... #11 10.84 Generating namespace member index... #11 10.84 Generating concept index... #11 10.84 Generating annotated compound index... #11 10.84 Generating alphabetical compound index... #11 10.84 Generating hierarchical class index... #11 10.84 Generating member index... #11 10.84 Generating file index... #11 10.84 Generating file member index... #11 10.84 Generating example index... #11 10.84 finalizing index lists... #11 10.84 writing tag file... #11 10.84 Running plantuml with JAVA... #11 10.84 lookup cache used 2094/65536 hits=24055 misses=2248 #11 10.84 finished... #11 10.85 cd ./doc && tar cf html.tar */html #11 10.86 make[3]: Entering directory '/data/libosmo-sigtran' #11 10.86 make[3]: Nothing to be done for 'install-exec-am'. #11 10.86 /usr/bin/mkdir -p '/usr/local/share/doc/libosmo-sigtran' #11 10.86 /usr/bin/mkdir -p '/usr/local/lib/pkgconfig' #11 10.86 /usr/bin/install -c -m 644 ./doc/html.tar '/usr/local/share/doc/libosmo-sigtran' #11 10.86 /usr/bin/install -c -m 644 libosmo-sigtran.pc '/usr/local/lib/pkgconfig' #11 10.86 make install-data-hook #11 10.87 make[4]: Entering directory '/data/libosmo-sigtran' #11 10.87 cd /usr/local/share/doc/libosmo-sigtran && tar xf html.tar && rm -f html.tar #11 10.89 make[4]: Leaving directory '/data/libosmo-sigtran' #11 10.89 make[3]: Leaving directory '/data/libosmo-sigtran' #11 10.89 make[2]: Leaving directory '/data/libosmo-sigtran' #11 10.89 make[1]: Leaving directory '/data/libosmo-sigtran' #11 DONE 11.1s #12 [7/7] COPY OSMO-STP.CFG /data/ #12 DONE 0.1s #13 exporting to image #13 exporting layers #13 exporting layers 0.6s done #13 writing image sha256:6f89a43acaf79b45130f79c5d2f50e0f93bd28acc203d9898d9ea799ed45addf done #13 naming to docker.io/osmocom-build/osmo-stp-master:latest 0.0s done #13 DONE 0.6s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-stp-master' + docker_image_exists osmo-stp-master + docker images -q osmocom-build/osmo-stp-master + test -n 6f89a43acaf7 + list_osmo_packages debian-bookworm osmo-stp-master + local distro=debian-bookworm + local image=osmo-stp-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-stp-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-stp-master ### ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202409222026 amd64 Development headers for Osmocom network interface ii libosmocodec4:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo coding library ii libosmocore 1.10.0.13.ddc5.202409222026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.13.ddc5.202409222026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202409222026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo SIM library ii libosmousb0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo VTY library ii osmocom-nightly 202409222026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends osmo-hnbgw-master + local feed + echo debian-bookworm-build + depends=debian-bookworm-build + [ -n debian-bookworm-build ] + docker_images_require debian-bookworm-build + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends debian-bookworm-build + local feed + depends= + [ -n ] + docker_distro_from_image_name debian-bookworm-build + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name debian-bookworm-build + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name debian-bookworm-build + echo debian-bookworm-build + dir=debian-bookworm-build + pull_arg=--pull + grep ^FROM ../debian-bookworm-build/Dockerfile + from_line=FROM ${REGISTRY}/${UPSTREAM_DISTRO} + echo FROM ${REGISTRY}/${UPSTREAM_DISTRO} + grep -q $USER + set +x Building image: debian-bookworm-build (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../debian-bookworm-build BUILD_ARGS=--pull UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/debian-bookworm-build OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ --pull -t osmocom-build/debian-bookworm-build:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 5.76kB done #2 DONE 0.0s #3 [auth] sharing credentials for registry.osmocom.org #3 DONE 0.0s #4 [internal] load metadata for registry.osmocom.org/debian:bookworm #4 DONE 0.0s #5 [internal] load build context #5 DONE 0.0s #6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12//Release #6 DONE 0.0s #7 https://gitea.osmocom.org/sim-card/pysim/raw/branch/master/requirements.txt #7 DONE 0.0s #8 [ 1/16] FROM registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf #8 resolve registry.osmocom.org/debian:bookworm@sha256:3521cd844df5a6f3fd71217af1fc8222db5a7138a753eef86a0550d153184cdf 0.1s done #8 DONE 0.1s #9 https://gerrit.osmocom.org/plugins/gitiles/osmo-gsm-manuals/+/master?format=TEXT #9 DONE 0.1s #10 https://gerrit.osmocom.org/plugins/gitiles/osmo-ci/+/master?format=TEXT #10 DONE 0.2s #11 https://gerrit.osmocom.org/plugins/gitiles/python/osmo-python-tests/+/master?format=TEXT #11 DONE 0.2s #5 [internal] load build context #5 transferring context: 1.96kB done #5 DONE 0.0s #12 [13/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-GSM-MANUALS/+/MASTER?FORMAT=TEXT /tmp/osmo-gsm-manuals-commit #12 CACHED #13 [15/16] ADD HTTPS://DOWNLOADS.OSMOCOM.ORG/PACKAGES/OSMOCOM:/NIGHTLY/DEBIAN_12//RELEASE /tmp/Release #13 CACHED #14 [ 3/16] COPY .COMMON/RELEASE.KEY /etc/apt/trusted.gpg.d/obs.osmocom.org.asc #14 CACHED #15 [14/16] RUN GIT -C /opt clone --depth=1 https://gerrit.osmocom.org/osmo-gsm-manuals #15 CACHED #16 [ 6/16] RUN SET -x && apt-get update && apt-get install -y --no-install-recommends asciidoc asciidoc-dblatex autoconf autoconf-archive autogen automake bc bison build-essential bzip2 ca-certificates ccache cmake coccinelle cppcheck curl dahdi-source dblatex dbus debhelper devscripts dh-autoreconf docbook5-xml doxygen equivs flex g++ gawk gcc gcc-arm-none-eabi ghostscript git gnupg graphviz htop iproute2 latexmk lcov libaio-dev libasound2-dev libbladerf-dev libboost-all-dev libc-ares-dev libcdk5-dev libcsv-dev libdbd-sqlite3 libdbi-dev libelf-dev libffi-dev libfftw3-dev libgmp-dev libgnutls28-dev libgps-dev libgsm1-dev libjansson-dev liblua5.3-dev libmnl-dev libncurses5-dev libnewlib-arm-none-eabi libnftables-dev libnftnl-dev libnl-3-dev libnl-route-3-dev liboping-dev libortp-dev libpcap-dev libpcsclite-dev libreadline-dev librsvg2-bin libsctp-dev libsigsegv-dev libsnmp-dev libsofia-sip-ua-glib-dev libsqlite3-dev libssl-dev libtalloc-dev libtinfo5 libtool liburing-dev libusb-1.0-0-dev libusb-dev libxml2-utils libzmq3-dev locales lua-socket make mscgen ofono openssh-client patchelf picolibc-arm-none-eabi pkg-config pylint python3 python3-gi python3-mako python3-nwdiag python3-pip python3-pyflakes python3-setuptools python3-usb python3-yaml rsync sdcc source-highlight sqlite3 stow sudo swig systemd tcpdump telnet tex-gyre texinfo unzip virtualenv xsltproc && apt-get clean #16 CACHED #17 [ 4/16] RUN SET -x && useradd --uid=1000 -d /build -m build && chown -R build:build /usr/local && echo "path-exclude=/usr/share/man/*" > /etc/dpkg/dpkg.cfg.d/exclude-man-pages && rm -rf /usr/share/man/ #17 CACHED #18 [ 7/16] ADD HTTPS://GITEA.OSMOCOM.ORG/SIM-CARD/PYSIM/RAW/BRANCH/MASTER/REQUIREMENTS.TXT /tmp/pysim_requirements.txt #18 CACHED #19 [12/16] RUN set -x && git clone --depth=1 https://gerrit.osmocom.org/osmo-ci osmo-ci && su build -c "cd osmo-ci/scripts && cp -v *.sh *.py /usr/local/bin" && rm -rf osmo-ci #19 CACHED #20 [ 8/16] RUN SET -x && cat /tmp/pysim_requirements.txt && pip3 install --break-system-packages 'git+https://github.com/eriwen/lcov-to-cobertura-xml.git' 'git+https://github.com/osmocom/sphinx-argparse@inside-classes#egg=sphinx-argparse' 'git+https://github.com/podshumok/python-smpplib.git' 'pydbus' 'pysispm' 'sphinx' 'sphinxcontrib-napoleon' -r /tmp/pysim_requirements.txt #20 CACHED #21 [10/16] RUN SET -x && git clone --depth=1 https://gerrit.osmocom.org/python/osmo-python-tests osmo-python-tests && cd osmo-python-tests && python3 setup.py clean build install && cd .. && rm -rf osmo-python-tests #21 CACHED #22 [11/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-CI/+/MASTER?FORMAT=TEXT /tmp/osmo-ci-commit #22 CACHED #23 [ 2/16] COPY .COMMON/RESPAWN.SH /usr/local/bin/respawn.sh #23 CACHED #24 [ 9/16] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/PYTHON/OSMO-PYTHON-TESTS/+/MASTER?FORMAT=TEXT /tmp/osmo-python-tests-commit #24 CACHED #25 [ 5/16] RUN IF [ "$(arch)" != "x86_64" ]; then echo "ERROR: use debian-bookworm-build-arm instead"; exit 1; fi && set -x && apt-get update && apt-get install -y --no-install-recommends ca-certificates libtinfo5 wget && apt-get clean && wget https://github.com/ARM-software/LLVM-embedded-toolchain-for-Arm/releases/download/release-14.0.0/LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && tar -xf LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && rm LLVMEmbeddedToolchainForArm-14.0.0-linux.tar.gz && mv LLVMEmbeddedToolchainForArm-14.0.0 /opt/llvm-arm && /opt/llvm-arm/bin/clang --version && /opt/llvm-arm/bin/clang --print-targets #25 CACHED #26 [16/16] RUN SET -x && echo "deb [signed-by=/etc/apt/trusted.gpg.d/obs.osmocom.org.asc] https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12/ ./" > /etc/apt/sources.list.d/osmocom-nightly.list && apt-get update && apt-get install -y --no-install-recommends liblimesuite-dev libuhd-dev libulfius-dev && apt-get clean #26 CACHED #27 exporting to image #27 exporting layers done #27 writing image sha256:1ecbeb047988831dc004529ba665ecef5f9d654ff2a1f173e3b5bf72e70fdbc2 done #27 naming to docker.io/osmocom-build/debian-bookworm-build:latest done #27 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/debian-bookworm-build' + docker_image_exists debian-bookworm-build + docker images -q osmocom-build/debian-bookworm-build + test -n 1ecbeb047988 + list_osmo_packages debian-bookworm debian-bookworm-build + local distro=debian-bookworm + local image=debian-bookworm-build + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/debian-bookworm-build -c + [ -n ] + return + docker_distro_from_image_name osmo-hnbgw-master + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name osmo-hnbgw-master + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name osmo-hnbgw-master + echo osmo-hnbgw-master + dir=osmo-hnbgw-master + pull_arg=--pull + grep ^FROM ../osmo-hnbgw-master/Dockerfile + from_line=FROM $USER/$DISTRO-build + echo FROM $USER/$DISTRO-build + grep -q $USER + pull_arg= + set +x Building image: osmo-hnbgw-master (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../osmo-hnbgw-master BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/osmo-hnbgw-master OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-hnbgw-master' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/osmo-hnbgw-master:latest . #0 building with "default" instance using docker driver #1 [internal] load .dockerignore #1 transferring context: 2B done #1 DONE 0.0s #2 [internal] load build definition from Dockerfile #2 transferring dockerfile: 1.16kB done #2 DONE 0.0s #3 [internal] load metadata for docker.io/osmocom-build/debian-bookworm-build:latest #3 DONE 0.0s #4 [internal] load build context #4 DONE 0.0s #5 [1/8] FROM docker.io/osmocom-build/debian-bookworm-build #5 CACHED #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 ... #7 https://gerrit.osmocom.org/plugins/gitiles/osmo-hnbgw/+/master?format=TEXT #7 CACHED #4 [internal] load build context #4 transferring context: 864B done #4 DONE 0.0s #6 [2/8] RUN APT-GET update && apt-get install -y --no-install-recommends libosmocore-dev libosmo-abis-dev libosmo-mgcp-client-dev libosmo-netif-dev libosmo-sigtran-dev libosmo-ranap-dev libosmo-rua-dev libosmo-hnbap-dev libasn1c-dev libosmo-pfcp-dev && apt-get clean #6 0.364 Hit:1 http://deb.debian.org/debian bookworm InRelease #6 0.364 Hit:2 http://deb.debian.org/debian bookworm-updates InRelease #6 0.364 Hit:3 http://deb.debian.org/debian-security bookworm-security InRelease #6 0.364 Hit:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ InRelease #6 0.810 Reading package lists... #6 1.062 Reading package lists... #6 1.314 Building dependency tree... #6 1.367 Reading state information... #6 1.429 The following additional packages will be installed: #6 1.429 libasn1c1 libosmo-gtlv-dev libosmo-gtlv1 libosmo-hnbap0 #6 1.429 libosmo-mgcp-client14 libosmo-pfcp0 libosmo-ranap7 libosmo-rua0 #6 1.429 libosmo-sigtran10 libosmoabis13 libosmocodec4 libosmocoding0 libosmocore #6 1.429 libosmocore22 libosmoctrl0 libosmogb14 libosmogsm20 libosmoisdn0 #6 1.429 libosmonetif11 libosmosim2 libosmotrau10 libosmousb0 libosmovty13 #6 1.429 osmocom-nightly #6 1.442 The following NEW packages will be installed: #6 1.442 libasn1c-dev libasn1c1 libosmo-abis-dev libosmo-gtlv-dev libosmo-gtlv1 #6 1.442 libosmo-hnbap-dev libosmo-hnbap0 libosmo-mgcp-client-dev #6 1.442 libosmo-mgcp-client14 libosmo-netif-dev libosmo-pfcp-dev libosmo-pfcp0 #6 1.442 libosmo-ranap-dev libosmo-ranap7 libosmo-rua-dev libosmo-rua0 #6 1.442 libosmo-sigtran-dev libosmo-sigtran10 libosmoabis13 libosmocodec4 #6 1.442 libosmocoding0 libosmocore libosmocore-dev libosmocore22 libosmoctrl0 #6 1.442 libosmogb14 libosmogsm20 libosmoisdn0 libosmonetif11 libosmosim2 #6 1.442 libosmotrau10 libosmousb0 libosmovty13 osmocom-nightly #6 1.463 0 upgraded, 34 newly installed, 0 to remove and 6 not upgraded. #6 1.463 Need to get 4003 kB of archives. #6 1.463 After this operation, 17.9 MB of additional disk space will be used. #6 1.463 Get:1 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ osmocom-nightly 202409222026 [1180 B] #6 1.487 Get:2 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore22 1.10.0.13.ddc5.202409222026 [168 kB] #6 1.491 Get:3 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocodec4 1.10.0.13.ddc5.202409222026 [50.6 kB] #6 1.492 Get:4 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmotrau10 1.6.0.11.0d73.202409222026 [31.6 kB] #6 1.493 Get:5 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoisdn0 1.10.0.13.ddc5.202409222026 [69.8 kB] #6 1.495 Get:6 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogsm20 1.10.0.13.ddc5.202409222026 [227 kB] #6 1.499 Get:7 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmovty13 1.10.0.13.ddc5.202409222026 [103 kB] #6 1.502 Get:8 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoabis13 1.6.0.11.0d73.202409222026 [73.2 kB] #6 1.504 Get:9 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-abis-dev 1.6.0.11.0d73.202409222026 [114 kB] #6 1.507 Get:10 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv1 0.4.0.1.c4dc.202409222026 [16.5 kB] #6 1.509 Get:11 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocoding0 1.10.0.13.ddc5.202409222026 [70.3 kB] #6 1.510 Get:12 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmogb14 1.10.0.13.ddc5.202409222026 [177 kB] #6 1.513 Get:13 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmoctrl0 1.10.0.13.ddc5.202409222026 [58.8 kB] #6 1.515 Get:14 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmosim2 1.10.0.13.ddc5.202409222026 [62.9 kB] #6 1.517 Get:15 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmousb0 1.10.0.13.ddc5.202409222026 [49.6 kB] #6 1.518 Get:16 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore 1.10.0.13.ddc5.202409222026 [43.0 kB] #6 1.520 Get:17 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmocore-dev 1.10.0.13.ddc5.202409222026 [846 kB] #6 1.528 Get:18 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-gtlv-dev 0.4.0.1.c4dc.202409222026 [57.3 kB] #6 1.528 Get:19 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmonetif11 1.5.1.5.89a1.202409222026 [53.9 kB] #6 1.529 Get:20 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-netif-dev 1.5.1.5.89a1.202409222026 [66.1 kB] #6 1.531 Get:21 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp0 0.4.0.1.c4dc.202409222026 [40.7 kB] #6 1.532 Get:22 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-pfcp-dev 0.4.0.1.c4dc.202409222026 [170 kB] #6 1.535 Get:23 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran10 2.0.0.3.e1ad.202409222026 [125 kB] #6 1.537 Get:24 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-sigtran-dev 2.0.0.3.e1ad.202409222026 [586 kB] #6 1.551 Get:25 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c1 0.9.37.202409222026 [75.2 kB] #6 1.560 Get:26 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libasn1c-dev 0.9.37.202409222026 [106 kB] #6 1.561 Get:27 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap0 1.6.0.1.4a6b5.202409222026 [51.9 kB] #6 1.561 Get:28 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-hnbap-dev 1.6.0.1.4a6b5.202409222026 [24.9 kB] #6 1.561 Get:29 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client14 1.13.1.202409222026 [57.6 kB] #6 1.562 Get:30 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-mgcp-client-dev 1.13.1.202409222026 [66.5 kB] #6 1.562 Get:31 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap7 1.6.0.1.4a6b5.202409222026 [225 kB] #6 1.564 Get:32 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-ranap-dev 1.6.0.1.4a6b5.202409222026 [92.1 kB] #6 1.564 Get:33 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua0 1.6.0.1.4a6b5.202409222026 [28.1 kB] #6 1.564 Get:34 https://downloads.osmocom.org/packages/osmocom:/nightly/Debian_12 ./ libosmo-rua-dev 1.6.0.1.4a6b5.202409222026 [14.7 kB] #6 1.677 debconf: delaying package configuration, since apt-utils is not installed #6 1.718 Fetched 4003 kB in 0s (33.5 MB/s) #6 1.781 Selecting previously unselected package osmocom-nightly. #6 1.781 (Reading database ... (Reading database ... 5% (Reading database ... 10% (Reading database ... 15% (Reading database ... 20% (Reading database ... 25% (Reading database ... 30% (Reading database ... 35% (Reading database ... 40% (Reading database ... 45% (Reading database ... 50% (Reading database ... 55% (Reading database ... 60% (Reading database ... 65% (Reading database ... 70% (Reading database ... 75% (Reading database ... 80% (Reading database ... 85% (Reading database ... 90% (Reading database ... 95% (Reading database ... 100% (Reading database ... 117405 files and directories currently installed.) #6 1.822 Preparing to unpack .../00-osmocom-nightly_202409222026_amd64.deb ... #6 1.839 Unpacking osmocom-nightly (202409222026) ... #6 1.942 Selecting previously unselected package libosmocore22:amd64. #6 1.950 Preparing to unpack .../01-libosmocore22_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 1.983 Unpacking libosmocore22:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.118 Selecting previously unselected package libosmocodec4:amd64. #6 2.136 Preparing to unpack .../02-libosmocodec4_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.153 Unpacking libosmocodec4:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.288 Selecting previously unselected package libosmotrau10:amd64. #6 2.305 Preparing to unpack .../03-libosmotrau10_1.6.0.11.0d73.202409222026_amd64.deb ... #6 2.323 Unpacking libosmotrau10:amd64 (1.6.0.11.0d73.202409222026) ... #6 2.466 Selecting previously unselected package libosmoisdn0:amd64. #6 2.484 Preparing to unpack .../04-libosmoisdn0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.502 Unpacking libosmoisdn0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.645 Selecting previously unselected package libosmogsm20:amd64. #6 2.653 Preparing to unpack .../05-libosmogsm20_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.670 Unpacking libosmogsm20:amd64 (1.10.0.13.ddc5.202409222026) ... #6 2.818 Selecting previously unselected package libosmovty13:amd64. #6 2.826 Preparing to unpack .../06-libosmovty13_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 2.843 Unpacking libosmovty13:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.005 Selecting previously unselected package libosmoabis13:amd64. #6 3.023 Preparing to unpack .../07-libosmoabis13_1.6.0.11.0d73.202409222026_amd64.deb ... #6 3.041 Unpacking libosmoabis13:amd64 (1.6.0.11.0d73.202409222026) ... #6 3.158 Selecting previously unselected package libosmo-abis-dev:amd64. #6 3.175 Preparing to unpack .../08-libosmo-abis-dev_1.6.0.11.0d73.202409222026_amd64.deb ... #6 3.193 Unpacking libosmo-abis-dev:amd64 (1.6.0.11.0d73.202409222026) ... #6 3.339 Selecting previously unselected package libosmo-gtlv1:amd64. #6 3.357 Preparing to unpack .../09-libosmo-gtlv1_0.4.0.1.c4dc.202409222026_amd64.deb ... #6 3.375 Unpacking libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202409222026) ... #6 3.517 Selecting previously unselected package libosmocoding0:amd64. #6 3.525 Preparing to unpack .../10-libosmocoding0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.542 Unpacking libosmocoding0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.693 Selecting previously unselected package libosmogb14:amd64. #6 3.711 Preparing to unpack .../11-libosmogb14_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.729 Unpacking libosmogb14:amd64 (1.10.0.13.ddc5.202409222026) ... #6 3.867 Selecting previously unselected package libosmoctrl0:amd64. #6 3.885 Preparing to unpack .../12-libosmoctrl0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 3.902 Unpacking libosmoctrl0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.044 Selecting previously unselected package libosmosim2:amd64. #6 4.052 Preparing to unpack .../13-libosmosim2_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 4.070 Unpacking libosmosim2:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.221 Selecting previously unselected package libosmousb0:amd64. #6 4.239 Preparing to unpack .../14-libosmousb0_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 4.257 Unpacking libosmousb0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.380 Selecting previously unselected package libosmocore. #6 4.398 Preparing to unpack .../15-libosmocore_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 4.415 Unpacking libosmocore (1.10.0.13.ddc5.202409222026) ... #6 4.539 Selecting previously unselected package libosmocore-dev:amd64. #6 4.557 Preparing to unpack .../16-libosmocore-dev_1.10.0.13.ddc5.202409222026_amd64.deb ... #6 4.575 Unpacking libosmocore-dev:amd64 (1.10.0.13.ddc5.202409222026) ... #6 4.726 Selecting previously unselected package libosmo-gtlv-dev:amd64. #6 4.744 Preparing to unpack .../17-libosmo-gtlv-dev_0.4.0.1.c4dc.202409222026_amd64.deb ... #6 4.762 Unpacking libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202409222026) ... #6 4.908 Selecting previously unselected package libosmonetif11:amd64. #6 4.915 Preparing to unpack .../18-libosmonetif11_1.5.1.5.89a1.202409222026_amd64.deb ... #6 4.933 Unpacking libosmonetif11:amd64 (1.5.1.5.89a1.202409222026) ... #6 5.053 Selecting previously unselected package libosmo-netif-dev:amd64. #6 5.071 Preparing to unpack .../19-libosmo-netif-dev_1.5.1.5.89a1.202409222026_amd64.deb ... #6 5.088 Unpacking libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409222026) ... #6 5.230 Selecting previously unselected package libosmo-pfcp0:amd64. #6 5.237 Preparing to unpack .../20-libosmo-pfcp0_0.4.0.1.c4dc.202409222026_amd64.deb ... #6 5.254 Unpacking libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202409222026) ... #6 5.370 Selecting previously unselected package libosmo-pfcp-dev:amd64. #6 5.387 Preparing to unpack .../21-libosmo-pfcp-dev_0.4.0.1.c4dc.202409222026_amd64.deb ... #6 5.404 Unpacking libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202409222026) ... #6 5.554 Selecting previously unselected package libosmo-sigtran10:amd64. #6 5.561 Preparing to unpack .../22-libosmo-sigtran10_2.0.0.3.e1ad.202409222026_amd64.deb ... #6 5.578 Unpacking libosmo-sigtran10:amd64 (2.0.0.3.e1ad.202409222026) ... #6 5.705 Selecting previously unselected package libosmo-sigtran-dev:amd64. #6 5.722 Preparing to unpack .../23-libosmo-sigtran-dev_2.0.0.3.e1ad.202409222026_amd64.deb ... #6 5.740 Unpacking libosmo-sigtran-dev:amd64 (2.0.0.3.e1ad.202409222026) ... #6 5.898 Selecting previously unselected package libasn1c1:amd64. #6 5.906 Preparing to unpack .../24-libasn1c1_0.9.37.202409222026_amd64.deb ... #6 5.923 Unpacking libasn1c1:amd64 (0.9.37.202409222026) ... #6 6.053 Selecting previously unselected package libasn1c-dev:amd64. #6 6.072 Preparing to unpack .../25-libasn1c-dev_0.9.37.202409222026_amd64.deb ... #6 6.090 Unpacking libasn1c-dev:amd64 (0.9.37.202409222026) ... #6 6.248 Selecting previously unselected package libosmo-hnbap0:amd64. #6 6.266 Preparing to unpack .../26-libosmo-hnbap0_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 6.283 Unpacking libosmo-hnbap0:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 6.407 Selecting previously unselected package libosmo-hnbap-dev:amd64. #6 6.425 Preparing to unpack .../27-libosmo-hnbap-dev_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 6.443 Unpacking libosmo-hnbap-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 6.596 Selecting previously unselected package libosmo-mgcp-client14:amd64. #6 6.614 Preparing to unpack .../28-libosmo-mgcp-client14_1.13.1.202409222026_amd64.deb ... #6 6.631 Unpacking libosmo-mgcp-client14:amd64 (1.13.1.202409222026) ... #6 6.752 Selecting previously unselected package libosmo-mgcp-client-dev:amd64. #6 6.760 Preparing to unpack .../29-libosmo-mgcp-client-dev_1.13.1.202409222026_amd64.deb ... #6 6.777 Unpacking libosmo-mgcp-client-dev:amd64 (1.13.1.202409222026) ... #6 6.921 Selecting previously unselected package libosmo-ranap7:amd64. #6 6.939 Preparing to unpack .../30-libosmo-ranap7_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 6.956 Unpacking libosmo-ranap7:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 7.088 Selecting previously unselected package libosmo-ranap-dev:amd64. #6 7.096 Preparing to unpack .../31-libosmo-ranap-dev_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 7.113 Unpacking libosmo-ranap-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 7.283 Selecting previously unselected package libosmo-rua0:amd64. #6 7.291 Preparing to unpack .../32-libosmo-rua0_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 7.308 Unpacking libosmo-rua0:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 7.433 Selecting previously unselected package libosmo-rua-dev:amd64. #6 7.451 Preparing to unpack .../33-libosmo-rua-dev_1.6.0.1.4a6b5.202409222026_amd64.deb ... #6 7.468 Unpacking libosmo-rua-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 7.640 Setting up osmocom-nightly (202409222026) ... #6 7.693 Setting up libosmocore22:amd64 (1.10.0.13.ddc5.202409222026) ... #6 7.751 Setting up libosmocodec4:amd64 (1.10.0.13.ddc5.202409222026) ... #6 7.803 Setting up libosmo-gtlv1:amd64 (0.4.0.1.c4dc.202409222026) ... #6 7.852 Setting up libasn1c1:amd64 (0.9.37.202409222026) ... #6 7.902 Setting up libosmo-hnbap0:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 7.954 Setting up libosmovty13:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.017 Setting up libosmo-rua0:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 8.069 Setting up libosmoisdn0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.120 Setting up libosmotrau10:amd64 (1.6.0.11.0d73.202409222026) ... #6 8.172 Setting up libasn1c-dev:amd64 (0.9.37.202409222026) ... #6 8.224 Setting up libosmo-rua-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 8.275 Setting up libosmousb0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.327 Setting up libosmo-mgcp-client14:amd64 (1.13.1.202409222026) ... #6 8.379 Setting up libosmogsm20:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.430 Setting up libosmoabis13:amd64 (1.6.0.11.0d73.202409222026) ... #6 8.482 Setting up libosmoctrl0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.532 Setting up libosmo-hnbap-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 8.583 Setting up libosmo-pfcp0:amd64 (0.4.0.1.c4dc.202409222026) ... #6 8.633 Setting up libosmogb14:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.683 Setting up libosmonetif11:amd64 (1.5.1.5.89a1.202409222026) ... #6 8.733 Setting up libosmo-abis-dev:amd64 (1.6.0.11.0d73.202409222026) ... #6 8.784 Setting up libosmo-mgcp-client-dev:amd64 (1.13.1.202409222026) ... #6 8.835 Setting up libosmocoding0:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.885 Setting up libosmosim2:amd64 (1.10.0.13.ddc5.202409222026) ... #6 8.936 Setting up libosmocore (1.10.0.13.ddc5.202409222026) ... #6 8.986 Setting up libosmo-sigtran10:amd64 (2.0.0.3.e1ad.202409222026) ... #6 9.036 Setting up libosmo-ranap7:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 9.088 Setting up libosmocore-dev:amd64 (1.10.0.13.ddc5.202409222026) ... #6 9.139 Setting up libosmo-netif-dev:amd64 (1.5.1.5.89a1.202409222026) ... #6 9.189 Setting up libosmo-gtlv-dev:amd64 (0.4.0.1.c4dc.202409222026) ... #6 9.239 Setting up libosmo-ranap-dev:amd64 (1.6.0.1.4a6b5.202409222026) ... #6 9.294 Setting up libosmo-sigtran-dev:amd64 (2.0.0.3.e1ad.202409222026) ... #6 9.344 Setting up libosmo-pfcp-dev:amd64 (0.4.0.1.c4dc.202409222026) ... #6 9.395 Processing triggers for libc-bin (2.36-9+deb12u8) ... #6 DONE 9.7s #8 [3/8] WORKDIR /TMP #8 DONE 0.1s #9 [4/8] RUN GIT clone https://gerrit.osmocom.org/osmo-hnbgw.git #9 0.328 Cloning into 'osmo-hnbgw'... #9 DONE 0.5s #10 [5/8] ADD HTTPS://GERRIT.OSMOCOM.ORG/PLUGINS/GITILES/OSMO-HNBGW/+/MASTER?FORMAT=TEXT /tmp/commit-osmo-hnbgw #10 DONE 0.1s #11 [6/8] RUN CD osmo-hnbgw && git fetch && git checkout master && (git symbolic-ref -q HEAD && git reset --hard origin/master || exit 1); git rev-parse --abbrev-ref HEAD && git rev-parse HEAD && autoreconf -fi && ./configure --enable-pfcp && make "-j$(nproc)" install && ldconfig #11 0.376 Already on 'master' #11 0.377 Your branch is up to date with 'origin/master'. #11 0.378 refs/heads/master #11 0.391 HEAD is now at 30068ad contrib/jenkins: libosmo-sccp -> libosmo-sigtran #11 0.393 master #11 0.395 30068ad3912cc8306d649e1e6d5cf1b601ba471f #11 1.461 aclocal: warning: couldn't open directory 'm4': No such file or directory #11 2.415 libtoolize: putting auxiliary files in AC_CONFIG_AUX_DIR, '.'. #11 2.415 libtoolize: copying file './ltmain.sh' #11 2.549 libtoolize: putting macros in 'm4'. #11 2.549 libtoolize: copying file 'm4/libtool.m4' #11 2.599 libtoolize: copying file 'm4/ltoptions.m4' #11 2.654 libtoolize: copying file 'm4/ltsugar.m4' #11 2.708 libtoolize: copying file 'm4/ltversion.m4' #11 2.763 libtoolize: copying file 'm4/lt~obsolete.m4' #11 2.852 libtoolize: Consider adding 'AC_CONFIG_MACRO_DIRS([m4])' to configure.ac, #11 2.852 libtoolize: and rerunning libtoolize and aclocal. #11 3.624 configure.ac:84: warning: The macro `AC_HEADER_STDC' is obsolete. #11 3.624 configure.ac:84: You should run autoupdate. #11 3.624 ./lib/autoconf/headers.m4:704: AC_HEADER_STDC is expanded from... #11 3.624 configure.ac:84: the top level #11 3.624 configure.ac:132: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.624 configure.ac:132: You should run autoupdate. #11 3.624 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.624 configure.ac:132: the top level #11 3.624 configure.ac:153: warning: The macro `AC_HELP_STRING' is obsolete. #11 3.624 configure.ac:153: You should run autoupdate. #11 3.624 ./lib/autoconf/general.m4:204: AC_HELP_STRING is expanded from... #11 3.624 configure.ac:153: the top level #11 3.624 configure.ac:232: warning: 'AM_CONFIG_HEADER': this macro is obsolete. #11 3.624 configure.ac:232: You should use the 'AC_CONFIG_HEADERS' macro instead. #11 3.624 ./lib/autoconf/general.m4:2434: AC_DIAGNOSE is expanded from... #11 3.624 aclocal.m4:1089: AM_CONFIG_HEADER is expanded from... #11 3.624 configure.ac:232: the top level #11 3.624 configure.ac:234: warning: AC_OUTPUT should be used without arguments. #11 3.624 configure.ac:234: You should run autoupdate. #11 4.183 configure.ac:23: installing './compile' #11 4.186 configure.ac:25: installing './config.guess' #11 4.190 configure.ac:25: installing './config.sub' #11 4.195 configure.ac:9: installing './install-sh' #11 4.200 configure.ac:9: installing './missing' #11 4.247 doc/charts/Makefile.am:10: warning: '%'-style pattern rules are a GNU make extension #11 4.247 doc/charts/Makefile.am:13: warning: '%'-style pattern rules are a GNU make extension #11 4.247 doc/charts/Makefile.am:18: warning: ':='-style assignments are not portable #11 4.300 src/osmo-hnbgw/Makefile.am: installing './depcomp' #11 4.380 checking for a BSD-compatible install... /usr/bin/install -c #11 4.386 checking whether build environment is sane... yes #11 4.398 checking for a race-free mkdir -p... /usr/bin/mkdir -p #11 4.401 checking for gawk... gawk #11 4.401 checking whether make sets $(MAKE)... yes #11 4.423 checking whether make supports nested variables... yes #11 4.438 checking whether make supports nested variables... (cached) yes #11 4.439 checking whether make sets $(MAKE)... (cached) yes #11 4.444 checking for gcc... gcc #11 4.512 checking whether the C compiler works... yes #11 4.556 checking for C compiler default output file name... a.out #11 4.556 checking for suffix of executables... #11 4.611 checking whether we are cross compiling... no #11 4.639 checking for suffix of object files... o #11 4.659 checking whether the compiler supports GNU C... yes #11 4.684 checking whether gcc accepts -g... yes #11 4.708 checking for gcc option to enable C11 features... none needed #11 4.731 checking whether gcc understands -c and -o together... yes #11 4.771 checking whether make supports the include directive... yes (GNU style) #11 4.787 checking dependency style of gcc... gcc3 #11 4.876 checking build system type... x86_64-pc-linux-gnu #11 4.977 checking host system type... x86_64-pc-linux-gnu #11 4.978 checking how to print strings... printf #11 5.008 checking for a sed that does not truncate output... /usr/bin/sed #11 5.010 checking for grep that handles long lines and -e... /usr/bin/grep #11 5.011 checking for egrep... /usr/bin/grep -E #11 5.012 checking for fgrep... /usr/bin/grep -F #11 5.013 checking for ld used by gcc... /usr/bin/ld #11 5.015 checking if the linker (/usr/bin/ld) is GNU ld... yes #11 5.016 checking for BSD- or MS-compatible name lister (nm)... /usr/bin/nm -B #11 5.017 checking the name lister (/usr/bin/nm -B) interface... BSD nm #11 5.034 checking whether ln -s works... yes #11 5.034 checking the maximum length of command line arguments... 1572864 #11 5.044 checking how to convert x86_64-pc-linux-gnu file names to x86_64-pc-linux-gnu format... func_convert_file_noop #11 5.044 checking how to convert x86_64-pc-linux-gnu file names to toolchain format... func_convert_file_noop #11 5.044 checking for /usr/bin/ld option to reload object files... -r #11 5.045 checking for file... file #11 5.045 checking for objdump... objdump #11 5.046 checking how to recognize dependent libraries... pass_all #11 5.046 checking for dlltool... no #11 5.047 checking how to associate runtime and link libraries... printf %s\n #11 5.047 checking for ar... ar #11 5.047 checking for archiver @FILE support... @ #11 5.084 checking for strip... strip #11 5.085 checking for ranlib... ranlib #11 5.085 checking command to parse /usr/bin/nm -B output from gcc object... ok #11 5.156 checking for sysroot... no #11 5.157 checking for a working dd... /usr/bin/dd #11 5.160 checking how to truncate binary pipes... /usr/bin/dd bs=4096 count=1 #11 5.179 checking for mt... no #11 5.179 checking if : is a manifest tool... no #11 5.185 checking for stdio.h... yes #11 5.206 checking for stdlib.h... yes #11 5.230 checking for string.h... yes #11 5.251 checking for inttypes.h... yes #11 5.263 checking for stdint.h... yes #11 5.278 checking for strings.h... yes #11 5.299 checking for sys/stat.h... yes #11 5.318 checking for sys/types.h... yes #11 5.336 checking for unistd.h... yes #11 5.352 checking for dlfcn.h... yes #11 5.365 checking for objdir... .libs #11 5.410 checking if gcc supports -fno-rtti -fno-exceptions... no #11 5.439 checking for gcc option to produce PIC... -fPIC -DPIC #11 5.439 checking if gcc PIC flag -fPIC -DPIC works... yes #11 5.477 checking if gcc static flag -static works... yes #11 5.539 checking if gcc supports -c -o file.o... yes #11 5.552 checking if gcc supports -c -o file.o... (cached) yes #11 5.552 checking whether the gcc linker (/usr/bin/ld -m elf_x86_64) supports shared libraries... yes #11 5.557 checking whether -lc should be explicitly linked in... no #11 5.576 checking dynamic linker characteristics... GNU/Linux ld.so #11 5.632 checking how to hardcode library paths into programs... immediate #11 5.633 checking whether stripping libraries is possible... yes #11 5.633 checking if libtool supports shared libraries... yes #11 5.633 checking whether to build shared libraries... yes #11 5.633 checking whether to build static libraries... yes #11 5.634 checking for pkg-config... /usr/bin/pkg-config #11 5.634 checking for pkg-config... /usr/bin/pkg-config #11 5.634 checking pkg-config is at least version 0.20... yes #11 5.634 checking for library containing sctp_recvmsg... -lsctp #11 5.709 checking for libasn1c >= 0.9.30... yes #11 5.719 checking for libosmocore >= 1.10.0... yes #11 5.736 checking for libosmovty >= 1.10.0... yes #11 5.753 checking for libosmoctrl >= 1.10.0... yes #11 5.774 checking for libosmogsm >= 1.10.0... yes #11 5.783 checking for libosmo-netif >= 1.5.0... yes #11 5.788 checking for libosmo-sigtran >= 1.9.0... yes #11 5.795 checking for libosmo-rua >= 1.6.0... yes #11 5.806 checking for libosmo-ranap >= 1.6.0... yes #11 5.813 checking for libosmo-hnbap >= 1.6.0... yes #11 5.818 checking for libosmo-mgcp-client >= 1.13.0... yes #11 5.822 checking for libosmo-pfcp >= 0.4.0... yes #11 5.827 checking for egrep... (cached) /usr/bin/grep -E #11 5.827 checking if gcc supports -fvisibility=hidden... yes #11 5.844 checking whether to enable code coverage support... no #11 5.844 checking whether to enable VTY/CTRL tests... no #11 5.848 CFLAGS=" -std=gnu11" #11 5.848 CPPFLAGS="" #11 5.891 checking that generated files are newer than configure... done #11 5.893 configure: creating ./config.status #11 6.874 config.status: creating include/Makefile #11 6.912 config.status: creating include/osmocom/Makefile #11 6.951 config.status: creating include/osmocom/hnbgw/Makefile #11 6.991 config.status: creating src/Makefile #11 7.031 config.status: creating src/osmo-hnbgw/Makefile #11 7.071 config.status: creating tests/Makefile #11 7.112 config.status: creating tests/atlocal #11 7.152 config.status: creating tests/ranap_rab_ass/Makefile #11 7.192 config.status: creating tests/umts_cell_id/Makefile #11 7.231 config.status: creating doc/Makefile #11 7.271 config.status: creating doc/examples/Makefile #11 7.311 config.status: creating doc/manuals/Makefile #11 7.351 config.status: creating doc/charts/Makefile #11 7.391 config.status: creating contrib/Makefile #11 7.431 config.status: creating contrib/systemd/Makefile #11 7.469 config.status: creating Makefile #11 7.501 config.status: creating config.h #11 7.537 config.status: executing tests/atconfig commands #11 7.543 config.status: executing depfiles commands #11 7.935 config.status: executing libtool commands #11 8.046 echo 1.6.0.7-3006 > .version-t && mv .version-t .version #11 8.051 make install-recursive #11 8.059 make[1]: Entering directory '/tmp/osmo-hnbgw' #11 8.067 Making install in include #11 8.072 make[2]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.080 Making install in osmocom #11 8.085 make[3]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.094 Making install in hnbgw #11 8.099 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.105 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.105 make[5]: Nothing to be done for 'install-exec-am'. #11 8.105 make[5]: Nothing to be done for 'install-data-am'. #11 8.105 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.105 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom/hnbgw' #11 8.110 make[4]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.116 make[5]: Entering directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.116 make[5]: Nothing to be done for 'install-exec-am'. #11 8.116 make[5]: Nothing to be done for 'install-data-am'. #11 8.116 make[5]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.116 make[4]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.117 make[3]: Leaving directory '/tmp/osmo-hnbgw/include/osmocom' #11 8.122 make[3]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.128 make[4]: Entering directory '/tmp/osmo-hnbgw/include' #11 8.128 make[4]: Nothing to be done for 'install-exec-am'. #11 8.128 make[4]: Nothing to be done for 'install-data-am'. #11 8.128 make[4]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.128 make[3]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.129 make[2]: Leaving directory '/tmp/osmo-hnbgw/include' #11 8.129 Making install in src #11 8.134 make[2]: Entering directory '/tmp/osmo-hnbgw/src' #11 8.143 Making install in osmo-hnbgw #11 8.149 make[3]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 8.152 CC osmo_hnbgw_main.o #11 8.153 CC hnbgw.lo #11 8.154 CC hnbgw_hnbap.lo #11 8.155 CC hnbgw_l3.lo #11 8.155 CC hnbgw_rua.lo #11 8.156 CC hnbgw_ranap.lo #11 8.158 CC hnbgw_vty.lo #11 8.159 CC context_map.lo #11 8.160 CC context_map_rua.lo #11 8.160 CC context_map_sccp.lo #11 8.162 CC hnbgw_cn.lo #11 8.162 CC cnlink.lo #11 8.164 CC ranap_rab_ass.lo #11 8.164 CC mgw_fsm.lo #11 8.165 CC kpi_dtap.lo #11 8.167 CC kpi_ranap.lo #11 8.167 CC tdefs.lo #11 8.168 CC nft_kpi.lo #11 8.169 CC hnbgw_pfcp.lo #11 8.172 CC ps_rab_ass_fsm.lo #11 8.339 CC ps_rab_fsm.lo #11 8.386 mgw_fsm.c: In function 'mgw_fsm_crcx_hnb_onenter': #11 8.387 mgw_fsm.c:180:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.387 180 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.387 | ^~~~~~~~ #11 8.387 In file included from /usr/include/osmocom/mgcp_client/mgcp_client_endpoint_fsm.h:4, #11 8.387 from mgw_fsm.c:48: #11 8.387 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.387 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.387 | ^~~~~~ #11 8.387 mgw_fsm.c:181:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.387 181 | mgw_info.codecs_len = 1; #11 8.387 | ^~~~~~~~ #11 8.387 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.387 35 | unsigned int codecs_len #11 8.387 | ^~~~~~~~~~ #11 8.391 mgw_fsm.c: In function 'mgw_fsm_mdcx_hnb_onenter': #11 8.391 mgw_fsm.c:368:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.391 368 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.391 | ^~~~~~~~ #11 8.391 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.391 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.391 | ^~~~~~ #11 8.391 mgw_fsm.c:369:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.391 369 | mgw_info.codecs_len = 1; #11 8.391 | ^~~~~~~~ #11 8.391 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.391 35 | unsigned int codecs_len #11 8.391 | ^~~~~~~~~~ #11 8.393 mgw_fsm.c: In function 'mgw_fsm_crcx_msc_onenter': #11 8.393 mgw_fsm.c:452:9: warning: 'codecs' is deprecated: use ptmap[i].codec instead [-Wdeprecated-declarations] #11 8.393 452 | mgw_info.codecs[0] = CODEC_IUFP; #11 8.393 | ^~~~~~~~ #11 8.393 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:33:26: note: declared here #11 8.393 33 | enum mgcp_codecs codecs[MGCP_MAX_CODECS] #11 8.393 | ^~~~~~ #11 8.393 mgw_fsm.c:453:9: warning: 'codecs_len' is deprecated: use ptmap[] and ptmap_len instead [-Wdeprecated-declarations] #11 8.393 453 | mgw_info.codecs_len = 1; #11 8.393 | ^~~~~~~~ #11 8.393 /usr/include/osmocom/mgcp_client/mgcp_client_fsm.h:35:22: note: declared here #11 8.393 35 | unsigned int codecs_len #11 8.393 | ^~~~~~~~~~ #11 8.664 CCLD libhnbgw.la #11 9.372 CCLD osmo-hnbgw #11 9.960 make[4]: Entering directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.960 make[4]: Nothing to be done for 'install-data-am'. #11 9.960 /usr/bin/mkdir -p '/usr/local/bin' #11 9.962 /bin/bash ../../libtool --mode=install /usr/bin/install -c osmo-hnbgw '/usr/local/bin' #11 9.976 libtool: install: /usr/bin/install -c osmo-hnbgw /usr/local/bin/osmo-hnbgw #11 9.978 make[4]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.979 make[3]: Leaving directory '/tmp/osmo-hnbgw/src/osmo-hnbgw' #11 9.980 make[3]: Entering directory '/tmp/osmo-hnbgw/src' #11 9.982 make[4]: Entering directory '/tmp/osmo-hnbgw/src' #11 9.982 make[4]: Nothing to be done for 'install-exec-am'. #11 9.982 make[4]: Nothing to be done for 'install-data-am'. #11 9.982 make[4]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.982 make[3]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.982 make[2]: Leaving directory '/tmp/osmo-hnbgw/src' #11 9.983 Making install in tests #11 9.984 make[2]: Entering directory '/tmp/osmo-hnbgw/tests' #11 9.987 Making install in ranap_rab_ass #11 9.989 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.991 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.991 make[4]: Nothing to be done for 'install-exec-am'. #11 9.991 make[4]: Nothing to be done for 'install-data-am'. #11 9.991 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.991 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/ranap_rab_ass' #11 9.991 Making install in umts_cell_id #11 9.993 make[3]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.996 make[4]: Entering directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.996 make[4]: Nothing to be done for 'install-exec-am'. #11 9.996 make[4]: Nothing to be done for 'install-data-am'. #11 9.996 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.997 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests/umts_cell_id' #11 9.999 make[3]: Entering directory '/tmp/osmo-hnbgw/tests' #11 10.00 make[4]: Entering directory '/tmp/osmo-hnbgw/tests' #11 10.00 make[4]: Nothing to be done for 'install-exec-am'. #11 10.00 make[4]: Nothing to be done for 'install-data-am'. #11 10.00 make[4]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.00 make[3]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.01 make[2]: Leaving directory '/tmp/osmo-hnbgw/tests' #11 10.01 Making install in doc #11 10.01 make[2]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.02 Making install in examples #11 10.02 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.03 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.03 make[4]: Nothing to be done for 'install-exec-am'. #11 10.03 /usr/bin/mkdir -p '/usr/local/etc/osmocom' #11 10.04 /usr/bin/install -c -m 644 osmo-hnbgw/osmo-hnbgw.cfg '/usr/local/etc/osmocom' #11 10.04 make install-data-hook #11 10.05 make[5]: Entering directory '/tmp/osmo-hnbgw/doc/examples' #11 10.05 for f in $(find . -name '*.cfg*' | sed -e 's,^.,,'); do \ #11 10.05 j="/usr/local/share/doc/osmo-hnbgw/examples/$f" && \ #11 10.05 mkdir -p "$(dirname $j)" && \ #11 10.05 /usr/bin/install -c -m 644 ./$f $j; \ #11 10.05 done #11 10.08 make[5]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.08 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.08 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/examples' #11 10.08 Making install in manuals #11 10.09 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.10 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.10 make[4]: Nothing to be done for 'install-exec-am'. #11 10.10 make[4]: Nothing to be done for 'install-data-am'. #11 10.10 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.10 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/manuals' #11 10.10 Making install in charts #11 10.10 make[3]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.10 make[4]: Entering directory '/tmp/osmo-hnbgw/doc/charts' #11 10.10 make[4]: Nothing to be done for 'install-exec-am'. #11 10.10 make[4]: Nothing to be done for 'install-data-am'. #11 10.10 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.10 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc/charts' #11 10.11 make[3]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.11 make[4]: Entering directory '/tmp/osmo-hnbgw/doc' #11 10.11 make[4]: Nothing to be done for 'install-exec-am'. #11 10.11 make[4]: Nothing to be done for 'install-data-am'. #11 10.11 make[4]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.11 make[3]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.11 make[2]: Leaving directory '/tmp/osmo-hnbgw/doc' #11 10.11 Making install in contrib #11 10.12 make[2]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.13 Making install in systemd #11 10.13 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.14 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.14 make[4]: Nothing to be done for 'install-exec-am'. #11 10.14 /usr/bin/mkdir -p '/lib/systemd/system' #11 10.15 /usr/bin/install -c -m 644 osmo-hnbgw.service '/lib/systemd/system' #11 10.15 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.15 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib/systemd' #11 10.16 make[3]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.16 make[4]: Entering directory '/tmp/osmo-hnbgw/contrib' #11 10.16 make[4]: Nothing to be done for 'install-exec-am'. #11 10.16 make[4]: Nothing to be done for 'install-data-am'. #11 10.16 make[4]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.16 make[3]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.16 make[2]: Leaving directory '/tmp/osmo-hnbgw/contrib' #11 10.17 make[2]: Entering directory '/tmp/osmo-hnbgw' #11 10.18 make[3]: Entering directory '/tmp/osmo-hnbgw' #11 10.18 make[3]: Nothing to be done for 'install-exec-am'. #11 10.18 make[3]: Nothing to be done for 'install-data-am'. #11 10.18 make[3]: Leaving directory '/tmp/osmo-hnbgw' #11 10.18 make[2]: Leaving directory '/tmp/osmo-hnbgw' #11 10.18 make[1]: Leaving directory '/tmp/osmo-hnbgw' #11 DONE 10.4s #12 [7/8] COPY OSMO-HNBGW.CFG /data/osmo-hnbgw.cfg #12 DONE 0.1s #13 [8/8] WORKDIR /DATA #13 DONE 0.1s #14 exporting to image #14 exporting layers #14 exporting layers 0.7s done #14 writing image sha256:c2bd6a13c7ee63d631f79671741692ee74f988e51ea1bcc66d70b09d0d8c3b00 done #14 naming to docker.io/osmocom-build/osmo-hnbgw-master:latest 0.0s done #14 DONE 0.8s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/osmo-hnbgw-master' + docker_image_exists osmo-hnbgw-master + docker images -q osmocom-build/osmo-hnbgw-master + test -n c2bd6a13c7ee + list_osmo_packages debian-bookworm osmo-hnbgw-master + local distro=debian-bookworm + local image=osmo-hnbgw-master + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/osmo-hnbgw-master -c + [ -n ] + set +x ### Installed Osmocom packages in: osmo-hnbgw-master ### ii libosmo-abis-dev:amd64 1.6.0.11.0d73.202409222026 amd64 Development headers for A-bis interface ii libosmo-gtlv-dev:amd64 0.4.0.1.c4dc.202409222026 amd64 Development files for libosmo-gtlv ii libosmo-gtlv1:amd64 0.4.0.1.c4dc.202409222026 amd64 Generic TLV and TLIV protocol support ii libosmo-hnbap-dev:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-hnbap0:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-mgcp-client-dev:amd64 1.13.1.202409222026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-mgcp-client14:amd64 1.13.1.202409222026 amd64 libosmo-mgcp-client: Osmocom's Media Gateway Control Protocol client utilities ii libosmo-netif-dev:amd64 1.5.1.5.89a1.202409222026 amd64 Development headers for Osmocom network interface ii libosmo-pfcp-dev:amd64 0.4.0.1.c4dc.202409222026 amd64 Development files for libosmo-pfcp ii libosmo-pfcp0:amd64 0.4.0.1.c4dc.202409222026 amd64 PFCP protocol support ii libosmo-ranap-dev:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-ranap7:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua-dev:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-rua0:amd64 1.6.0.1.4a6b5.202409222026 amd64 Osmocom code for the Iuh interface (HNBAP, RUA, RANAP) ii libosmo-sigtran-dev:amd64 2.0.0.3.e1ad.202409222026 amd64 Development headers for the Osmocom SIGTRAN library ii libosmo-sigtran10:amd64 2.0.0.3.e1ad.202409222026 amd64 Osmocom SIGTRAN library (SCCP, SUA, M3UA and more) ii libosmoabis13:amd64 1.6.0.11.0d73.202409222026 amd64 GSM A-bis handling ii libosmocodec4:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo codec library ii libosmocoding0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo coding library ii libosmocore 1.10.0.13.ddc5.202409222026 amd64 Open Source MObile COMmunications CORE library (metapackage) ii libosmocore-dev:amd64 1.10.0.13.ddc5.202409222026 amd64 Development headers for Open Source MObile COMmunications CORE library ii libosmocore22:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo Core library ii libosmoctrl0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo control library ii libosmogb14:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo GPRS GB library ii libosmogsm20:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo GSM utility library ii libosmoisdn0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo ISDN utility library ii libosmonetif11:amd64 1.5.1.5.89a1.202409222026 amd64 Common/shared code regarding network interface for OpenBSC ii libosmosim2:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo SIM library ii libosmotrau10:amd64 1.6.0.11.0d73.202409222026 amd64 GSM trau handling ii libosmousb0:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo USB library ii libosmovty13:amd64 1.10.0.13.ddc5.202409222026 amd64 Osmo VTY library ii osmocom-nightly 202409222026 amd64 Dummy package, conflicts with ['osmocom-2022q1', 'osmocom-2022q2', 'osmocom-2023q1', 'osmocom-latest', 'osmocom-master', 'osmocom-nightly'] + [ registry.osmocom.org = registry.osmocom.org ] + docker_depends ttcn3-hnbgw-test + local feed + echo debian-bookworm-titan + depends=debian-bookworm-titan + [ -n debian-bookworm-titan ] + docker_images_require debian-bookworm-titan + local i + local from_line + local pull_arg + local upstream_distro_arg + local distro_arg + local depends + local dir + [ registry.osmocom.org = registry.osmocom.org ] + docker pull registry.osmocom.org/osmocom-build/debian-bookworm-titan Using default tag: latest latest: Pulling from osmocom-build/debian-bookworm-titan Digest: sha256:982153db4f568a7e1486514647e2014dad3a30a7be027fa02e3ad2b67ce59011 Status: Image is up to date for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest + continue + docker_distro_from_image_name ttcn3-hnbgw-test + echo debian-bookworm + distro_arg=debian-bookworm + [ -z ] + docker_upstream_distro_from_image_name ttcn3-hnbgw-test + echo debian:bookworm + upstream_distro_arg=debian:bookworm + docker_dir_from_image_name ttcn3-hnbgw-test + echo ttcn3-hnbgw-test + dir=ttcn3-hnbgw-test + pull_arg=--pull + grep ^FROM ../ttcn3-hnbgw-test/Dockerfile + from_line=FROM $REGISTRY/$USER/debian-bookworm-titan + echo FROM $REGISTRY/$USER/debian-bookworm-titan + grep -q $USER + pull_arg= + set +x Building image: ttcn3-hnbgw-test (export NO_DOCKER_IMAGE_BUILD=1 to prevent this) + docker_osmo_ttcn3_branch + [ -n ] + echo master + make -C ../ttcn3-hnbgw-test BUILD_ARGS= UPSTREAM_DISTRO=debian:bookworm DISTRO=debian-bookworm IMAGE=osmocom-build/ttcn3-hnbgw-test OSMO_TTCN3_BRANCH=master make: Entering directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test' awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory awk: fatal: cannot open file `.release' for reading: No such file or directory rm -rf .common cp -r /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/common .common INFO: .release created release=0.0.0 docker build \ --build-arg USER=osmocom-build \ --build-arg UID=1000 \ --build-arg REGISTRY=registry.osmocom.org \ --build-arg OSMO_TTCN3_BRANCH=master \ --build-arg UPSTREAM_DISTRO=debian:bookworm \ --build-arg DISTRO=debian-bookworm \ --build-arg OSMOCOM_REPO_MIRROR=https://downloads.osmocom.org \ --build-arg OSMOCOM_REPO_PATH=packages/osmocom: \ --build-arg OSMOCOM_REPO_VERSION=latest \ --build-arg OSMOCOM_REPO_TESTSUITE_MIRROR=https://downloads.osmocom.org \ --build-arg ASTERISK_BRANCH=jolly/work \ --build-arg LIBOSMOCORE_BRANCH=master \ --build-arg OSMO_BB_BRANCH=master \ --build-arg OSMO_BSC_BRANCH=master \ --build-arg OSMO_BTS_BRANCH=master \ --build-arg OSMO_CBC_BRANCH=master \ --build-arg OSMO_DIA2GSUP_BRANCH=master \ --build-arg OSMO_EPDG_BRANCH=master \ --build-arg OSMO_GBPROXY_BRANCH=master \ --build-arg OSMO_GGSN_BRANCH=master \ --build-arg OSMO_GSM_TESTER_BRANCH=master \ --build-arg OSMO_HLR_BRANCH=master \ --build-arg OSMO_HNBGW_BRANCH=master \ --build-arg OSMO_HNODEB_BRANCH=master \ --build-arg OSMO_IUH_BRANCH=master \ --build-arg OSMO_MGW_BRANCH=master \ --build-arg OSMO_MSC_BRANCH=master \ --build-arg OSMO_NITB_BRANCH=master \ --build-arg OSMO_PCU_BRANCH=master \ --build-arg OSMO_SGSN_BRANCH=master \ --build-arg OSMO_SIP_BRANCH=master \ --build-arg OSMO_STP_BRANCH=master \ --build-arg OSMO_UECUPS_BRANCH=master \ --build-arg OPEN5GS_BRANCH=main \ --build-arg PJPROJECT_BRANCH=jolly/work \ -t osmocom-build/ttcn3-hnbgw-test:latest . #0 building with "default" instance using docker driver #1 [internal] load build definition from Dockerfile #1 transferring dockerfile: 395B done #1 DONE 0.0s #2 [internal] load .dockerignore #2 transferring context: 2B done #2 DONE 0.0s #3 [internal] load metadata for registry.osmocom.org/osmocom-build/debian-bookworm-titan:latest #3 DONE 0.0s #4 [1/4] FROM registry.osmocom.org/osmocom-build/debian-bookworm-titan #4 DONE 0.0s #5 [internal] load build context #5 transferring context: 3.38kB done #5 DONE 0.0s #6 https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT #6 DONE 0.1s #7 [3/4] RUN TTCN3-DOCKER-PREPARE "master" hnbgw #7 CACHED #8 [2/4] ADD https://gerrit.osmocom.org/plugins/gitiles/osmo-ttcn3-hacks/+/master?format=TEXT /tmp/commit #8 CACHED #9 [4/4] COPY HNBGW_TESTS.CFG /data/HNBGW_Tests.cfg #9 CACHED #10 exporting to image #10 exporting layers done #10 writing image sha256:c3a415ced0208cf7781bbfa7fb1f8255770f3286a6aded8790a372e864f3ac0f done #10 naming to docker.io/osmocom-build/ttcn3-hnbgw-test:latest done #10 DONE 0.0s rm -rf .common make: Leaving directory '/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/ttcn3-hnbgw-test' + docker_image_exists ttcn3-hnbgw-test + docker images -q osmocom-build/ttcn3-hnbgw-test + test -n c3a415ced020 + list_osmo_packages debian-bookworm ttcn3-hnbgw-test + local distro=debian-bookworm + local image=ttcn3-hnbgw-test + local docker_run_sh=docker run --rm --entrypoint=/bin/sh osmocom-build/ttcn3-hnbgw-test -c + [ -n ] + return + set_clean_up_trap + trap clean_up_common EXIT INT TERM 0 + set -e + VOL_BASE_DIR_PFCP=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + network_create + SUBNET=2669613 + seq 1 30 + echo (2669613 + 1) % 256 + bc + SUBNET=46 + NET_NAME=ttcn3-hnbgw-test-46 + SUB4=172.18.46.0/24 + SUB6=fd02:db8:46::/64 + set +x Creating network ttcn3-hnbgw-test-46, trying SUBNET=46... + docker network create --internal --subnet 172.18.46.0/24 --ipv6 --subnet fd02:db8:46::/64 ttcn3-hnbgw-test-46 5240a32d6e2d4fd2ab24fea3d8b6a8bfe8ee544ca97e15f3c01fb4ad47b4e2bb + set +x ### Network ttcn3-hnbgw-test-46 created (SUBNET=46) ### + return + echo Testing without PFCP Testing without PFCP + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs HNBGW_Tests.cfg osmo-stp.cfg osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs + tests_cfg=HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/unix + cp HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/unix + cp osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 46 200 + NET=46 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.200 --ip6 fd02:db8:46::200 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.200 --ip6 fd02:db8:46::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp:/data --name jenkins-ttcn3-hnbgw-test-990-stp -d osmocom-build/osmo-stp-master 586f2aab81e62063fc8c661330c11d37800182e4d2dfbac4289371412902224d + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 46 20 + NET=46 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.20 --ip6 fd02:db8:46::20 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.20 --ip6 fd02:db8:46::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-990-hnbgw -d osmocom-build/osmo-hnbgw-master 709862164fac4d7eb6b495b0e3b133223b92c331dc5e9dca5c61a39f6f4d6038 + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 46 203 + NET=46 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.203 --ip6 fd02:db8:46::203 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.203 --ip6 fd02:db8:46::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.46.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-990-ttcn3-hnbgw-test osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@d00515b5a167: Unix server socket created successfully. MC@d00515b5a167: Listening on TCP port 43113. d00515b5a167 is the default MC2> spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests d00515b5a167 43113 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@d00515b5a167: New HC connected from 172.18.46.203 [172.18.46.203]. d00515b5a167: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@d00515b5a167: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@d00515b5a167: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@d00515b5a167: Configuration file was processed on all HCs. MC@d00515b5a167: Creating MTC on host 172.18.46.203. MC@d00515b5a167: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Mon Sep 23 07:47:46 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(9)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(9)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(7)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(12)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(10)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(8)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(8)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(11)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(11)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register-Iuh0-RUA(5)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(7)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(3)@d00515b5a167: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(13)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(8)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(11)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@d00515b5a167: Test case TC_hnb_register finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Mon Sep 23 07:47:49 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=158133) Waiting for packet dumper to finish... 1 (prev_count=158133, count=213362) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Mon Sep 23 07:47:51 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(22)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(22)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(20)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: talloc reports "struct hnb_context" x 1, expecting 1 MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(20)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0-RUA(16)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1-RUA(18)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(21)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1(17)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(26)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(14)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@d00515b5a167: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Mon Sep 23 07:47:53 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=81989) Waiting for packet dumper to finish... 1 (prev_count=81989, count=140416) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Mon Sep 23 07:47:56 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(33)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(33)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(31)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(36)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.sgsn0-RAN(35)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: talloc reports "struct hnb_context" x 1, expecting 1 MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(32)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(27)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@d00515b5a167: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(35)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(37)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@d00515b5a167: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Mon Sep 23 07:47:58 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80223) Waiting for packet dumper to finish... 1 (prev_count=80223, count=138353) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Mon Sep 23 07:48:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(44)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(44)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(42)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(47)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(45)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@d00515b5a167: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@d00515b5a167: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@d00515b5a167: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@d00515b5a167: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_hnb_disconnected_timeout-Iuh0(49)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@d00515b5a167: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@d00515b5a167: setverdict(fail): pass -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", new component reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" TC_hnb_disconnected_timeout-Iuh0(49)@d00515b5a167: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@d00515b5a167: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@d00515b5a167: setverdict(fail): fail -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", component reason not changed MTC@d00515b5a167: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@d00515b5a167: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(43)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(46)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(45)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(38)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(48)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(38): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(48): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (fail -> fail) MTC@d00515b5a167: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (fail -> fail) MTC@d00515b5a167: Test case TC_hnb_disconnected_timeout finished. Verdict: fail reason: Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail'. Mon Sep 23 07:48:17 UTC 2024 ------ HNBGW_Tests.TC_hnb_disconnected_timeout fail ------ Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=145496) Waiting for packet dumper to finish... 1 (prev_count=145496, count=145994) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Mon Sep 23 07:48:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(57)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(57)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(55)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(60)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(58)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(55)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(56)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(59)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(51)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@d00515b5a167: Final verdict of PTC: none TC_ue_register-Iuh0-RUA(53)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@d00515b5a167: Final verdict of PTC: none TC_ue_register-Iuh0(52)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(61)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@d00515b5a167: Test case TC_ue_register finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Mon Sep 23 07:48:21 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82680) Waiting for packet dumper to finish... 1 (prev_count=82680, count=137040) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Mon Sep 23 07:48:24 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ue_register_tmsi_lai started. MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(68)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(68)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(66)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(67)@d00515b5a167: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0-RUA(64)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(66)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@d00515b5a167: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(72)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(62)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@d00515b5a167: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Mon Sep 23 07:48:26 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82580) Waiting for packet dumper to finish... 1 (prev_count=82580, count=136923) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Mon Sep 23 07:48:29 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(79)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(79)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(77)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(82)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(80)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(81)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_before_hnb_register-Iuh0-RUA(75)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(81)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(77)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(78)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(73)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@d00515b5a167: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(83)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@d00515b5a167: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Mon Sep 23 07:48:31 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80130) Waiting for packet dumper to finish... 1 (prev_count=80130, count=134833) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Mon Sep 23 07:48:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(90)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(90)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(88)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(93)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(91)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@d00515b5a167: f_create_expect(l3 := '2D7FAD4CBC5DAA7D6DEF'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@d00515b5a167: Created Expect[0] for '2D7FAD4CBC5DAA7D6DEF'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@d00515b5a167: Added conn table entry 0TC_ranap_cs_initial_ue0(95)5804693 HNBGW_Test.msc0-SCCP(88)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@d00515b5a167: Found Expect[0] for l3='2D7FAD4CBC5DAA7D6DEF'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@d00515b5a167: Added conn table entry 0TC_ranap_cs_initial_ue0(95)9759397 HNBGW_Test.msc0-SCCP(88)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(88)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@d00515b5a167: setverdict(pass): none -> pass TC_ranap_cs_initial_ue0(95)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue-Iuh0-RUA(86)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(84)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(91)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(89)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(94)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Mon Sep 23 07:48:36 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118537) Waiting for packet dumper to finish... 1 (prev_count=118537, count=156652) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Mon Sep 23 07:48:39 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(102)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(102)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(100)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(102)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(105)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: f_create_expect(l3 := 'B1633E8AEC026F442150'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: Created Expect[0] for 'B1633E8AEC026F442150'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@d00515b5a167: Added conn table entry 0TC_ranap_ps_initial_ue0(107)7992689 HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: Found Expect[0] for l3='B1633E8AEC026F442150'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: Added conn table entry 0TC_ranap_ps_initial_ue0(107)16425 HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@d00515b5a167: setverdict(pass): none -> pass TC_ranap_ps_initial_ue0(107)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue-Iuh0-RUA(98)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(100)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(101)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(106)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(96)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Mon Sep 23 07:48:42 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118403) Waiting for packet dumper to finish... 1 (prev_count=118403, count=157185) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Mon Sep 23 07:48:45 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(114)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(114)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(112)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@d00515b5a167: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@d00515b5a167: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@d00515b5a167: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)1697771 HNBGW_Test.msc0-SCCP(112)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@d00515b5a167: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@d00515b5a167: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)15205905 HNBGW_Test.msc0-SCCP(112)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@d00515b5a167: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(113)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(108)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(112)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(118)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Mon Sep 23 07:48:48 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124246) Waiting for packet dumper to finish... 1 (prev_count=124246, count=165668) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Mon Sep 23 07:48:51 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(126)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(126)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(124)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@d00515b5a167: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)7704938 HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)6296684 HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@d00515b5a167: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(128)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(125)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(120)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(124)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(130)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Mon Sep 23 07:48:54 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=124230) Waiting for packet dumper to finish... 1 (prev_count=124230, count=165633) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Mon Sep 23 07:48:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(138)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(138)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(136)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(141)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(139)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@d00515b5a167: f_create_expect(l3 := '08F691A516B43B80EE41'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@d00515b5a167: Created Expect[0] for '08F691A516B43B80EE41'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@d00515b5a167: Added conn table entry 0TC_ranap_cs_bidir0(143)13478852 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@d00515b5a167: Found Expect[0] for l3='08F691A516B43B80EE41'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@d00515b5a167: Added conn table entry 0TC_ranap_cs_bidir0(143)16287819 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_bidir0(143)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: vl_len:22 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A82EAE96763B2477E5A57'O TC_ranap_cs_bidir0(143)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: vl_len:20 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(136)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_bidir-Iuh0-RUA(134)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(137)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(136)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(132)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(142)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Mon Sep 23 07:49:00 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=122950) Waiting for packet dumper to finish... 1 (prev_count=122950, count=174783) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Mon Sep 23 07:49:03 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(150)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(150)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(148)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(153)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(153)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: f_create_expect(l3 := 'E6CC56DD5CB3E78E67D7'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: Created Expect[0] for 'E6CC56DD5CB3E78E67D7'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@d00515b5a167: Added conn table entry 0TC_ranap_ps_bidir0(155)2438162 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: Found Expect[0] for l3='E6CC56DD5CB3E78E67D7'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: Added conn table entry 0TC_ranap_ps_bidir0(155)16322795 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_bidir0(155)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AA2B50689B31A265743A9'O TC_ranap_ps_bidir0(155)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(148)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(144)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(154)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0-RUA(146)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(151)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Mon Sep 23 07:49:06 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119793) Waiting for packet dumper to finish... 1 (prev_count=119793, count=172064) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Mon Sep 23 07:49:09 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(162)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(162)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(160)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@d00515b5a167: f_create_expect(l3 := 'E9EF9E5644447E88DD32'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@d00515b5a167: Created Expect[0] for 'E9EF9E5644447E88DD32'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@d00515b5a167: Added conn table entry 0TC_rab_assignment0(167)14271381 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@d00515b5a167: Found Expect[0] for l3='E9EF9E5644447E88DD32'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@d00515b5a167: Added conn table entry 0TC_rab_assignment0(167)13684426 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): none -> pass VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d9c39517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d9c39517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@d00515b5a167: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d9c39517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@d00515b5a167: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d9c39517", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: vl_len:12 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d9c39517" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assignment-Iuh0-RUA(158)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(161)@d00515b5a167: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(166)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(156)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_assignment finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Mon Sep 23 07:49:12 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120033) Waiting for packet dumper to finish... 1 (prev_count=120033, count=233396) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Mon Sep 23 07:49:15 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(174)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(174)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(172)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@d00515b5a167: f_create_expect(l3 := '0268204F01E583E4528C'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@d00515b5a167: Created Expect[0] for '0268204F01E583E4528C'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@d00515b5a167: Added conn table entry 0TC_rab_release0(179)13659604 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@d00515b5a167: Found Expect[0] for l3='0268204F01E583E4528C'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@d00515b5a167: Added conn table entry 0TC_rab_release0(179)3102617 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d06dd417", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d06dd417", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@d00515b5a167: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d06dd417", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@d00515b5a167: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d06dd417", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: vl_len:21 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(172)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d06dd417" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-M3UA(174)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@d00515b5a167: Final verdict of PTC: none TC_rab_release-Iuh0(169)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(172)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@d00515b5a167: Final verdict of PTC: none TC_rab_release-Iuh0-RUA(170)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(178)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(168)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_release finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Mon Sep 23 07:49:18 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=119748) Waiting for packet dumper to finish... 1 (prev_count=119748, count=227033) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Mon Sep 23 07:49:21 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(186)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(184)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(189)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(187)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@d00515b5a167: f_create_expect(l3 := 'B0BAE9AA8568A5B5E619'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@d00515b5a167: Created Expect[0] for 'B0BAE9AA8568A5B5E619'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@d00515b5a167: Added conn table entry 0TC_rab_release_abnormal0(191)12570641 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@d00515b5a167: Found Expect[0] for l3='B0BAE9AA8568A5B5E619'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@d00515b5a167: Added conn table entry 0TC_rab_release_abnormal0(191)11164038 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release_abnormal0(191)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bfd01117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bfd01117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@d00515b5a167: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bfd01117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@d00515b5a167: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "bfd01117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: vl_len:21 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(184)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "bfd01117" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release_abnormal-Iuh0-RUA(182)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(188)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(185)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(190)@d00515b5a167: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(180)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Mon Sep 23 07:49:24 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=138449) Waiting for packet dumper to finish... 1 (prev_count=138449, count=236085) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Mon Sep 23 07:49:27 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(198)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(196)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@d00515b5a167: f_create_expect(l3 := '94925401A8F66E462710'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@d00515b5a167: Created Expect[0] for '94925401A8F66E462710'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@d00515b5a167: Added conn table entry 0TC_rab_assign_fail0(203)14258097 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@d00515b5a167: Found Expect[0] for l3='94925401A8F66E462710'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@d00515b5a167: Added conn table entry 0TC_rab_assign_fail0(203)14838613 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_fail0(203)@d00515b5a167: setverdict(pass): none -> pass VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d98fb117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d98fb117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "d98fb117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "d98fb117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "d98fb117" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-M3UA(201)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(202)@d00515b5a167: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(200)@d00515b5a167: Final verdict of PTC: none TC_rab_assign_fail-Iuh0-RUA(194)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(192)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_assign_fail finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Mon Sep 23 07:49:30 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=122965) Waiting for packet dumper to finish... 1 (prev_count=122965, count=212338) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Mon Sep 23 07:49:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(210)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(208)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(213)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(211)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@d00515b5a167: f_create_expect(l3 := '680093A1015C927ECF57'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@d00515b5a167: Created Expect[0] for '680093A1015C927ECF57'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@d00515b5a167: Added conn table entry 0TC_rab_assign_mgcp_to0(215)10109068 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@d00515b5a167: Found Expect[0] for l3='680093A1015C927ECF57'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@d00515b5a167: Added conn table entry 0TC_rab_assign_mgcp_to0(215)2368656 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgcp_to0(215)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "9a408c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "9a408c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@d00515b5a167: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "9a408c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "9a408c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: vl_len:12 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgcp_to-Iuh0-RUA(206)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@d00515b5a167: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(214)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(211)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(204)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Mon Sep 23 07:49:40 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=151559) Waiting for packet dumper to finish... 1 (prev_count=151559, count=196446) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Mon Sep 23 07:49:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(222)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(222)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(220)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(225)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(223)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@d00515b5a167: f_create_expect(l3 := '98C7844C7F228051A0DC'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@d00515b5a167: Created Expect[0] for '98C7844C7F228051A0DC'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@d00515b5a167: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)15410524 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@d00515b5a167: Found Expect[0] for l3='98C7844C7F228051A0DC'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@d00515b5a167: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)6003982 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): none -> pass VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "eb255c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "eb255c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "eb255c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "eb255c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@d00515b5a167: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: vl_len:12 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "eb255c17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(220)@d00515b5a167: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(226)@d00515b5a167: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(221)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(216)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@d00515b5a167: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Mon Sep 23 07:49:46 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118686) Waiting for packet dumper to finish... 1 (prev_count=118686, count=237610) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Mon Sep 23 07:49:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(234)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(234)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(232)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(237)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(235)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@d00515b5a167: f_create_expect(l3 := '964283F4DE9CB9B5F5C5'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@d00515b5a167: Created Expect[0] for '964283F4DE9CB9B5F5C5'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@d00515b5a167: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)3699431 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@d00515b5a167: Found Expect[0] for l3='964283F4DE9CB9B5F5C5'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@d00515b5a167: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)2994681 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: vl_len:22 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A37D477E6C5BC26154B93'O TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@d00515b5a167: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)3699431 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@d00515b5a167: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)2994681 TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(232)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(228)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(233)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(236)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@d00515b5a167: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(238)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Mon Sep 23 07:49:58 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=154370) Waiting for packet dumper to finish... 1 (prev_count=154370, count=179930) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Mon Sep 23 07:50:00 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(246)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(246)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(244)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(249)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(247)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@d00515b5a167: f_create_expect(l3 := '2BC2672828C2DF7594E8'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@d00515b5a167: Created Expect[0] for '2BC2672828C2DF7594E8'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@d00515b5a167: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)12468383 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@d00515b5a167: Found Expect[0] for l3='2BC2672828C2DF7594E8'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@d00515b5a167: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)13320547 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: vl_len:22 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AE5B75F7CD0C5650D9779'O TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@d00515b5a167: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)12468383 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@d00515b5a167: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)13320547 TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(245)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(240)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(249)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@d00515b5a167: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(250)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Mon Sep 23 07:50:09 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=149577) Waiting for packet dumper to finish... 1 (prev_count=149577, count=175229) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_without_pfcp ------ Mon Sep 23 07:50:11 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_ps_rab_assignment_without_pfcp started. TC_ps_rab_assignment_without_pfcp-Iuh0(253)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_ps_rab_assignment_without_pfcp-Iuh1(255)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(260)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(260)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(260)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(258)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(263)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(263)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(263)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(260)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(263)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(259)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(259)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_without_pfcp-PFCP(265)@d00515b5a167: PFCP_Emulation main() CLIENT_PROC.getcall(PFCPEM_register) HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: f_create_expect(l3 := '30740F27E25FDE302938'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: Created Expect[0] for '30740F27E25FDE302938'O to be handled at TC_ps_rab_assignment_without_pfcp0(266) TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@d00515b5a167: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)13850566 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: Found Expect[0] for l3='30740F27E25FDE302938'O handled at TC_ps_rab_assignment_without_pfcp0(266) HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: Added conn table entry 0TC_ps_rab_assignment_without_pfcp0(266)5692539 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: vl_len:91 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: vl_len:12 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: vl_from0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp0(266)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(263)@d00515b5a167: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(258)@d00515b5a167: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh0(253)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(259)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(252)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(261)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(262)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(260)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(264)@d00515b5a167: Final verdict of PTC: none TC_ps_rab_assignment_without_pfcp-Iuh1(255)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(257)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_without_pfcp-PFCP(265)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0(253): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1(255): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-Iuh1-RUA(256): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(257): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(258): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(259): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(260): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(261): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(262): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(263): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(264): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp-PFCP(265): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_ps_rab_assignment_without_pfcp0(266): pass (pass -> pass) MTC@d00515b5a167: Test case TC_ps_rab_assignment_without_pfcp finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass'. Mon Sep 23 07:50:20 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=158086) Waiting for packet dumper to finish... 1 (prev_count=158086, count=185003) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Mon Sep 23 07:50:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(275)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(275)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(275)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(273)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(278)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(278)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(278)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(276)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(275)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(278)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(274)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(274)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(277)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(277)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)7882874 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(274)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(274)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(280)3080487 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@d00515b5a167: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@d00515b5a167: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)14314446 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(274)@d00515b5a167: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(274)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(281)11860840 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@d00515b5a167: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@d00515b5a167: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(282) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)11649216 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: First idle individual index:2 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(274)@d00515b5a167: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(282) HNBGW_Test.msc0-RAN(274)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(282)10905379 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(282)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(282)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(274)@d00515b5a167: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(274)@d00515b5a167: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(283) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@d00515b5a167: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)12142600 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: First idle individual index:3 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(274)@d00515b5a167: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(283) HNBGW_Test.msc0-RAN(274)@d00515b5a167: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(283)4368090 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(283)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(283)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(267)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(272)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(274)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(276)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(277)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(275)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(273)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(278)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(279)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(267): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(268): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(269): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(270): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(271): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(272): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(273): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(274): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(275): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(276): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(277): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(278): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(279): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(282): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(283): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Mon Sep 23 07:50:29 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=215167) Waiting for packet dumper to finish... 1 (prev_count=215167, count=283405) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Mon Sep 23 07:50:32 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(292)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(292)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(292)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(290)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(295)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(295)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(295)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(293)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(298)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(298)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(298)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(296)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(301)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(301)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(301)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(299)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(292)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(295)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(298)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(301)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(291)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(291)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(294)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(294)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(297)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(297)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(300)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(300)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)5309513 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(291)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(291)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(303)16762623 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(294)@d00515b5a167: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(294)@d00515b5a167: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(304)7392927 HNBGW_Test.msc1-SCCP(293)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(293)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(294)@d00515b5a167: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(304) HNBGW_Test.msc1-RAN(294)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(304)6199066 HNBGW_Test.msc1-SCCP(293)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(293)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(304)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(304)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(291)@d00515b5a167: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(291)@d00515b5a167: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(305)11744829 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(291)@d00515b5a167: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(305) HNBGW_Test.msc0-RAN(291)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(305)10529854 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(305)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(305)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(297)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(300)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(291)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(294)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(299)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(298)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(292)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(296)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(301)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(293)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(290)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(302)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(284)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(295)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(289)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(284): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(285): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(286): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(287): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(288): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(289): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(290): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(291): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(292): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(293): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(294): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(295): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(296): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(297): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(298): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(299): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(300): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(301): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(302): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(304): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(305): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Mon Sep 23 07:50:38 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243229) Waiting for packet dumper to finish... 1 (prev_count=243229, count=311401) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Mon Sep 23 07:50:41 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(314)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(314)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(314)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(312)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(317)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(317)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(317)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(315)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(320)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(320)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(320)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(318)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(323)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(323)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(323)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(321)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(314)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(317)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(320)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(323)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(313)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(313)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(316)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(316)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(319)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(319)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(322)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(322)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)3087911 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(313)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(313)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)4713561 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(316)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(316)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@d00515b5a167: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)14374127 HNBGW_Test.msc1-SCCP(315)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(315)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(316)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326) HNBGW_Test.msc1-RAN(316)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)12852586 HNBGW_Test.msc1-SCCP(315)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(315)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(313)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(313)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@d00515b5a167: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)16120294 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(313)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327) HNBGW_Test.msc0-RAN(313)@d00515b5a167: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)8381811 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(319)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(313)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(318)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(315)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(316)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(317)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(312)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(321)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(322)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(324)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(306)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(323)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(320)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(314)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(311)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(306): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(307): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(308): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(309): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(310): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(311): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(312): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(313): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(314): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(315): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(316): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(317): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(318): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(319): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(320): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(321): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(322): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(323): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(324): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(326): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(327): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Mon Sep 23 07:50:47 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243691) Waiting for packet dumper to finish... 1 (prev_count=243691, count=311751) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Mon Sep 23 07:50:50 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(336)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(336)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(336)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(334)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(339)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(339)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(339)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(337)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(342)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(342)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(342)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(340)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(345)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(345)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(345)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(343)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(336)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(339)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(342)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(345)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(335)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(335)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(338)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(338)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(341)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(341)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(344)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(344)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)8158987 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(335)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(335)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)12847555 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Session index based on connection ID:0 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(338)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(338)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@d00515b5a167: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)9487034 HNBGW_Test.msc1-SCCP(337)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(337)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(338)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348) HNBGW_Test.msc1-RAN(338)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)11742133 HNBGW_Test.msc1-SCCP(337)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(337)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(335)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(335)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@d00515b5a167: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)12404027 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(335)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349) HNBGW_Test.msc0-RAN(335)@d00515b5a167: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)13457214 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(341)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(344)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(336)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(339)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(343)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(337)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(335)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(340)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(333)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(345)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(342)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(346)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(334)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(328)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(338)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(328): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(329): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(330): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(331): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(332): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(333): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(334): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(335): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(336): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(337): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(338): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(339): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(340): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(341): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(342): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(343): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(344): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(345): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(346): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(348): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(349): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Mon Sep 23 07:50:56 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=247064) Waiting for packet dumper to finish... 1 (prev_count=247064, count=314672) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Mon Sep 23 07:50:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(358)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(358)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(358)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(356)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(361)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(361)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(361)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(359)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(364)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(364)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(364)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(362)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(367)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(367)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(367)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(365)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(358)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(361)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(364)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(367)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(357)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(357)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(360)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(360)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(363)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(363)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(366)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(366)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)14561724 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(357)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(357)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)16179770 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(360)@d00515b5a167: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(360)@d00515b5a167: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)10190801 HNBGW_Test.msc1-SCCP(359)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(359)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(360)@d00515b5a167: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370) HNBGW_Test.msc1-RAN(360)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)5263851 HNBGW_Test.msc1-SCCP(359)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(359)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(357)@d00515b5a167: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(357)@d00515b5a167: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)8709358 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(357)@d00515b5a167: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371) HNBGW_Test.msc0-RAN(357)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)5270993 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(371)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-RAN(366)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(364)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(363)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(365)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(356)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(360)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(359)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(358)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(362)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(367)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(361)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(350)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(368)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(355)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(357)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(350): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(351): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(352): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(353): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(354): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(355): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(356): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(357): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(358): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(359): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(360): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(361): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(362): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(363): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(364): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(365): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(366): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(367): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(368): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(370): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_rMon Sep 23 07:51:05 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc ound_robin0(371): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=252091) Waiting for packet dumper to finish... 1 (prev_count=252091, count=320623) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Mon Sep 23 07:51:08 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(380)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(380)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(380)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(378)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(383)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(383)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(383)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(381)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(386)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(386)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(386)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(384)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(389)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(389)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(389)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(387)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(380)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(383)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(386)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(389)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(379)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(379)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(382)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(382)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(385)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(388)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(388)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(385)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)5859991 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(379)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(379)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)3907441 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(382)@d00515b5a167: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(382)@d00515b5a167: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)5469576 HNBGW_Test.msc1-SCCP(381)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(381)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(382)@d00515b5a167: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392) HNBGW_Test.msc1-RAN(382)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)1659117 HNBGW_Test.msc1-SCCP(381)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(381)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(379)@d00515b5a167: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(379)@d00515b5a167: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)6166306 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(379)@d00515b5a167: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393) HNBGW_Test.msc0-RAN(379)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)16697806 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-M3UA(389)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(388)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(387)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(384)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(379)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(385)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(381)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(378)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(372)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(386)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(390)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(383)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(380)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(377)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(382)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(372): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(373): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(374): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(375): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(376): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(377): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(378): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(379): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(380): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(381): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(382): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(383): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(384): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(385): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(386): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(387): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(388): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(389): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(390): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(392): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(393): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpooMon Sep 23 07:51:14 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc l_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=256243) Waiting for packet dumper to finish... 1 (prev_count=256243, count=325089) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Mon Sep 23 07:51:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(402)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(402)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(402)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(400)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(405)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(405)@d00515b5a167: M3UA emulation initiated, the test can be started MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(405)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(403)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(408)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(408)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(408)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(406)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(411)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(411)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(411)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(409)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(402)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(405)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(408)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(411)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(401)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(404)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(404)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(407)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(407)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(410)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(410)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(401)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)13400042 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(404)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(404)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)16417604 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@d00515b5a167: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@d00515b5a167: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)6177172 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(404)@d00515b5a167: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414) HNBGW_Test.msc1-RAN(404)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)13712392 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(404)@d00515b5a167: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(404)@d00515b5a167: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)10694436 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: First idle individual index:2 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(404)@d00515b5a167: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415) HNBGW_Test.msc1-RAN(404)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)13626559 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(411)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(410)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(409)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(407)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(408)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(401)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(404)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(400)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(405)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(403)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(394)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(406)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(402)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(399)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(412)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(394): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(395): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(396): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(397): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(398): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(399): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(400): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(401): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(402): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(403): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(404): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(405): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(406): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(407): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(408): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(409): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(410): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(411): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(412): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(414): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(415): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Mon Sep 23 07:51:23 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=331085) Waiting for packet dumper to finish... 1 (prev_count=331085, count=340925) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Mon Sep 23 07:51:26 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(424)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(424)@d00515b5a167: M3UA emulation initiated, the test can be started MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(424)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(422)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(427)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(427)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(427)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(425)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(430)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(430)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(430)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(428)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(433)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(433)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(433)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(431)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(436)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(436)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(436)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(434)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(439)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-M3UA(439)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(439)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-SCCP(437)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(424)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(427)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(430)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(433)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(436)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(439)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(423)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(423)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(426)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(426)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(429)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(429)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(432)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(432)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(435)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(435)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(438)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(438)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)8645629 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(429)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc2-RAN(429)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)12583746 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(429)@d00515b5a167: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(429)@d00515b5a167: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)6525537 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(429)@d00515b5a167: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442) HNBGW_Test.msc2-RAN(429)@d00515b5a167: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)8087371 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(426)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(426)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@d00515b5a167: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)3452400 HNBGW_Test.msc1-SCCP(425)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(425)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(426)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443) HNBGW_Test.msc1-RAN(426)@d00515b5a167: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)10264400 HNBGW_Test.msc1-SCCP(425)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(425)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(435)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(430)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(434)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(436)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(432)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(427)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(426)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(425)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(437)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(423)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(422)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(439)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(433)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417)@d00515b5a167: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(428)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(416)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(438)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(431)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(429)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(424)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(421)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(440)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(416): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(417): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(418): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(419): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(420): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(421): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(422): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(423): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(424): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(425): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(426): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(427): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(428): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(429): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(430): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(431): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(432): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(433): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(434): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(435): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(436): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(437): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-RAN(438): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(439): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(440): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(442): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(443): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Mon Sep 23 07:51:33 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=392897) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Mon Sep 23 07:51:35 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(452)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(452)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(452)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(450)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(455)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(455)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(455)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(453)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(458)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(458)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(458)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(456)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(461)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(461)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(461)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(459)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(464)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(464)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(464)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(462)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(467)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-M3UA(467)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(467)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-SCCP(465)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(452)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(455)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(458)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(461)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(464)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(467)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(451)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(451)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(454)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(454)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(457)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(457)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(460)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(460)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(463)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(463)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(466)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(466)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(451)@d00515b5a167: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(451)@d00515b5a167: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)6144486 HNBGW_Test.msc0-SCCP(450)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(450)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(451)@d00515b5a167: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(469) HNBGW_Test.msc0-RAN(451)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)7968199 HNBGW_Test.msc0-SCCP(450)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(450)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(469)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(457)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(457)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@d00515b5a167: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)11522579 HNBGW_Test.msc2-SCCP(456)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc2-SCCP(456)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(457)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(470) HNBGW_Test.msc2-RAN(457)@d00515b5a167: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)8355754 HNBGW_Test.msc2-SCCP(456)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(456)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(470)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-M3UA(458)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(450)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(444)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(462)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(456)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(460)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(453)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(451)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(454)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(467)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(459)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(449)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(455)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(463)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(457)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(464)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(466)@d00515b5a167: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(461)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(465)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(468)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(452)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(444): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(445): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(446): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(447): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(448): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(449): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(450): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(451): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(452): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(453): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(454): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(455): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(456): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(457): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(458): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(459): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(460): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(461): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(462): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(463): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(464): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(465): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-RAN(466): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(467): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(468): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(469): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(470): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Mon Sep 23 07:51:40 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=304699) Waiting for packet dumper to finish... 1 (prev_count=304699, count=372355) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Mon Sep 23 07:51:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(472)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(474)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(479)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(479)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(479)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(477)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(482)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(482)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(482)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(480)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(485)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(485)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(485)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(483)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(488)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(488)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(488)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(486)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(479)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(482)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(485)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(488)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(478)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(478)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(481)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(481)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(484)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(484)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(487)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(487)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh0-RUA(473)@d00515b5a167: UnitdataCallback TC_mscpool_paging_imsi-Iuh1-RUA(475)@d00515b5a167: UnitdataCallback HNBGW_Test.msc0-RAN(478)@d00515b5a167: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(478)@d00515b5a167: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(490) TC_mscpool_paging_imsi-Iuh0-RUA(473)@d00515b5a167: Added conn table entry 0TC_mscpool_paging_imsi0(490)7380005 HNBGW_Test.msc0-SCCP(477)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(477)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(478)@d00515b5a167: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(490) HNBGW_Test.msc0-RAN(478)@d00515b5a167: Added conn table entry 0TC_mscpool_paging_imsi0(490)14708363 HNBGW_Test.msc0-SCCP(477)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(477)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(490)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(490)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_imsi-Iuh1-RUA(475)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(478)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(484)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0-RUA(473)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(486)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(487)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(477)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(483)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(476)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(481)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(480)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(488)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(479)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(471)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(472)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(485)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(482)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(474)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(489)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(471): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(472): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(473): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(474): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(475): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(476): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(477): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(478): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(479): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(480): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(481): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(482): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(483): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(484): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(485): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(486): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(487): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(488): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(489): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_imsi0(490): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Mon Sep 23 07:51:49 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=248547) Waiting for packet dumper to finish... 1 (prev_count=248547, count=289728) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Mon Sep 23 07:51:52 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(492)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(494)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(499)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(499)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(499)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(497)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(502)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(502)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(502)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(500)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(505)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(505)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(505)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(503)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(508)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(508)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(508)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(506)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(499)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(502)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(505)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(508)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(498)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(498)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(501)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(504)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(504)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(507)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(507)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(501)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(510)@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh1-RUA(495)@d00515b5a167: UnitdataCallback TC_mscpool_paging_tmsi-Iuh0-RUA(493)@d00515b5a167: UnitdataCallback TC_mscpool_paging_tmsi0(510)@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(498)@d00515b5a167: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(498)@d00515b5a167: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(510) TC_mscpool_paging_tmsi-Iuh0-RUA(493)@d00515b5a167: Added conn table entry 0TC_mscpool_paging_tmsi0(510)16732890 HNBGW_Test.msc0-SCCP(497)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(497)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(498)@d00515b5a167: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(510) HNBGW_Test.msc0-RAN(498)@d00515b5a167: Added conn table entry 0TC_mscpool_paging_tmsi0(510)11583394 HNBGW_Test.msc0-SCCP(497)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(497)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(510)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_paging_tmsi0(510)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_tmsi-Iuh1-RUA(495)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(504)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(507)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0-RUA(493)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(508)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(505)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(500)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(506)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(498)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(499)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(497)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(501)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(503)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(496)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(494)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(491)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(502)@d00515b5a167: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(492)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(509)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(491): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(492): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(493): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(494): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(495): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(496): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(497): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(498): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(499): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(500): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(501): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(502): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(503): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(504): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(505): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(506): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(507): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(508): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(509): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_paging_tmsi0(510): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Mon Sep 23 07:51:58 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=229632) Waiting for packet dumper to finish... 1 (prev_count=229632, count=270218) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Mon Sep 23 07:52:01 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(519)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(519)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(519)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(517)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(522)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(522)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(522)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(520)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(525)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(525)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(525)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(523)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(528)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(528)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(528)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(526)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(519)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(522)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(525)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(528)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(518)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(518)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(521)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(524)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(527)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(527)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(521)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(524)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)16070347 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(518)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(518)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(530)3639706 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(524)@d00515b5a167: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(524)@d00515b5a167: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(531) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@d00515b5a167: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(531)9602072 HNBGW_Test.msc2-SCCP(523)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc2-SCCP(523)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(524)@d00515b5a167: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(531) HNBGW_Test.msc2-RAN(524)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(531)4881583 HNBGW_Test.msc2-SCCP(523)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(523)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(531)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(531)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(518)@d00515b5a167: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(518)@d00515b5a167: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(532) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@d00515b5a167: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(532)485903 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(518)@d00515b5a167: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(532) HNBGW_Test.msc0-RAN(518)@d00515b5a167: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(532)14453796 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(532)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(532)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(518)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(520)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(524)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(527)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(521)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(512)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(511)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(514)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(523)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(526)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(519)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(528)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(517)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(525)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(529)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(522)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(516)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(511): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(512): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(513): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(514): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(515): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(516): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(517): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(518): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(519): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(520): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(521): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(522): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(523): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(524): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(525): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(526): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(527): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(528): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(529): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(531): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(532): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Mon Sep 23 07:52:07 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=261095) Waiting for packet dumper to finish... 1 (prev_count=261095, count=325626) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Mon Sep 23 07:52:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(541)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(541)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(541)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(539)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(544)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(544)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(544)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(542)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(547)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(547)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(547)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(545)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(550)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(550)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(550)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(548)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(541)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(544)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(547)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(550)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(540)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(540)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(543)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(543)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(546)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(546)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(549)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(549)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(543)@d00515b5a167: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(543)@d00515b5a167: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)3894740 HNBGW_Test.msc1-SCCP(542)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(542)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(543)@d00515b5a167: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc1-RAN(543)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)6878653 HNBGW_Test.msc1-SCCP(542)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(542)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(552)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(540)@d00515b5a167: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(540)@d00515b5a167: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(553) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@d00515b5a167: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(553)14809321 HNBGW_Test.msc0-SCCP(539)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(539)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(540)@d00515b5a167: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(553) HNBGW_Test.msc0-RAN(540)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(553)3408722 HNBGW_Test.msc0-SCCP(539)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(539)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(553)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(553)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(546)@d00515b5a167: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(546)@d00515b5a167: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(554) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@d00515b5a167: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(554)10375230 HNBGW_Test.msc2-SCCP(545)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc2-SCCP(545)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(546)@d00515b5a167: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(554) HNBGW_Test.msc2-RAN(546)@d00515b5a167: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(554)13454518 HNBGW_Test.msc2-SCCP(545)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(545)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(554)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(554)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-SCCP(545)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(549)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(548)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(546)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(547)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(539)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(534)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(543)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(542)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(544)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(533)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(541)@d00515b5a167: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(536)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(540)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(538)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(551)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(550)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(533): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(534): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(535): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(536): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(537): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(538): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(539): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(540): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(541): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(542): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(543): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(544): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(545): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(546): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(547): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(548): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(549): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(550): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(551): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(553): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(554): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Mon Sep 23 07:52:16 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=252659) Waiting for packet dumper to finish... 1 (prev_count=252659, count=319637) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Mon Sep 23 07:52:19 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(563)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(563)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(563)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(561)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(566)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(566)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(566)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(564)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(569)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(569)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(569)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(567)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(572)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(572)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(572)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(570)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(563)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(566)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(569)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(572)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(562)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(562)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(565)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(565)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(568)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(568)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(571)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(571)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(562)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(562)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)11103671 HNBGW_Test.msc0-SCCP(561)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(561)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(562)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc0-RAN(562)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)3649038 HNBGW_Test.msc0-SCCP(561)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(561)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(565)@d00515b5a167: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@d00515b5a167: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@d00515b5a167: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)13284444 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(565)@d00515b5a167: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575) HNBGW_Test.msc1-RAN(565)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)11345726 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: "disconnecting msc0" HNBGW_Test.msc0-RAN(562)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(563)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(561)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@d00515b5a167: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)11103671 HNBGW_Test.msc1-RAN(565)@d00515b5a167: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(565)@d00515b5a167: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)1368270 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(565)@d00515b5a167: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576) HNBGW_Test.msc1-RAN(565)@d00515b5a167: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)8066256 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(572)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(560)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(565)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(568)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(571)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(555)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(566)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(567)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(564)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(573)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(569)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(570)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(555): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(556): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(557): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(558): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(559): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(560): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(561): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(562): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(563): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(564): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(565): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(566): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(567): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(568): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(569): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(570): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(571): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(572): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(573): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(575): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(576): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Mon Sep 23 07:52:25 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=258201) Waiting for packet dumper to finish... 1 (prev_count=258201, count=319406) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Mon Sep 23 07:52:28 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(585)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(585)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(585)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(583)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(588)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(588)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(588)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(586)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(585)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(588)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(584)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(584)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(587)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(587)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)2330569 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(584)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590) HNBGW_Test.msc0-RAN(584)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)5798245 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(584)@d00515b5a167: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(584)@d00515b5a167: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@d00515b5a167: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)13833710 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: First idle individual index:1 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(584)@d00515b5a167: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591) HNBGW_Test.msc0-RAN(584)@d00515b5a167: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)71987 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: "connecting cnlink 1" MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(594)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(594)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(594)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(592)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(594)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(593)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(593)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(593)@d00515b5a167: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(593)@d00515b5a167: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@d00515b5a167: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)4731155 HNBGW_Test.msc1-SCCP(592)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc1-SCCP(592)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(593)@d00515b5a167: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595) HNBGW_Test.msc1-RAN(593)@d00515b5a167: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)5553806 HNBGW_Test.msc1-SCCP(592)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(592)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@d00515b5a167: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(583)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(593)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(592)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580)@d00515b5a167: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(584)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(587)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(582)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(586)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(585)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(594)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(588)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(577)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(589)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(577): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(578): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(579): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(580): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(581): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(582): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(583): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(584): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(585): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(586): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(587): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(588): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(589): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(590): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(591): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(592): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(593): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(594): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(595): pass (pass -> pass) MTC@d00515b5a167: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Mon Sep 23 07:52:35 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=232654) Waiting for packet dumper to finish... 1 (prev_count=232654, count=311817) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Mon Sep 23 07:52:38 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(604)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(604)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(604)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(602)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(607)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(607)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(607)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(604)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(607)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(603)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(603)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)2526803 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(609)15786576 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)11582229 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(610)13545293 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)3373539 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(611) HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(611)977562 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(611)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(611)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@d00515b5a167: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)1618586 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(612) HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(612)14154251 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(612)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(612)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(606)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(603)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(596)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(607)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(602)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(604)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(605)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(608)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(601)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(596): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(597): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(598): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(599): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(600): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(601): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(602): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(603): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(604): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(605): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(606): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(607): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(608): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(611): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(612): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Mon Sep 23 07:52:45 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=218888) Waiting for packet dumper to finish... 1 (prev_count=218888, count=287134) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Mon Sep 23 07:52:47 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(621)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(621)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(621)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(619)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(624)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(624)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(624)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(622)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(627)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(627)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(627)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(630)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(630)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(630)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(621)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(624)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(627)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(630)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(620)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(620)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(623)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(623)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)12358131 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(632)1383002 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(633)5250620 HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(633) HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(633)10570170 HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(633)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(634)16334916 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(634) HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(634)2796656 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(634)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(627)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(628)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(619)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(626)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(624)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(618)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(630)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(622)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(629)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(625)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(613)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(620)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(621)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(631)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(623)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(613): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(614): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(615): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(616): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(617): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(618): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(619): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(620): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(621): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(622): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(623): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(624): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(625): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(626): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(627): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(628): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(629): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(630): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(631): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(633): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(634): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Mon Sep 23 07:52:54 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=319008) Waiting for packet dumper to finish... 1 (prev_count=319008, count=321677) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Mon Sep 23 07:52:57 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(643)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(643)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(643)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(641)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(646)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(646)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(646)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(644)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(649)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(649)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(649)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(647)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(652)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(652)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(652)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(643)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(646)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(649)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(652)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(642)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(642)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(645)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(645)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(648)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(648)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)4802272 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(654)15976869 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(655) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)14080748 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(655) HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(655)8832505 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(655)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(655)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(656) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)1994605 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(656) HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(656)13879263 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(656)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(656)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(651)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(645)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(652)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(642)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(648)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(644)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(649)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(650)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(646)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(635)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(641)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(640)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(653)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(647)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(643)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(635): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(636): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(637): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(638): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(639): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(640): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(641): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(642): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(643): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(644): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(645): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(646): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(647): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(648): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(649): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(650): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(651): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(652): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(653): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(655): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(656): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Mon Sep 23 07:53:03 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=252931) Waiting for packet dumper to finish... 1 (prev_count=252931, count=321844) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Mon Sep 23 07:53:06 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(665)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(665)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(665)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(663)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(668)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(668)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(668)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(666)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(671)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(671)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(671)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(669)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(674)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(674)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(674)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(672)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(677)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(677)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(677)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(680)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-M3UA(680)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(680)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(665)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(668)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(671)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(674)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(677)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(680)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(664)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(664)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(667)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(667)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(670)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(670)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(673)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(673)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)9227460 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)12912395 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(683) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)5628804 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(683) HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(683)7031050 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(683)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(683)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(684) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@d00515b5a167: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(684)11904982 HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(684) HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(684)16465025 HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(684)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(684)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(672)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(666)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(677)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(663)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(671)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(665)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(679)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(669)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(676)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(667)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(668)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(664)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(675)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(670)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(662)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(657)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(678)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(673)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(674)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(681)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(680)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(657): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(658): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(659): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(660): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(661): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(662): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(663): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(664): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(665): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(666): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(667): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(668): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(669): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(670): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(671): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(672): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(673): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(674): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(675): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(676): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(677): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(678): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-RAN(679): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(680): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(681): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(683): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(684): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Mon Sep 23 07:53:12 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=379343) Waiting for packet dumper to finish... 1 (prev_count=379343, count=389177) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Mon Sep 23 07:53:15 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(693)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(693)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(693)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(691)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(696)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(696)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(696)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(694)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(699)@d00515b5a167: ************************************************* HNBGW_Test.msc2-M3UA(699)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(699)@d00515b5a167: ************************************************* HNBGW_Test.msc2-SCCP(697)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(702)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(702)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(702)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(705)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(705)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(705)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(703)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(708)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-M3UA(708)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(708)@d00515b5a167: ************************************************* HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(693)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(696)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(699)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(702)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(705)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(708)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(692)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(692)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(695)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(695)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(698)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(698)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(704)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(704)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@d00515b5a167: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(710) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@d00515b5a167: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)108578 HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(710) HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(710)12464614 HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(710)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(710)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(711) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@d00515b5a167: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(711)6761448 HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(711) HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(711)1401975 HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(711)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(711)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(697)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(704)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(706)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(708)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(701)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(694)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-RAN(698)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(686)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(696)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(705)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(699)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(688)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(685)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(709)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(702)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(692)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(703)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(700)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(690)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(695)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(691)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(693)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(707)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(685): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(686): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(687): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(688): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(689): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(690): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(691): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(692): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(693): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(694): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(695): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(696): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-SCCP(697): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-RAN(698): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc2-M3UA(699): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(700): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(701): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(702): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(703): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(704): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(705): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(706): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-RAN(707): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(708): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(709): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(710): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(711): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Mon Sep 23 07:53:21 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=354951) Waiting for packet dumper to finish... 1 (prev_count=354951, count=360105) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Mon Sep 23 07:53:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(720)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(720)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(720)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(718)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(723)@d00515b5a167: ************************************************* HNBGW_Test.msc1-M3UA(723)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(723)@d00515b5a167: ************************************************* HNBGW_Test.msc1-SCCP(721)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(726)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(726)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(726)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(729)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(729)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(729)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(720)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(723)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(726)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(729)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(719)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(722)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(722)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(719)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)4221343 HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)4153207 HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@d00515b5a167: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)9168064 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732) HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)14332576 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(725)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(726)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(724)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@d00515b5a167: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)4221343 HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)2885528 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733) HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)8110651 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(728)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(723)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(727)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(729)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(718)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(719)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(721)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc1-RAN(722)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(720)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(717)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(712)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(730)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(712): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(713): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(714): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(715): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(716): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(717): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(718): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(719): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(720): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-SCCP(721): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-RAN(722): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc1-M3UA(723): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(724): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(725): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(726): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(727): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(728): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(729): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(730): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(732): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(733): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Mon Sep 23 07:53:30 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=282366) Waiting for packet dumper to finish... 1 (prev_count=282366, count=341736) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Mon Sep 23 07:53:33 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(742)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(742)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(742)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(740)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(745)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(745)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(745)@d00515b5a167: ************************************************* MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(742)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(745)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(741)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(741)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)7706262 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747) HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)7217102 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@d00515b5a167: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)5151854 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748) HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)3601601 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: "connecting cnlink 1" MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(751)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-M3UA(751)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(751)@d00515b5a167: ************************************************* HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(751)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 MTC@d00515b5a167: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "127.0.0.1", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@d00515b5a167: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)4260444 HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752) HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)12581288 HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@d00515b5a167: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(741)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(750)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(751)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(740)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(739)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(744)@d00515b5a167: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(749)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(745)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(743)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(742)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(734)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(746)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(734): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(735): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(736): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(737): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(738): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(739): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(740): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(741): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(742): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(743): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(744): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(745): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(746): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(747): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(748): pass (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(749): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-RAN(750): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(751): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(752): pass (pass -> pass) MTC@d00515b5a167: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Mon Sep 23 07:53:40 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=261696) Waiting for packet dumper to finish... 1 (prev_count=261696, count=340075) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Mon Sep 23 07:53:43 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(754)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(759)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(759)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(759)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(757)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(762)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(762)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(762)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(760)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(759)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(762)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(758)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(761)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(758)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(761)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(763)@d00515b5a167: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@d00515b5a167: f_create_expect(l3 := '07CAA67C7F0CC0431F1F'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(758)@d00515b5a167: Created Expect[0] for '07CAA67C7F0CC0431F1F'O to be handled at TC_second_rab_assignment0(764) TC_second_rab_assignment-Iuh0-RUA(755)@d00515b5a167: Added conn table entry 0TC_second_rab_assignment0(764)2332787 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(758)@d00515b5a167: Found Expect[0] for l3='07CAA67C7F0CC0431F1F'O handled at TC_second_rab_assignment0(764) HNBGW_Test.msc0-RAN(758)@d00515b5a167: Added conn table entry 0TC_second_rab_assignment0(764)10764181 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_len:91 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(763)@d00515b5a167: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "23987317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(764) TC_second_rab_assignment0(764)@d00515b5a167: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "23987317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@d00515b5a167: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "23987317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(764)@d00515b5a167: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "23987317", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_len:63 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_len:12 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@d00515b5a167: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(764)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(764)@d00515b5a167: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "23987317" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(757)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(764)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(764)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(758)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(760)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(757)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(753)@d00515b5a167: Final verdict of PTC: none TC_second_rab_assignment-Iuh0-RUA(755)@d00515b5a167: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(754)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(761)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(759)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(762)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(763)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(756)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(753): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_second_rab_assignment-Iuh0(754): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(755): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(756): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(757): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(758): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(759): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(760): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(761): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(762): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(763): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_second_rab_assignment0(764): pass (pass -> pass) MTC@d00515b5a167: Test case TC_second_rab_assignment finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Mon Sep 23 07:53:46 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=228366) Waiting for packet dumper to finish... 1 (prev_count=228366, count=228864) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Mon Sep 23 07:53:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(771)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(771)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(771)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(769)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(774)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(774)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(774)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(772)@d00515b5a167: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(771)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(774)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(770)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(770)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(773)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(773)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: talloc reports "struct hnb_context" x 1, expecting 1 MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(769)@d00515b5a167: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767)@d00515b5a167: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(771)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(765)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(770)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(773)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(772)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(768)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(774)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(775)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(765): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(766): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(767): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(768): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(769): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(770): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(771): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(772): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(773): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(774): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(775): none (pass -> pass) MTC@d00515b5a167: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Mon Sep 23 07:53:51 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=91079) Waiting for packet dumper to finish... 1 (prev_count=91079, count=149569) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Mon Sep 23 07:53:54 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@d00515b5a167: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@d00515b5a167: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(777)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(779)@d00515b5a167: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(784)@d00515b5a167: ************************************************* HNBGW_Test.msc0-M3UA(784)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(784)@d00515b5a167: ************************************************* HNBGW_Test.msc0-SCCP(782)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@d00515b5a167: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(787)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-M3UA(787)@d00515b5a167: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(787)@d00515b5a167: ************************************************* HNBGW_Test.sgsn0-SCCP(785)@d00515b5a167: v_sccp_pdu_maxlen:268 MTC@d00515b5a167: setverdict(pass): none -> pass MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(784)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(787)@d00515b5a167: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(783)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(783)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(786)@d00515b5a167: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(786)@d00515b5a167: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(783)@d00515b5a167: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(783)@d00515b5a167: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(789) TC_apply_sccp-Iuh0-RUA(778)@d00515b5a167: Added conn table entry 0TC_apply_sccp0(789)12992635 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: First idle individual index:0 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(783)@d00515b5a167: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(789) HNBGW_Test.msc0-RAN(783)@d00515b5a167: Added conn table entry 0TC_apply_sccp0(789)9837651 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(789)@d00515b5a167: setverdict(pass): none -> pass TC_apply_sccp0(789)@d00515b5a167: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@d00515b5a167: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(782)@d00515b5a167: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(789)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: vl_len:22 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: vl_from0 HNBGW_Test.msc0-SCCP(782)@d00515b5a167: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A83776D12D39074A1E278'O TC_apply_sccp0(789)@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(789)@d00515b5a167: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Session index based on local reference:0 HNBGW_Test.msc0-RAN(783)@d00515b5a167: Deleted conn table entry 0TC_apply_sccp0(789)9837651 TC_apply_sccp-Iuh0-RUA(778)@d00515b5a167: Deleted conn table entry 0TC_apply_sccp0(789)12992635 TC_apply_sccp0(789)@d00515b5a167: Final verdict of PTC: pass MTC@d00515b5a167: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(782)@d00515b5a167: Final verdict of PTC: none TC_apply_sccp-Iuh1-RUA(780)@d00515b5a167: Final verdict of PTC: none TC_apply_sccp-Iuh0-RUA(778)@d00515b5a167: Final verdict of PTC: none TC_apply_sccp-Iuh1(779)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(787)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(786)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-RAN(783)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(785)@d00515b5a167: Final verdict of PTC: none HNBGW-MGCP(788)@d00515b5a167: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(784)@d00515b5a167: Final verdict of PTC: none TC_apply_sccp-Iuh0(777)@d00515b5a167: Final verdict of PTC: none VirtHNBGW-STATS(776)@d00515b5a167: Final verdict of PTC: none IPA-CTRL-CLI-IPA(781)@d00515b5a167: Final verdict of PTC: none MTC@d00515b5a167: setverdict(pass): pass -> pass, component reason not changed MTC@d00515b5a167: Setting final verdict of the test case. MTC@d00515b5a167: Local verdict of MTC: pass MTC@d00515b5a167: Local verdict of PTC VirtHNBGW-STATS(776): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_apply_sccp-Iuh0(777): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(778): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_apply_sccp-Iuh1(779): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(780): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC IPA-CTRL-CLI-IPA(781): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-SCCP(782): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-RAN(783): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.msc0-M3UA(784): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(785): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-RAN(786): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(787): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC HNBGW-MGCP(788): none (pass -> pass) MTC@d00515b5a167: Local verdict of PTC TC_apply_sccp0(789): pass (pass -> pass) MTC@d00515b5a167: Test case TC_apply_sccp finished. Verdict: pass MTC@d00515b5a167: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Mon Sep 23 07:54:01 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=179895) Waiting for packet dumper to finish... 1 (prev_count=179895, count=199782) MTC@d00515b5a167: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@d00515b5a167: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@d00515b5a167: Terminating MTC. MC@d00515b5a167: MTC terminated. MC2> exit MC@d00515b5a167: Shutting down session. MC@d00515b5a167: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-20.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_ps_rab_assignment_without_pfcp pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: FAIL HNBGW_Tests.TC_hnb_disconnected_timeout Summary: NEW: FAIL: 1 pass: 47 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_without_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-990-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-990-hnbgw jenkins-ttcn3-hnbgw-test-990-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-990-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-990-stp + docker kill jenkins-ttcn3-hnbgw-test-990-stp jenkins-ttcn3-hnbgw-test-990-stp + docker wait jenkins-ttcn3-hnbgw-test-990-stp 137 + echo Testing with PFCP Testing with PFCP + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + run_tests /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp with-pfcp/HNBGW_Tests.cfg osmo-stp.cfg with-pfcp/osmo-hnbgw.cfg + base_dir=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp + tests_cfg=with-pfcp/HNBGW_Tests.cfg + stp_cfg=osmo-stp.cfg + hnbgw_cfg=with-pfcp/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/unix + cp with-pfcp/HNBGW_Tests.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/ + write_mp_osmo_repo /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local repo=nightly + local config=/home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + local line + [ -e /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg ] + line=Misc_Helpers.mp_osmo_repo := "nightly" + sed -i s/\[MODULE_PARAMETERS\]/\[MODULE_PARAMETERS\]\nMisc_Helpers.mp_osmo_repo := "nightly"/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp + cp osmo-stp.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp/osmo-stp.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/unix + cp with-pfcp/osmo-hnbgw.cfg /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg + mkdir /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix + network_replace_subnet_in_configs + set +x Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/HNBGW_Tests.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw/osmo-hnbgw.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp/osmo-stp.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw/osmo-hnbgw.cfg Applying SUBNET=46 to: /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/stp/osmo-stp.cfg + echo Starting container with STP Starting container with STP + docker_network_params 46 200 + NET=46 + ADDR_SUFIX=200 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.200 --ip6 fd02:db8:46::200 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.200 --ip6 fd02:db8:46::200 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/stp:/data --name jenkins-ttcn3-hnbgw-test-990-stp -d osmocom-build/osmo-stp-master a4673eae4f8788b76f489e7ee05b76942e169b0e40625c2d32735b91b634af38 + echo Starting container with HNBGW Starting container with HNBGW + docker_network_params 46 20 + NET=46 + ADDR_SUFIX=20 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.20 --ip6 fd02:db8:46::20 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.20 --ip6 fd02:db8:46::20 --ulimit core=-1 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-990-hnbgw -d osmocom-build/osmo-hnbgw-master 7a4c5ad0c972f4616019b41e45b805233b5fe314f996a72db5848ebf31f0868c + echo Starting container with HNBGW testsuite Starting container with HNBGW testsuite + docker_network_params 46 203 + NET=46 + ADDR_SUFIX=203 + echo --network ttcn3-hnbgw-test-46 --ip 172.18.46.203 --ip6 fd02:db8:46::203 + docker run --rm --network ttcn3-hnbgw-test-46 --ip 172.18.46.203 --ip6 fd02:db8:46::203 --ulimit core=-1 -e TTCN3_PCAP_PATH=/data -e OSMO_SUT_HOST=172.18.46.20 -e OSMO_SUT_PORT=4261 -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/unix:/data/unix --name jenkins-ttcn3-hnbgw-test-990-ttcn3-hnbgw-test osmocom-build/ttcn3-hnbgw-test + SUBDIR=hnbgw + SUITE=HNBGW_Tests + '[' -n '' ']' + cd /data + EXTRA_ARGS= + '[' -n '' ']' + /osmo-ttcn3-hacks/start-testsuite.sh /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests HNBGW_Tests.cfg ttcn3_start: Starting the test suite ttcn3_start: warning: TTCN3_DIR environment variable is not set spawn mctr_cli HNBGW_Tests.cfg ************************************************************************* * TTCN-3 Test Executor - Main Controller 2 * * Version: 9.0.0 * * Copyright (c) 2000-2023 Ericsson Telecom AB * * All rights reserved. This program and the accompanying materials * * are made available under the terms of the Eclipse Public License v2.0 * * which accompanies this distribution, and is available at * * https://www.eclipse.org/org/documents/epl-2.0/EPL-2.0.html * ************************************************************************* Using configuration file: HNBGW_Tests.cfg MC@05e891daadfd: Unix server socket created successfully. MC@05e891daadfd: Listening on TCP port 43705. 05e891daadfd is the default MC2> spawn /osmo-ttcn3-hacks/hnbgw/HNBGW_Tests 05e891daadfd 43705 TTCN-3 Host Controller (parallel mode), version 9.0.0 MC@05e891daadfd: New HC connected from 172.18.46.203 [172.18.46.203]. 05e891daadfd: Linux 6.1.0-13-amd64 on x86_64. cmtc MC@05e891daadfd: Downloading configuration file to all HCs. construct junitlogger Initializing `JUnitLogger' (v2.0): JUnitLogger writes JUnit-compatible XML HC@05e891daadfd: Warning: Option `FileMask' was given more than once in section [LOGGING] of the configuration file. MC@05e891daadfd: Configuration file was processed on all HCs. MC@05e891daadfd: Creating MTC on host 172.18.46.203. MC@05e891daadfd: MTC is created. MC2> smtc Executing all items of [EXECUTE] section. MC2> MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register'. ------ HNBGW_Tests.TC_hnb_register ------ Mon Sep 23 07:54:07 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register.pcap" >/data/HNBGW_Tests.TC_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_hnb_register started. TC_hnb_register-Iuh0(4)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(9)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(9)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(9)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(7)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(12)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(12)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(12)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(10)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(9)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(12)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(8)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(8)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(11)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(11)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(7)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(9)@05e891daadfd: Final verdict of PTC: none TC_hnb_register-Iuh0-RUA(5)@05e891daadfd: Final verdict of PTC: none TC_hnb_register-Iuh0(4)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(6)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(3)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(12)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(11)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(8)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(13)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(10)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(3): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register-Iuh0(4): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register-Iuh0-RUA(5): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(6): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(7): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(8): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(9): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(10): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(11): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(12): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(13): none (pass -> pass) MTC@05e891daadfd: Test case TC_hnb_register finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass'. Mon Sep 23 07:54:09 UTC 2024 ====== HNBGW_Tests.TC_hnb_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=149171) Waiting for packet dumper to finish... 1 (prev_count=149171, count=204702) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate'. ------ HNBGW_Tests.TC_hnb_register_duplicate ------ Mon Sep 23 07:54:12 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_hnb_register_duplicate started. TC_hnb_register_duplicate-Iuh0(15)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_hnb_register_duplicate-Iuh1(17)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(22)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(22)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(22)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(20)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(25)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(25)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(25)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(23)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(22)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(25)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(21)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(21)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(24)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(24)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: talloc reports "struct hnb_context" x 1, expecting 1 MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_register_duplicate-Iuh1-RUA(18)@05e891daadfd: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0-RUA(16)@05e891daadfd: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh1(17)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(25)@05e891daadfd: Final verdict of PTC: none TC_hnb_register_duplicate-Iuh0(15)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(24)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(21)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(22)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(14)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(23)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(20)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(26)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(19)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(14): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate-Iuh0(15): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate-Iuh0-RUA(16): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate-Iuh1(17): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate-Iuh1-RUA(18): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(19): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(20): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(21): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(22): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(23): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(24): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(25): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(26): none (pass -> pass) MTC@05e891daadfd: Test case TC_hnb_register_duplicate finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass'. Mon Sep 23 07:54:14 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=82521) Waiting for packet dumper to finish... 1 (prev_count=82521, count=140466) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc ------ Mon Sep 23 07:54:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_hnb_register_duplicate_reuse_sctp_assoc started. TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(33)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(33)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(33)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(31)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(36)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(36)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(36)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(34)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(33)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(36)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(32)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(32)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(35)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(35)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: talloc reports "struct hnb_context" x 1, expecting 1 MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(35)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(33)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(31)@05e891daadfd: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(27)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(30)@05e891daadfd: Final verdict of PTC: none TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(36)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(32)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(34)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(37)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(27): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0(28): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_register_duplicate_reuse_sctp_assoc-Iuh0-RUA(29): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(30): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(31): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(32): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(33): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(34): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(35): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(36): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(37): none (pass -> pass) MTC@05e891daadfd: Test case TC_hnb_register_duplicate_reuse_sctp_assoc finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass'. Mon Sep 23 07:54:19 UTC 2024 ====== HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=81630) Waiting for packet dumper to finish... 1 (prev_count=81630, count=138987) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout'. ------ HNBGW_Tests.TC_hnb_disconnected_timeout ------ Mon Sep 23 07:54:21 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap" >/data/HNBGW_Tests.TC_hnb_disconnected_timeout.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_disconnected_timeout' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_hnb_disconnected_timeout started. TC_hnb_disconnected_timeout-Iuh0(39)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(44)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(44)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(44)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(42)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(47)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(47)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(47)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(45)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(44)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(47)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(43)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(43)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(46)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(46)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "hnb": { { { name := "iuh:established", val := 1 } } } MTC@05e891daadfd: initial hnb rate counters: { { { name := "iuh:established", val := 1 } } } TC_hnb_disconnected_timeout-Iuh0(39)@05e891daadfd: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(40)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@05e891daadfd: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@05e891daadfd: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") TC_hnb_disconnected_timeout-Iuh0(49)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@05e891daadfd: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@05e891daadfd: setverdict(fail): pass -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", new component reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" TC_hnb_disconnected_timeout-Iuh0(49)@05e891daadfd: Final verdict of PTC: none TC_hnb_disconnected_timeout-Iuh0-RUA(50)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := 1 } } } IPA-CTRL-CLI-IPA(41)@05e891daadfd: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@05e891daadfd: setverdict(fail): fail -> fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1", component reason not changed MTC@05e891daadfd: verifying hnb rate counters: { { { name := "iuh:established", val := -1 } } } IPA-CTRL-CLI-IPA(41)@05e891daadfd: Warning: dec_CtrlMessage(): Data remained at the end of the stream after successful decoding: '2067726F7570207769746820676976656E206E616D6520616E6420696E646578206E6F7420666F756E64'O (" group with given name and index not found") MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(46)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(42)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(43)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(41)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(45)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(44)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(47)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(38)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(48)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: fail reason: "Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1" MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(38): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(39): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(40): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(41): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(42): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(43): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(44): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(45): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(46): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(47): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(48): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0(49): none (fail -> fail) MTC@05e891daadfd: Local verdict of PTC TC_hnb_disconnected_timeout-Iuh0-RUA(50): none (fail -> fail) MTC@05e891daadfd: Test case TC_hnb_disconnected_timeout finished. Verdict: fail reason: Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail'. Mon Sep 23 07:54:38 UTC 2024 ------ HNBGW_Tests.TC_hnb_disconnected_timeout fail ------ Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_disconnected_timeout.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=150878) Waiting for packet dumper to finish... 1 (prev_count=150878, count=151468) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_disconnected_timeout fail' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register'. ------ HNBGW_Tests.TC_ue_register ------ Mon Sep 23 07:54:40 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register.pcap" >/data/HNBGW_Tests.TC_ue_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ue_register started. TC_ue_register-Iuh0(52)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(57)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(57)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(57)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(55)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(60)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(60)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(60)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(58)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(57)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(60)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(56)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(56)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(59)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(59)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register-Iuh0-RUA(53)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(55)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(60)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(51)@05e891daadfd: Final verdict of PTC: none TC_ue_register-Iuh0(52)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(54)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(59)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(56)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(57)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(58)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(61)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(51): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register-Iuh0(52): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register-Iuh0-RUA(53): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(54): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(55): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(56): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(57): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(58): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(59): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(60): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(61): none (pass -> pass) MTC@05e891daadfd: Test case TC_ue_register finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass'. Mon Sep 23 07:54:42 UTC 2024 ====== HNBGW_Tests.TC_ue_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=84478) Waiting for packet dumper to finish... 1 (prev_count=84478, count=138356) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai'. ------ HNBGW_Tests.TC_ue_register_tmsi_lai ------ Mon Sep 23 07:54:45 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap" >/data/HNBGW_Tests.TC_ue_register_tmsi_lai.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_tmsi_lai' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ue_register_tmsi_lai started. MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O TC_ue_register_tmsi_lai-Iuh0(63)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(68)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(68)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(68)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(66)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(71)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(71)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(71)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(69)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(68)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(71)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(67)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(67)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(70)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(70)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_tmsi_lai-Iuh0-RUA(64)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(66)@05e891daadfd: Final verdict of PTC: none TC_ue_register_tmsi_lai-Iuh0(63)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(65)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(67)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(70)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(62)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(68)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(69)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(71)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(72)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(62): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0(63): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register_tmsi_lai-Iuh0-RUA(64): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(65): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(66): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(67): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(68): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(69): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(70): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(71): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(72): none (pass -> pass) MTC@05e891daadfd: Test case TC_ue_register_tmsi_lai finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass'. Mon Sep 23 07:54:47 UTC 2024 ====== HNBGW_Tests.TC_ue_register_tmsi_lai pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register_tmsi_lai.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=83112) Waiting for packet dumper to finish... 1 (prev_count=83112, count=136973) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_tmsi_lai pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register'. ------ HNBGW_Tests.TC_ue_register_before_hnb_register ------ Mon Sep 23 07:54:50 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap" >/data/HNBGW_Tests.TC_ue_register_before_hnb_register.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ue_register_before_hnb_register' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ue_register_before_hnb_register started. TC_ue_register_before_hnb_register-Iuh0(74)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(79)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(79)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(79)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(77)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(82)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(82)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(82)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(80)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(79)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(82)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(78)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(78)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(81)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(81)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ue_register_before_hnb_register-Iuh0-RUA(75)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(77)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(78)@05e891daadfd: Final verdict of PTC: none TC_ue_register_before_hnb_register-Iuh0(74)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(76)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(81)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(80)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(79)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(73)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(82)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(83)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(73): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0(74): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ue_register_before_hnb_register-Iuh0-RUA(75): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(76): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(77): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(78): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(79): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(80): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(81): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(82): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(83): none (pass -> pass) MTC@05e891daadfd: Test case TC_ue_register_before_hnb_register finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass'. Mon Sep 23 07:54:52 UTC 2024 ====== HNBGW_Tests.TC_ue_register_before_hnb_register pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ue_register_before_hnb_register.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80130) Waiting for packet dumper to finish... 1 (prev_count=80130, count=135758) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ue_register_before_hnb_register pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue ------ Mon Sep 23 07:54:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_cs_initial_ue started. TC_ranap_cs_initial_ue-Iuh0(85)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(90)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(90)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(90)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(88)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(93)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(93)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(93)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(91)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(90)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(93)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(89)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(89)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(92)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(92)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(89)@05e891daadfd: f_create_expect(l3 := 'DF6E4505D2AF57853BB1'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(89)@05e891daadfd: Created Expect[0] for 'DF6E4505D2AF57853BB1'O to be handled at TC_ranap_cs_initial_ue0(95) TC_ranap_cs_initial_ue-Iuh0-RUA(86)@05e891daadfd: Added conn table entry 0TC_ranap_cs_initial_ue0(95)1546015 HNBGW_Test.msc0-SCCP(88)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(88)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(89)@05e891daadfd: Found Expect[0] for l3='DF6E4505D2AF57853BB1'O handled at TC_ranap_cs_initial_ue0(95) HNBGW_Test.msc0-RAN(89)@05e891daadfd: Added conn table entry 0TC_ranap_cs_initial_ue0(95)13588919 HNBGW_Test.msc0-SCCP(88)@05e891daadfd: Session index based on connection ID:0 TC_ranap_cs_initial_ue0(95)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(88)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_initial_ue0(95)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(89)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0-RUA(86)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(88)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(92)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(84)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(90)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(91)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_initial_ue-Iuh0(85)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(93)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(94)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(87)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(84): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0(85): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue-Iuh0-RUA(86): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(87): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(88): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(89): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(90): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(91): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(92): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(93): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(94): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue0(95): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_cs_initial_ue finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass'. Mon Sep 23 07:54:58 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120335) Waiting for packet dumper to finish... 1 (prev_count=120335, count=159652) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue ------ Mon Sep 23 07:55:00 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_ps_initial_ue started. TC_ranap_ps_initial_ue-Iuh0(97)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(102)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(102)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(102)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(100)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(105)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(105)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(105)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(102)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(105)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(101)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(101)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: f_create_expect(l3 := '7291E39DF7C0CC0284C9'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: Created Expect[0] for '7291E39DF7C0CC0284C9'O to be handled at TC_ranap_ps_initial_ue0(107) TC_ranap_ps_initial_ue-Iuh0-RUA(98)@05e891daadfd: Added conn table entry 0TC_ranap_ps_initial_ue0(107)10467689 HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: Found Expect[0] for l3='7291E39DF7C0CC0284C9'O handled at TC_ranap_ps_initial_ue0(107) HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: Added conn table entry 0TC_ranap_ps_initial_ue0(107)5406734 HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_initial_ue0(107)@05e891daadfd: setverdict(pass): none -> pass TC_ranap_ps_initial_ue0(107)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_initial_ue-Iuh0-RUA(98)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(100)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(103)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(101)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(104)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(105)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(102)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(106)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(96)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_initial_ue-Iuh0(97)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(99)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(96): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0(97): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue-Iuh0-RUA(98): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(99): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(100): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(101): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(102): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(103): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(104): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(105): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(106): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue0(107): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_ps_initial_ue finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass'. Mon Sep 23 07:55:04 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=118843) Waiting for packet dumper to finish... 1 (prev_count=118843, count=157158) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr ------ Mon Sep 23 07:55:06 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_cs_initial_ue_empty_cr started. TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(114)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(114)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(114)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(112)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(117)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(117)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(117)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(115)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(114)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(117)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(113)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(113)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(116)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(116)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(113)@05e891daadfd: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.msc0-RAN(113)@05e891daadfd: Created Expect[0] for omit to be handled at TC_ranap_cs_initial_ue_empty_cr0(119) TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@05e891daadfd: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)14077118 HNBGW_Test.msc0-SCCP(112)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(112)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(113)@05e891daadfd: Found Expect[0] for l3=omit handled at TC_ranap_cs_initial_ue_empty_cr0(119) HNBGW_Test.msc0-RAN(113)@05e891daadfd: Added conn table entry 0TC_ranap_cs_initial_ue_empty_cr0(119)11847507 HNBGW_Test.msc0-SCCP(112)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(112)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.msc0-SCCP(112)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(112)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(112)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_initial_ue_empty_cr0(119)@05e891daadfd: setverdict(pass): none -> pass TC_ranap_cs_initial_ue_empty_cr0(119)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(112)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_initial_ue_empty_cr-Iuh0(109)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(111)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(113)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(108)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(116)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(117)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(114)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(115)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(118)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(108): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0(109): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr-Iuh0-RUA(110): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(111): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(112): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(113): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(114): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(115): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(116): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(117): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(118): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_initial_ue_empty_cr0(119): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_cs_initial_ue_empty_cr finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass'. Mon Sep 23 07:55:09 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126277) Waiting for packet dumper to finish... 1 (prev_count=126277, count=168333) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr'. ------ HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr ------ Mon Sep 23 07:55:12 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap" >/data/HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_ps_initial_ue_empty_cr started. TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(126)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(126)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(126)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(124)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(129)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(129)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(129)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(126)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(129)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(125)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(125)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: f_create_expect(l3 := omit, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: Created Expect[0] for omit to be handled at TC_ranap_ps_initial_ue_empty_cr0(131) TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@05e891daadfd: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)12921384 HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: Found Expect[0] for l3=omit handled at TC_ranap_ps_initial_ue_empty_cr0(131) HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: Added conn table entry 0TC_ranap_ps_initial_ue_empty_cr0(131)2926737 HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_initial_ue_empty_cr0(131)@05e891daadfd: setverdict(pass): none -> pass TC_ranap_ps_initial_ue_empty_cr0(131)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(124)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0(121)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(128)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(120)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(130)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(129)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(123)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(125)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(127)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(126)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(120): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0(121): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr-Iuh0-RUA(122): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(123): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(124): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(125): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(126): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(127): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(128): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(129): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(130): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_initial_ue_empty_cr0(131): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_ps_initial_ue_empty_cr finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass'. Mon Sep 23 07:55:15 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=126136) Waiting for packet dumper to finish... 1 (prev_count=126136, count=167036) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir'. ------ HNBGW_Tests.TC_ranap_cs_bidir ------ Mon Sep 23 07:55:18 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_cs_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_bidir' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_cs_bidir started. TC_ranap_cs_bidir-Iuh0(133)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(138)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(138)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(138)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(136)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(141)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(141)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(141)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(139)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(138)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(141)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(137)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(137)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(140)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(140)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(137)@05e891daadfd: f_create_expect(l3 := 'A0A8DEEA8F0B3A1B65B4'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(137)@05e891daadfd: Created Expect[0] for 'A0A8DEEA8F0B3A1B65B4'O to be handled at TC_ranap_cs_bidir0(143) TC_ranap_cs_bidir-Iuh0-RUA(134)@05e891daadfd: Added conn table entry 0TC_ranap_cs_bidir0(143)1651014 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(137)@05e891daadfd: Found Expect[0] for l3='A0A8DEEA8F0B3A1B65B4'O handled at TC_ranap_cs_bidir0(143) HNBGW_Test.msc0-RAN(137)@05e891daadfd: Added conn table entry 0TC_ranap_cs_bidir0(143)13606675 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_bidir0(143)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: vl_len:22 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A1F7E7D022EE7DB8961F7'O TC_ranap_cs_bidir0(143)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(136)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_bidir0(143)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: vl_len:20 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(136)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000003'O TC_ranap_cs_bidir0(143)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_bidir0(143)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_cs_bidir-Iuh0-RUA(134)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(136)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(137)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_bidir-Iuh0(133)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(140)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(139)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(135)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(138)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(141)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(142)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(132)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(132): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_bidir-Iuh0(133): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_bidir-Iuh0-RUA(134): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(135): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(136): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(137): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(138): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(139): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(140): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(141): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(142): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_bidir0(143): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_cs_bidir finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass'. Mon Sep 23 07:55:21 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_bidir pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=123482) Waiting for packet dumper to finish... 1 (prev_count=123482, count=174814) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_bidir pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir'. ------ HNBGW_Tests.TC_ranap_ps_bidir ------ Mon Sep 23 07:55:24 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap" >/data/HNBGW_Tests.TC_ranap_ps_bidir.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_bidir' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_ps_bidir started. TC_ranap_ps_bidir-Iuh0(145)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(150)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(150)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(150)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(148)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(153)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(153)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(153)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(150)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(153)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(149)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(149)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: f_create_expect(l3 := '428D06C66862EAEFA25B'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: Created Expect[0] for '428D06C66862EAEFA25B'O to be handled at TC_ranap_ps_bidir0(155) TC_ranap_ps_bidir-Iuh0-RUA(146)@05e891daadfd: Added conn table entry 0TC_ranap_ps_bidir0(155)11925099 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: Found Expect[0] for l3='428D06C66862EAEFA25B'O handled at TC_ranap_ps_bidir0(155) HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: Added conn table entry 0TC_ranap_ps_bidir0(155)16091454 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Session index based on connection ID:0 TC_ranap_ps_bidir0(155)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: vl_len:22 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: data sent by MTP3_SCCP_PORT: '001440120000010010400B0ABA66FC24C43E776E465E'O TC_ranap_ps_bidir0(155)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_bidir0(155)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: vl_len:20 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: vl_from0 HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000F401000000100174009500262420000000004'O TC_ranap_ps_bidir0(155)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_bidir0(155)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ranap_ps_bidir-Iuh0-RUA(146)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_bidir-Iuh0(145)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(152)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(144)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(148)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(154)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(149)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(147)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(153)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(151)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(150)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(144): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_bidir-Iuh0(145): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_bidir-Iuh0-RUA(146): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(147): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(148): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(149): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(150): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(151): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(152): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(153): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(154): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_bidir0(155): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_ps_bidir finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass'. Mon Sep 23 07:55:27 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_bidir pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_bidir.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=121200) Waiting for packet dumper to finish... 1 (prev_count=121200, count=172717) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_bidir pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment'. ------ HNBGW_Tests.TC_rab_assignment ------ Mon Sep 23 07:55:30 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assignment.pcap" >/data/HNBGW_Tests.TC_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assignment' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_assignment started. TC_rab_assignment-Iuh0(157)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(162)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(162)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(162)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(160)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(165)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(165)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(165)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(163)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(162)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(165)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(161)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(161)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(164)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(164)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(166)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@05e891daadfd: f_create_expect(l3 := 'E6720F1ACCA0FC1F314C'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(161)@05e891daadfd: Created Expect[0] for 'E6720F1ACCA0FC1F314C'O to be handled at TC_rab_assignment0(167) TC_rab_assignment-Iuh0-RUA(158)@05e891daadfd: Added conn table entry 0TC_rab_assignment0(167)8855976 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(161)@05e891daadfd: Found Expect[0] for l3='E6720F1ACCA0FC1F314C'O handled at TC_rab_assignment0(167) HNBGW_Test.msc0-RAN(161)@05e891daadfd: Added conn table entry 0TC_rab_assignment0(167)3376019 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Session index based on connection ID:0 TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(166)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "8721a817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assignment0(167) TC_rab_assignment0(167)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "1", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "8721a817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@05e891daadfd: MDCX1{ line := { verb := "MDCX", trans_id := "2", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "8721a817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assignment0(167)@05e891daadfd: CRCX2{ line := { verb := "CRCX", trans_id := "3", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "8721a817", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(156)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: vl_len:12 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "4", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assignment0(167)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "5", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "8721a817" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(160)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assignment0(167)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assignment0(167)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assignment-Iuh0-RUA(158)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(163)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(162)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(161)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(159)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(160)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(164)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(165)@05e891daadfd: Final verdict of PTC: none TC_rab_assignment-Iuh0(157)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(166)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(156)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(156): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assignment-Iuh0(157): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assignment-Iuh0-RUA(158): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(159): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(160): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(161): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(162): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(163): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(164): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(165): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(166): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assignment0(167): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_assignment finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass'. Mon Sep 23 07:55:34 UTC 2024 ====== HNBGW_Tests.TC_rab_assignment pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=121591) Waiting for packet dumper to finish... 1 (prev_count=121591, count=234328) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assignment pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release'. ------ HNBGW_Tests.TC_rab_release ------ Mon Sep 23 07:55:36 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release.pcap" >/data/HNBGW_Tests.TC_rab_release.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_release started. TC_rab_release-Iuh0(169)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(174)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(174)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(174)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(172)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(177)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(177)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(177)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(175)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(174)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(177)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(173)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(173)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(176)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(176)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(178)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@05e891daadfd: f_create_expect(l3 := 'F8DEC1ACD03F3CA60AA1'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(173)@05e891daadfd: Created Expect[0] for 'F8DEC1ACD03F3CA60AA1'O to be handled at TC_rab_release0(179) TC_rab_release-Iuh0-RUA(170)@05e891daadfd: Added conn table entry 0TC_rab_release0(179)10828862 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(173)@05e891daadfd: Found Expect[0] for l3='F8DEC1ACD03F3CA60AA1'O handled at TC_rab_release0(179) HNBGW_Test.msc0-RAN(173)@05e891daadfd: Added conn table entry 0TC_rab_release0(179)13761523 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release0(179)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(178)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a53c3e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release0(179) TC_rab_release0(179)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "6", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a53c3e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@05e891daadfd: MDCX1{ line := { verb := "MDCX", trans_id := "7", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a53c3e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release0(179)@05e891daadfd: CRCX2{ line := { verb := "CRCX", trans_id := "8", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "a53c3e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(172)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release0(179)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(168)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: vl_len:21 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(172)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C880'O VirtHNBGW-STATS(168)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.normal", mtype := "c", min := 1, max := 1 } TC_rab_release0(179)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "9", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release0(179)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "10", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "a53c3e17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release0(179)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release0(179)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-SCCP(172)@05e891daadfd: Final verdict of PTC: none TC_rab_release-Iuh0-RUA(170)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(176)@05e891daadfd: Final verdict of PTC: none TC_rab_release-Iuh0(169)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(173)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(171)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(174)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(175)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(177)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(178)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(168)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(168): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release-Iuh0(169): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release-Iuh0-RUA(170): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(171): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(172): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(173): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(174): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(175): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(176): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(177): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(178): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release0(179): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_release finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass'. Mon Sep 23 07:55:40 UTC 2024 ====== HNBGW_Tests.TC_rab_release pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_release.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=120280) Waiting for packet dumper to finish... 1 (prev_count=120280, count=228619) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal'. ------ HNBGW_Tests.TC_rab_release_abnormal ------ Mon Sep 23 07:55:42 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_release_abnormal.pcap" >/data/HNBGW_Tests.TC_rab_release_abnormal.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_release_abnormal' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_release_abnormal started. TC_rab_release_abnormal-Iuh0(181)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(186)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(186)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(186)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(184)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(189)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(189)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(189)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(187)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(186)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(189)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(185)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(185)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(188)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(188)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(190)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@05e891daadfd: f_create_expect(l3 := '2437EAD3F83897DD1F89'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(185)@05e891daadfd: Created Expect[0] for '2437EAD3F83897DD1F89'O to be handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal-Iuh0-RUA(182)@05e891daadfd: Added conn table entry 0TC_rab_release_abnormal0(191)4481820 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(185)@05e891daadfd: Found Expect[0] for l3='2437EAD3F83897DD1F89'O handled at TC_rab_release_abnormal0(191) HNBGW_Test.msc0-RAN(185)@05e891daadfd: Added conn table entry 0TC_rab_release_abnormal0(191)16733864 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_release_abnormal0(191)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(190)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "44631c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_release_abnormal0(191) TC_rab_release_abnormal0(191)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "11", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "44631c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@05e891daadfd: MDCX1{ line := { verb := "MDCX", trans_id := "12", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "44631c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_release_abnormal0(191)@05e891daadfd: CRCX2{ line := { verb := "CRCX", trans_id := "13", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "44631c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(184)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_release_abnormal0(191)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(180)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: vl_len:21 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(184)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000110000010029400A0000010028400305C2D0'O VirtHNBGW-STATS(180)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_rel.req.abnormal", mtype := "c", min := 1, max := 1 } TC_rab_release_abnormal0(191)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "14", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_release_abnormal0(191)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "15", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "44631c17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_release_abnormal0(191)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_release_abnormal0(191)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_rab_release_abnormal-Iuh0-RUA(182)@05e891daadfd: Final verdict of PTC: none TC_rab_release_abnormal-Iuh0(181)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(185)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(188)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(187)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(190)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(184)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(186)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(189)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(183)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(180)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(180): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release_abnormal-Iuh0(181): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release_abnormal-Iuh0-RUA(182): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(183): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(184): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(185): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(186): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(187): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(188): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(189): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(190): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_release_abnormal0(191): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_release_abnormal finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass'. Mon Sep 23 07:55:46 UTC 2024 ====== HNBGW_Tests.TC_rab_release_abnormal pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_release_abnormal.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=125924) Waiting for packet dumper to finish... 1 (prev_count=125924, count=233639) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_release_abnormal pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail'. ------ HNBGW_Tests.TC_rab_assign_fail ------ Mon Sep 23 07:55:49 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_fail.pcap" >/data/HNBGW_Tests.TC_rab_assign_fail.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_fail' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_assign_fail started. TC_rab_assign_fail-Iuh0(193)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(198)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(198)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(198)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(196)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(201)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(201)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(201)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(199)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(198)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(201)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(197)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(197)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(200)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(200)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(202)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@05e891daadfd: f_create_expect(l3 := '3431F59B86D97EBEEE2D'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(197)@05e891daadfd: Created Expect[0] for '3431F59B86D97EBEEE2D'O to be handled at TC_rab_assign_fail0(203) TC_rab_assign_fail-Iuh0-RUA(194)@05e891daadfd: Added conn table entry 0TC_rab_assign_fail0(203)7445473 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(197)@05e891daadfd: Found Expect[0] for l3='3431F59B86D97EBEEE2D'O handled at TC_rab_assign_fail0(203) HNBGW_Test.msc0-RAN(197)@05e891daadfd: Added conn table entry 0TC_rab_assign_fail0(203)9275721 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_fail0(203)@05e891daadfd: setverdict(pass): none -> pass VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(202)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "719be117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "719be117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_fail0(203) TC_rab_assign_fail0(203)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "16", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "719be117" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "719be117", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_fail0(203)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(196)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(196)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_fail0(203)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(192)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 1, max := 1 } TC_rab_assign_fail0(203)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "17", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "719be117" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_fail0(203)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_fail0(203)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_fail-Iuh0-RUA(194)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(196)@05e891daadfd: Final verdict of PTC: none TC_rab_assign_fail-Iuh0(193)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(195)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(197)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(200)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(201)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(199)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(198)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(202)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(192)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(192): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_fail-Iuh0(193): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_fail-Iuh0-RUA(194): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(195): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(196): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(197): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(198): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(199): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(200): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(201): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(202): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_fail0(203): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_assign_fail finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass'. Mon Sep 23 07:55:52 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_fail pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_fail.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=125058) Waiting for packet dumper to finish... 1 (prev_count=125058, count=210191) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_fail pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to'. ------ HNBGW_Tests.TC_rab_assign_mgcp_to ------ Mon Sep 23 07:55:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgcp_to.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgcp_to' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_assign_mgcp_to started. TC_rab_assign_mgcp_to-Iuh0(205)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(210)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(210)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(210)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(208)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(213)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(213)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(213)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(211)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(210)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(213)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(209)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(209)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(212)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(212)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(214)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@05e891daadfd: f_create_expect(l3 := '69FD07F54CD6239F48D7'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(209)@05e891daadfd: Created Expect[0] for '69FD07F54CD6239F48D7'O to be handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to-Iuh0-RUA(206)@05e891daadfd: Added conn table entry 0TC_rab_assign_mgcp_to0(215)2865782 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(209)@05e891daadfd: Found Expect[0] for l3='69FD07F54CD6239F48D7'O handled at TC_rab_assign_mgcp_to0(215) HNBGW_Test.msc0-RAN(209)@05e891daadfd: Added conn table entry 0TC_rab_assign_mgcp_to0(215)15455981 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_rab_assign_mgcp_to0(215)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(214)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2bba7617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2bba7617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgcp_to0(215) TC_rab_assign_mgcp_to0(215)@05e891daadfd: Ignoreing CRCX1{ line := { verb := "CRCX", trans_id := "18", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "2bba7617" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "2bba7617", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: vl_len:12 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgcp_to0(215)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(208)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgcp_to0(215)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgcp_to0(215)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgcp_to-Iuh0-RUA(206)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(209)@05e891daadfd: Final verdict of PTC: none TC_rab_assign_mgcp_to-Iuh0(205)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(207)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(204)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(212)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(208)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(211)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(213)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(210)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(214)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(204): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0(205): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgcp_to-Iuh0-RUA(206): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(207): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(208): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(209): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(210): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(211): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(212): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(213): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(214): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgcp_to0(215): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_assign_mgcp_to finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass'. Mon Sep 23 07:56:02 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgcp_to pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_mgcp_to.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=154941) Waiting for packet dumper to finish... 1 (prev_count=154941, count=199706) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgcp_to pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg'. ------ HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg ------ Mon Sep 23 07:56:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap" >/data/HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_rab_assign_mgw_iuup_addr_chg started. TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(222)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(222)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(222)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(220)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(225)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(225)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(225)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(223)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(222)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(225)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(221)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(221)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(224)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(224)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(226)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@05e891daadfd: f_create_expect(l3 := 'E25A81A615E95B9F694C'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(221)@05e891daadfd: Created Expect[0] for 'E25A81A615E95B9F694C'O to be handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@05e891daadfd: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)12874812 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(221)@05e891daadfd: Found Expect[0] for l3='E25A81A615E95B9F694C'O handled at TC_rab_assign_mgw_iuup_addr_chg0(227) HNBGW_Test.msc0-RAN(221)@05e891daadfd: Added conn table entry 0TC_rab_assign_mgw_iuup_addr_chg0(227)10991290 TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 0, max := 0 } VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(226)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c4743c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_rab_assign_mgw_iuup_addr_chg0(227) TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "19", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c4743c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: MDCX1{ line := { verb := "MDCX", trans_id := "20", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c4743c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: CRCX2{ line := { verb := "CRCX", trans_id := "21", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "c4743c17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.req", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", val := 1, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.cnf", mtype := "c", min := 1, max := 1 } VirtHNBGW-STATS(216)@05e891daadfd: EXP match: { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", val := 0, mtype := "c", srate := omit } vs exp { name := "TTCN3.hnb.001-01-L2342-R0-S55-C1.ranap.cs.rab_act.fail", mtype := "c", min := 0, max := 0 } HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: vl_len:12 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "22", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "I", val := "11111" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "23", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "c4743c17" }, { code := "I", val := "22222" } }, sdp := omit } TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(220)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_rab_assign_mgw_iuup_addr_chg0(227)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(220)@05e891daadfd: Final verdict of PTC: none TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(221)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(219)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(224)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(223)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(225)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(222)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(226)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(216)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(216): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0(217): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg-Iuh0-RUA(218): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(219): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(220): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(221): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(222): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(223): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(224): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(225): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(226): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_rab_assign_mgw_iuup_addr_chg0(227): pass (pass -> pass) MTC@05e891daadfd: Test case TC_rab_assign_mgw_iuup_addr_chg finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass'. Mon Sep 23 07:56:08 UTC 2024 ====== HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=241775) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_cs_mo_disconnect ------ Mon Sep 23 07:56:10 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_cs_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_cs_mo_disconnect started. TC_ranap_cs_mo_disconnect-Iuh0(229)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(234)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(234)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(234)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(232)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(237)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(237)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(237)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(235)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(234)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(237)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(233)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(233)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(236)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(236)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(233)@05e891daadfd: f_create_expect(l3 := 'F7909634F2313424D58C'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(233)@05e891daadfd: Created Expect[0] for 'F7909634F2313424D58C'O to be handled at TC_ranap_cs_mo_disconnect0(239) TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@05e891daadfd: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)390835 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(233)@05e891daadfd: Found Expect[0] for l3='F7909634F2313424D58C'O handled at TC_ranap_cs_mo_disconnect0(239) HNBGW_Test.msc0-RAN(233)@05e891daadfd: Added conn table entry 0TC_ranap_cs_mo_disconnect0(239)3327163 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: vl_len:22 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AA15AE81EC0CAD760587E'O TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@05e891daadfd: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)390835 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(232)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-RAN(233)@05e891daadfd: Deleted conn table entry 0TC_ranap_cs_mo_disconnect0(239)3327163 TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_cs_mo_disconnect0(239)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(233)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0-RUA(230)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(232)@05e891daadfd: Final verdict of PTC: none TC_ranap_cs_mo_disconnect-Iuh0(229)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(236)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(231)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(237)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(235)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(234)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(228)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(238)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(228): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0(229): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_mo_disconnect-Iuh0-RUA(230): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(231): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(232): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(233): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(234): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(235): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(236): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(237): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(238): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_cs_mo_disconnect0(239): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_cs_mo_disconnect finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass'. Mon Sep 23 07:56:19 UTC 2024 ====== HNBGW_Tests.TC_ranap_cs_mo_disconnect pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_cs_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=195170) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_cs_mo_disconnect pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect'. ------ HNBGW_Tests.TC_ranap_ps_mo_disconnect ------ Mon Sep 23 07:56:20 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap" >/data/HNBGW_Tests.TC_ranap_ps_mo_disconnect.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ranap_ps_mo_disconnect started. TC_ranap_ps_mo_disconnect-Iuh0(241)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(246)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(246)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(246)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(244)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(249)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(249)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(249)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(247)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(246)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(249)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(245)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(245)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(248)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(248)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(245)@05e891daadfd: f_create_expect(l3 := '95B30A0A462041DD90B6'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(245)@05e891daadfd: Created Expect[0] for '95B30A0A462041DD90B6'O to be handled at TC_ranap_ps_mo_disconnect0(251) TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@05e891daadfd: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)10264603 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(245)@05e891daadfd: Found Expect[0] for l3='95B30A0A462041DD90B6'O handled at TC_ranap_ps_mo_disconnect0(251) HNBGW_Test.msc0-RAN(245)@05e891daadfd: Added conn table entry 0TC_ranap_ps_mo_disconnect0(251)4596387 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: vl_len:22 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: data sent by MTP3_SCCP_PORT: '001440120000010010400B0AF7D07D58B951B39F41AA'O TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@05e891daadfd: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)10264603 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(244)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-RAN(245)@05e891daadfd: Deleted conn table entry 0TC_ranap_ps_mo_disconnect0(251)4596387 TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ranap_ps_mo_disconnect0(251)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-M3UA(249)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(244)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(247)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(240)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(243)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0-RUA(242)@05e891daadfd: Final verdict of PTC: none TC_ranap_ps_mo_disconnect-Iuh0(241)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(248)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(246)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(245)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(250)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(240): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0(241): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_mo_disconnect-Iuh0-RUA(242): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(243): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(244): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(245): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(246): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(247): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(248): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(249): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(250): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ranap_ps_mo_disconnect0(251): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ranap_ps_mo_disconnect finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass'. Mon Sep 23 07:56:29 UTC 2024 ====== HNBGW_Tests.TC_ranap_ps_mo_disconnect pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ranap_ps_mo_disconnect.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=176865) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ranap_ps_mo_disconnect pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp'. ------ HNBGW_Tests.TC_ps_rab_assignment_with_pfcp ------ Mon Sep 23 07:56:30 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap" >/data/HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_ps_rab_assignment_with_pfcp started. TC_ps_rab_assignment_with_pfcp-Iuh0(253)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(258)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(258)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(258)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(256)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(261)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(261)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(261)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(258)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(261)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(257)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(257)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() CLIENT_PROC.getcall(PFCPEM_register) TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.46.20", remote_port := 8805 }, pdu := { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 5, lengthIndicator := 26, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC122E14'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 4, time_value := 3936066846 }, up_function_features := omit, cp_function_features := { elementIdentifier := 89, lengthIndicator := 1, features := '10'O }, UP_IP_resource_list := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := omit, pfcp_msg_sequence_number := omit } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): none -> pass TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := omit, sequence_number := 10, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_association_setup_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, time_stamp := { elementIdentifier := 96, lengthIndicator := 0, time_value := 1234 }, up_function_features := omit, cp_function_features := omit, UP_IP_resource_list := omit } } } HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: f_create_expect(l3 := '39B6D904D412AA64BF37'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: Created Expect[0] for '39B6D904D412AA64BF37'O to be handled at TC_ps_rab_assignment_with_pfcp0(264) TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@05e891daadfd: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)357126 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: Found Expect[0] for l3='39B6D904D412AA64BF37'O handled at TC_ps_rab_assignment_with_pfcp0(264) HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: Added conn table entry 0TC_ps_rab_assignment_with_pfcp0(264)584501 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: vl_len:91 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F000001000000000000000000000000000010101010400100'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '0000030025006C000400000002002C0002020000040013002A0001010054000A0100101010107F000001'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.46.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 50, lengthIndicator := 187, seid := '0000000000000000'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_request := { node_id := { elementIdentifier := 60, lengthIndicator := 5, node_id_type := 0, spare := '0000'B, node_id_value := 'AC122E14'O }, CP_F_SEID := { elementIdentifier := 57, lengthIndicator := 13, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '0000000000000001'O, ipv4_address := 'AC122E14'O, ipv6_address := omit }, create_PDR_list := { { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 1, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } }, { elementIdentifier := 1, lengthIndicator := 41, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, precedence := { elementIdentifier := 29, lengthIndicator := 4, precedence_value := 255 }, pdi := { elementIdentifier := 2, lengthIndicator := 10, grouped_ie := { source_interface := { elementIdentifier := 20, lengthIndicator := 1, interfacevalue := 0, spare := '0000'B }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 1, v4 := '1'B, v6 := '0'B, ch := '1'B, chid := '0'B, spare := '0000'B, teid := omit, ipv4_address := omit, ipv6_address := omit, choose_id := omit }, pdn_instance := omit, ue_ip_address := omit, traffic_endpoint_id := omit, sdf_filter_list := omit, application_id := omit, ethernet_packet_filter_list := omit, qfi_list := omit } }, outer_header_removal := { elementIdentifier := 95, lengthIndicator := 1, ohc_description := 0 }, FAR_ID_list := { { elementIdentifier := 108, lengthIndicator := 4, id_value := 2 } }, uRR_ID_list := omit, qER_ID_list := omit, activate_predefined_rules := omit } } }, create_FAR_list := { { elementIdentifier := 3, lengthIndicator := 14, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '1'B, forw := '0'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint_list := omit, pdn_type := omit, node_list := omit, up_inactivity_timer := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := omit, pfcp_msg_sequence_number := 10 } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 11, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_establishment_response := { node_id := { elementIdentifier := 60, lengthIndicator := 0, node_id_type := 2, spare := '0000'B, node_id_value := '076F736D6F636F6D036F7267'O }, cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_ie := omit, UP_F_SEID := { elementIdentifier := 57, lengthIndicator := 0, v6 := '0'B, v4 := '1'B, spare := '000000'B, seid := '1111111111111111'O, ipv4_address := '7F000001'O, ipv6_address := omit }, created_PDR_list := { { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0001'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '22002200'O, ipv4_address := '7F000002'O, ipv6_address := omit, choose_id := omit } } }, { elementIdentifier := 8, lengthIndicator := 0, grouped_ie := { pdr_id := { elementIdentifier := 56, lengthIndicator := 2, rule_id := '0002'O }, local_F_TEID := { elementIdentifier := 21, lengthIndicator := 0, v4 := '1'B, v6 := '0'B, ch := '0'B, chid := '0'B, spare := '0000'B, teid := '30303030'O ("0000"), ipv4_address := '7F000003'O, ipv6_address := omit, choose_id := omit } } } }, load_control_information := omit, overload_control_information := omit, node_list := omit, failed_rule_id := omit, created_traffic_endpoint_list := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: Warning: dec_PDU_PFCP(): Data remained at the end of the stream after successful decoding: '00000B000E0054000A0100440044007F000004'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.46.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 52, lengthIndicator := 48, seid := '1111111111111111'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_request := { f_seid := omit, remove_PDR_list := omit, remove_FAR_list := omit, remove_URR_list := omit, remove_QER_list := omit, remove_BAR := omit, remove_traffic_endpoint := omit, create_PDR_list := omit, create_FAR_list := omit, create_URR_list := omit, create_QER_list := omit, create_BAR := omit, create_traffic_endpoint := omit, update_PDR_list := omit, update_FAR_list := { { elementIdentifier := 10, lengthIndicator := 32, grouped_ie := { far_id := { elementIdentifier := 108, lengthIndicator := 4, id_value := 1 }, apply_action := { elementIdentifier := 44, lengthIndicator := 2, drop := '0'B, forw := '1'B, buff := '0'B, nocp := '0'B, dupl := '0'B, spare := '000'B }, forwarding_parameters := omit, duplicating_parameters := omit, bar_id := omit } } }, update_URR_list := omit, update_QER_list := omit, update_BAR := omit, update_traffic_endpoint := omit, pfcpSMReq_flags := omit, query_URR_list := omit, node_list := omit, up_inactivity_timer := omit, querry_urr_reference := omit } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := '0000000000000001'O, pfcp_msg_sequence_number := 11 } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 12, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_modification_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, created_PDR := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit, failed_rule_id := omit, additional_usage_reports_information := omit, created_updated_traffic_endpoint := omit } } } HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: vl_len:12 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: vl_from0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() PFCP.receive: { peer := { conn_id := 1, remote_name := "172.18.46.20", remote_port := 8805 }, pdu := { s_flag := '1'B, mp := '0'B, spare := '000'B, version := 1, message_type := 54, lengthIndicator := 12, seid := '1111111111111111'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_request := { } } } } TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: sending to all conns: { { vc_conn := TC_ps_rab_assignment_with_pfcp0(264), seid := '0000000000000001'O, pfcp_msg_sequence_number := 12 } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: PFCP_Emulation main() CLIENT.receive from TC_ps_rab_assignment_with_pfcp0(264): { s_flag := '0'B, mp := '0'B, spare := '000'B, version := 1, message_type := 0, lengthIndicator := 0, seid := '0000000000000001'O, sequence_number := 13, spare2 := '0000'B, mp_or_spare := '0000'B, message_body := { pfcp_session_deletion_response := { cause := { elementIdentifier := 19, lengthIndicator := 0, causeValue := '01'O }, offending_IE := omit, load_control_information := omit, overload_control_information := omit, usage_report := omit } } } TC_ps_rab_assignment_with_pfcp0(264)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(255)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(262)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(252)@05e891daadfd: Final verdict of PTC: none TC_ps_rab_assignment_with_pfcp-Iuh0(253)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(257)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(261)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(260)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(258)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(259)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(256)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_ps_rab_assignment_with_pfcp-PFCP(263)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(252): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0(253): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-Iuh0-RUA(254): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(255): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(256): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(257): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(258): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(259): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(260): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(261): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(262): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ps_rab_assignment_with_pfcp-PFCP(263): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_ps_rab_assignment_with_pfcp0(264): pass (pass -> pass) MTC@05e891daadfd: Test case TC_ps_rab_assignment_with_pfcp finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass'. Mon Sep 23 07:56:44 UTC 2024 ====== HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=196590) Waiting for packet dumper to finish... 1 (prev_count=196590, count=204367) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_ps_rab_assignment_with_pfcp pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink ------ Mon Sep 23 07:56:46 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Compl_on_1_cnlink started. TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(273)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(273)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(273)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(271)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(276)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(276)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(276)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(274)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(273)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(276)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(272)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(272)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(275)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(275)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(278) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)16056638 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(272)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(278) HNBGW_Test.msc0-RAN(272)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Compl_on_1_cnlink0(278)7882745 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(278)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(278)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@05e891daadfd: f_create_expect(l3 := '05240103505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@05e891daadfd: Created Expect[0] for '05240103505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(279) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)13384439 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(272)@05e891daadfd: Found Expect[0] for l3='05240103505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(279) HNBGW_Test.msc0-RAN(272)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Compl_on_1_cnlink0(279)8452606 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(279)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(279)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@05e891daadfd: f_create_expect(l3 := '06270003505902082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@05e891daadfd: Created Expect[0] for '06270003505902082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(280) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)15274828 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: First idle individual index:2 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc0-RAN(272)@05e891daadfd: Found Expect[0] for l3='06270003505902082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(280) HNBGW_Test.msc0-RAN(272)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Compl_on_1_cnlink0(280)3371768 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Session index based on connection ID:2 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(280)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(280)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '050152082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(272)@05e891daadfd: f_create_expect(l3 := '050152082926240000000040'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(272)@05e891daadfd: Created Expect[0] for '050152082926240000000040'O to be handled at TC_mscpool_L3Compl_on_1_cnlink0(281) TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@05e891daadfd: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)2700630 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: First idle individual index:3 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.msc0-RAN(272)@05e891daadfd: Found Expect[0] for l3='050152082926240000000040'O handled at TC_mscpool_L3Compl_on_1_cnlink0(281) HNBGW_Test.msc0-RAN(272)@05e891daadfd: Added conn table entry 3TC_mscpool_L3Compl_on_1_cnlink0(281)6854701 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Session index based on connection ID:3 HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_mscpool_L3Compl_on_1_cnlink0(281)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Compl_on_1_cnlink0(281)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(274)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(265)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(275)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(272)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(273)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(271)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(276)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(270)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(277)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(265): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0(266): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh0-RUA(267): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1(268): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink-Iuh1-RUA(269): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(270): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(271): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(272): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(273): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(274): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(275): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(276): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(277): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(278): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(279): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(280): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Compl_on_1_cnlink0(281): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass'. Mon Sep 23 07:56:53 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=215403) Waiting for packet dumper to finish... 1 (prev_count=215403, count=282464) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin ------ Mon Sep 23 07:56:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_imsi_round_robin started. TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(290)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(290)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(290)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(288)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(293)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(293)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(293)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(291)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(296)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(296)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(296)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(294)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(299)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(299)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(299)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(297)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(290)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(293)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(296)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(299)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(289)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(289)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(292)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(292)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(295)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(295)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(298)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(298)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)15831622 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(289)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(301) HNBGW_Test.msc0-RAN(289)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(301)11217270 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(301)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(301)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(292)@05e891daadfd: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(292)@05e891daadfd: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(302)10959558 HNBGW_Test.msc1-SCCP(291)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(291)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(292)@05e891daadfd: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(302) HNBGW_Test.msc1-RAN(292)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_imsi_round_robin0(302)1441084 HNBGW_Test.msc1-SCCP(291)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(291)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(302)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(302)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(289)@05e891daadfd: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(289)@05e891daadfd: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_imsi_round_robin0(303)8167587 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(289)@05e891daadfd: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_L3Complete_by_imsi_round_robin0(303) HNBGW_Test.msc0-RAN(289)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_imsi_round_robin0(303)10952076 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_imsi_round_robin0(303)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_imsi_round_robin0(303)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(290)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(296)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(297)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(295)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(292)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(289)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(288)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(298)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(294)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(291)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(287)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(282)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(293)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(300)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(299)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(282): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0(283): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh0-RUA(284): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1(285): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin-Iuh1-RUA(286): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(287): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(288): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(289): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(290): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(291): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(292): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(293): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(294): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(295): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(296): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(297): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(298): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(299): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(300): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(301): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(302): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_imsi_round_robin0(303): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_imsi_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass'. Mon Sep 23 07:57:02 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243247) Waiting for packet dumper to finish... 1 (prev_count=243247, count=311903) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin ------ Mon Sep 23 07:57:04 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(312)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(312)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(312)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(310)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(315)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(315)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(315)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(313)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(318)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(318)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(318)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(316)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(321)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(321)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(321)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(319)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc1-M3UA(315)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-M3UA(312)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(318)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(321)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(311)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(311)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(314)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(314)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(317)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(317)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(320)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(320)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=0, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000000000000100011'B == '42000023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)4071766 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(311)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323) HNBGW_Test.msc0-RAN(311)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)12686018 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(314)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(314)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@05e891daadfd: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)7772869 HNBGW_Test.msc1-SCCP(313)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(313)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(314)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324) HNBGW_Test.msc1-RAN(314)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)12046241 HNBGW_Test.msc1-SCCP(313)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(313)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442000023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(311)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442000023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(311)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442000023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@05e891daadfd: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)5580701 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(311)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442000023'O handled at TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325) HNBGW_Test.msc0-RAN(311)@05e891daadfd: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)1457891 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(320)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(318)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(319)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(312)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(311)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(314)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(310)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(321)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(313)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(304)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(316)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(317)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(309)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(322)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(315)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(304): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0(305): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh0-RUA(306): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1(307): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin-Iuh1-RUA(308): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(309): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(310): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(311): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(312): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(313): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(314): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(315): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(316): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(317): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(318): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(319): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(320): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(321): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(322): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(323): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(324): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_0_round_robin0(325): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_null_nri_0_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass'. Mon Sep 23 07:57:11 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243680) Waiting for packet dumper to finish... 1 (prev_count=243680, count=313350) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin ------ Mon Sep 23 07:57:14 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin started. TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(334)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(334)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(334)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(332)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(337)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(337)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(337)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(335)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(340)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(340)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(340)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(338)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(343)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(343)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(343)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(341)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(334)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(337)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(340)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(343)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(333)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(333)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(336)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(336)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(339)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(339)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(342)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(342)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=1, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010000000000100000000100011'B == '42004023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)11363644 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(333)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345) HNBGW_Test.msc0-RAN(333)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)10156741 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(336)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(336)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@05e891daadfd: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)6517785 HNBGW_Test.msc1-SCCP(335)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(335)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(336)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346) HNBGW_Test.msc1-RAN(336)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)253170 HNBGW_Test.msc1-SCCP(335)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(335)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442004023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(333)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442004023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(333)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442004023'O to be handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@05e891daadfd: Added conn table entry 2TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)883913 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(333)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442004023'O handled at TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347) HNBGW_Test.msc0-RAN(333)@05e891daadfd: Added conn table entry 1TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)8710964 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 2 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 1 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-SCCP(338)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(342)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(341)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(340)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(336)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(334)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(335)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(332)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(339)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(344)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(326)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(337)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(331)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(333)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(343)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(326): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0(327): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh0-RUA(328): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1(329): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin-Iuh1-RUA(330): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(331): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(332): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(333): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(334): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(335): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(336): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(337): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(338): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(339): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(340): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(341): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(342): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(343): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(344): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(345): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(346): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_null_nri_1_round_robin0(347): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_null_nri_1_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass'. Mon Sep 23 07:57:20 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=245918) Waiting for packet dumper to finish... 1 (prev_count=245918, count=314735) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin ------ Mon Sep 23 07:57:23 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin started. TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(356)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(356)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(356)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(354)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(359)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(359)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(359)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(357)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(362)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(362)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(362)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(360)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(365)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(365)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(365)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(363)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(356)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(359)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(362)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(365)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(355)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(355)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(358)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(358)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(361)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(361)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(364)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(364)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=1000, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010111110100000000000100011'B == '42FA0023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=768, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110000000000000000100011'B == '42C00023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=819, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010110011001100000000100011'B == '42CCC023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442FA0023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442FA0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442FA0023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)12623155 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(355)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442FA0023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367) HNBGW_Test.msc0-RAN(355)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)9404635 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Session index based on connection ID:0 TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0524010350590205F442C00023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(358)@05e891daadfd: f_create_expect(l3 := '0524010350590205F442C00023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(358)@05e891daadfd: Created Expect[0] for '0524010350590205F442C00023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)6674039 HNBGW_Test.msc1-SCCP(357)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(357)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(358)@05e891daadfd: Found Expect[0] for l3='0524010350590205F442C00023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368) HNBGW_Test.msc1-RAN(358)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)6981850 HNBGW_Test.msc1-SCCP(357)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(357)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0627000350590205F442CCC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(355)@05e891daadfd: f_create_expect(l3 := '0627000350590205F442CCC023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(355)@05e891daadfd: Created Expect[0] for '0627000350590205F442CCC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)4118067 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(355)@05e891daadfd: Found Expect[0] for l3='0627000350590205F442CCC023'O handled at TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369) HNBGW_Test.msc0-RAN(355)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)11461483 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(357)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(356)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(363)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(362)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(354)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(353)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(358)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(348)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(365)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(359)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(361)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(364)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(360)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(366)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(355)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(348): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0(349): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh0-RUA(350): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1(351): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin-Iuh1-RUA(352): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(353): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(354): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(355): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(356): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(357): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(358): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(359): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(360): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(361): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(362): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(363): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(364): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(365): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(366): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(367): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(368): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin0(369): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass'. Mon Sep 23 07:57:29 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=245846) Waiting for packet dumper to finish... 1 (prev_count=245846, count=310477) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin ------ Mon Sep 23 07:57:32 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin started. TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(378)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(378)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(378)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(376)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(381)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(381)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(381)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(379)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(384)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(384)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(384)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(382)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(387)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(387)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(387)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(385)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(378)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(381)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(384)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(387)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(377)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(377)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(380)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(380)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(383)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(383)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(386)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(386)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=767, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101111111100000000100011'B == '42BFC023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=750, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101110111000000000100011'B == '42BB8023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)13911958 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(377)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389) HNBGW_Test.msc0-RAN(377)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)67746 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Session index based on connection ID:0 TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 1 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0524010350590205F442BFC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(380)@05e891daadfd: f_create_expect(l3 := '0524010350590205F442BFC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(380)@05e891daadfd: Created Expect[0] for '0524010350590205F442BFC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)13436194 HNBGW_Test.msc1-SCCP(379)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(379)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(380)@05e891daadfd: Found Expect[0] for l3='0524010350590205F442BFC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390) HNBGW_Test.msc1-RAN(380)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)2681223 HNBGW_Test.msc1-SCCP(379)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(379)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 2 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0627000350590205F442BB8023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(377)@05e891daadfd: f_create_expect(l3 := '0627000350590205F442BB8023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(377)@05e891daadfd: Created Expect[0] for '0627000350590205F442BB8023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)5864836 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(377)@05e891daadfd: Found Expect[0] for l3='0627000350590205F442BB8023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391) HNBGW_Test.msc0-RAN(377)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)4479249 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 3 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(383)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(382)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(385)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(377)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(384)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(376)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(386)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(378)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(381)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(379)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(370)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(388)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(387)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(375)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(380)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(370): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0(371): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh0-RUA(372): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1(373): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin-Iuh1-RUA(374): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(375): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(376): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(377): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(378): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(379): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(380): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(381): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(382): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(383): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(384): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(385): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(386): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(387): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(388): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(389): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(390): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin0(391): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass'. Mon Sep 23 07:57:38 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=324501) Waiting for packet dumper to finish... 1 (prev_count=324501, count=334341) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 ------ Mon Sep 23 07:57:41 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(400)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(400)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(400)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(398)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(403)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(403)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(403)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(401)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(406)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(406)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(406)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(404)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(409)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(409)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(409)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(407)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(400)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(403)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(406)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(409)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(399)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(399)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(402)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(402)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(405)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(405)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(408)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(408)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442400023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442400023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442400023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)5450574 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(402)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442400023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411) HNBGW_Test.msc1-RAN(402)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)9934862 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0524010350590205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@05e891daadfd: f_create_expect(l3 := '0524010350590205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@05e891daadfd: Created Expect[0] for '0524010350590205F442410023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)12915622 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(402)@05e891daadfd: Found Expect[0] for l3='0524010350590205F442410023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412) HNBGW_Test.msc1-RAN(402)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)12304845 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0627000350590205F4427FC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(402)@05e891daadfd: f_create_expect(l3 := '0627000350590205F4427FC023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(402)@05e891daadfd: Created Expect[0] for '0627000350590205F4427FC023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)9209884 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: First idle individual index:2 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.msc1-RAN(402)@05e891daadfd: Found Expect[0] for l3='0627000350590205F4427FC023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413) HNBGW_Test.msc1-RAN(402)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)8165822 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Session index based on connection ID:2 HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-RAN(408)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(404)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(407)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(401)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(403)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(398)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(400)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(399)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(402)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(406)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(405)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(410)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(392)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(397)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(409)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(392): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0(393): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh0-RUA(394): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1(395): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_1-Iuh1-RUA(396): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(397): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(398): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(399): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(400): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(401): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(402): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(403): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(404): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(405): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(406): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(407): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(408): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(409): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(410): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(411): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(412): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_10(413): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_1 finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass'. Mon Sep 23 07:57:47 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=269274) Waiting for packet dumper to finish... 1 (prev_count=269274, count=342585) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2'. ------ HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 ------ Mon Sep 23 07:57:50 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 started. TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(422)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(422)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(422)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(420)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(425)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(425)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(425)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(423)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(428)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(428)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(428)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(426)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(431)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(431)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(431)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(429)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(434)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(434)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(434)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(432)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(437)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-M3UA(437)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(437)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-SCCP(435)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(422)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(425)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(428)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(431)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(434)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(437)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(421)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(421)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(424)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(424)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(427)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(427)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(430)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(430)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(433)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(433)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(436)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(436)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442800023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442800023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442800023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)10519266 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(427)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442800023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439) HNBGW_Test.msc2-RAN(427)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)14501391 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '0524010350590205F442A98023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(427)@05e891daadfd: f_create_expect(l3 := '0524010350590205F442A98023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(427)@05e891daadfd: Created Expect[0] for '0524010350590205F442A98023'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)10842545 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc2-RAN(427)@05e891daadfd: Found Expect[0] for l3='0524010350590205F442A98023'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440) HNBGW_Test.msc2-RAN(427)@05e891daadfd: Added conn table entry 1TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)2444194 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000010'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(424)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(424)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@05e891daadfd: Added conn table entry 2TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)8013619 HNBGW_Test.msc1-SCCP(423)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(423)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(424)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441) HNBGW_Test.msc1-RAN(424)@05e891daadfd: Added conn table entry 0TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)3995983 HNBGW_Test.msc1-SCCP(423)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(423)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(430)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(427)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(434)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(432)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(421)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(425)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(426)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(420)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(423)@05e891daadfd: Final verdict of PTC: none TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(433)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(428)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(422)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(414)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(435)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(429)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(431)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(419)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(436)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(437)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(424)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(438)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(414): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0(415): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh0-RUA(416): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1(417): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_2-Iuh1-RUA(418): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(419): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(420): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(421): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(422): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(423): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(424): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(425): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(426): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(427): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(428): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(429): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(430): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(431): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(432): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(433): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(434): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(435): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-RAN(436): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(437): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(438): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(439): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(440): pass (passMon Sep 23 07:57:57 UTC 2024 ====== HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.talloc -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_L3Complete_by_tmsi_valid_nri_20(441): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_L3Complete_by_tmsi_valid_nri_2 finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=317390) Waiting for packet dumper to finish... 1 (prev_count=317390, count=391246) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN'. ------ HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN ------ Mon Sep 23 07:57:59 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN started. TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(450)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(450)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(450)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(448)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(453)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(453)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(453)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(451)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(456)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(456)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(456)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(454)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn0-M3UA(459)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(459)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(459)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-SCCP(457)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn1-M3UA(462)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(462)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(462)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-SCCP(460)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(465)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-M3UA(465)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(465)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn2-SCCP(463)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(450)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(453)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(456)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(459)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(462)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(465)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(449)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(449)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(452)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(452)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(455)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(455)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(458)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(458)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(461)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(461)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(464)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(464)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080299F999172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(449)@05e891daadfd: f_create_expect(l3 := '05080299F999172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(449)@05e891daadfd: Created Expect[0] for '05080299F999172A5205F442410023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)11454559 HNBGW_Test.msc0-SCCP(448)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(448)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(449)@05e891daadfd: Found Expect[0] for l3='05080299F999172A5205F442410023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(467) HNBGW_Test.msc0-RAN(449)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)1114282 HNBGW_Test.msc0-SCCP(448)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(448)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(467)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F4428AC023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(455)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F4428AC023'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(455)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F4428AC023'O to be handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@05e891daadfd: Added conn table entry 1TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)11189376 HNBGW_Test.msc2-SCCP(454)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc2-SCCP(454)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(455)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F4428AC023'O handled at TC_mscpool_LU_by_tmsi_from_other_PLMN0(468) HNBGW_Test.msc2-RAN(455)@05e891daadfd: Added conn table entry 0TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)2814732 HNBGW_Test.msc2-SCCP(454)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(454)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_LU_by_tmsi_from_other_PLMN0(468)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(458)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(460)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(457)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(455)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(454)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(461)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(442)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(449)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(452)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(448)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(465)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(450)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(451)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(453)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(462)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(456)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(459)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(463)@05e891daadfd: Final verdict of PTC: none TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(447)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(466)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(464)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(442): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0(443): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh0-RUA(444): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1(445): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN-Iuh1-RUA(446): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(447): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(448): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(449): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(450): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(451): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(452): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(453): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(454): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(455): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(456): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(457): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(458): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(459): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(460): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(461): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(462): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(463): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-RAN(464): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(465): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(466): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(467): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_LU_by_tmsi_from_other_PLMN0(468): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_LU_by_tmsi_from_other_PLMN finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass'. Mon Sep 23 07:58:05 UTC 2024 ====== HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=357475) Waiting for packet dumper to finish... 1 (prev_count=357475, count=357973) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi'. ------ HNBGW_Tests.TC_mscpool_paging_imsi ------ Mon Sep 23 07:58:08 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_imsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_imsi' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_paging_imsi started. TC_mscpool_paging_imsi-Iuh0(470)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_imsi-Iuh1(472)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(477)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(477)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(477)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(475)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(480)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(480)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(480)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(478)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(483)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(483)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(483)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(481)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(486)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(486)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(486)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(484)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(477)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(480)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(483)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(486)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(476)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(476)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(479)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(479)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(482)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(482)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(485)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(485)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_imsi-Iuh0-RUA(471)@05e891daadfd: UnitdataCallback TC_mscpool_paging_imsi-Iuh1-RUA(473)@05e891daadfd: UnitdataCallback HNBGW_Test.msc0-RAN(476)@05e891daadfd: f_create_expect(l3 := '06270003505902080910100000001032'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(476)@05e891daadfd: Created Expect[0] for '06270003505902080910100000001032'O to be handled at TC_mscpool_paging_imsi0(488) TC_mscpool_paging_imsi-Iuh0-RUA(471)@05e891daadfd: Added conn table entry 0TC_mscpool_paging_imsi0(488)1129300 HNBGW_Test.msc0-SCCP(475)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(475)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(476)@05e891daadfd: Found Expect[0] for l3='06270003505902080910100000001032'O handled at TC_mscpool_paging_imsi0(488) HNBGW_Test.msc0-RAN(476)@05e891daadfd: Added conn table entry 0TC_mscpool_paging_imsi0(488)14123777 HNBGW_Test.msc0-SCCP(475)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(475)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_imsi0(488)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_paging_imsi0(488)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_imsi-Iuh1-RUA(473)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0-RUA(471)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(484)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(485)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(486)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(483)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(475)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(478)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(479)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(474)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh1(472)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(476)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(482)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_imsi-Iuh0(470)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(477)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(481)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(469)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(487)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(480)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(469): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0(470): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_imsi-Iuh0-RUA(471): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1(472): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_imsi-Iuh1-RUA(473): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(474): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(475): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(476): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(477): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(478): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(479): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(480): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(481): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(482): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(483): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(484): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(485): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(486): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(487): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_imsi0(488): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_paging_imsi finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass'. Mon Sep 23 07:58:14 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_imsi pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_paging_imsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=243922) Waiting for packet dumper to finish... 1 (prev_count=243922, count=287649) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_imsi pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi'. ------ HNBGW_Tests.TC_mscpool_paging_tmsi ------ Mon Sep 23 07:58:17 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap" >/data/HNBGW_Tests.TC_mscpool_paging_tmsi.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_paging_tmsi' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_paging_tmsi started. TC_mscpool_paging_tmsi-Iuh0(490)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_paging_tmsi-Iuh1(492)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(497)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(497)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(497)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(495)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(500)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(500)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(500)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(498)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc2-M3UA(503)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(503)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(503)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-SCCP(501)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(506)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(506)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(506)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(504)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(497)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(500)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(503)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(506)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(496)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(496)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(499)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(499)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(502)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(502)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(505)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(505)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } TC_mscpool_paging_tmsi0(508)@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O TC_mscpool_paging_tmsi-Iuh0-RUA(491)@05e891daadfd: UnitdataCallback TC_mscpool_paging_tmsi-Iuh1-RUA(493)@05e891daadfd: UnitdataCallback TC_mscpool_paging_tmsi0(508)@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=300, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010010110000000000100011'B == '424B0023'O HNBGW_Test.msc0-RAN(496)@05e891daadfd: f_create_expect(l3 := '0627000350590205F4424B0023'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(496)@05e891daadfd: Created Expect[0] for '0627000350590205F4424B0023'O to be handled at TC_mscpool_paging_tmsi0(508) TC_mscpool_paging_tmsi-Iuh0-RUA(491)@05e891daadfd: Added conn table entry 0TC_mscpool_paging_tmsi0(508)9700456 HNBGW_Test.msc0-SCCP(495)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(495)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(496)@05e891daadfd: Found Expect[0] for l3='0627000350590205F4424B0023'O handled at TC_mscpool_paging_tmsi0(508) HNBGW_Test.msc0-RAN(496)@05e891daadfd: Added conn table entry 0TC_mscpool_paging_tmsi0(508)10036625 HNBGW_Test.msc0-SCCP(495)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(495)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_paging_tmsi0(508)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_paging_tmsi0(508)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 1 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_paging_tmsi-Iuh0-RUA(491)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(502)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(503)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1-RUA(493)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(501)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(496)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(495)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(505)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(489)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(500)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(506)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(498)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh0(490)@05e891daadfd: Final verdict of PTC: none TC_mscpool_paging_tmsi-Iuh1(492)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(504)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(497)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(507)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(499)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(494)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(489): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0(490): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh0-RUA(491): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1(492): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_tmsi-Iuh1-RUA(493): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(494): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(495): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(496): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(497): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(498): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(499): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(500): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(501): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(502): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(503): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(504): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(505): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(506): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(507): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_paging_tmsi0(508): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_paging_tmsi finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass'. Mon Sep 23 07:58:23 UTC 2024 ====== HNBGW_Tests.TC_mscpool_paging_tmsi pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_paging_tmsi.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=229824) Waiting for packet dumper to finish... 1 (prev_count=229824, count=266310) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_paging_tmsi pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin ------ Mon Sep 23 07:58:26 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_no_allow_attach_round_robin started. TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(517)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(517)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(517)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(515)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(520)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(520)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(520)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(518)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(523)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(523)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(523)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(521)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(526)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(526)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(526)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(524)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(517)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(520)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(523)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(526)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(516)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(516)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(519)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(522)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(522)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(519)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(525)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(525)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(528) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)11480896 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(516)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(528) HNBGW_Test.msc0-RAN(516)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(528)2436808 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(528)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(528)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(522)@05e891daadfd: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(522)@05e891daadfd: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(529) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@05e891daadfd: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(529)4818615 HNBGW_Test.msc2-SCCP(521)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc2-SCCP(521)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(522)@05e891daadfd: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(529) HNBGW_Test.msc2-RAN(522)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_round_robin0(529)14231207 HNBGW_Test.msc2-SCCP(521)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc2-SCCP(521)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(529)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(529)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(516)@05e891daadfd: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(516)@05e891daadfd: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_no_allow_attach_round_robin0(530) TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@05e891daadfd: Added conn table entry 2TC_mscpool_no_allow_attach_round_robin0(530)5727369 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(516)@05e891daadfd: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_no_allow_attach_round_robin0(530) HNBGW_Test.msc0-RAN(516)@05e891daadfd: Added conn table entry 1TC_mscpool_no_allow_attach_round_robin0(530)11646884 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_no_allow_attach_round_robin0(530)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_round_robin0(530)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(516)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(521)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(525)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(509)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(514)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(524)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(522)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh0(510)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(518)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(519)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(515)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(520)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(523)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_round_robin-Iuh1(512)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(517)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(527)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(526)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(509): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0(510): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh0-RUA(511): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1(512): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin-Iuh1-RUA(513): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(514): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(515): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(516): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(517): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(518): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(519): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(520): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(521): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(522): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(523): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(524): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(525): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(526): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(527): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(528): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(529): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_round_robin0(530): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_no_allow_attach_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass'. Mon Sep 23 07:58:32 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=270683) Waiting for packet dumper to finish... 1 (prev_count=270683, count=339297) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri'. ------ HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri ------ Mon Sep 23 07:58:35 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap" >/data/HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_no_allow_attach_valid_nri started. TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(539)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(539)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(539)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(537)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(542)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(542)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(542)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(540)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(545)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(545)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(545)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(543)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(548)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(548)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(548)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(546)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(539)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(542)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(545)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(548)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(538)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(538)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(541)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(541)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(544)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(544)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(547)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(547)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A5205F442410023'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(541)@05e891daadfd: f_create_expect(l3 := '05080200F110172A5205F442410023'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(541)@05e891daadfd: Created Expect[0] for '05080200F110172A5205F442410023'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(550) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)13539735 HNBGW_Test.msc1-SCCP(540)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(540)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(541)@05e891daadfd: Found Expect[0] for l3='05080200F110172A5205F442410023'O handled at TC_mscpool_no_allow_attach_valid_nri0(550) HNBGW_Test.msc1-RAN(541)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(550)15104240 HNBGW_Test.msc1-SCCP(540)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(540)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(550)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_no_allow_attach_valid_nri0(550)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902080910100000000020'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(538)@05e891daadfd: f_create_expect(l3 := '05240103505902080910100000000020'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(538)@05e891daadfd: Created Expect[0] for '05240103505902080910100000000020'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(551) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@05e891daadfd: Added conn table entry 1TC_mscpool_no_allow_attach_valid_nri0(551)224860 HNBGW_Test.msc0-SCCP(537)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(537)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(538)@05e891daadfd: Found Expect[0] for l3='05240103505902080910100000000020'O handled at TC_mscpool_no_allow_attach_valid_nri0(551) HNBGW_Test.msc0-RAN(538)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(551)12767401 HNBGW_Test.msc0-SCCP(537)@05e891daadfd: Session index based on connection ID:0 TC_mscpool_no_allow_attach_valid_nri0(551)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(537)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(551)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 2, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902080910100000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc2-RAN(544)@05e891daadfd: f_create_expect(l3 := '06270003505902080910100000000030'O, n_connectPointCode := omit HNBGW_Test.msc2-RAN(544)@05e891daadfd: Created Expect[0] for '06270003505902080910100000000030'O to be handled at TC_mscpool_no_allow_attach_valid_nri0(552) TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@05e891daadfd: Added conn table entry 2TC_mscpool_no_allow_attach_valid_nri0(552)16132505 HNBGW_Test.msc2-SCCP(543)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc2-SCCP(543)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc2-RAN(544)@05e891daadfd: Found Expect[0] for l3='06270003505902080910100000000030'O handled at TC_mscpool_no_allow_attach_valid_nri0(552) HNBGW_Test.msc2-RAN(544)@05e891daadfd: Added conn table entry 0TC_mscpool_no_allow_attach_valid_nri0(552)1086442 HNBGW_Test.msc2-SCCP(543)@05e891daadfd: Session index based on connection ID:0 TC_mscpool_no_allow_attach_valid_nri0(552)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc2-SCCP(543)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_no_allow_attach_valid_nri0(552)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(545)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(542)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(547)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(540)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(543)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(541)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(546)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(537)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(539)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(544)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(549)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh0(532)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(548)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(536)@05e891daadfd: Final verdict of PTC: none TC_mscpool_no_allow_attach_valid_nri-Iuh1(534)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(531)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(538)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(531): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0(532): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh0-RUA(533): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1(534): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri-Iuh1-RUA(535): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(536): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(537): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(538): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(539): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(540): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(541): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(542): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(543): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(544): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(545): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(546): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(547): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(548): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(549): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(550): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(551): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_no_allow_attach_valid_nri0(552): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_no_allow_attach_valid_nri finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass'. Mon Sep 23 07:58:41 UTC 2024 ====== HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=261335) Waiting for packet dumper to finish... 1 (prev_count=261335, count=328824) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink ------ Mon Sep 23 07:58:44 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink started. TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(561)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(561)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(561)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(559)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(564)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(564)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(564)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(562)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(567)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(567)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(567)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(565)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(570)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(570)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(570)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(568)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(561)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(564)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(567)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(570)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(560)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(560)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(563)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(563)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(566)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(566)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(569)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(569)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(560)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(560)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)9940643 HNBGW_Test.msc0-SCCP(559)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(559)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(560)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572) HNBGW_Test.msc0-RAN(560)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)1828276 HNBGW_Test.msc0-SCCP(559)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(559)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(563)@05e891daadfd: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@05e891daadfd: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@05e891daadfd: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)15432691 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(563)@05e891daadfd: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573) HNBGW_Test.msc1-RAN(563)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)4834729 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: "disconnecting msc0" HNBGW_Test.msc0-RAN(560)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(561)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(559)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@05e891daadfd: Deleted conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572)9940643 HNBGW_Test.msc1-RAN(563)@05e891daadfd: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(563)@05e891daadfd: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)8412368 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc1-RAN(563)@05e891daadfd: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574) HNBGW_Test.msc1-RAN(563)@05e891daadfd: Added conn table entry 1TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)9815282 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-RAN(569)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(568)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(567)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(558)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(563)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(566)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(565)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(562)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(553)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(571)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(570)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(564)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(553): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0(554): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(555): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1(556): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(557): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(558): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(559): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(560): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(561): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(562): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(563): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(564): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(565): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(566): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(567): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(568): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(569): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(570): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(571): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(572): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(573): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_detaches_cnlink0(574): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass'. Mon Sep 23 07:58:50 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=256394) Waiting for packet dumper to finish... 1 (prev_count=256394, count=315853) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink ------ Mon Sep 23 07:58:53 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink started. TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(583)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(583)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(583)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(581)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(586)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(586)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(586)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(584)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(583)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(586)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(582)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(582)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(585)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(585)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "msc": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial msc rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05080200F110172A52082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)3054128 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(582)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588) HNBGW_Test.msc0-RAN(582)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)1442734 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 0, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '05240103505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc0-RAN(582)@05e891daadfd: f_create_expect(l3 := '05240103505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(582)@05e891daadfd: Created Expect[0] for '05240103505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@05e891daadfd: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)11444806 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: First idle individual index:1 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.msc0-RAN(582)@05e891daadfd: Found Expect[0] for l3='05240103505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589) HNBGW_Test.msc0-RAN(582)@05e891daadfd: Added conn table entry 1TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)5981503 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: "connecting cnlink 1" MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc1-M3UA(592)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(592)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(592)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-SCCP(590)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc1-M3UA(592)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 1, imsi := '262420000000000'H, ps_domain := false, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '06270003505902082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.msc1-RAN(591)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(591)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(591)@05e891daadfd: f_create_expect(l3 := '06270003505902082926240000000030'O, n_connectPointCode := omit HNBGW_Test.msc1-RAN(591)@05e891daadfd: Created Expect[0] for '06270003505902082926240000000030'O to be handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@05e891daadfd: Added conn table entry 2TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)13653668 HNBGW_Test.msc1-SCCP(590)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc1-SCCP(590)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc1-RAN(591)@05e891daadfd: Found Expect[0] for l3='06270003505902082926240000000030'O handled at TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593) HNBGW_Test.msc1-RAN(591)@05e891daadfd: Added conn table entry 0TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)15200342 HNBGW_Test.msc1-SCCP(590)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc1-SCCP(590)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@05e891daadfd: setverdict(pass): none -> pass TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"msc" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-RAN(585)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(583)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(584)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(580)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(590)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(582)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(591)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(592)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(581)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(586)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(587)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(575)@05e891daadfd: Final verdict of PTC: none TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(575): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0(576): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(577): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1(578): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(579): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(580): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(581): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(582): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(583): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(584): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(585): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(586): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(587): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(588): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(589): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(590): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(591): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(592): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_mscpool_sccp_n_pcstate_attaches_cnlink0(593): pass (pass -> pass) MTC@05e891daadfd: Test case TC_mscpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass'. Mon Sep 23 07:59:01 UTC 2024 ====== HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=235037) Waiting for packet dumper to finish... 1 (prev_count=235037, count=310357) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink ------ Mon Sep 23 07:59:03 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_L3Compl_on_1_cnlink started. TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(602)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(602)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(602)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(600)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(605)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(605)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(605)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(602)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(605)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(601)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(601)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)11029797 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(607) HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Compl_on_1_cnlink0(607)7040713 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(607)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(607)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)7082341 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(608) HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Compl_on_1_cnlink0(608)4613964 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(608)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(608)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08050118082926240000000040'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: f_create_expect(l3 := '08050118082926240000000040'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Created Expect[0] for '08050118082926240000000040'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)3920191 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: First idle individual index:2 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Found Expect[0] for l3='08050118082926240000000040'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(609) HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Compl_on_1_cnlink0(609)5223675 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Session index based on connection ID:2 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(609)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(609)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 3 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000004000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000004000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000004000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@05e891daadfd: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)1677435 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: First idle individual index:3 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Stopping inactive timer T_ias[3]. HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000004000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Compl_on_1_cnlink0(610) HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Added conn table entry 3TC_sgsnpool_L3Compl_on_1_cnlink0(610)2105764 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Session index based on connection ID:3 HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Warning: Re-starting timer T_ias[3], which is already active (running or expired). TC_sgsnpool_L3Compl_on_1_cnlink0(610)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Compl_on_1_cnlink0(610)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 4 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(600)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(599)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(604)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(601)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(605)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(602)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(606)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(594)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(603)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(594): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0(595): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh0-RUA(596): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1(597): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink-Iuh1-RUA(598): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(599): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(600): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(601): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(602): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(603): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(604): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(605): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(606): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(607): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(608): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(609): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Compl_on_1_cnlink0(610): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_L3Compl_on_1_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass'. Mon Sep 23 07:59:10 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=221265) Waiting for packet dumper to finish... 1 (prev_count=221265, count=288740) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin ------ Mon Sep 23 07:59:13 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_no_nri_round_robin started. TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(619)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(619)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(619)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(617)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(622)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(622)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(622)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(620)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(625)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(625)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(625)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(628)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(628)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(628)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(619)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(622)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(625)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(628)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(618)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(618)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(621)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(621)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)11398422 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(630) HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(630)8091282 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(630)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(631)1716995 HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(631) HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_no_nri_round_robin0(631)3862491 HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(631)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Complete_no_nri_round_robin0(632)4281832 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_L3Complete_no_nri_round_robin0(632) HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_no_nri_round_robin0(632)12259353 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_no_nri_round_robin0(632)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn0-M3UA(625)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(618)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(626)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(616)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(627)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(621)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(620)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(624)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(617)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(619)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(628)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(623)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(629)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(611)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(622)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(611): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0(612): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh0-RUA(613): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1(614): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin-Iuh1-RUA(615): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(616): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(617): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(618): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(619): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(620): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(621): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(622): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(623): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(624): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(625): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(626): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(627): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(628): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(629): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(630): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(631): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_no_nri_round_robin0(632): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_no_nri_round_robin finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass'. Mon Sep 23 07:59:19 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=251218) Waiting for packet dumper to finish... 1 (prev_count=251218, count=319753) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 ------ Mon Sep 23 07:59:22 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_valid_nri_1 started. TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(641)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(641)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(641)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(639)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(644)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(644)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(644)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(642)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(647)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(647)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(647)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(645)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(650)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(650)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(650)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(641)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(644)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(647)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(650)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(640)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(640)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(643)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(643)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(646)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(646)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=256, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000000000000000100011'B == '42400023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=511, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010011111111100000000100011'B == '427FC023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E5100010024000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E5100010024000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E5100010024000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(652) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)2627204 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E5100010024000'O handled at TC_sgsnpool_L3Complete_valid_nri_10(652) HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_10(652)12883787 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(652)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(652)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E5100010024100'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(653) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)14663154 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E5100010024100'O handled at TC_sgsnpool_L3Complete_valid_nri_10(653) HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_10(653)7141420 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(653)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(653)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E5100010027FC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E5100010027FC0'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E5100010027FC0'O to be handled at TC_sgsnpool_L3Complete_valid_nri_10(654) TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)8798203 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: First idle individual index:2 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Stopping inactive timer T_ias[2]. HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E5100010027FC0'O handled at TC_sgsnpool_L3Complete_valid_nri_10(654) HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_10(654)8174471 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Session index based on connection ID:2 HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Warning: Re-starting timer T_ias[2], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_10(654)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_10(654)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 3 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(646)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(649)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(648)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(645)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(642)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(643)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(639)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(647)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(651)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(644)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(650)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(633)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(638)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(640)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(641)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(633): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0(634): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh0-RUA(635): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1(636): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_1-Iuh1-RUA(637): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(638): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(639): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(640): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(641): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(642): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(643): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(644): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(645): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(646): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(647): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(648): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(649): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(650): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(651): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(652): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(653): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_10(654): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_valid_nri_1 finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass'. Mon Sep 23 07:59:28 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=321696) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2'. ------ HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 ------ Mon Sep 23 07:59:30 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap" >/data/HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_valid_nri_2 started. TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(663)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(663)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(663)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(661)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(666)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(666)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(666)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(664)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(669)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(669)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(669)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(667)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(672)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(672)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(672)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(670)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(675)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(675)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(675)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.sgsn2-M3UA(678)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-M3UA(678)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(678)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(663)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(666)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(669)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(672)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(675)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(678)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(662)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(662)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(665)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(665)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(668)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(668)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(671)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(671)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=512, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100000000000000000100011'B == '42800023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=678, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010101010011000000000100011'B == '42A98023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: f_create_expect(l3 := '080101D471000005F44280002300F1102A2A170411E5100010028000'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Created Expect[0] for '080101D471000005F44280002300F1102A2A170411E5100010028000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(680) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)3144658 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Found Expect[0] for l3='080101D471000005F44280002300F1102A2A170411E5100010028000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(680) HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(680)15779707 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(680)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(680)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: f_create_expect(l3 := '080101D471000005F442A9802300F1102A2A170411E510001002A980'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Created Expect[0] for '080101D471000005F442A9802300F1102A2A170411E510001002A980'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(681) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)13747186 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Found Expect[0] for l3='080101D471000005F442A9802300F1102A2A170411E510001002A980'O handled at TC_sgsnpool_L3Complete_valid_nri_20(681) HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Added conn table entry 1TC_sgsnpool_L3Complete_valid_nri_20(681)8822390 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(681)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(681)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000001000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000001000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000001000F1102A2A170411E51000'O to be handled at TC_sgsnpool_L3Complete_valid_nri_20(682) TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@05e891daadfd: Added conn table entry 2TC_sgsnpool_L3Complete_valid_nri_20(682)15439101 HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000001000F1102A2A170411E51000'O handled at TC_sgsnpool_L3Complete_valid_nri_20(682) HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: Added conn table entry 0TC_sgsnpool_L3Complete_valid_nri_20(682)12186058 HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_L3Complete_valid_nri_20(682)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_L3Complete_valid_nri_20(682)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 2 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc0-RAN(662)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-RAN(668)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(666)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(670)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(667)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(664)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(669)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(663)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(665)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(661)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(673)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(671)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(660)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(672)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(677)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(655)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(678)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(676)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(674)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(679)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(675)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(655): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0(656): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh0-RUA(657): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1(658): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_2-Iuh1-RUA(659): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(660): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(661): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(662): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(663): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(664): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(665): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(666): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(667): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(668): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(669): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(670): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(671): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(672): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(673): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(674): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(675): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(676): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-RAN(677): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(678): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(679): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(680): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(681): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_L3Complete_valid_nri_20(682): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_L3Complete_valid_nri_2 finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass'. Mon Sep 23 07:59:36 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=403194) Waiting for packet dumper to finish... 1 (prev_count=403194, count=408348) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN'. ------ HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN ------ Mon Sep 23 07:59:39 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap" >/data/HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_nri_from_other_PLMN started. TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(691)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(691)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(691)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(689)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(694)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(694)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(694)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(692)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc2-M3UA(697)@05e891daadfd: ************************************************* HNBGW_Test.msc2-M3UA(697)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc2-M3UA(697)@05e891daadfd: ************************************************* HNBGW_Test.msc2-SCCP(695)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(700)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(700)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(700)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(703)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(703)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(703)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(701)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn2-M3UA(706)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-M3UA(706)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn2-M3UA(706)@05e891daadfd: ************************************************* HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(691)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(694)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc2-M3UA(697)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23909 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(700)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(703)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn2-M3UA(706)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23910 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(690)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(690)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(693)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(693)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc2-RAN(696)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc2-RAN(696)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(702)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(702)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=260, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010010000010000000000100011'B == '42410023'O MTC@05e891daadfd: f_gen_tmsi(suffix:=0, nri_v:=555, nri_bitlen:=10, base_tmsi:='42000023'O) -> prefix:='01000010'B, suffix:='00000000100011'B, total_bits:='01000010100010101100000000100011'B == '428AC023'O MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: f_create_expect(l3 := '080101D471000005F44241002399F9992A2A170411E5100010024100'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: Created Expect[0] for '080101D471000005F44241002399F9992A2A170411E5100010024100'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(708) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@05e891daadfd: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)1833046 HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: Found Expect[0] for l3='080101D471000005F44241002399F9992A2A170411E5100010024100'O handled at TC_sgsnpool_nri_from_other_PLMN0(708) HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(708)8407549 HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(708)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(708)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 6, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: f_create_expect(l3 := '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O, n_connectPointCode := omit HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: Created Expect[0] for '080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O to be handled at TC_sgsnpool_nri_from_other_PLMN0(709) TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@05e891daadfd: Added conn table entry 1TC_sgsnpool_nri_from_other_PLMN0(709)994602 HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: Found Expect[0] for l3='080101D471000005F4428AC02300F1102A2A170411E5100010028AC0'O handled at TC_sgsnpool_nri_from_other_PLMN0(709) HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: Added conn table entry 0TC_sgsnpool_nri_from_other_PLMN0(709)3083105 HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_nri_from_other_PLMN0(709)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_nri_from_other_PLMN0(709)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 1 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.msc2-RAN(696)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(702)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(692)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(691)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(700)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-M3UA(697)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(689)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(698)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(693)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(694)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(690)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh0(684)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc2-SCCP(695)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_nri_from_other_PLMN-Iuh1(686)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-RAN(705)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-SCCP(704)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(701)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(703)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn2-M3UA(706)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(688)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(683)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(707)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(699)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(683): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0(684): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh0-RUA(685): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1(686): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN-Iuh1-RUA(687): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(688): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(689): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(690): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(691): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(692): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(693): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(694): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-SCCP(695): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-RAN(696): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc2-M3UA(697): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(698): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(699): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(700): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(701): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(702): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(703): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-SCCP(704): none (pass -> pass) MTC@05e891daadfd: Local vMon Sep 23 07:59:45 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.talloc erdict of PTC HNBGW_Test.sgsn2-RAN(705): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn2-M3UA(706): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(707): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(708): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_nri_from_other_PLMN0(709): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_nri_from_other_PLMN finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass'. Waiting for packet dumper to finish... 0 (prev_count=-1, count=360736) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink ------ Mon Sep 23 07:59:46 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(718)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(718)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(718)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(716)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc1-M3UA(721)@05e891daadfd: ************************************************* HNBGW_Test.msc1-M3UA(721)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc1-M3UA(721)@05e891daadfd: ************************************************* HNBGW_Test.msc1-SCCP(719)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(724)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(724)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(724)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(727)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(727)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(727)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(718)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc1-M3UA(721)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23907 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(724)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn1-M3UA(727)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(717)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(717)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc1-RAN(720)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc1-RAN(720)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)9295830 HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729) HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)15912714 HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@05e891daadfd: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)12855491 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730) HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)3851460 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: "disconnecting msc0" HNBGW_Test.sgsn0-RAN(723)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(724)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(722)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@05e891daadfd: Deleted conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729)9295830 HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)6004600 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731) HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)13031920 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes HNBGW_Test.sgsn1-SCCP(725)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(726)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-M3UA(721)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-RAN(720)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(715)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(717)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(716)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc1-SCCP(719)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(710)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(718)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(728)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(727)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(710): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0(711): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh0-RUA(712): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1(713): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink-Iuh1-RUA(714): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(715): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(716): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(717): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(718): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-SCCP(719): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-RAN(720): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc1-M3UA(721): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(722): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(723): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(724): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(725): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(726): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(727): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(728): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(729): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(730): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_detaches_cnlink0(731): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_sccp_n_pcstate_detaches_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass'. Mon Sep 23 07:59:53 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=301026) Waiting for packet dumper to finish... 1 (prev_count=301026, count=360821) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink'. ------ HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink ------ Mon Sep 23 07:59:55 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap" >/data/HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink started. TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(740)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(740)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(740)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(738)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(743)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(743)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(743)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(740)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(743)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(739)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(739)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: retrieved rate counters: "sgsn": { { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: "initial sgsn rate counters: "{ { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '080101D471000008292624000000003000F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: f_create_expect(l3 := '080101D471000008292624000000003000F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Created Expect[0] for '080101D471000008292624000000003000F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)7794422 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Found Expect[0] for l3='080101D471000008292624000000003000F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745) HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)11045867 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 4, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08087300F1102A2A170411E51000'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: f_create_expect(l3 := '08087300F1102A2A170411E51000'O, n_connectPointCode := omit HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Created Expect[0] for '08087300F1102A2A170411E51000'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@05e891daadfd: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)6437808 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: First idle individual index:1 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Warning: Stopping inactive timer T_ias[1]. HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Found Expect[0] for l3='08087300F1102A2A170411E51000'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746) HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Added conn table entry 1TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)6959529 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Session index based on connection ID:1 HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Warning: Re-starting timer T_ias[1], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: "connecting cnlink 1" MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn1-M3UA(749)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-M3UA(749)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn1-M3UA(749)@05e891daadfd: ************************************************* HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.sgsn1-M3UA(749)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23908 to server: "172.18.46.200":2905 association #8 MTC@05e891daadfd: XXX { hnb_idx := 0, cn_idx := 5, imsi := '262420000000000'H, ps_domain := true, mgcp_pars := { got_crcx_count := 0, got_dlcx_count := 0, mgcp_call_id := omit, mgcp_ep := "rtpbridge/1@mgw", mgw_conn_ran := { resp := 1, mgw_rtp_ip := "127.1.2.1", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 10000, mgcp_connection_id := '11111'H }, mgw_conn_cn := { resp := 1, mgw_rtp_ip := "127.1.2.2", mgw_rtp_ip_mdcx := omit, mgw_rtp_port := 20000, mgcp_connection_id := '22222'H }, rtp_payload_type := 112, rtp_sdp_format := "VND.3GPP.IUFP", hnb_rtp_ip := "127.1.1.1", hnb_rtp_port := 10001, cn_rtp_ip := "127.1.3.1", cn_rtp_port := 20001, use_osmux := false, got_osmux_count := 0 }, hnb := omit, expect_separate_sccp_cr := false, tx_sccp_cr_data_len := 0, pfcp_local_addr := "172.18.46.203", nas_pdu := '08050118082926240000000030'O, sccp_addr_msc := omit, sccp_addr_hnbgw := omit, rab_rel_cause := { nAS := 83 } } HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: f_create_expect(l3 := '08050118082926240000000030'O, n_connectPointCode := omit HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: Created Expect[0] for '08050118082926240000000030'O to be handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@05e891daadfd: Added conn table entry 2TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)13368288 HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: First idle individual index:0 HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: Found Expect[0] for l3='08050118082926240000000030'O handled at TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750) HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: Added conn table entry 0TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)14036877 HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@05e891daadfd: setverdict(pass): none -> pass TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: verifying"sgsn" rate counters: { { { name := "cnpool:subscr:new", val := 2 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 1 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } }, { { name := "cnpool:subscr:new", val := 0 }, { name := "cnpool:subscr:known", val := 0 }, { name := "cnpool:subscr:reattach", val := 0 }, { name := "cnpool:subscr:attach_lost", val := 0 }, { name := "cnpool:subscr:paged", val := 0 } } } MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(742)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-RAN(748)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-M3UA(749)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(737)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(739)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(743)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(740)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(738)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(741)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735)@05e891daadfd: Final verdict of PTC: none TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn1-SCCP(747)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(732)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(744)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(732): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0(733): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh0-RUA(734): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1(735): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink-Iuh1-RUA(736): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(737): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(738): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(739): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(740): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(741): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(742): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(743): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(744): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(745): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(746): pass (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-SCCP(747): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-RAN(748): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn1-M3UA(749): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_sgsnpool_sccp_n_pcstate_attaches_cnlink0(750): pass (pass -> pass) MTC@05e891daadfd: Test case TC_sgsnpool_sccp_n_pcstate_attaches_cnlink finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass'. Mon Sep 23 08:00:03 UTC 2024 ====== HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=230052) Waiting for packet dumper to finish... 1 (prev_count=230052, count=304560) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment'. ------ HNBGW_Tests.TC_second_rab_assignment ------ Mon Sep 23 08:00:05 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_second_rab_assignment.pcap" >/data/HNBGW_Tests.TC_second_rab_assignment.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_second_rab_assignment' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_second_rab_assignment started. TC_second_rab_assignment-Iuh0(752)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(757)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(757)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(757)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(755)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(760)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(760)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(760)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(758)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-M3UA(757)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(760)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(756)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(756)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(759)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(759)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW-MGCP(761)@05e891daadfd: Created Expect[0] for { connid := omit, endpoint := omit, transid := omit } to be handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@05e891daadfd: f_create_expect(l3 := '8D21FCAC703A41E69E54'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(756)@05e891daadfd: Created Expect[0] for '8D21FCAC703A41E69E54'O to be handled at TC_second_rab_assignment0(762) TC_second_rab_assignment-Iuh0-RUA(753)@05e891daadfd: Added conn table entry 0TC_second_rab_assignment0(762)246174 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(756)@05e891daadfd: Found Expect[0] for l3='8D21FCAC703A41E69E54'O handled at TC_second_rab_assignment0(762) HNBGW_Test.msc0-RAN(756)@05e891daadfd: Added conn table entry 0TC_second_rab_assignment0(762)6120210 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): none -> pass HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_len:91 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000000570000010036405000000100350046382ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D0800109F3500017F01030100000000000000000000000000404E210000400100'O HNBGW-MGCP(761)@05e891daadfd: Found Expect[0] for { line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "3c19e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } handled at TC_second_rab_assignment0(762) TC_second_rab_assignment0(762)@05e891daadfd: CRCX1{ line := { verb := "CRCX", trans_id := "24", ep := "rtpbridge/*@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "M", val := "recvonly" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "3c19e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "172.18.46.203", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 0, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@05e891daadfd: MDCX1{ line := { verb := "MDCX", trans_id := "25", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "I", val := "11111" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "3c19e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.1.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 10001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } TC_second_rab_assignment0(762)@05e891daadfd: CRCX2{ line := { verb := "CRCX", trans_id := "26", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "M", val := "sendrecv" } }, sdp := { protocol_version := 0, origin := { user_name := "-", session_id := "3c19e17", session_version := "23", net_type := "IN", addr_type := "IP4", addr := "172.18.46.20" }, session_name := "-", information := omit, uri := omit, emails := omit, phone_numbers := omit, connection := { net_type := "IN", addr_type := "IP4", conn_addr := { addr := "127.1.3.1", ttl := omit, num_of_addr := omit } }, bandwidth := omit, times := { { time_field := { start_time := "0", stop_time := "0" }, time_repeat := omit } }, timezone_adjustments := omit, key := omit, attributes := omit, media_list := { { media_field := { media := "audio", ports := { port_number := 20001, num_of_ports := omit }, transport := "RTP/AVP", fmts := { "96" } }, information := omit, connections := omit, bandwidth := omit, key := omit, attributes := { { rtpmap := { attr_value := "96 VND.3GPP.IUFP/16000" } }, { ptime := { attr_value := "20" } } } } } } } HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_len:63 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: data sent by MTP3_SCCP_PORT: '0000003B000001003640340000010035002A202ED0012FA7202FA80000F44C080A028000514000272028140067400000222814003C40000000503D00400100'O TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_len:12 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: data sent by MTP3_SCCP_PORT: '000100080000010004400122'O TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@05e891daadfd: Warning: Re-starting timer T, which is already active (running or expired). TC_second_rab_assignment0(762)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "27", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "I", val := "11111" } }, sdp := omit } TC_second_rab_assignment0(762)@05e891daadfd: DLCX{ line := { verb := "DLCX", trans_id := "28", ep := "rtpbridge/1@mgw", ver := "1.0" }, params := { { code := "C", val := "3c19e17" }, { code := "I", val := "22222" } }, sdp := omit } TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(755)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_second_rab_assignment0(762)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_second_rab_assignment0(762)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_second_rab_assignment-Iuh0-RUA(753)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(756)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(755)@05e891daadfd: Final verdict of PTC: none TC_second_rab_assignment-Iuh0(752)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(751)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(759)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(758)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(760)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(757)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(761)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(754)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(751): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_second_rab_assignment-Iuh0(752): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_second_rab_assignment-Iuh0-RUA(753): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(754): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(755): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(756): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(757): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(758): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(759): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(760): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(761): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_second_rab_assignment0(762): pass (pass -> pass) MTC@05e891daadfd: Test case TC_second_rab_assignment finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass'. Mon Sep 23 08:00:09 UTC 2024 ====== HNBGW_Tests.TC_second_rab_assignment pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_second_rab_assignment.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=227039) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_second_rab_assignment pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc'. ------ HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc ------ Mon Sep 23 08:00:11 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap" >/data/HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_hnb_reregister_reuse_sctp_assoc started. TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT HNBGW_Test.msc0-M3UA(769)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(769)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(769)@05e891daadfd: ************************************************* MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-SCCP(767)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(772)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(772)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(772)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(770)@05e891daadfd: v_sccp_pdu_maxlen:268 HNBGW_Test.msc0-M3UA(769)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(772)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(768)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(768)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(771)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(771)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: talloc reports "struct hnb_context" x 1, expecting 1 MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(772)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(767)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(763)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(771)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(768)@05e891daadfd: Final verdict of PTC: none TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(770)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(769)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(773)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(766)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(763): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0(764): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_hnb_reregister_reuse_sctp_assoc-Iuh0-RUA(765): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(766): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(767): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(768): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(769): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(770): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(771): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(772): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(773): none (pass -> pass) MTC@05e891daadfd: Test case TC_hnb_reregister_reuse_sctp_assoc finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass'. Mon Sep 23 08:00:13 UTC 2024 ====== HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=80130) Waiting for packet dumper to finish... 1 (prev_count=80130, count=149409) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass' was executed successfully (exit status: 0). MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp'. ------ HNBGW_Tests.TC_apply_sccp ------ Mon Sep 23 08:00:16 UTC 2024 NOTE: unable to use dumpcap due to missing capabilities or suid bit /usr/bin/tcpdump -U -s 1520 -n -i any -w "/data/HNBGW_Tests.TC_apply_sccp.pcap" >/data/HNBGW_Tests.TC_apply_sccp.pcap.stdout 2>/tmp/cmderr & Waiting for packet dumper to start... 0 MTC@05e891daadfd: External command `../ttcn3-tcpdump-start.sh HNBGW_Tests.TC_apply_sccp' was executed successfully (exit status: 0). MTC@05e891daadfd: Test case TC_apply_sccp started. TC_apply_sccp-Iuh0(775)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 TC_apply_sccp-Iuh1(777)@05e891daadfd: Warning: sizes of 'struct sctp_event_subscribe': compile-time 14, kernel: 14 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.msc0-M3UA(782)@05e891daadfd: ************************************************* HNBGW_Test.msc0-M3UA(782)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.msc0-M3UA(782)@05e891daadfd: ************************************************* HNBGW_Test.msc0-SCCP(780)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: Connecting RANAP RAN_Emulation to SCCP_SP_PORT MTC@05e891daadfd: Starting RAN_Emulation HNBGW_Test.sgsn0-M3UA(785)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-M3UA(785)@05e891daadfd: M3UA emulation initiated, the test can be started HNBGW_Test.sgsn0-M3UA(785)@05e891daadfd: ************************************************* HNBGW_Test.sgsn0-SCCP(783)@05e891daadfd: v_sccp_pdu_maxlen:268 MTC@05e891daadfd: setverdict(pass): none -> pass MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-M3UA(782)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23905 to server: "172.18.46.200":2905 association #8 HNBGW_Test.sgsn0-M3UA(785)@05e891daadfd: SCTP_ConnectResult -> connection established from: "172.18.46.203":23906 to server: "172.18.46.200":2905 association #8 HNBGW_Test.msc0-RAN(781)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.msc0-RAN(781)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.sgsn0-RAN(784)@05e891daadfd: RANAP: Responding to inbound IuRESET with IuRESET-ACK HNBGW_Test.sgsn0-RAN(784)@05e891daadfd: CommonRanapUnitdataCallback: Not a paging message HNBGW_Test.msc0-RAN(781)@05e891daadfd: f_create_expect(l3 := '05080200F110172A52082926240000000010'O, n_connectPointCode := omit HNBGW_Test.msc0-RAN(781)@05e891daadfd: Created Expect[0] for '05080200F110172A52082926240000000010'O to be handled at TC_apply_sccp0(787) TC_apply_sccp-Iuh0-RUA(776)@05e891daadfd: Added conn table entry 0TC_apply_sccp0(787)2271489 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: First idle individual index:0 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Warning: Stopping inactive timer T_ias[0]. HNBGW_Test.msc0-RAN(781)@05e891daadfd: Found Expect[0] for l3='05080200F110172A52082926240000000010'O handled at TC_apply_sccp0(787) HNBGW_Test.msc0-RAN(781)@05e891daadfd: Added conn table entry 0TC_apply_sccp0(787)2040137 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Warning: Re-starting timer T_ias[0], which is already active (running or expired). TC_apply_sccp0(787)@05e891daadfd: setverdict(pass): none -> pass TC_apply_sccp0(787)@05e891daadfd: "Changing SCCP address, don't apply yet" HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: DT1 will be put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@05e891daadfd: DT1 data has been put to the reassembly buffer HNBGW_Test.msc0-SCCP(780)@05e891daadfd: DT1/segmentingReassembl/more==0 received=> send ASP_SCCP_N_DATA comes TC_apply_sccp0(787)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Session index based on connection ID:0 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: vl_len:22 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: vl_from0 HNBGW_Test.msc0-SCCP(780)@05e891daadfd: data sent by MTP3_SCCP_PORT: '001440120000010010400B0A7C80BD1B5CF7B2E24A8B'O TC_apply_sccp0(787)@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed TC_apply_sccp0(787)@05e891daadfd: "Apply SCCP address changes" HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Session index based on local reference:0 HNBGW_Test.msc0-RAN(781)@05e891daadfd: Deleted conn table entry 0TC_apply_sccp0(787)2040137 TC_apply_sccp-Iuh0-RUA(776)@05e891daadfd: Deleted conn table entry 0TC_apply_sccp0(787)2271489 TC_apply_sccp0(787)@05e891daadfd: Final verdict of PTC: pass MTC@05e891daadfd: ok: talloc reports "asn1_context" = 1 bytes TC_apply_sccp-Iuh1-RUA(778)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-SCCP(780)@05e891daadfd: Final verdict of PTC: none TC_apply_sccp-Iuh0(775)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-RAN(781)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-SCCP(783)@05e891daadfd: Final verdict of PTC: none VirtHNBGW-STATS(774)@05e891daadfd: Final verdict of PTC: none TC_apply_sccp-Iuh0-RUA(776)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-RAN(784)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.msc0-M3UA(782)@05e891daadfd: Final verdict of PTC: none HNBGW_Test.sgsn0-M3UA(785)@05e891daadfd: Final verdict of PTC: none HNBGW-MGCP(786)@05e891daadfd: Final verdict of PTC: none TC_apply_sccp-Iuh1(777)@05e891daadfd: Final verdict of PTC: none IPA-CTRL-CLI-IPA(779)@05e891daadfd: Final verdict of PTC: none MTC@05e891daadfd: setverdict(pass): pass -> pass, component reason not changed MTC@05e891daadfd: Setting final verdict of the test case. MTC@05e891daadfd: Local verdict of MTC: pass MTC@05e891daadfd: Local verdict of PTC VirtHNBGW-STATS(774): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_apply_sccp-Iuh0(775): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_apply_sccp-Iuh0-RUA(776): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_apply_sccp-Iuh1(777): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_apply_sccp-Iuh1-RUA(778): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC IPA-CTRL-CLI-IPA(779): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-SCCP(780): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-RAN(781): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.msc0-M3UA(782): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-SCCP(783): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-RAN(784): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW_Test.sgsn0-M3UA(785): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC HNBGW-MGCP(786): none (pass -> pass) MTC@05e891daadfd: Local verdict of PTC TC_apply_sccp0(787): pass (pass -> pass) MTC@05e891daadfd: Test case TC_apply_sccp finished. Verdict: pass MTC@05e891daadfd: Starting external command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass'. Mon Sep 23 08:00:23 UTC 2024 ====== HNBGW_Tests.TC_apply_sccp pass ====== Saving talloc report from 172.18.46.20:4261 to HNBGW_Tests.TC_apply_sccp.talloc Waiting for packet dumper to finish... 0 (prev_count=-1, count=173554) Waiting for packet dumper to finish... 1 (prev_count=173554, count=192722) MTC@05e891daadfd: External command `../ttcn3-tcpdump-stop.sh HNBGW_Tests.TC_apply_sccp pass' was executed successfully (exit status: 0). MC@05e891daadfd: Test execution finished. Execution of [EXECUTE] section finished. emtc MC@05e891daadfd: Terminating MTC. MC@05e891daadfd: MTC terminated. MC2> exit MC@05e891daadfd: Shutting down session. MC@05e891daadfd: Shutdown complete. Comparing expected results '/osmo-ttcn3-hacks/hnbgw/expected-results.xml' against results in 'junit-xml-with-pfcp-20.log' -------------------- pass HNBGW_Tests.TC_hnb_register pass HNBGW_Tests.TC_hnb_register_duplicate pass HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc pass HNBGW_Tests.TC_ue_register pass HNBGW_Tests.TC_ue_register_tmsi_lai pass HNBGW_Tests.TC_ue_register_before_hnb_register pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_ranap_cs_initial_ue pass HNBGW_Tests.TC_ranap_ps_initial_ue pass HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr pass HNBGW_Tests.TC_ranap_cs_bidir pass HNBGW_Tests.TC_ranap_ps_bidir pass HNBGW_Tests.TC_rab_assignment pass HNBGW_Tests.TC_rab_release pass HNBGW_Tests.TC_rab_release_abnormal pass HNBGW_Tests.TC_rab_assign_fail pass HNBGW_Tests.TC_rab_assign_mgcp_to pass HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg pass HNBGW_Tests.TC_ranap_cs_mo_disconnect pass HNBGW_Tests.TC_ranap_ps_mo_disconnect pass HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1 pass HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2 pass HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN pass HNBGW_Tests.TC_mscpool_paging_imsi pass HNBGW_Tests.TC_mscpool_paging_tmsi pass HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin pass HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink pass HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1 pass HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2 pass HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink pass HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink pass HNBGW_Tests.TC_second_rab_assignment pass HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc pass HNBGW_Tests.TC_apply_sccp NEW: FAIL HNBGW_Tests.TC_hnb_disconnected_timeout NEW: PASS HNBGW_Tests.TC_ps_rab_assignment_with_pfcp Summary: NEW: FAIL: 1 pass: 46 NEW: PASS: 1 skip: 1 + exit_code=0 + /osmo-ttcn3-hacks/log_merge.sh HNBGW_Tests --rm Generated HNBGW_Tests.TC_apply_sccp.merged Generated HNBGW_Tests.TC_hnb_disconnected_timeout.merged Generated HNBGW_Tests.TC_hnb_register.merged Generated HNBGW_Tests.TC_hnb_register_duplicate.merged Generated HNBGW_Tests.TC_hnb_register_duplicate_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_hnb_reregister_reuse_sctp_assoc.merged Generated HNBGW_Tests.TC_mscpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_imsi_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_1.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_2.merged Generated HNBGW_Tests.TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_from_other_PLMN.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_0_round_robin.merged Generated HNBGW_Tests.TC_mscpool_LU_by_tmsi_null_nri_1_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_round_robin.merged Generated HNBGW_Tests.TC_mscpool_no_allow_attach_valid_nri.merged Generated HNBGW_Tests.TC_mscpool_paging_imsi.merged Generated HNBGW_Tests.TC_mscpool_paging_tmsi.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_mscpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ps_rab_assignment_with_pfcp.merged Generated HNBGW_Tests.TC_rab_assign_fail.merged Generated HNBGW_Tests.TC_rab_assign_mgcp_to.merged Generated HNBGW_Tests.TC_rab_assign_mgw_iuup_addr_chg.merged Generated HNBGW_Tests.TC_rab_assignment.merged Generated HNBGW_Tests.TC_rab_release.merged Generated HNBGW_Tests.TC_rab_release_abnormal.merged Generated HNBGW_Tests.TC_ranap_cs_bidir.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue.merged Generated HNBGW_Tests.TC_ranap_cs_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_cs_mo_disconnect.merged Generated HNBGW_Tests.TC_ranap_ps_bidir.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue.merged Generated HNBGW_Tests.TC_ranap_ps_initial_ue_empty_cr.merged Generated HNBGW_Tests.TC_ranap_ps_mo_disconnect.merged Generated HNBGW_Tests.TC_second_rab_assignment.merged Generated HNBGW_Tests.TC_sgsnpool_L3Compl_on_1_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_no_nri_round_robin.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_1.merged Generated HNBGW_Tests.TC_sgsnpool_L3Complete_valid_nri_2.merged Generated HNBGW_Tests.TC_sgsnpool_nri_from_other_PLMN.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_attaches_cnlink.merged Generated HNBGW_Tests.TC_sgsnpool_sccp_n_pcstate_detaches_cnlink.merged Generated HNBGW_Tests.TC_ue_register.merged Generated HNBGW_Tests.TC_ue_register_before_hnb_register.merged Generated HNBGW_Tests.TC_ue_register_tmsi_lai.merged Removing Input log files !!! + exit 0 + echo Stopping containers Stopping containers + docker_kill_wait jenkins-ttcn3-hnbgw-test-990-hnbgw + docker kill jenkins-ttcn3-hnbgw-test-990-hnbgw jenkins-ttcn3-hnbgw-test-990-hnbgw + docker wait jenkins-ttcn3-hnbgw-test-990-hnbgw 137 + docker_kill_wait jenkins-ttcn3-hnbgw-test-990-stp + docker kill jenkins-ttcn3-hnbgw-test-990-stp jenkins-ttcn3-hnbgw-test-990-stp + docker wait jenkins-ttcn3-hnbgw-test-990-stp 137 + clean_up_common + set +e + set +x ### Clean up ### + trap - EXIT INT TERM 0 + type clean_up + clean_up + sed -i s/classname='\([^']\+\)'/classname='\1:with-pfcp'/g /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/with-pfcp/hnbgw-tester/junit-xml-with-pfcp-20.log + network_clean + docker network+ inspect ttcn3-hnbgw-test-46 grep Name + cut -d : -f2 + awk -F" NR>1{print $2} + local containers= + [ -n ] + network_remove + set +x Removing network ttcn3-hnbgw-test-46 + docker network remove ttcn3-hnbgw-test-46 ttcn3-hnbgw-test-46 + rm -rf /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/unix + fix_perms + set +x Fixing permissions + id -u + id -g + docker run --rm -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs:/data -v /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/_cache:/cache --name jenkins-ttcn3-hnbgw-test-990-cleaner debian:bookworm sh -e -x -c chmod -R a+rX /data/ /cache/ chown -R 1000:1000 /data /cache + chmod -R a+rX /data/ /cache/ + chown -R 1000:1000 /data /cache + collect_logs + cat /home/osmocom-build/jenkins/workspace/ttcn3-hnbgw-test/logs/hnbgw-tester/junit-xml-20.log <?xml version="1.0"?> <testsuite name='Titan' tests='47' failures='1' errors='0' skipped='0' inconc='0' time='378.00'> <testcase classname='HNBGW_Tests' name='TC_hnb_register' time='1.099617'/> <testcase classname='HNBGW_Tests' name='TC_hnb_register_duplicate' time='1.112781'/> <testcase classname='HNBGW_Tests' name='TC_hnb_register_duplicate_reuse_sctp_assoc' time='1.127312'/> <testcase classname='HNBGW_Tests' name='TC_hnb_disconnected_timeout' time='15.182422'> <failure type='fail-verdict'>Rate counter mismatch: "hnb" 0 "iuh:established" is at -1 but expected 1 HNBGW_Tests.ttcn:2990 HNBGW_Tests control part HNBGW_Tests.ttcn:1136 TC_hnb_disconnected_timeout testcase </failure> </testcase> <testcase classname='HNBGW_Tests' name='TC_ue_register' time='1.087855'/> <testcase classname='HNBGW_Tests' name='TC_ue_register_tmsi_lai' time='1.103015'/> <testcase classname='HNBGW_Tests' name='TC_ue_register_before_hnb_register' time='1.105362'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_initial_ue' time='2.110163'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_initial_ue' time='2.193676'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_initial_ue_empty_cr' time='2.178589'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_initial_ue_empty_cr' time='2.132645'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_bidir' time='2.405072'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_bidir' time='2.375624'/> <testcase classname='HNBGW_Tests' name='TC_rab_assignment' time='2.445364'/> <testcase classname='HNBGW_Tests' name='TC_rab_release' time='2.373909'/> <testcase classname='HNBGW_Tests' name='TC_rab_release_abnormal' time='2.347158'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_fail' time='2.217615'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_mgcp_to' time='6.611036'/> <testcase classname='HNBGW_Tests' name='TC_rab_assign_mgw_iuup_addr_chg' time='2.479016'/> <testcase classname='HNBGW_Tests' name='TC_ranap_cs_mo_disconnect' time='7.588632'/> <testcase classname='HNBGW_Tests' name='TC_ranap_ps_mo_disconnect' time='7.560461'/> <testcase classname='HNBGW_Tests' name='TC_ps_rab_assignment_without_pfcp' time='7.447919'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Compl_on_1_cnlink' time='5.348276'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_imsi_round_robin' time='5.348400'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_null_nri_0_round_robin' time='5.305825'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_null_nri_1_round_robin' time='5.264325'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_unassigned_nri_round_robin' time='5.367327'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_msc_not_connected_round_robin' time='5.354578'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_1' time='5.363001'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_L3Complete_by_tmsi_valid_nri_2' time='5.412861'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_LU_by_tmsi_from_other_PLMN' time='4.318508'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_paging_imsi' time='5.314892'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_paging_tmsi' time='5.256193'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_no_allow_attach_round_robin' time='5.371533'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_no_allow_attach_valid_nri' time='5.379936'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_sccp_n_pcstate_detaches_cnlink' time='5.378044'/> <testcase classname='HNBGW_Tests' name='TC_mscpool_sccp_n_pcstate_attaches_cnlink' time='6.348014'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Compl_on_1_cnlink' time='5.430268'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_no_nri_round_robin' time='5.436208'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_valid_nri_1' time='5.389918'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_L3Complete_valid_nri_2' time='5.389856'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_nri_from_other_PLMN' time='4.344587'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_sccp_n_pcstate_detaches_cnlink' time='5.338236'/> <testcase classname='HNBGW_Tests' name='TC_sgsnpool_sccp_n_pcstate_attaches_cnlink' time='6.345854'/> <testcase classname='HNBGW_Tests' name='TC_second_rab_assignment' time='2.437158'/> <testcase classname='HNBGW_Tests' name='TC_hnb_reregister_reuse_sctp_assoc' time='1.290333'/> <testcase classname='HNBGW_Tests' name='TC_apply_sccp' time='6.238327'/> </testsuite> Recording test results [Checks API] No suitable checks publisher found. Build step 'Publish JUnit test result report' changed build result to UNSTABLE Archiving artifacts Finished: UNSTABLE